溫馨提示:Ctrl+F鍵檢索所需產品,具體價格和產品詳情,請咨詢熱線:15000335393(微信同號)
Product Code | Product Name |
GL3628 | (-)-Ageloxime D |
GL0766 | (-)-alpha-Pinene |
GL7074 | (-)-Blebbistatin |
GL9681 | (-)-Borneol, 97% |
GK7856 | (-)-Catechin |
GK9244 | (-)-Catechin gallate |
GL3914 | (-)-Gallocatechin gallate |
GK8768 | (-)-Huperzine A |
GL4102 | (-)-Indolactam V |
GK0009 | (-)-Menthone |
GW4756 | (-)-Mitorubrinic acid |
GL6791 | (-)-Nicotine hemisulfate salt, 40% aqueous solution |
GL9693 | (-)-Nicotine hydrogen tartrate salt |
GK5476 | (-)-Perillyl alcohol |
GL8537 | (-)-Scopolamine hydrobromide trihydrate |
GK4380 | (-)-Terpinen-4-ol |
GW9400 | (-)-Viriditoxin |
GW9906 | (+)-(8,8-Dichlorocamphorylsulfonyl) oxaziridine |
GA3662 | (+)-Abscisic acid |
GL2550 | (+)-alpha-Pinene |
GL1672 | (+)-alpha-Tocopherol acetate |
GE0805 | (+)-Bicuculline |
GV8230 | (+)-Biotin N-hydroxysuccinimide ester |
GW3852 | (+)-Biotin-PFP-ester |
GL5584 | (+)-Borneol |
GK0455 | (+)-Catechin |
GL6828 | (+)-Catechin hydrate |
GK6736 | (+)-Dehydroabietic acid |
GP8869 | (+)-Epinephrine (+)-bitartrate salt |
GL0593 | (+)-Etomoxir sodium salt hydrate |
GL0765 | (+)-Flavipucine |
GK1846 | (+)-Isomenthol |
GW0962 | (+)-JQ1 |
GV8858 | (+)-Magnesium L-ascorbate |
GW3266 | (+)-Rubiginone B2 |
GW0417 | (+)-Spartein Surrogate |
GL7349 | (+)-Usnic acid |
GW6270 | (+/-)-C75 |
GP0916 | (+/-)-Cloprostenol sodium salt hydrate |
GE9509 | (+/-)-Jasmonic acid |
GW8355 | (+/-)-Lisofylline |
GW5906 | (+/-)-Potassium citramalate monohydrate |
GW1880 | (+/-)-Sodium 2,3-dihydroxyisovalerate hydrate |
GP3540 | (+/-)-Taxifolin hydrate |
GK1082 | (±)-Dihydrokaempferol |
GW6264 | (?)-(8,8-Dichlorocamphorylsulfonyl) oxaziridine |
GD0341 | (1-Hexadecyl)trimethylammonium bromide |
GC4950 | (1E)-2-Acetamido-3,4,6-tri-O-benzoyl-2-deoxy-D-glucose 1-oxime |
GK6757 | (1R,2R)-(-)-2-Amino-1-nitrophenyl)-1,3-propanediol |
GK6738 | (1R)-(-)-Camphor-10-sulfonic acid |
GW5467 | (1S)-(+)-3-Bromocamphor-10-sulfonic acid hydrate |
GK7715 | (1S)-(+)-Camphor-10-sulfonic acid |
GK4925 | (2-Bromoethyl)trimethylammonium bromide |
GX9244 | (2-Hydroxypropyl)-gamma-cyclodextrin |
GV6226 | (24R)-24,25-Dihydroxyvitamin D3 |
GL4605 | (25S)-delta7-Dafachronic acid |
GC5130 | (2R)-2,3-Dihydroxypropyl-b-D-galactopyranoside |
GC2774 | (2R)-2,3-O-Isopropylidene-D-glyceric acid benzyl ester |
GW5424 | (2R)-3-(1-Naphthalenyloxy)-1,2-propanediol |
GL6358 | (3S,6R)-Lateritin |
GC4542 | (4S)-2,2-Dimethyl-1,3-dioxane-4-methanol |
GK9183 | (9,9-Dimethyl-9H-xanthene-4,5-diyl)bis(diphenylphosphine) |
GM1444 | (Boc-Cys-OH)2 |
GW1934 | (Difluoromethyl)trimethylsilane |
GW0272 | (E)-8-Methyl-6-nonenoic acid |
GW0815 | (R,R)-(+)-1,4-Dimethoxy-2,3-butanediol |
GC2211 | (R,S)-Alvimopan O-β-D-glucuronide |
GC3482 | (R,S)-Ambrisentan acyl-β-D-glucuronide |
GC4548 | (R,S)-Carvedilol O-β-D-glucuronide |
GP9597 | (R,S)-Equol |
GC2517 | (R,S)-Flurbiprofen acyl-β-D-glucuronide |
GC0405 | (R,S)-Flurbiprofen-d8 |
GC7744 | (R,S)-Flurbiprofen-d8 acyl-β-D-glucuronide |
GC3123 | (R,S)-Ibuprofen-d4 acyl-β-D-glucuronide |
GC8251 | (R,S)-Methocarbamol O-β-D-glucuronide |
GC5125 | (R,S)-Naproxen acyl-β-D-glucuronide |
GC3234 | (R,S)-Naproxen-1,3,4,5,7,8-d6 |
GC2700 | (R,S)-Norfluoxetine N-β-D-glucuronide |
GC0368 | (R,S)-Ramipril acyl-β-D-glucuronide |
GK3923 | (R)-(-)-1,1''-Binaphthyl-2,2''-diyl hydrogenphosphate |
GP4315 | (R)-(-)-2-Fluoro-alpha-methyl-4-biphenylacetic acid |
GL3381 | (R)-(-)-Carvone |
GK4856 | (R)-(-)-Methyl 3-hydroxybutyrate |
GL9617 | (R)-(-)-Phenylephrine hydrochloride |
GK0559 | (R)-(+)-1,1''-Bi-2-naphthol |
GW9630 | (R)-(+)-2-Phenyl-1-propanol |
GK0418 | (R)-(+)-alpha-Lipoic acid |
GL0622 | (R)-(+)-Pulegone |
GK7020 | (R)-3-Hydroxybutyric acid |
GW3338 | (R)-3-Hydroxymyristic acid |
GW0676 | (R)-BI-2536 |
GL2908 | (R)-CR8 |
GL4415 | (R)-FSL-1 |
GL2018 | (R)-Perharidine 1 |
GM2918 | (R)-Propionyl carnitine chloride |
GC5485 | (R)-Propranolol O-β-D-glucuronide |
GA0013 | (R)-Semivioxanthin |
GL1233 | (R)-Semixanthomegnin |
GC3952 | (rac)-N-Desmethyl-Ecopipam O-β-D-glucuronide |
GC3887 | (rac)-N-Desmethyl-Ecopipam-d6 O-β-D-glucuronide |
GW0124 | (RS)-1-Methyl-2-propynyl-p-toluenesulfonate |
GW6265 | (S,S)-(-)-1,4-Dimethoxy-2,3-butanediol |
GW0880 | (S,S)-Ethylenediamine-N,N''-disuccinic acid |
GW0455 | (S,S)-Ethylenediamine-N,N''-disuccinic acid trisodium salt solution |
GM0237 | (S)-(-)-2-Amino-4-pentenoic acid |
GL6848 | (S)-(+)-1-Aminoindan |
GM6081 | (S)-(+)-4-Nitrophenylalanine methyl ester hydrochloride |
GK1601 | (S)-(+)-4-Phenyl-2-oxazolidinone |
GA6393 | (S)-(+)-Ascochin |
GA9966 | (S)-(+)-Camptothecin |
GL7238 | (S)-(+)-Carvone |
GK4784 | (S)-(+)-Clopidogrel hydrogen sulfate |
GP9058 | (S)-(+)-Ibuprofen |
GP6062 | (S)-(+)-Ketoprofen |
GK9869 | (S)-3-Hydroxybutyric acid |
GM6729 | (S)-5-Azido-2-(Fmoc-amino)pentanoic acid |
GW2431 | (S)-alpha-Methoxy-2-naphthylacetic acid |
GL4189 | (S)-CR8 |
GC3999 | (S)-Flurbiprofen acyl-β-D-glucuronide |
GC3957 | (S)-Naproxen acyl-b-D-glucuronide |
GL9968 | (S)-Perharidine 1 |
GC7121 | (S)-Propranolol O-β-D-glucuronide |
GL1360 | (S)-Roscovitine |
GL0840 | [10]-Gingerol |
GP8612 | [6]-Gingerol |
GL9488 | [8]-Gingerol |
GK3718 | [D-Ala2, N-Me-Phe4, Gly5-ol]-Enkephalin acetate salt |
GW2513 | [Ru(bpy)2(5-chloroacetamido-1,10-phenanthroline)](PF6)2 |
GW1890 | [Ru(bpy)2(5-iodoacetamido-1,10-phenanthroline)](PF6)2 |
GW5936 | 1-(2-Isothiocyanatoethyl)-4-[2-(3,4-dihydro-2H-1-benzopyranyl-6-yl)-5-oxazolyl]pyridinium bromide |
GW2652 | 1-(2-Isothiocyanatoethyl)-4-[5-(4-methoxyphenyl)-2-oxazolyl]pyridinium bromide |
GT6232 | 1-(2-Pyridylazo)-2-naphthol |
GC4876 | 1-(2,2,2-Trifluoro-N-phenylethanimidate)-D-glucopyranuronic acid methyl ester 2,3,4-triacetate |
GW9017 | 1-(2,5-Dichloro-3,6-dimethylphenyl ethanone |
GW0830 | 1-(3-Isothiocyanatobenzyl)-4-[2-(3,4-dihydro-2H-1-benzopyran-6-yl)-5-oxazolyl] pyridinium bromide |
GW4246 | 1-(3''-Carboxypropyl)-3,7-dimethylxanthine |
GW3012 | 1-(4-Dimethylamino-phenyl)-2-phenanthridin-6-yl-ethanone |
GE9805 | 1-(4-Nitrophenyl)glycerol |
GW9713 | 1-(4''-Carboxybutyl)-3,7-dimethylxanthine |
GX8752 | 1-(cis-3-Chloroallyl)-3,5,7-triaza-1-azoniaadamantane chloride |
GK3194 | 1-(Ethoxycarbonylmethyl)-6-methoxyquinolinium bromide |
GW2166 | 1-[2-(4-Isothiocyanatophenoxy)ethyl]-4-[5-(4-methoxyphenyl)-2-oxazolyl] pyridinium tosylate |
GW1502 | 1-[2-(6-Methoxy-3-oxo-3H-xanthen-9-yl)-benzoyl]-piperidine-4-carboxylic acid |
GW9698 | 1-[2-(Maleimido)ethyl]-4-[5-(4-methoxyphenyl)-2-oxazolyl] pyridinium triflate |
GK6663 | 1-Acetyl-2-phenylhydrazine |
GC2506 | 1-Amino-1-deoxy-scyllo-inositol |
GC3462 | 1-Amino-1-deoxy-scyllo-inositol hydrochloride |
GC3995 | 1-Amino-1,2-dideoxy-scyllo-inositol |
GM9665 | 1-Aminocyclopropanecarboxylic acid |
GL5815 | 1-Azakenpaullone |
GC9520 | 1-Azido-1-deoxy-b-D-lactopyranoside |
GX4295 | 1-Benzyl-2-methylimidazole |
GK0901 | 1-Benzylimidazole |
GW7570 | 1-Bromoundecane |
GK2430 | 1-Butanesulfonic acid sodium salt, HPLC grade |
GK8249 | 1-Butanol |
GX8686 | 1-Butyl-3-methylimidazolium chloride |
GX4050 | 1-Butyl-3-methylimidazolium hexafluorophosphate |
GW9456 | 1-Chloro-1,2-benziodoxol-3-one |
GW0990 | 1-Chloro-1,3-dihydro-3,3-dimethyl-1,2-benziodoxole |
GK8344 | 1-Chlorobutane |
GS9086 | 1-Chlorobutane, GlenDry?, anhydrous |
GS8301 | 1-Chlorobutane, GlenPure?, analytical grade |
GW0069 | 1-Cyano-4-dimethylaminopyridinium tetrafluoroborate |
GK1505 | 1-Decanesulfonic acid sodium salt |
GK2994 | 1-Decanol |
GC9238 | 1-Deoxy-1-iodo-2,3:4,5-di-O-isopropylidene-β-D-fructopyranose |
GC0354 | 1-Deoxy-3-O-tert-butyldimethylsilyl-4,5-O-isopropylidene-D-fructopyranose |
GC8278 | 1-Deoxy-D-fructose |
GC6644 | 1-Deoxygalactonojirimycin hydrochoride |
GC2683 | 1-Deoxynojirimycin |
GK1715 | 1-Dodecanesulfonic acid sodium salt |
GX8668 | 1-Ethyl-3-methylimidazolium chloride |
GK4196 | 1-Heptanesulfonic acid sodium salt monohydrate |
GK4832 | 1-Heptanesulfonic acid sodium salt, HPLC grade |
GK8194 | 1-Hexadecanesulfonic acid sodium salt |
GX1637 | 1-Hexadecanol |
GK8349 | 1-Hexanesulfonic acid sodium salt monohydrate, HPLC grade |
GK0100 | 1-Hexanesulfonic acid sodium salt, HPLC grade |
GW9359 | 1-Hydroxy-1,2-benziodoxol-3-one |
GW4641 | 1-Hydroxy-1,2-benziodoxol-3-one 1-oxide pyridinium complex |
GX2582 | 1-Hydroxypyridine-2-thione zinc salt |
GC0415 | 1-Kestose |
GW6305 | 1-Methoxy-1,3-butadiene |
GT7110 | 1-Methoxy-5-methylphenazinium methyl sulfate |
GK1345 | 1-Methyl-2-pyrrolidinone |
GK6677 | 1-Methylnaphthalene |
GW7718 | 1-Methyltryptamine |
GK2088 | 1-Naphthaleneacetic acid potassium salt |
GL5209 | 1-Naphthohydroxamic acid |
GK9874 | 1-Naphthol |
GC6475 | 1-Naphthyl 2-acetamido-2-deoxy-b-D-glucopyranoside |
GC7868 | 1-Naphthyl b-D-glucopyranoside |
GE8832 | 1-Naphthyl phosphate disodium salt hydrate |
GE3933 | 1-Naphthyl phosphate monosodium salt hydrate |
GK7756 | 1-Naphthylamine |
GK1538 | 1-Nitroso-2-naphthol |
GC6024 | 1-O-(3,4,5-Tri-O-benzyl)-galloyl β-D-glucopyranoside tetraacetate |
GC3100 | 1-O-(E)-Feruloyl-β-D-glucopyranose |
GC3288 | 1-O-Acetyl-2,3,5-tri-O-benzyl-D-ribofuranose |
GC5374 | 1-O-Acetyl-3,5-bis(4-chlorobenzoyl)-2-deoxy-D-ribose |
GC1016 | 1-O-Acetyl-4-azido-2,3,6-tri-O-benzoyl-4-deoxy-D-glucopyranose |
GC2553 | 1-O-Galloyl-b-D-glucose |
GC8374 | 1-O-p-Coumaroyl β-D-glucopyranose |
GC1018 | 1-O-tert-Butyldimethylsilyl-2,3-O-isopropylidene-α-D-mannofuranose |
GC7962 | 1-O-tert-Butyldimethylsilyl-2,3:5,6-di-O-isopropylidene-α-D-mannofuranose |
GK2715 | 1-Octadecanethiol |
GK7991 | 1-Octadecanol |
GK7376 | 1-Octanesulfonic acid sodium salt monohydrate |
GK3339 | 1-Octanesulfonic acid sodium salt, HPLC grade |
GM6151 | 1-Octanol |
GC1184 | 1-Octylamino-1-deoxy-D-glucitol |
GK0438 | 1-Pentanesulfonic acid sodium salt monohydrate |
GK8163 | 1-Pentanesulfonic acid sodium salt, HPLC grade |
GL6339 | 1-Pentanol |
GK4574 | 1-Phenyl-3-pyrazolidinone |
GK6491 | 1-Propanesulfonic acid sodium salt |
GL9076 | 1-Propanol, 99% |
GW9349 | 1-Pyrenecarboxaldehyde |
GK4046 | 1-Tetradecanol |
GL6030 | 1-Triacontanol |
GK0090 | 1-Tridecanol |
GW3640 | 1,1-Bis(phenylsulfonyl)ethylene |
GK4690 | 1,1,1,3,3,3-Hexafluoro-2-propanol |
GW2823 | 1,1,2-Trimethyl-3-(4-sulfobutyl)benz[e]benzindolium, inner salt |
GK1393 | 1,1,4,7,7-Pentamethyldiethylenetriamine |
GW6694 | 1,1''-(1,2-Ethanediyl)bis-1H-1,2,4-triazole |
GW0163 | 1,1''-Carbonyldipyrrolidine |
GW7092 | 1,1''-Dibutyl-3,3,3'',3''-tetramethylindotricarbocyanine hexafluorophosphate |
GW3985 | 1,1′-Dioctadecyl-3,3,3′,3′-tetramethylindocarbocyanine perchlorate |
GA0090 | 1,10-Phenanthroline hydrochloride monohydrate |
GE7007 | 1,10-Phenanthroline monohydrate |
GE1327 | 1,10-Phenanthroline, anhydrous |
GK0328 | 1,2-Bis(2-aminophenoxy)ethane-N,N,N'',N''-tetraacetic acid |
GK6651 | 1,2-Bis(diphenylphosphino)ethane |
GC4187 | 1,2-Di-O-acetyl-3,5-di-O-benzoyl-β-D-ribofuranose |
GS4126 | 1,2-Dichlorobenzene, GlenDry?, anhydrous |
GS3093 | 1,2-Dichlorobenzene, GlenPure?, analytical grade |
GK1801 | 1,2-Dihydroxybenzene |
GS5227 | 1,2-Dimethoxyethane, GlenDry, anhydrous over molecular sieve |
GS7642 | 1,2-Dimethoxyethane, GlenDry?, anhydrous |
GS6752 | 1,2-Dimethoxyethane, GlenPure?, analytical grade |
GS0065 | 1,2-Epoxypropane, GlenDry?, anhydrous |
GS3680 | 1,2-Ethanediol, GlenDry?, anhydrous |
GS6301 | 1,2-Ethanediol, GlenPure?, analytical grade |
GC7919 | 1,2-O-Isopropylidene-6-O-tert-butyldimethylsilyl-α-D-glucofuranose |
GC9080 | 1,2-O-Isopropylidene-6-O-trityl-α-D-glucofuranose |
GC7780 | 1,2-O-Isopropylidene-b-L-idofuranosylurono-6,3-lactone |
GC4252 | 1,2-O-Isopropylidene-D-mannitol |
GC7659 | 1,2-O-Isopropylidene-DL-myo-inositol |
GC8090 | 1,2-O-Isopropylidene-α-D-glucofuranose |
GC6546 | 1,2-O-Isopropylidene-α-D-glucofuranosidurono-6,3-lactone |
GC9804 | 1,2-O-Isopropylidene-α-D-glucofuranuronic-6-13C acid, γ-lactone |
GC2230 | 1,2-O-Isopropylidene-β-D-fructofuranose |
GC5848 | 1,2-O-Isopropylidene-β-L-idofuranuronic-1,6-13C2 acid γ-lactone |
GC2040 | 1,2-O-Isopropylidene-β-L-idofuranuronic-6-13C acid γ-lactone |
GC7732 | 1,2,2'',3,3'',6-Hexa-O-acetyl-4'',6''-O-benzylidene-D-cellobiose |
GC9754 | 1,2,3-Tri-O-acetyl-2,6-dideoxy-6-iodo-D-glucopyranose |
GW1357 | 1,2,3-Tris(diethylamino)cyclopropenylium bis(trifluoromethanesulfonyl)imide |
GW2679 | 1,2,3-Tris(diethylamino)cyclopropenylium dicyanamide |
GX0888 | 1,2,3,4-Butanetetracarboxylic acid |
GC0979 | 1,2,3,4-Tetra-O-acetyl-6-azido-6-deoxy-D-galactopyranose |
GC1780 | 1,2,3,4-Tetra-O-acetyl-6-azido-6-deoxy-α-D-galactopyranose |
GC0446 | 1,2,3,4-Tetra-O-acetyl-6-azido-L-fucopyranose |
GC3594 | 1,2,3,4-Tetra-O-acetyl-6-deoxy-6-iodo-α-D-glucopyranose |
GC4038 | 1,2,3,4-Tetra-O-acetyl-6-diphenylphosphoryl-β-D-mannopyranose |
GC1747 | 1,2,3,4-Tetra-O-acetyl-6-O-trityl-b-D-glucopyranose |
GC0346 | 1,2,3,4-Tetra-O-acetyl-6-O-trityl-β-D-mannopyranose |
GC0953 | 1,2,3,4-Tetra-O-acetyl-a-L-fucopyranose |
GC5900 | 1,2,3,4-Tetra-O-acetyl-b-D-glucopyranose |
GC5906 | 1,2,3,4-Tetra-O-acetyl-b-D-xylopyranose |
GC1176 | 1,2,3,4-Tetra-O-acetyl-beta-D-glucuronic acid |
GC4650 | 1,2,3,4-Tetra-O-acetyl-L-rhamnopyranose |
GC0019 | 1,2,3,4-Tetra-O-acetyl-α-D-galacturonic acid |
GC7263 | 1,2,3,4-Tetra-O-acetyl-β-D-glucopyranuronic acid benzyl ester |
GC8516 | 1,2,3,4-Tetra-O-acetyl-β-D-mannopyranose |
GC9303 | 1,2,3,4-Tetra-O-benzyl-6-O-trityl-a-D-mannopyranose |
GC5837 | 1,2,3,4-Tetra-O-isobutyryl-β-D-glucopyranuronic acid methyl ester |
GC7693 | 1,2,3,4-Tetra-O-pivaloyl-β-D-glucopyranuronic acid methyl ester |
GK8366 | 1,2,3,4-Tetrahydroquinoline |
GC6653 | 1,2,3,4,5-Penta-O-acetyl-b-D-fructose |
GC8082 | 1,2,3,4,5,6-Hexa-O-acetyl-myo-inositol |
GC6108 | 1,2,3,4,6-Penta-O-acetyl-1-thio-β-D-galactopyranose |
GC6125 | 1,2,3,4,6-Penta-O-acetyl-1-thio-β-D-glucopyranose |
GC3275 | 1,2,3,4,6-Penta-O-acetyl-b-D-galactopyranose |
GC7359 | 1,2,3,4,6-Penta-O-acetyl-b-D-glucopyranose |
GC8999 | 1,2,3,4,6-Penta-O-acetyl-L-idopyranose |
GC5395 | 1,2,3,4,6-Penta-O-acetyl-β-D-glucopyranose-1,2,3,4,5,6-13C6 |
GC6402 | 1,2,3,4,6-Penta-O-acetyl-β-D-glucopyranose-1,6-13C2 |
GC5342 | 1,2,3,4,6-Penta-O-benzoyl-a-D-galactopyranose |
GC9382 | 1,2,3,4,6-Penta-O-benzoyl-a-D-glucopyranose |
GC4585 | 1,2,3,4,6-Penta-O-benzoyl-α-D-mannopyranose |
GC7755 | 1,2,3,5,6-Penta-O-tert-butyldimethylsilyl-α-D-galactofuranose |
GC0874 | 1,2,3,6-Tetra-O-benzoyl-β-D-mannopyranose |
GK6052 | 1,2,4-Butanetriol |
GK8927 | 1,2,4-Triazole |
GS2710 | 1,2,4-Trichlorobenzene, GlenDry?, anhydrous |
GC5156 | 1,2,4,5-Di-O-isopropylidene-b-D-fructopyranose |
GC3976 | 1,2,4,6-Tetra-O-acetyl-3-azido-3-deoxy-D-glucopyranose |
GC9637 | 1,2,4,6-Tetra-O-acetyl-3-deoxy-3-fluoro-D-glucopyranose |
GC3054 | 1,2,4,6-Tetra-O-acetyl-3-deoxy-3-fluoro-β-D-allopyranose |
GC9556 | 1,2,4,6-Tetra-O-acetyl-3-O-(2,3,4-tri-O-acetyl-β-D-xylopyranosyl)-β-D-glucopyranose |
GC0188 | 1,2,4,6-Tetra-O-acetyl-3-O-allyl-β-D-glucopyranose |
GC2036 | 1,2,4,6-Tetra-O-acetyl-3-O-benzyl-b-D-glucopyranose |
GC8270 | 1,2,4,6-Tetra-O-acetyl-3-O-carbamoyl-α-D-mannopyranose |
GC5146 | 1,2,4,6-Tetra-O-acetyl-β-D-glucopyranose |
GC1750 | 1,2:3,4-Di-O-isopropylidene-6-O-mesyl-α-D-galactopyranose |
GC3852 | 1,2:3,4-Di-O-isopropylidene-6-O-p-toluenesulfonyl-a-D-galactopyranose |
GC2289 | 1,2:3,4-Di-O-isopropylidene-alpha-D-galactopyranose |
GC9085 | 1,2:3,4-Di-O-isopropylidene-α-D-galactopyranuronic acid methyl ester |
GC8025 | 1,2:3,4-Di-O-isopropylidene-α-L-galactopyranose |
GC2245 | 1,2:3,5-Di-O-isopropylidene-a-D-xylofuranose |
GC3064 | 1,2:5,6-Di-O-isopropylidene-3-O-tosyl-α-D-glucofuranose |
GC3745 | 1,2:5,6-Di-O-isopropylidene-a-D-gulofuranose |
GC2354 | 1,2:5,6-Di-O-isopropylidene-alpha-D-allofuranose |
GC2055 | 1,2:5,6-Di-O-isopropylidene-α-D-glucofuranose |
GC6909 | 1,2:5,6-Di-O-isopropylidene-α-D-glucofuranose-1,2,3,4,5,6-13C6 |
GC5451 | 1,2:5,6-Di-O-isopropylidene-α-D-ribo-hexofuranose-3-ulose |
GW3521 | 1,3-bis(Aminooxy)propan dihydrochloride |
GM0020 | 1,3-Bis(tert-butoxycarbonyl)-2-methyl-2-thiopseudourea |
GL1795 | 1,3-Diamino-2-propanol |
GK6415 | 1,3-Dibromo-5,5-dimethylhydantoin |
GL5447 | 1,3-Diethyl-1,3-diphenylurea |
GK7697 | 1,3-Diethyl-2-thiourea |
GW5128 | 1,3-Dihydro-1-hydroxy-3,3-dimethyl-1,2-benziodoxole |
GT2891 | 1,3-Dihydroxynaphthalene |
GX7393 | 1,3-Dimethoxy-5-iodobenzene |
GK4775 | 1,3-Dimethyl-2-imidazolidinone |
GK1429 | 1,3-Diphenylurea |
GK6085 | 1,3-Indanedione |
GC8272 | 1,3-O-Benzylidene-D-arabitol |
GC7605 | 1,3,4-Tri-O-acetyl-2-amino-2-deoxy-N-(4-methoxybenzylidene)-6-O-tosyl-β-D-glucopyranose |
GC2084 | 1,3,4-Tri-O-acetyl-2-amino-2,6-dideoxy-6-iodo-N-(4-methoxybenzylidene)-β-D-glucopyranose |
GC9402 | 1,3,4-Tri-O-acetyl-2-azido-2-deoxy-6-O-trityl-β-D-glucopyranose |
GC5048 | 1,3,4-Tri-O-acetyl-2-azido-2-deoxy-α-L-fucopyranose |
GC3731 | 1,3,4-Tri-O-acetyl-2-azido-2-deoxy-β-D-glucopyranuronic acid methyl ester |
GC2139 | 1,3,4-Tri-O-acetyl-2-deoxy-2-fluoro-L-fucopyranose |
GC3163 | 1,3,4-Tri-O-acetyl-2-deoxy-2-fluoro-α-L-fucopyranose |
GC8538 | 1,3,4-Tri-O-acetyl-2-deoxy-D-glucopyranose |
GC3173 | 1,3,4-Tri-O-acetyl-2-deoxy-D-xylopyranose |
GC3675 | 1,3,4-Tri-O-acetyl-2,6-dideoxy-D-glucopyranose |
GC9503 | 1,3,4,6-Tetra-O-acetyl-2-amino-2-deoxy-D-galactopyranose hydrochloride |
GC0435 | 1,3,4,6-Tetra-O-acetyl-2-amino-2-deoxy-N-(4-methoxybenzylidene)-β-D-galactopyranose |
GC6829 | 1,3,4,6-Tetra-O-acetyl-2-azido-2-deoxy-a-D-glucopyranose |
GC5410 | 1,3,4,6-Tetra-O-acetyl-2-azido-2-deoxy-D-glucopyranose |
GC0260 | 1,3,4,6-Tetra-O-acetyl-2-deoxy-2-(2,2,2-trichloroethoxycarbonylamino)-D-glucopyranose |
GC7722 | 1,3,4,6-Tetra-O-acetyl-2-deoxy-2-fluoro-D-galactopyranose |
GC4769 | 1,3,4,6-Tetra-O-acetyl-2-deoxy-2-iodo-a-D-glucopyranose |
GC5256 | 1,3,4,6-Tetra-O-acetyl-2-deoxy-2-iodo-D-galactopyranose |
GC3729 | 1,3,4,6-Tetra-O-acetyl-2-deoxy-2-iodo-β-D-galactopyranose |
GC0802 | 1,3,4,6-Tetra-O-acetyl-2-deoxy-2-phthalimido-α-D-glucopyranose |
GC2974 | 1,3,4,6-Tetra-O-acetyl-2-deoxy-2-trichloroacetylamino-β-D-glucopyranose |
GC7946 | 1,3,4,6-Tetra-O-acetyl-b-D-glucosamine hydrochloride |
GC2618 | 1,3,4,6-Tetra-O-acetyl-b-D-mannopyranose |
GC3318 | 1,3,4,6-Tetra-O-acetyl-N-propanoyl-D-mannosamine |
GK6321 | 1,3,5-Benzenetricarboxylic acid |
GK1486 | 1,3,5-Benzenetricarboxylic acid chloride |
GC1101 | 1,3,5-O-Methylidyne-myo-inositol |
GC8131 | 1,3,5-Tri-O-benzoyl-α-D-arabinofuranose |
GC2888 | 1,3,6-Tri-O-galloyl glucose |
GC4459 | 1,3,6,7-Tetrahydroxyxanthone-C2-b-D-glucoside |
GW4466 | 1,3,6,8-Pyrenetetrasulfonic acid tetrasodium salt |
GC8478 | 1,4-Anhydro-2-deoxy-2-iodo-β-D-galactopyranose |
GC3619 | 1,4-Anhydro-D-erythritol |
GC3216 | 1,4-Anhydro-D-mannitol |
GW7558 | 1,4-Cubanebis(dimethylamide) |
GW0129 | 1,4-Cubanedicarboxylic acid |
GW0910 | 1,4-Cubanediol |
GK2466 | 1,4-Diazabicyclo(2.2.2)octane |
GS0901 | 1,4-Dioxan, GlenDry?, anhydrous |
GS3872 | 1,4-Dioxan, GlenDry?, anhydrous over molecular sieve |
GS5840 | 1,4-Dioxan, GlenPure?, analytical grade |
GK4038 | 1,4-Dioxane |
GE5960 | 1,4-Dithioerythritol |
GC3468 | 1,4,5,6-Tetra-O-acetyl-3-O-tosyl-myo-inositol |
GC8879 | 1,4,5,6-Tetra-O-benzyl-3-O-tosyl-DL-myo-inositol |
GC5709 | 1,4,5,6-Tetra-O-benzyl-DL-myo-inositol |
GC7939 | 1,4:3,6-Dianhydro-D-glucitol |
GC3292 | 1,4:3,6-Dianhydro-α-D-glucopyranose |
GC9779 | 1,5-Anhydro-D-mannitol |
GC8099 | 1,5-Anhydro-D-sorbitol |
GC4721 | 1,5-Anhydro-β-D-xylofuranose |
GK7051 | 1,5-Isoquinolinediol |
GX9598 | 1,6-Anhydro-2-azido-2-deoxy-b-D-glucopyranose |
GC7611 | 1,6-Anhydro-2-azido-3-O-benzyl-2-deoxy-β-D-glucopyranose |
GC9454 | 1,6-Anhydro-2-azido-3,4-di-O-benzyl-2-deoxy-β-D-glucopyranose |
GC7689 | 1,6-Anhydro-2-azido-4-O-benzyl-2-deoxy-b-D-glucopyranose |
GC4174 | 1,6-Anhydro-2-deoxy-2-fluoro-β-D-glucopyranose |
GC0024 | 1,6-Anhydro-2-deoxy-2-iodo-β-D-galactopyranose |
GX1764 | 1,6-Anhydro-2-iodo-2-deoxy-b-D-glucopyranose |
GC0958 | 1,6-Anhydro-2-O-α-D-glucopyranosyl-β-D-glucopyranose |
GC8470 | 1,6-Anhydro-2-O-β-D-glucopyranosyl-β-D-glucopyranose |
GC7748 | 1,6-Anhydro-2,3,4-tri-O-benzyl-b-D-glucopyranose |
GC2239 | 1,6-Anhydro-2,3,4-tri-O-benzyl-β-L-idopyranose |
GC3874 | 1,6-Anhydro-2,4-dideoxy-4-fluoro-2-iodo-β-D-glucopyranose |
GC6073 | 1,6-Anhydro-3-O-benzoyl-2-deoxy-2-fluoro-β-D-glucopyranose |
GC7485 | 1,6-Anhydro-3-O-benzyl-b-L-idopyranose |
GC0760 | 1,6-Anhydro-3-O-α-D-glucopyranosyl-β-D-glucopyranose |
GC1200 | 1,6-Anhydro-3-O-β-D-glucopyranosyl-β-D-glucopyranose |
GC4109 | 1,6-Anhydro-3,4-dideoxy-2,2-(ethylenedioxy)-β-D-glycero-hex-3-enopyranose |
GC1732 | 1,6-Anhydro-3,4-O-isopropylidene-2-O-(2,3,4,6-tetra-O-acetyl-β-D-galactopyranosyl)-β-D-galactopyranose |
GC2792 | 1,6-Anhydro-3,4-O-isopropylidene-β-D-galactopyranose |
GC9221 | 1,6-Anhydro-4'',6''-O-benzylidene-β-D-maltose |
GC1056 | 1,6-Anhydro-b-D-cellobiose |
GC3680 | 1,6-Anhydro-α-D-galactofuranose |
GC3386 | 1,6-Anhydro-β-D-cellopentaose |
GC1313 | 1,6-Anhydro-β-D-cellotetraose |
GC7678 | 1,6-Anhydro-β-D-cellotriose |
GC2336 | 1,6-Anhydro-β-D-cellotriose nonaacetate |
GC9846 | 1,6-Anhydro-β-D-glucofuranose |
GC5907 | 1,6-Anhydro-β-D-glucopyranose |
GC5502 | 1,6-Anhydro-β-D-glucopyranose 2,3,4-triacetate |
GC2845 | 1,6-Anhydro-β-D-lactose |
GC9708 | 1,6-Anhydro-β-D-lactose hexaacetate |
GC4270 | 1,6-Anhydro-β-D-maltose |
GC7390 | 1,6-Anhydro-β-D-maltose hexaacetate |
GC1522 | 1,6-Anhydro-β-D-maltotriose |
GC1479 | 1,6-Anhydro-β-D-maltotriose nonaacetate |
GC2681 | 1,6-Anhydro-β-D-mannofuranose |
GC1511 | 1,6-Di-O-acetyl-2-azido-3,4-di-O-benzyl-2-deoxy-α-D-glucopyranose |
GC8010 | 1,6:2,3-Dianhydro-4-O-(2,3-di-O-benzyl-4,6-O-benzylidene-β-D-glucopyranosyl)-β-D-mannopyranose |
GC7404 | 1,6:2,3-Dianhydro-4-O-(2,3-di-O-benzyl-β-D-glucopyranosyl)-β-D-mannopyranose |
GC4821 | 1,6:2,3-Dianhydro-4-O-(2,3,4,6-tetra-O-acetyl-β-D-glucopyranosyl)-β-D-mannopyranose |
GC1272 | 1,6:2,3-Dianhydro-4-O-(4,6-O-benzylidene-β-D-glucopyranosyl)-β-D-mannopyranose |
GC1166 | 1,6:2,3-Dianhydro-4-O-(6-methyl-2,3-di-O-benzyl-β-D-glucopyranuronosyl)-β-D-mannopyranose |
GC1827 | 1,6:2,3-Dianhydro-4-O-benzyl-β-D-mannopyranose |
GC2391 | 1,6:2,3-Dianhydro-b-D-mannopyranose |
GC7927 | 1,6:2,3-Dianhydro-β-D-talopyranose |
GC1940 | 1,6:3,4-Dianhydro-2-O-benzyl-β-D-altropyranose |
GC0672 | 1,6:3,4-Dianhydro-β-D-altropyranose |
GW2666 | 1,7-Dimethyluric acid |
GE9784 | 1,8-Cineole |
GK8071 | 1,8-Diazabicyclo(5.4.0)undec-7-ene |
GK5792 | 1,8-Diazafluoren-9-one |
GW6285 | 1(E)-Iodo-hex-1-ene |
GW9956 | 1(E)-Iodo-oct-1-ene |
GW0590 | 1(H)-Naphthotriazol |
GL1949 | 1(S);9(R)-(-)-Bicuculline methiodide |
GW8626 | 10-Dodecylacridine Orange Bromide |
GP2894 | 10-Hydroxycamptothecin |
GK2383 | 10-Hydroxydecanoic acid |
GW6191 | 10-Octadecylacridine orange bromide |
GK3843 | 10-Undecenoic acid |
GL1970 | 10,11-Dehydrocurvularin |
GC3455 | 10,11-Dihydro-10-hydroxycarbamazepine O-b-D-glucuronide |
GX2825 | 10% Pd/C Degussa Type E 106 NN/W (water wet) |
GL1230 | 10058-F4 |
GL2243 | 10Z-Hymenialdisine |
GK8220 | 11-alpha-Hydroxyprogesterone |
GL2214 | 11-O-Methylpseurotin A |
GW9547 | 12-(1-Pyrenyl) dodecanoic acid |
GK1795 | 12-Hydroxyoctadecanoic acid |
GL9536 | 12-Methoxycarnosic acid |
GX6295 | 12-Molybdophosphoric acid hydrate p.A., ACS |
GX2453 | 12-Tungstophosphoric acid hydrate |
GL0512 | 1233B |
GW3882 | 13-cis-4-Oxoretinoic acid |
GK6799 | 1400W dihydrochloride |
GL0386 | 16-epi-Latrunculin B |
GL4924 | 16-keto-Aspergillimide |
GA4123 | 17-Dimethylaminoethylamino-17-demethoxygeldanamycin |
GL0144 | 17-Hydroxyventuricidin A |
GW6196 | 19-O-Acetylchaetoglobosin A |
GC3561 | 1D-chiro-Inositol |
GL1507 | 1H-[1,2,4]Oxadiazolo[4,3-a]quinoxalin-1-one |
GC7626 | 1L-chiro-Inositol |
GW0298 | 2-(1,1-Dimethylpropyl)-6-(diphenylphosphino)pyridine |
GW9222 | 2-(2-Benzofuranyl)-3-hydroxychromone |
GW1052 | 2-(2-Naphthyl)-2-(phenylmethoxy)-ethanenitrile |
GW8066 | 2-(2-Naphthyl)-2-pentyloxyethanenitrile |
GW9746 | 2-(4-Aminophenyl)-6-methylbenzothiazole-7-sulphonic acid |
GK8928 | 2-(4-Hydroxyphenyl)ethanol |
GC3113 | 2-(4-Iodophenyl)-3-(4-nitrophenyl)-5-phenyltetrazolium chloride |
GC8008 | 2-(4-Methoxybenzylidene)imino-2-deoxy-1,3,4,6-Tetra-O-acetyl-β-D-glucopyranose |
GC0682 | 2-(4-Methoxybenzylidene)imino-2-deoxy-D-glucopyranose |
GC0914 | 2-(Acetylamino)phenyl β-D-glucopyranosiduronic acid, sodium salt |
GX3212 | 2-(Aminomethyl)-1,3-dioxolane |
GC1658 | 2-(Biotinylamido)ethyl α-D-mannopyranoside |
GW5329 | 2-(Chloromethyl)benzoic acid |
GC5983 | 2-(Dihydrogen phosphate) D-glucose |
GC0571 | 2-(Dimethoxymethyl)-5-(methoxymethyl)furan |
GC0906 | 2-(Dimethoxymethyl)furan |
GW7725 | 2-(Tosyloxy)cycloheptanone |
GW0746 | 2-(Tosyloxy)cyclohexanone |
GW1095 | 2-[2-(2-Aminophenoxy)ethoxy]-4-methyl-benzenamine |
GC2376 | 2-Acetamido-1,3-di-O-acetyl-2-deoxy-4,6-O-isopropylidene-D-glucopyranose |
GC8022 | 2-Acetamido-1,3,4-tri-O-acetyl-2-deoxy-α-L-fucopyranose |
GC3993 | 2-Acetamido-1,3,4-tri-O-acetyl-2-deoxy-β-D-quinovose |
GC1882 | 2-Acetamido-1,3,4-tri-O-acetyl-2,6-dideoxy-6-fluoro-D-glucopyranose |
GC8421 | 2-Acetamido-1,3,4-tri-O-butanoyl-2-deoxy-D-mannopyranose |
GC9132 | 2-Acetamido-1,3,4,6-tetra-O-acetyl-2-deoxy-a-D-glucopyranose |
GC8824 | 2-Acetamido-1,3,4,6-tetra-O-acetyl-2-deoxy-b-D-galactopyranose |
GC0192 | 2-Acetamido-2-deoxy-3,4,6-tri-O-acetyl-β-D-glucopyranosylamine |
GC2175 | 2-Acetamido-2-deoxy-4-O-(2-acetamido-2-deoxy-b-D-galactopyranosyl)-D-glucose |
GC7643 | 2-Acetamido-2-deoxy-4-O-(b-D-galactopyranosyl)-D-galactopyranose |
GC9273 | 2-Acetamido-2-deoxy-4-O-α-D-galactopyranosyl-D-glucose |
GC7323 | 2-Acetamido-2-deoxy-4,6-O-isopropylidene-D-glucopyranose |
GC3327 | 2-Acetamido-2-deoxy-6-O-(b-D-galactopyranosyl)-D-glucopyranose |
GC8334 | 2-Acetamido-2-deoxy-N-(2-(2-aminoethoxy)ethoxy)acetylaminohexanoyl-β-D-glucopyranosylamine |
GC0418 | 2-Acetamido-2-deoxy-β-D-glucopyranosyl azide |
GC0341 | 2-Acetamido-2,6-dideoxy-L-galactose |
GC9902 | 2-Acetamido-3,4,6-tri-O-acetyl-2-deoxy-N-(2-(2-(fluorenylmethyloxycarbonylamino)ethoxy)ethoxy)acetylaminohexanoyl-β-D-glucopyranosylamine |
GC6071 | 2-Acetamido-3,4,6-tri-O-acetyl-N-(N-Cbz-ε-aminocaproyl)-2-deoxy-β-D-glucopyranosylamine |
GC1733 | 2-Acetamido-4-fluoro-1,3,6-tri-O-acetyl-2,4-dideoxy-D-glucopyranose |
GC2532 | 2-Acetamido-4,6-O-benzylidene-2-deoxy-D-glucopyranose |
GN8510 | 2-Acetamido-6-chloro-9-(2'',3'',5''-tri-O-acetyl-b-D-ribofuranosyl)purine |
GK4219 | 2-Acetyl-6-methoxynaphthalene |
GC1108 | 2-Acetylsalicylic acid acyl-b-D-glucuronide |
GC3189 | 2-Amino-2-deoxy-D-ribopyranose, hydrochloride (min. 95% α-anomer) |
GC0129 | 2-Amino-2-deoxy-N-(4-methoxybenzylidene)-β-D-galactopyranose |
GK0508 | 2-Amino-2-methyl-1-propanol hydrochloride |
GK9117 | 2-Amino-2-methyl-1-propanol, 95% |
GN7302 | 2-Amino-4-methoxy-7-(2-deoxy-b-D-ribofuranosyl)-pyrrolo[2,3-d]pyrimidine |
GK1489 | 2-Amino-4-methylbenzamide |
GK3964 | 2-Amino-5-chloro-2''-fluorobenzophenone |
GM8338 | 2-Amino-5-chlorobenzoic acid |
GK8739 | 2-Amino-5-chloropyridine |
GK1804 | 2-Amino-5-mercapto-1,3,4-thiadiazole |
GK5047 | 2-Amino-5-nitrothiazole |
GK1021 | 2-Aminobenzenesulfonamide |
GC6285 | 2-Aminoethyl 2-acetamido-2-deoxy-3-O-β-D-galactopyranosyl-β-D-glucopyranoside |
GC0673 | 2-Aminoethyl 2-O-sulfo-α-L-fucopyranoside sodium salt |
GC6268 | 2-Aminoethyl 2,3,4,6-tetra-O-acetyl-α-D-mannopyranoside hydrochloride |
GC4975 | 2-Aminoethyl 3-O-α-D-galactopyranosyl-β-D-galactopyranoside |
GC6645 | 2-Aminoethyl 6-deoxy-α-D-galactopyranoside |
GC2707 | 2-Aminoethyl α-L-fucopyranoside |
GC4850 | 2-Aminoethyl β-D-anthropyranoside |
GM4865 | 2-Aminoisobutyric acid |
GK2991 | 2-Aminophenol |
GC6815 | 2-Aminophenyl 2,3,4-tri-O-acetyl-β-D-glucopyranosiduronic acid methyl ester |
GE6905 | 2-Aminopurine |
GW1198 | 2-Anthracenylsulfonyl chloride |
GC9044 | 2-Azido-2-deoxy-1-O-(thexyldimethylsilyl)-β-L-fucopyranose |
GC6213 | 2-Azido-2-deoxy-1,3,4,6-tetra-O-acetyl-D-galactopyranose |
GC5275 | 2-Azido-2-deoxy-D-galactose |
GC5099 | 2-Azido-2-deoxy-D-glucofuranurono-6,3-lactone |
GC8902 | 2-Azido-2-deoxy-D-glucose |
GC6789 | 2-Azido-2-deoxy-L-fucopyranose |
GC5554 | 2-Azidoethyl 2-acetamido-2-deoxy-3-O-β-D-galactopyranosyl-β-D-glucopyranoside |
GC6784 | 2-Azidoethyl 2-acetamido-2-deoxy-4-O-β-D-galactopyranosyl-β-D-glucopyranoside |
GC7544 | 2-Azidoethyl 2-acetamido-2-deoxy-β-D-glucopyranoside |
GC4249 | 2-Azidoethyl 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-β-D-galactopyranoside |
GC2840 | 2-Azidoethyl 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-β-D-glucopyranoside |
GC5686 | 2-Azidoethyl 2,3,4-tri-O-acetyl-6-deoxy-α-D-galactopyranoside |
GC2992 | 2-Azidoethyl 2,3,4-tri-O-acetyl-α-L-fucopyranoside |
GC4178 | 2-Azidoethyl 2,3,4-tri-O-acetyl-β-D-glucopyranosiduronic acid methyl ester |
GC0060 | 2-Azidoethyl 2,3,4-tri-O-acetyl-β-D-xylopyranoside |
GC3573 | 2-Azidoethyl 2,3,4,6-tetra-O-acetyl-α-D-mannopyranoside |
GC0578 | 2-Azidoethyl 2,3,4,6-tetra-O-acetyl-β-D-galactopyranoside |
GC4291 | 2-Azidoethyl 2,3,4,6-tetra-O-acetyl-β-D-glucopyranoside |
GC9458 | 2-Azidoethyl 2,4-di-O-benzoyl-α-D-mannopyranoside |
GC5237 | 2-Azidoethyl 3-O-acetyl-4,6-O-benzylidene-2-deoxy-2-phthalimido-β-D-glucopyranoside |
GC6746 | 2-Azidoethyl 3,4-O-isopropylidene-α-L-fucopyranoside |
GC2770 | 2-Azidoethyl 3,6-di-O-(α-D-mannopyranosyl)-α-D-mannopyranoside |
GC6983 | 2-Azidoethyl α-D-mannopyranoside |
GC9084 | 2-Azidoethyl α-L-fucopyranoside |
GC6933 | 2-Azidoethyl β-D-galactopyranoside |
GC5576 | 2-Azidoethyl β-D-glucopyranoside |
GC5504 | 2-Azidoethyl β-D-glucopyranosiduronic acid |
GC9441 | 2-Azidoethyl β-D-lactoside |
GC3441 | 2-Azidoethyl β-D-lactoside heptaacetate |
GC6031 | 2-Benzyl-lactyl lactate |
GX0684 | 2-Bromo-1-(4-fluorophenyl)-2-phenylethanone |
GP7889 | 2-Bromo-2-nitro-1,3-propanediol |
GK5453 | 2-Bromo-5-methoxybenzoic acid |
GW4551 | 2-Bromoacrolein |
GW0228 | 2-Bromocycloheptanone |
GK9684 | 2-Bromoethanesulfonic acid sodium salt |
GK0232 | 2-Bromoethylamine hydrobromide |
GW5217 | 2-Bromophenethylamine |
GL0826 | 2-Butanol |
GK2748 | 2-Butanone |
GK1873 | 2-Carbethoxycyclopentanone |
GK3806 | 2-Chloro-2'',4''-difluoroacetophenone |
GK8367 | 2-Chloro-4-fluorobenzoic acid |
GW3462 | 2-Chloro-4-methoxyresorcinol |
GK1821 | 2-Chloro-4-methylphenol |
GC0463 | 2-Chloro-4-nitrophenyl 2-azido-2-deoxy-β-D-galactopyranoside |
GC2222 | 2-Chloro-4-nitrophenyl a-D-maltotrioside |
GC9138 | 2-Chloro-4-nitrophenyl b-D-cellobioside |
GC5397 | 2-Chloro-4-nitrophenyl b-D-maltotrioside |
GC0413 | 2-Chloro-4-nitrophenyl-α-D-glucopyranoside |
GK9320 | 2-Chloro-4,6-dimethoxy-1,3,5-triazine |
GK8517 | 2-Chloro-5-chloromethylthiazole |
GK4024 | 2-Chloro-5-nitrobenzaldehyde |
GK3965 | 2-Chloro-5-nitrobenzoic acid |
GK4951 | 2-Chloro-6-trichloromethylpyridine |
GK4392 | 2-Chloro-6-trifluoromethylpyridine |
GK8903 | 2-Chloroaniline |
GW2613 | 2-Chlorocyclohepta-2,4,6-trienone |
GC2627 | 2-Chloroethyl 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-β-D-glucopyranoside |
GC7015 | 2-Chloroethyl 2,3,4-tri-O-acetyl-β-D-glucopyranosiduronic acid methyl ester |
GC3955 | 2-Chloroethyl 2,3,4-tri-O-acetyl-β-D-xylopyranoside |
GC3265 | 2-Chloroethyl 2,3,4,6-tetra-O-acetyl-β-D-galactopyranoside |
GC1334 | 2-Chloroethyl 2,3,4,6-tetra-O-acetyl-β-D-glucopyranoside |
GC2640 | 2-Chloroethyl 3-O-acetyl-4,6-O-benzylidene-2-deoxy-2-phthalimido-β-D-glucopyranoside |
GC0171 | 2-Chloroethyl α-L-fucopyranoside |
GC5174 | 2-Chloroethyl β-D-lactoside |
GC8520 | 2-Chloroethyl β-D-lactoside heptaacetate |
GC0442 | 2-Chloroethyl-2,3,4,6-tetra-O-acetyl-a-D-mannopyranoside |
GK5986 | 2-Chloromethylpyridine hydrochloride |
GK8595 | 2-Chloropyridine-4-carboxylic acid |
GK2810 | 2-Coumaranone |
GW4194 | 2-Cyclopropyl-propylamine -p-toluenesulfonate salt |
GC7979 | 2-Decyltetradecyl D-xylopyranoside |
GC7411 | 2-Deoxy-2-fluoro-D-glucose |
GC8449 | 2-Deoxy-2-fluoro-D-lactose |
GC4574 | 2-Deoxy-2-fluoro-D-ribofuranose |
GC8836 | 2-Deoxy-2-fluoro-L-fucose |
GC3912 | 2-Deoxy-2-fluoro-β-D-glucopyranosyl azide |
GC6121 | 2-Deoxy-2-iodo-D-glucose |
GC8127 | 2-Deoxy-2-N-phthalimido-1,3,4,6-tetra-O-acetyl-D-glucopyranose |
GC2414 | 2-Deoxy-D-arabino-Hexonic acid, calcium salt |
GC5572 | 2-Deoxy-D-galactose |
GC6248 | 2-Deoxy-D-glucose |
GC2000 | 2-Deoxy-D-glucose 6-phosphate sodium salt |
GC7273 | 2-Deoxy-D-ribose |
GC9858 | 2-Deoxy-D-xylose |
GC5334 | 2-Deoxy-L-ribose |
GC3703 | 2-Deoxy-scyllo-inosose |
GM1876 | 2-Dimethylaminoethanol (+)-bitartrate salt |
GC7173 | 2-Dodecylhexadecyl D-xylopyranoside |
GM0340 | 2-Ethoxy-1-ethoxycarbonyl-1,2-dihydroquinoline |
GW8859 | 2-Ethoxy-2-(2-naphthyl)-acetonitrile |
GX2445 | 2-Ethoxyethanol |
GC2764 | 2-Ethylhexyl D-xylopyranoside |
GK6026 | 2-Ethylhexyl nitrate |
GC6081 | 2-Fluoro-4-nitrophenyl 2-azido-2-deoxy-β-D-galactopyranoside |
GK0223 | 2-Fluorobenzaldehyde |
GC2819 | 2-Fluoroethyl α-L-fucopyranoside |
GC1395 | 2-Formylphenyl 2,3,4,6-tetra-O-acetyl-b-D-glucopyranoside |
GW9659 | 2-Heptyl-3-hydroxyl-4-quinolone |
GK0834 | 2-Hydroxy-3-nitropyridine |
GK3659 | 2-Hydroxy-4-methoxybenzaldehyde |
GK2691 | 2-Hydroxy-4-methoxybenzophenone-5-sulfonic acid |
GK9908 | 2-Hydroxybenzyl alcohol |
GK9328 | 2-Hydroxybiphenyl |
GK7095 | 2-Hydroxyethyl methacrylate |
GE5756 | 2-Hydroxypropyl-beta-cyclodextrin |
GE5877 | 2-Hydroxypropyl-beta-cyclodextrin, EP, USP grade |
GE3201 | 2-Hydroxypropyl-beta-cyclodextrin, USP grade |
GK4072 | 2-Hydroxypyridine-N-oxide |
GX3703 | 2-Iodobenzenesulfonic acid sodium salt |
GK1884 | 2-Iodobenzoic acid |
GC6472 | 2-Iodoethyl 2,3,4-tri-O-acetyl-α-L-fucopyranoside |
GC1017 | 2-Iodoethyl α-L-fucopyranoside |
GW7450 | 2-Iodoso-3,4,5,6-tetrafluorobenzoic acid |
GW8496 | 2-Iodoxy-3,4,5,6-tetrafluorobenzoic acid |
GP9006 | 2-Ketoglutaric acid |
GE6119 | 2-Ketoglutaric acid disodium salt dihydrate |
GE8113 | 2-Ketoglutaric acid monopotassium salt |
GW6904 | 2-Maleinimidoethyl mesylate |
GK2967 | 2-Mercaptobenzimidazole |
GK4221 | 2-Mercaptobenzothiazole |
GC3766 | 2-Mercaptoethyl 3-O-α-D-galactopyranosyl-β-D-galactopyranoside |
GW3426 | 2-Methoxy-2-(2-naphthyl)ethanenitrile |
GK1548 | 2-Methoxyphenacyl bromide |
GK8378 | 2-Methoxyphenylacetic acid |
GK2141 | 2-Methyl-1-propanol |
GC1739 | 2-Methyl-4,5-(2-deoxy-α-D-glucopyrano)-?2-oxazoline |
GC4116 | 2-Methyl-4,5-(3,4,6-tri-O-acetyl-2-deoxy-α-D-glucopyrano)-Δ2-oxazoline |
GW8818 | 2-Methyl-5-nitroimidazole-1-acetic acid |
GK4791 | 2-Methyl-6-nitroaniline |
GC0254 | 2-Methylbutyl D-glucuronide |
GK6407 | 2-Methylimidazole |
GS4207 | 2-Methylpropan-1-ol, GlenDry?, anhydrous |
GS9642 | 2-Methylpropan-2-ol, GlenPure?, analytical grade |
GS6963 | 2-Methyltetrahydrofuran, GlenDry?, anhydrous |
GS5892 | 2-Methyltetrahydrofuran, GlenDry?, anhydrous stabilised with BHT |
GS0371 | 2-Methyltetrahydrofuran, GlenPure?, analytical grade |
GS6995 | 2-Methyltetrahydrofuran, GlenPure?, analytical grade stabilised with BHT |
GC7707 | 2-Naphthalenyl β-D-glucopyranosiduronic acid, sodium salt |
GK1330 | 2-Naphthol |
GC6509 | 2-NBDG |
GK9508 | 2-Nitrobenzaldehyde |
GC0206 | 2-Nitrophenyl b-D-cellobioside heptaacetate |
GC0605 | 2-Nitrophenyl b-D-galactopyranoside |
GC5922 | 2-Nitrophenyl b-D-glucopyranoside |
GW8426 | 2-Nitrophenyl dodecyl ether |
GC5682 | 2-Nitrophenyl α-D-galactopyranoside |
GC0123 | 2-Nitrophenyl α-D-glucopyranoside |
GC5464 | 2-Nitrophenyl β-D-Glucuronide |
GC0557 | 2-O-(2-Acetamido-2-deoxy-α-D-galactopyranosyl)-D-galactose |
GC9937 | 2-O-(2-Acetamido-2-deoxy-β-D-galactopyranosyl)-D-galactose |
GC5377 | 2-O-(a-L-Fucopyranosyl)-D-galactopyranose |
GC6431 | 2-O-(Carboxymethyl)-D-glucose |
GC3628 | 2-O-a-D-Glucopyranosyl-L-ascorbic acid |
GC8450 | 2-O-Acetyl-1,6-anhydro-3,4-O-isopropylidene-β-D-galactopyranose |
GC3534 | 2-O-Acetyl-3,4-di-O-benzyl-L-fucopyranose |
GC7337 | 2-O-Methyl-D-glucopyranose |
GC5974 | 2-O-Tert-butyldimethylsilyl-3,4-O-isopropylidene-D-arabinonic acid δ-lactone |
GC8727 | 2-O-β-D-Galactopyranosyl-D-galactose |
GC5135 | 2-Octyldodecyl D-xylopyranoside |
GK4735 | 2-Phenoxyaniline |
GK9546 | 2-Phenoxyethanol |
GK6984 | 2-Phenylbutyric acid |
GK6245 | 2-Phenylethanol |
GM3708 | 2-Phenylglycine |
GW4893 | 2-Phenylpropionyl chloride |
GV3345 | 2-Phospho-L-ascorbic acid trisodium salt |
GX4575 | 2-Phosphonobutane-1,2,4-tricarboxylic acid solution |
GW1004 | 2-Propyl-2-pentenoic acid |
GK6992 | 2-Pyrrolidinone |
GK3183 | 2-Thiouracil |
GW1654 | 2-Tosyloxytropone |
GK3424 | 2-Vanillylamine hydrochloride |
GC2922 | 2-β-D-Glucopyranosyloxy-1,4-benzoxazin-3-one |
GC4214 | 2-β-D-Glucuronopyranosyloxy-1,4-benzoxazin-3-one |
GL3296 | 2,2-Dimethoxy-2-phenylacetophenone |
GE8961 | 2,2-Dimethyl-1,3-dioxane-4,6-dione |
GL7180 | 2,2-Dimethyl-1,3-propanediamine |
GX8890 | 2,2-Dimethyl-3-(3-methylphenyl)propanol |
GK8315 | 2,2-Dimethylcyclopentanone |
GX8745 | 2,2-Diphenyl-1-picrylhydrazyl |
GS2953 | 2,2,2-Trifluoroethanol, GlenPure?, analytical grade |
GS9378 | 2,2,4-Trimethylpentane, GlenDry?, anhydrous |
GS9928 | 2,2,4-Trimethylpentane, GlenDry?, anhydrous over molecular sieve |
GS9997 | 2,2,4-Trimethylpentane, GlenPure?, analytical grade |
GS5342 | 2,2,4-Trimethylpentane, GlenUltra?, analytical grade, for GC |
GX6792 | 2,2''-Azobis(2-(2-imidazolin-2-yl)propane) dihydrochloride |
GK3418 | 2,2''-Dipyridyl |
GK5006 | 2,2''-Dithiodipyridine |
GC4251 | 2,2'',3,3''-Tetra-O-acetyl-4'',6''-O-benzylidene-1,6-anhydro-β-D-cellobiose |
GC4128 | 2,2'',3,3'',4'',6,6''-Hepta-O-acetyl-α-D-lactosyl bromide |
GC8971 | 2,2'',3,3'',4'',6,6''-Hepta-O-benzoyl-D-lactosyl trichloroacetimidate |
GC2542 | 2,2'',3,3'',6''-Penta-O-acetyl-1,6-anhydro-β-D-cellobiose |
GL3348 | 2,3-Butanedione monoxime |
GC5114 | 2,3-Di-O-(carboxymethyl)-D-glucose |
GK7665 | 2,3-Diaminonaphthalene |
GW1075 | 2,3-Diaminopropane-1-thiol dihydrobromide |
GK4311 | 2,3-Dichloro-1,4-naphthoquinone |
GK7795 | 2,3-Dihydroxybenzaldehyde, 97% |
GC0421 | 2,3-Diketo-L-gulonic acid |
GC4551 | 2,3-O-Carbonyl-α-D-mannopyranose |
GC3038 | 2,3-O-Isopropylidene-1,1,4,4-tetraphenyl-L-threitol |
GC8613 | 2,3-O-Isopropylidene-D-erythrofuranose |
GC4888 | 2,3-O-Isopropylidene-L-gulonic acid-1,4-lactone |
GC0119 | 2,3,2'',3'',4'',6''-Hexa-O-acetyl-1,6-anhydro-b-D-cellobiose |
GW1039 | 2,3,3-Trimethyl-1-(4-sulfobutyl)-indolium, inner salt |
GK6260 | 2,3,3-Trimethylindolenine |
GC9530 | 2,3,3'',4,4''-Penta-O-isovaleryl-sucrose |
GC4075 | 2,3,3'',4,4'',6,6''-Hepta-O-benzoyl-D-sucrose |
GC2218 | 2,3,4-Tri-O-acetyl-6-azido-6-deoxy-β-D-glucopyranosyl azide |
GC1325 | 2,3,4-Tri-O-acetyl-6-azido-6-deoxy-β-D-glucopyranosylamine |
GC6675 | 2,3,4-Tri-O-acetyl-6-O-tosyl-β-D-glucopyranosyl azide |
GC3919 | 2,3,4-Tri-O-acetyl-6-O-trityl-D-galactopyranose |
GC8293 | 2,3,4-Tri-O-acetyl-a-D-xylopyranosyl trichloroacetimidate |
GC4447 | 2,3,4-Tri-O-acetyl-b-D-xylopyranosyl azide |
GC2056 | 2,3,4-Tri-O-acetyl-b-L-fucopyranosyl azide |
GC1572 | 2,3,4-Tri-O-acetyl-D-glucopyranuronic acid methyl ester |
GC6305 | 2,3,4-Tri-O-acetyl-D-xylopyranosyl trichloroacetimidate |
GC1151 | 2,3,4-Tri-O-acetyl-L-fucose |
GC5477 | 2,3,4-Tri-O-acetyl-α-D-glucopyranuronic acid 4-methoxybenzyl ester trichloroacetimidate |
GC0455 | 2,3,4-Tri-O-acetyl-α-D-glucuronide methyl ester trichloroacetimidate |
GC4810 | 2,3,4-Tri-O-acetyl-α-L-arabinopyranosyl bromide |
GC3560 | 2,3,4-Tri-O-acetyl-α-L-fucopyranosyl fluoride |
GC7672 | 2,3,4-Tri-O-acetyl-α-L-fucopyranosyl trichloroacetimidate |
GC0144 | 2,3,4-Tri-O-acetyl-α-L-rhamnopyranosyl bromide |
GC5795 | 2,3,4-Tri-O-acetyl-β-D-xylopyranosyl trichloroacetimidate |
GC1761 | 2,3,4-Tri-O-acetyl-β-L-fucopyranosyl fluoride |
GC7116 | 2,3,4-Tri-O-benzyl-a-D-glucuronide benzyl ester trichloroacetimidate |
GC2697 | 2,3,4-Tri-O-benzyl-D-glucopyranose |
GC9135 | 2,3,4-Tri-O-benzyl-D-glucopyranuronic acid benzyl ester |
GC6114 | 2,3,4-Tri-O-benzyl-D-xylopyranose |
GC7661 | 2,3,4-Tri-O-benzyl-D-xylopyranosyl trichloroacetimidate |
GC0315 | 2,3,4-Tri-O-isobutyryl-D-glucopyranuronic acid methyl ester |
GC4023 | 2,3,4-Tri-O-pivaloyl-α-D-glucopyranuronic acid methyl ester trichloroacetimidate |
GC9895 | 2,3,4-Tri-O-pivaloyl-β-D-glucopyranuronic acid methyl ester |
GK5123 | 2,3,4-Trifluorobenzoic acid |
GK3797 | 2,3,4-Trihydroxybenzaldehyde |
GC1828 | 2,3,4,6-Tetra-O-acetyl-1-deoxy-D-arabino-hex-1-enopyranose |
GC5969 | 2,3,4,6-Tetra-O-acetyl-a-D-galactopyranosyl trichloroacetimidate |
GC2702 | 2,3,4,6-Tetra-O-acetyl-alpha-D-mannopyranosyl trichloroacetimidate |
GC2562 | 2,3,4,6-Tetra-O-acetyl-b-D-galactopyranosyl azide |
GC1823 | 2,3,4,6-Tetra-O-acetyl-b-D-glucopyranosyl azide |
GC4363 | 2,3,4,6-Tetra-O-acetyl-b-D-glucopyranosyl fluoride |
GC2324 | 2,3,4,6-Tetra-O-acetyl-b-D-glucopyranosyl salicylate |
GC9112 | 2,3,4,6-Tetra-O-acetyl-b-D-glucopyranosyl trichloroacetimidate |
GC6496 | 2,3,4,6-Tetra-O-acetyl-D-galactopyranosyl trichloroacetimidate |
GC2556 | 2,3,4,6-Tetra-O-acetyl-D-glucopyranosyl trichloroacetimidate |
GC1085 | 2,3,4,6-Tetra-O-acetyl-α-D-mannopyranosyl azide |
GC9539 | 2,3,4,6-Tetra-O-benzoyl-α-D-mannopyranosyl trichloroacetimidate |
GC2006 | 2,3,4,6-Tetra-O-benzoyl-β-D-glucopyranosyl fluoride |
GC9056 | 2,3,4,6-Tetra-O-benzyl-D-galactopyranose |
GC7184 | 2,3,4,6-Tetra-O-benzyl-D-glucopyranose |
GC1557 | 2,3,4,6-Tetra-O-benzyl-D-mannopyranose |
GC6470 | 2,3,4,6-Tetra-O-benzyl-D-mannopyranosyl fluoride |
GC6047 | 2,3,4,6-Tetra-O-benzyl-β-D-galactopyranosyl trichloroacetimidate |
GE0337 | 2,3,4,6-Tetramethyl-D-glucose |
GC0772 | 2,3,5-Tri-O-acetyl-D-arabinonic acid, γ-lactone |
GC5277 | 2,3,5-Tri-O-acetyl-D-xylonic acid, γ-lactone |
GC7875 | 2,3,5-Tri-O-benzoyl-β-D-arabinofuranosyl fluoride |
GC0836 | 2,3,5-Tri-O-benzyl-b-D-arabinofuranose |
GC5276 | 2,3,5-Tri-O-benzyl-D-ribofuranose |
GC9514 | 2,3,5-Triphenyltetrazolium chloride, 99% |
GE2454 | 2,3,5-Triphenyltetrazolium chloride, 99%, for analysis |
GC5452 | 2,3,6-Tri-O-(carboxymethyl)-D-glucose |
GC8269 | 2,3,6-Tri-O-benzyl-1-O-(thexyldimethylsilyl)-β-D-galactopyranose |
GC7711 | 2,3,6,2'',3'',4'',6''-Hepta-O-acetyl-1-thio-β-D-lactose 1-(dimethylcarbamodithioate) |
GC4713 | 2,3,6,2'',3'',4'',6''-Hepta-O-acetyl-a-D-cellobiosyl bromide |
GC0193 | 2,3,6,2'',3'',6''-Hepta-O-acetyl-b-maltosyl azide |
GT1501 | 2,3,6,7-Tetrahydro-8-hydroxy-1H,5H-benzo[ij]quinolizine-9-carboxaldehyde |
GC0061 | 2,3:4,5-Di-O-isopropylidene-1-O-propargyl-β-D-fructopyranose |
GC1595 | 2,3:4,5-Di-O-isopropylidene-D-arabinose |
GC0195 | 2,3:4,5-Di-O-isopropylidene-D-arabitol |
GC6033 | 2,3:4,5-Di-O-isopropylidene-β-D-fructopyranose |
GC0575 | 2,3:4,6-Di-O-isopropylidene-a-L-sorbofuranose |
GC6507 | 2,3:5,6-Di-O-isopropylidene-D-gluconic acid methyl ester |
GC2026 | 2,3:5,6-Di-O-isopropylidene-α-D-mannofuranose |
GC3818 | 2,4-Di-O-acetyl-1,6-anhydro-3-O-benzyl-β-L-idopyranose |
GK6386 | 2,4-Dichlorophenoxyacetic acid |
GW3317 | 2,4-Dichlororesorcinol |
GK0030 | 2,4-Difluoroaniline |
GW6353 | 2,4-Difluororesorcinol |
GK5333 | 2,4-Dinitrofluorobenzene |
GC7368 | 2,4-Dinitrophenyl 2-deoxy-2-fluoro-b-D-glucopyranoside |
GC1845 | 2,4-Dinitrophenyl 2-deoxy-2-fluoro-β-D-xylopyranoside |
GC9590 | 2,4-Dinitrophenyl 2,3,4,6-tetra-O-acetyl-α-D-glucopyranoside |
GC6346 | 2,4-Dinitrophenyl 2,3,4,6-tetra-O-acetyl-β-D-glucopyranoside |
GC9571 | 2,4-Dinitrophenyl 3,4-di-O-acetyl-2-deoxy-2-fluoro-α-D-lyxopyranoside |
GC9478 | 2,4-Dinitrophenyl β-D-glucopyranoside |
GW8640 | 2,4-Pentadienoic acid |
GW9999 | 2,4,5-Trichlorophenol |
GC2544 | 2,4,6-Tri-O-acetyl-1,3,5-O-methylidyne-myo-inositol |
GC3129 | 2,4,6-Tri-O-acetyl-3-O-allyl-D-glucopyranosyl trichloroacetimidate |
GC7134 | 2,4,6-Tri-O-acetyl-3-O-allyl-α-D-glucopyranosyl trichloroacetimidate |
GC7774 | 2,4,6-Tri-O-acetyl-3-O-benzyl-α-D-glucopyranosyl trichloroacetimidate |
GC9832 | 2,4,6-Tri-O-acetyl-3-O-benzyl-β-D-glucopyranosyl trichloroacetimidate |
GK6656 | 2,4,6-Tri(2-pyridyl)-s-triazine |
GW0465 | 2,4,6-Triiodobenzoic acid |
GW5495 | 2,4,6-Tris(trifluoromethyl)-1,3,5-triazine |
GC5558 | 2,4,7,8-Tetra-O-acetyl-9-azido-9-deoxy-N-acetylneuraminic acid methyl ester |
GC1218 | 2,4,7,8,9-Penta-O-acetyl-a-D-neuraminic acid methyl ester |
GC7893 | 2,5-Anhydro-1-O-trityl-D-mannitol |
GC0241 | 2,5-Anhydro-D-mannitol |
GC4910 | 2,5-Anhydro-L-iditol |
GK4865 | 2,5-Bis-trifluoromethylaniline |
GW2517 | 2,5-Bis(4-aminophenyl)-1,3,4-oxadiazole |
GW3033 | 2,5-Dichloro-p-xylene |
GK8629 | 2,5-Dichloroaniline |
GL7510 | 2,5-Dimethyl-celecoxib |
GW1803 | 2,5-Dioxopyrrolidin-1-yl propanoate |
GE1342 | 2,5-Diphenyloxazole |
GC9225 | 2,6-Anhydro-3-deoxy-D-glycero-D-galacto-non-2-enoic-acid |
GC5552 | 2,6-Di-O-(carboxymethyl)-D-glucose |
GM5205 | 2,6-Diaminopimelic acid |
GK0378 | 2,6-Dichloro-4-nitroaniline |
GT5955 | 2,6-Dichloroindophenol sodium salt |
GT0602 | 2,6-Dichloroquinone-4-chloroimide |
GC5575 | 2,6-Dideoxy-D-glucose |
GK9208 | 2,6-Difluoropyridine |
GK9246 | 2,6-Dihydroxyanthraquinone |
GK8250 | 2,6-Dihydroxybenzoic acid |
GK9060 | 2,6-Dimethyl-4-hydroxypyridine |
GL6190 | 2,6-Dimethylphenol |
GK3868 | 2,6-Lutidine |
GN5326 | 2''-C-Methylcytidine |
GN2276 | 2''-Deoxy-2'',2''-difluorouridine |
GW1127 | 2''-Deoxy-5-formylcytidine |
GN8981 | 2''-Deoxy-5''-O-DMT-N2-isobutyrylguanosine |
GN9770 | 2''-Deoxy-L-cytidine |
GN1250 | 2''-Deoxy-N6-methyladenosine |
GN7468 | 2''-Deoxyadenosine monohydrate |
GE5892 | 2''-Deoxyadenosine-5''-monophosphate disodium salt |
GK4440 | 2''-Deoxycytidine |
GE7787 | 2''-Deoxycytidine hydrochloride |
GL7240 | 2''-Deoxyguanosine monohydrate |
GE3235 | 2''-Deoxyuridine |
GE3411 | 2''-Deoxyuridine-5''-monophosphate disodium salt |
GK0150 | 2''-Nitrophenacyl bromide |
GC3937 | 2''-O-Methyl guanosine |
GE2863 | 2'',3''-Dideoxyadenosine |
GN2393 | 2'',3'',5''-Tri-O-acetyl-6-chloro-6-deoxyguanosine |
GE4701 | 2'',3'',5''-Triacetyluridine |
GT2638 | 2'',7''-bis(2-Carboxyethyl)-5(6)-carboxyfluorescein |
GT8033 | 2'',7''-Dichlorofluorescein |
GW2593 | 2'',7''-Dichlorofluorescin diacetate |
GW1362 | 2'',7''-Difluorofluorescein |
GW1829 | 2'',7''-Difluorofluorescein diacetate |
GC5734 | 2'''',3'''',4'''',5,6''''-Penta-O-acetyl-4''-O-tert-butyldimethylsilyl-genistin |
GM3282 | 2(S)-Amino-4-azido-butanoic acid |
GK5583 | 2′,7′-bis(2-Carboxyethyl)-5(6)-carboxyfluorescein acetoxymethyl ester |
GP0436 | 20-Hydroxyecdysone, 90% |
GP9112 | 20-Hydroxyecdysone, 97% |
GC1836 | 20(s)-Ginsenoside Rh2 |
GW9823 | 22-NHC . hydrochloride |
GL1954 | 22-NHC (inactive isomer) |
GL2658 | 22-NHC hydrochloride |
GK9955 | 25-Hydroxycholesterol |
GV7732 | 25-Hydroxyvitamin D3 |
GV7349 | 25-Hydroxyvitamin D3 monohydrate |
GC9490 | 2α-Mannobiose octaacetate |
GK3590 | 3-(1-Pyridinio)-1-propanesulfonate |
GM1275 | 3-(1,2,4-Triazol-1-yl)-L-alanine |
GW8865 | 3-(2-Furoyl)quinoline-2-carboxaldehyde |
GX8894 | 3-(4-Chlorobutyl)-1H-indole-5-carbonitrile |
GL9990 | 3-(4-tert-Butyl-1-pyridinio)-1-propanesulfonate |
GE2828 | 3-(N-Ethyl-3-methylanilino)-2-hydroxypropanesulfonic acid sodium salt |
GD9579 | 3-(N,N-Dimethylmyristylammonio)propanesulfonate |
GC0671 | 3-[2-[2-(Aminooxy)acetyl]hydrazinocarbonyl]propyl 2α-mannobioside |
GC6383 | 3-Acetamido-3,6-dideoxy-D-galactose |
GW1063 | 3-Acetamido-4-nitrophthalic anhydride |
GK7482 | 3-Acetylcoumarin |
GC6979 | 3-Acetylumbelliferyl b-D-glucopyranoside |
GL4935 | 3-Amino-1-propanesulfonic acid sodium salt |
GK4820 | 3-Amino-1,2-propanediol |
GK0366 | 3-Amino-1,2,4-triazole |
GC8196 | 3-Amino-3-deoxy-D-ribose, hydrochloride |
GK4976 | 3-Amino-4-iodopyridine |
GM0393 | 3-Amino-5-bromobenzoic acid |
GX9435 | 3-Amino-6-chloropyridazine |
GK6824 | 3-Amino-9-ethylcarbazole |
GK1994 | 3-Aminobenzonitrile |
GK5470 | 3-Aminobenzotrifluoride |
GW1262 | 3-Aminoisobutyric acid [BAIBA] |
GE9420 | 3-Aminophenyl sulfone |
GK3705 | 3-Aminophenylboronic acid |
GK6749 | 3-Aminopropyltriethoxysilane |
GX2840 | 3-Aminopyridine-4-carboxylic acid |
GC4602 | 3-Azido-3-deoxy-1,2-O-isopropylidene-α-D-allofuranose |
GX3105 | 3-Azido-3-deoxy-1,2:5,6-di-O-isopropylidene-α-D-allofuranose |
GC2997 | 3-Azido-3-deoxy-1,2:5,6-di-O-isopropylidene-α-D-glucofuranose |
GC3433 | 3-Azido-3-deoxy-4-hydroxy-methyl-1,2-O-isopropylidene-a-D-ribofuranose |
GC9380 | 3-Azido-3-deoxy-D-galactose |
GC3469 | 3-Azido-3-deoxy-D-glucopyranose |
GW5837 | 3-Bromo-1-butyne |
GK5829 | 3-Bromo-o-xylene |
GK0949 | 3-Bromopyruvic acid |
GW2598 | 3-Butyn-2-ol |
GW0184 | 3-Carboxy-6,8-difluoro-7-hydroxycoumarin N-succinimidyl ester |
GK9936 | 3-Chloro-4-fluoroaniline |
GW8092 | 3-Chloro-4-methyl-7-hydroxycoumarin |
GM4001 | 3-Chloro-L-tyrosine |
GW7155 | 3-cis-Hydroxyglibenclamide |
GW9413 | 3-Cyano-7-ethoxycoumarin |
GK9086 | 3-Cyanoumbelliferone |
GC9415 | 3-Deoxy-1,2:4,5-di-O-isopropylidene-β-D-fructopyranose |
GC5764 | 3-Deoxy-1,2:5,6-di-O-isopropylidene-α-D-erythro-hex-3,4-enofuranose |
GC3228 | 3-Deoxy-1,2:5,6-di-O-isopropylidene-α-D-glucofuranose |
GC7539 | 3-Deoxy-2-C-(hydroxymethyl)-D-erythro-pentonic acid, calcium salt |
GC9136 | 3-Deoxy-2-C-(hydroxymethyl)-D-threo-pentonic acid, calcium salt |
GC6525 | 3-Deoxy-3-fluoro-D-allose |
GC0271 | 3-Deoxy-3-fluoro-D-glucopyranose |
GC8304 | 3-Deoxy-3-fluoro-D-mannose |
GC9690 | 3-Deoxy-5,6-O-isopropylidene-D-arabino-hexonic acid, γ-lactone |
GC8404 | 3-Deoxy-D-arabino-hexonic acid, calcium salt |
GC6222 | 3-Deoxy-D-fructose |
GC4920 | 3-Deoxy-D-ribo-hexonic acid, calcium salt |
GC2009 | 3-Deoxy-D-ribo-hexonic acid, γ-lactone |
GC2330 | 3-Deoxy-galactosone |
GL9152 | 3-Deoxyaphidicolin |
GC0945 | 3-Deoxyglucosone |
GK1051 | 3-Diethylaminophenol |
GW6838 | 3-Fluorophthalic anhydride |
GC7369 | 3-Fucosyl-D-lactose |
GM2009 | 3-Guanidinopropionic acid |
GK1049 | 3-Hexanol |
GK4205 | 3-Hydroxy-2,4,6-tribromobenzoic acid |
GK7523 | 3-Hydroxy-3-methylglutaric acid |
GW3842 | 3-Hydroxy-butanoyl-DL-homoserine lactone |
GW7571 | 3-Hydroxy-butanoyl-L-homoserine lactone |
GW3769 | 3-Hydroxy-hexanoyl-DL-homoserine lactone |
GW6190 | 3-Hydroxy-hexanoyl-L-homoserine lactone |
GW9838 | 3-Hydroxy-pentanoyl-DL-homoserine lactone |
GL8795 | 3-Hydroxybenzoic acid |
GK2157 | 3-Hydroxytyrosol |
GT2044 | 3-Indoleacetic acid |
GC7681 | 3-Indolyl β-D-cellotrioside |
GK2261 | 3-Indoxyl acetate |
GL2425 | 3-Isobutyl-1-methylxanthine |
GM5666 | 3-Mercaptopropionic acid |
GK8188 | 3-Methyl-1-butanol |
GL5578 | 3-Methyl-2-buten-1-ol |
GL3599 | 3-Methyladenine autophagy inhibitor |
GS6015 | 3-Methylbutan-1-ol, GlenBiol?, suitable for molecular biology |
GW6110 | 3-Morpholinobenzanthrone |
GK4946 | 3-Morpholinosydnonimine hydrochloride |
GK4162 | 3-Nitroaniline |
GK2298 | 3-Nitrobenzaldehyde |
GK0858 | 3-Nitrobenzyl alcohol |
GK3336 | 3-Nitrobenzyl chloride |
GC2835 | 3-Nitrophenyl α-D-galactopyranoside |
GK0653 | 3-Nitrophthalic anhydride |
GT0573 | 3-Nitrophthalonitrile |
GC2377 | 3-O-(2-Acetamido-2-deoxy-α-D-glucopyranosyl)-D-galactose |
GC4506 | 3-O-(2-Acetamido-2-deoxy-β-D-glucopyranosyl)-D-galactose |
GC1801 | 3-O-(Carboxymethyl)-D-glucose |
GC2891 | 3-O-Acetyl-1,2:5,6-di-O-isopropylidene-α-D-erythrohexofuranen-(3)-ose |
GC0032 | 3-O-Acetyl-1,2:5,6-di-O-isopropylidene-α-D-gulofuranose |
GC0912 | 3-O-Acetyl-1,6-anhydro-2-azido-2'',3''-di-O-benzyl-4'',6''-O-benzylidene-2-deoxy-β-D-cellobiose |
GL3831 | 3-O-Acetyl-11-keto-beta-boswellic acid |
GC4442 | 3-O-Acetyl-4-O-methyl-D-glucuronic acid |
GC6375 | 3-O-Allyl-1,2:5,6-di-O-isopropylidene-α-D-glucofuranose |
GC4003 | 3-O-Allyl-β-D-glucopyranose |
GC6797 | 3-O-Benzyl 4-C-(methanesulfonyloxymethyl)-5-O-methanesulfonyl-1,2-O-isopropylidene-a-D-ribofuranose |
GC0759 | 3-O-Benzyl-1,2-O-isopropylidene-a-D-xylopentodialdo-1,4-furanose |
GC5473 | 3-O-Benzyl-1,2-O-isopropylidene-β-D-fructopyranose |
GC5890 | 3-O-Benzyl-1,2,4,6-tetra-O-acetyl-α-D-mannopyranose |
GC7108 | 3-O-Benzyl-1,2:5,6-di-O-isopropylidene-a-D-allofuranose |
GC2593 | 3-O-Benzyl-1,2:5,6-Di-O-isopropylidene-α-D-glucofuranose |
GC0720 | 3-O-Benzyl-D-glucopyranose |
GL8113 | 3-O-Caffeoyl-betulin |
GC1008 | 3-O-Methyl-D-glucopyranose |
GX7688 | 3-O-Methylfluorescein |
GC5713 | 3-O-α-L-Fucopyranosyl-D-galactose |
GC0399 | 3-O-α-L-Fucopyranosyl-D-glucose |
GC7159 | 3-O-β-D-Galactopyranosyl-D-galactose |
GC2827 | 3-O-β-D-Glucopyranuronosyl-D-xylose |
GC1110 | 3-O-β-D-Xylopyranosyl-D-glucuronic acid |
GW5237 | 3-Oxo-dodecan-(2-aminocyclohexanone) |
GX4577 | 3-Pentanone |
GK9047 | 3-Phenanthrol |
GW4341 | 3-Phenyl-2-propynenitrile |
GK0782 | 3-Quinuclidone hydrochloride |
GL3346 | 3,28-Di-O-(3,3-dimethylglutaryl)betulin |
GW9541 | 3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluoro-1-octanethiol |
GK6069 | 3,3''-[Oxybis(methylene)]bis(3-ethyloxetane) |
GE0505 | 3,3''-Diaminobenzidine |
GE4032 | 3,3''-Diaminobenzidine tetrahydrochloride hydrate |
GW3021 | 3,3''-Diethylthiacarbocyanine iodide |
GW9950 | 3,3''-Dipropylthiacarbocyanine iodide |
GW2803 | 3,3''-Dipropylthiadicarbocyanine iodide |
GE2741 | 3,3'',5-Triiodo-L-thyronine |
GE6369 | 3,3'',5-Triiodo-L-thyronine sodium salt |
GE8825 | 3,3'',5,5''-Tetramethylbenzidine |
GX7677 | 3,3'',5,5''-Tetramethylbenzidine (TMB) Liquid Substrate, for ELISA |
GE6063 | 3,3'',5,5''-Tetramethylbenzidine dihydrochloride hydrate |
GC8123 | 3,4-Di-O-acetyl-1,6-anhydro-2-azido-2-deoxy-β-D-glucopyranose |
GC6663 | 3,4-Di-O-acetyl-1,6-anhydro-2-deoxy-2-fluoro-β-D-glucopyranose |
GC3547 | 3,4-Di-O-acetyl-1,6-anhydro-2-deoxy-2-iodo-β-D-glucopyranose |
GC2610 | 3,4-Di-O-acetyl-2-azido-2-deoxy-D-glucopyranose |
GC7937 | 3,4-Di-O-acetyl-2-deoxy-2-fluoro-L-fucopyranose |
GC6112 | 3,4-Di-O-acetyl-D-xylal |
GC9295 | 3,4-Di-O-acetyl-L-fucal |
GY6814 | 3,4-Dicaffeoylquinic acid |
GC1951 | 3,4-Dideoxyglucosone-3-ene |
GP5740 | 3,4-Difluorobenzaldehyde |
GL1038 | 3,4-Dihydroxy-DL-phenylalanine |
GM9724 | 3,4-Dihydroxy-L-phenylalanine |
GK7288 | 3,4-Dihydroxybenzoic acid |
GK5224 | 3,4-Dihydroxyphenylacetic acid |
GK5000 | 3,4-Dimethoxybenzoic acid |
GW3024 | 3,4-Dimethoxychalcone |
GK7280 | 3,4-Dimethylbenzaldehyde |
GW5808 | 3,4-Epoxycyclohex-1-en |
GC4495 | 3,4-O-[(1R,2R)-1,2-Dimethoxy-1,2-dimethyl-1,2-ethanediyl]-1,6-O-[(1S,2S)-1,2-dimethoxy-1,2-dimethyl-1,2-ethanediyl]-D-myo-inositol |
GC5144 | 3,4-O-Isopropylidene-D-arabinonic acid δ-lactone |
GK0381 | 3,4,5-Trihydroxybenzaldehyde |
GW5520 | 3,4,5,6-Tetramethylpyridazin |
GC3915 | 3,4,6-Tri-O-acetyl-1,2-O-(1-alloxyethylidene)-β-D-mannopyranose |
GC7073 | 3,4,6-Tri-O-acetyl-1,2-O-ethoxyethylidene-b-D-mannopyranose |
GC7266 | 3,4,6-Tri-O-acetyl-1,2-O-isopropylidene-β-D-fructofuranose |
GC7811 | 3,4,6-Tri-O-acetyl-2-azido-2-deoxy-D-glucopyranosyl trichloroacetimidate |
GC7860 | 3,4,6-Tri-O-acetyl-2-azido-2-deoxy-β-D-glucopyranosyl trichloroacetimidate |
GC7798 | 3,4,6-Tri-O-acetyl-2-deoxy-2-fluoro-β-D-glucopyranosyl azide |
GC5681 | 3,4,6-Tri-O-acetyl-2-deoxy-2-fluoro-β-D-glucopyranosyl fluoride |
GC1208 | 3,4,6-Tri-O-acetyl-2-deoxy-2-phthalimido-D-glucopyranose |
GC1854 | 3,4,6-Tri-O-acetyl-2-deoxy-2-phthalimido-β-D-glucopyranose |
GC6922 | 3,4,6-Tri-O-acetyl-2-deoxy-2-phthalimido-β-D-glucopyranosyl trichloroacetimidate |
GC1068 | 3,4,6-Tri-O-acetyl-2-O-trifluoromethanesulfonyl-β-D-mannopyranosyl azide |
GC6886 | 3,4,6-Tri-O-acetyl-D-galactal |
GC8639 | 3,4,6-Tri-O-acetyl-β-D-mannopyranose 1,2-(methyl orthoacetate) |
GC5169 | 3,4,6-Tri-O-benzyl-b-D-mannopyranose 1,2-(methyl orthoacetate) |
GC2644 | 3,4,6-Tri-O-tert-butyldimethylsilyl-1,2-O-isopropylidene-β-D-fructofuranose |
GC5145 | 3,4:5,6-Di-O-isopropylidene-D-glucitol |
GC3320 | 3,4'',5-Trihydroxystilbene-3-b-D-glucopyranoside |
GC1075 | 3,5-Di-O-benzoyl-1,2-O-isopropylidene-α-D-ribofuranose |
GC4112 | 3,5-Di-O-benzoyl-2-deoxy-2-fluoro-α-D-arabinofuranosyl bromide |
GW3782 | 3,5-Di-tert-butylbenzaldehyde |
GL2424 | 3,5-Dicaffeoylquinic acid |
GK1672 | 3,5-Dichloro-2-hydroxybenzenesulfonic acid sodium salt |
GW7251 | 3,5-Difluoro-2,4-dihydroxybenzaldehyde |
GK8169 | 3,5-Dimethoxybenzaldehyde |
GK1802 | 3,5-Dimethoxyphenylacetic acid |
GW8849 | 3,5-Dimethyl-NAPQI |
GK2398 | 3,5-Dimethylpyrazole |
GT6720 | 3,5-Dinitrosalicylic acid |
GC9650 | 3,5-O-Benzylidene-1,2-O-isopropylidene-6-O-propargyl-α-D-glucofuranose |
GC4984 | 3,5-O-Benzylidene-1,2-O-isopropylidene-α-D-glucofuranose |
GC0247 | 3,5,6-Tri-O-benzoyl-1,2-O-isopropylidene-α-D-glucofuranose |
GC6678 | 3,5,6-Trichloro-2-pyridinol b-D-glucuronide |
GC7226 | 3,6-Di-O-(carboxymethyl)-D-glucose |
GC3769 | 3,6-Di-O-acetyl-2-azido-2-deoxy-α-D-glucopyranose |
GC3689 | 3,6-Di-O-benzoyl-D-galactal |
GC4699 | 3,6-Di-O-benzoyl-D-glucal |
GC1099 | 3,6-Di-O-benzyl-D-glucal |
GT4417 | 3,6-Dichloro-1,2-benzenedithiol |
GW4063 | 3,6-Dichlorotrimellitic acid |
GK3538 | 3,7-Dimethyl-1,6-octadien-3-yl acetate |
GK7393 | 3,8-Diamino-6-phenylphenanthridine |
GC6091 | 3,u200b6-u200bAnhydro-u200bD-u200bglucose |
GN2140 | 3''-Azido-3''-deoxythymidine |
GX9281 | 3''-Chloropropiophenone |
GW2740 | 3''-O-Methylfluorescein |
GN3227 | 3''-O-Methylguanosine |
GT9232 | 3'',3'''',5'',5''''-Tetrabromophenolphthalein ethyl ester potassium salt |
GK4078 | 3'',5-Dimethoxy-4''-hydroxyacetophenone |
GW1351 | 4-((4-(Dimethylamino)phenyl)azo)benzoic acid N-succinimidyl ester |
GK6761 | 4-(3-(4-Iodophenyl)-2-(2,4-dinitrophenyl)-2H-5-tetrazolio)-1,3-benzene |
GT9017 | 4-(4-Nitrophenylazo)resorcinol |
GX6763 | 4-(4,6-Dimethoxy-1,3,5-triazin-2-yl)-4-methylmorpholinium chloride |
GW7938 | 4-(6-Methylbenzothiazol-2-yl)-aniline |
GM6072 | 4-(Aminomethyl)benzoic acid |
GP9986 | 4-(Benzyloxy)phenol |
GX5018 | 4-(Bromomethyl)benzoic acid |
GW6268 | 4-(Bromomethyl)phenyl isothiocyanate |
GT3284 | 4-(Dimethylamino)benzaldehyde |
GT3524 | 4-(Dimethylamino)benzaldehyde, 98% |
GT5394 | 4-(Dimethylamino)cinnamaldehyde |
GX9847 | 4-(Imidazol-1-yl)phenol |
GW9250 | 4-(N,N-Diethylaminomethyl)-7-methoxy-coumarin |
GW6432 | 4-(N,N-Diethylaminomethyl)-7-propoxycoumarin |
GW0297 | 4-(N,N-Dimethylaminomethyl)-7-propoxycoumarin |
GW0017 | 4-(Trifluoroacetyl)benzoyl chloride |
GK7826 | 4-(Trifluoromethyl)phenyl isothiocyanate |
GW9595 | 4-(Trifluoromethyl)umbelliferyl phosphate |
GC8144 | 4-(Trifluoromethyl)umbelliferyl-b-D-cellotrioside |
GW9237 | 4-[4''-(2''-Methyl)thiazolyl]phenol |
GC3246 | 4-Acetamido-4-deoxy-D-glucopyranose |
GW7710 | 4-Acetamido-5-nitrophthalic anhydride |
GM0898 | 4-Acetamidobenzoic acid |
GK4314 | 4-Acetamidophenol |
GW2107 | 4-Acetoxystyrene (Stabilized with MEHQ) |
GK6464 | 4-Allylanisole |
GK9259 | 4-Amino-2-chlorophenol |
GW5931 | 4-Amino-3-hydroxy-1-naphthalenesulfonic acid |
GW5511 | 4-Amino-3-hydroxy-1-naphthalenesulfonic acid, ACS grade |
GK1140 | 4-Amino-3-nitrobenzotrifluoride |
GT6946 | 4-Amino-5-hydroxy-2,7-naphthalenedisulfonic acid monosodium salt hydrate |
GK3497 | 4-Aminoantipyrine |
GL6173 | 4-Aminoazobenzene |
GM6679 | 4-Aminobenzoic acid |
GM2145 | 4-Aminobenzoic acid, USP grade |
GK0362 | 4-Aminobutyric acid |
GK8970 | 4-Aminophenol |
GL2746 | 4-Aminophenol hydrochloride |
GC1550 | 4-Aminophenyl 3,6-di-O-(α-D-mannopyranosyl)-α-D-mannopyranoside |
GC3719 | 4-Aminophenyl b-D-lactopyranoside |
GC6601 | 4-Aminophenyl b-D-thiogalactopyranoside |
GC5729 | 4-Aminophenyl b-D-thioglucopyranoside |
GC0512 | 4-Aminophenyl b-L-fucopyranoside |
GX5844 | 4-Aminophenyl disulfide |
GC3242 | 4-Aminophenyl α-D-mannopyranoside |
GC0889 | 4-Aminophenyl β-D-xylopyranoside |
GK6823 | 4-Aminophenylboronic acid hydrochloride |
GL6836 | 4-Aminophenylphosphate sodium salt |
GT7777 | 4-Aminophthalonitrile |
GM8827 | 4-Aminosalicylic acid |
GK1726 | 4-Aminothiophenol |
GC0898 | 4-Azido-4-deoxy-D-galactose |
GC9076 | 4-Azido-4-deoxy-D-glucose |
GW9407 | 4-Azido-4-nitro-2,1,3-benzoxadiazole |
GW6973 | 4-Benzylamino-7-nitrobenzofurazan |
GK8159 | 4-Biphenylacetic acid |
GW4949 | 4-Bromo-1,8-naphthalic anhydride |
GE8435 | 4-Bromo-2-(trifluoromethyl)benzenol |
GK7136 | 4-Bromo-2-fluoroaniline |
GK8323 | 4-Bromobenzaldehyde |
GW4304 | 4-Bromobenzenediazonium tetrafluoroborate |
GK4692 | 4-Bromobiphenyl |
GT0455 | 4-Bromomethyl-7-methoxycoumarin |
GK1485 | 4-Carboxybenzaldehyde |
GE8221 | 4-Chloro-1-naphthol |
GW4182 | 4-Chloro-2,1,3-benzoxadiazole |
GK6955 | 4-Chloro-3-fluorobenzaldehyde |
GK3346 | 4-Chloro-3-methylphenol |
GK8861 | 4-Chloro-3-methylphenol, BP, EP grade |
GK9303 | 4-Chloro-3-methylphenol, BP, Ph. Eur., USP grade |
GK4354 | 4-Chloro-4''-hydroxybenzophenone |
GK5353 | 4-Chloroaniline |
GK2625 | 4-Chlorobenzophenone |
GW0503 | 4-Chloromethylbenzonitrile |
GK7849 | 4-Chlorophenol |
GL2685 | 4-Cumylphenol |
GK5664 | 4-Cyanobenzaldehyde |
GC6964 | 4-Cyclohexylbutyl β-D-glucopyranoside |
GC7335 | 4-Deoxy-4-fluoro-D-galactose |
GC9628 | 4-Deoxy-4-fluoro-D-glucopyranose |
GC6508 | 4-Deoxy-4-fluoro-D-mannose |
GX8186 | 4-Deoxypyridoxine hydrochloride |
GW1929 | 4-Di-2-ASP |
GE4595 | 4-Dimethylaminopyridine |
GX2537 | 4-Ethoxy-3-methoxybenzaldehyde |
GW9969 | 4-Fluoro-2,1,3-benzoxadiazol |
GK3478 | 4-Fluorobenzoyl chloride |
GK7183 | 4-Fluorophenacyl bromide |
GK2089 | 4-Fluorophenol |
GW9408 | 4-Fluororesorcinol |
GC4513 | 4-Formylphenyl b-D-allopyranoside |
GK1506 | 4-Formylphenylboronic acid |
GK9325 | 4-Hexylresorcinol |
GW2291 | 4-Hydrazino-7-nitro-2,1,3-benzoxadiazol |
GE0239 | 4-Hydroxy TEMPO, free radical |
GK7543 | 4-Hydroxybenzaldehyde |
GX4620 | 4-Hydroxybenzoic acid |
GK8868 | 4-Hydroxybiphenyl |
GK1602 | 4-Hydroxycinnamic acid |
GL1043 | 4-Hydroxyestradiol |
GP1978 | 4-Hydroxyindole |
GK5318 | 4-Hydroxyisophthalic acid |
GL4484 | 4-Hydroxymephenytoin |
GK3530 | 4-Hydroxymethyl-4-methyl-1-phenyl-3-pyrazolidone |
GA3752 | 4-Hydroxytamoxifen |
GL7772 | 4-Hydroxytolbutamide |
GK0166 | 4-Imidazoleacetic acid hydrochloride |
GK2009 | 4-Isopropylbenzoic acid |
GC1132 | 4-Isothiocyanatophenyl 6-O-[(di-O-tert-butyl)phosphoryl]-α-D-mannopyranoside |
GC6661 | 4-Isothiocyanatophenyl α-D-galactopyranoside |
GW9881 | 4-Methoxy-7-nitro-2,1,3-benzoxadiazole |
GK5518 | 4-Methoxyphenol |
GC3394 | 4-Methoxyphenyl 2,2'',3,3'',4'',6,6''-hepta-O-acetyl-β-D-maltoside |
GC4670 | 4-Methoxyphenyl 2,3-di-O-acetyl-4,6-O-benzylidene-β-D-galactopyranoside |
GC5063 | 4-Methoxyphenyl 2,3-di-O-benzyl-4,6-O-benzylidene-β-D-glucopyranoside |
GC9837 | 4-Methoxyphenyl 2,3,4-tri-O-benzyl-β-D-glucopyranoside |
GC7500 | 4-Methoxyphenyl 2,3,4,6-tetra-O-acetyl-b-D-galactopyranoside |
GC6291 | 4-Methoxyphenyl 2,3,4,6-tetra-O-acetyl-b-D-glucopyranoside |
GC3377 | 4-Methoxyphenyl 2,3,6-tri-O-acetyl-β-D-galactopyranoside |
GC4045 | 4-Methoxyphenyl 2,3,6-tri-O-acetyl-β-D-glucopyranoside |
GC2277 | 4-Methoxyphenyl 2,3,6-tri-O-benzoyl-β-D-glucopyranoside |
GC8189 | 4-Methoxyphenyl 2,4,6-tri-O-acetyl-3-O-allyl-β-D-galactopyranoside |
GC5303 | 4-Methoxyphenyl 2,4,6-tri-O-acetyl-3-O-benzyl-α-D-glucopyranoside |
GC6302 | 4-Methoxyphenyl 2,4,6-tri-O-benzyl-b-D-galactopyranoside |
GC7468 | 4-Methoxyphenyl 2,6-di-O-acetyl-3,4-O-isopropylidene-β-D-galactopyranoside |
GC5211 | 4-Methoxyphenyl 2,6-di-O-acetyl-β-D-galactopyranoside |
GC9269 | 4-Methoxyphenyl 2,6-di-O-benzyl-b-D-galactopyranoside |
GC0539 | 4-Methoxyphenyl 3-O-allyl-2,4,6-tri-O-benzyl-β-D-galactopyranoside |
GC8202 | 4-Methoxyphenyl 3-O-allyl-b-D-galactopyranoside |
GC8943 | 4-Methoxyphenyl 3,4-O-isopropylidene-b-D-galactopyranoside |
GC9881 | 4-Methoxyphenyl 4,6-O-benzylidene-β-D-galactopyranoside |
GC5591 | 4-Methoxyphenyl 4,6-O-benzylidene-β-D-glucopyranoside |
GC7760 | 4-Methoxyphenyl 6-O-tert-butyldiphenylsilyl-3,4-O-isopropylidene-β-D-galactopyranoside |
GC0428 | 4-Methoxyphenyl b-D-galactopyranoside |
GC5744 | 4-Methoxyphenyl b-D-glucopyranoside |
GK6323 | 4-Methyl-2-pentanone |
GK6220 | 4-Methyl-3-nitroaniline |
GK4728 | 4-Methylaminophenol sulfate |
GK8875 | 4-Methylbenzenesulfinic acid sodium salt |
GC6564 | 4-Methylphenyl 1-thio-6-O-tosyl-β-D-glucopyranoside |
GC3283 | 4-Methylphenyl 1-thio-α-D-mannopyranoside |
GC4423 | 4-Methylphenyl 1-thio-β-D-glucopyranosiduronic acid |
GC7577 | 4-Methylphenyl 1-thio-β-D-glucopyranosiduronic acid sodium salt |
GC7237 | 4-Methylphenyl 1-thio-β-D-xylopyranoside |
GC0904 | 4-Methylphenyl 2-O-acetyl-3-O-benzyl-1-thio-β-D-glucopyranoside |
GC6048 | 4-Methylphenyl 2-O-acetyl-3-O-benzyl-4,6-O-benzylidene-1-thio-β-D-galactopyranoside |
GC9074 | 4-Methylphenyl 2-O-benzyl-1-thio-β-D-galactopyranoside |
GC0088 | 4-Methylphenyl 2,2'',3,3'',4'',6,6''-hepta-O-acetyl-1-thio-β-D-maltoside |
GC4879 | 4-Methylphenyl 2,3-di-O-acetyl-1-thio-D-glucopyranosiduronic acid methyl ester |
GC7497 | 4-Methylphenyl 2,3-di-O-acetyl-1-thio-β-D-glucopyranoside |
GC3415 | 4-Methylphenyl 2,3-di-O-acetyl-4,6-O-benzylidene-1-thio-β-D-galactopyranoside |
GC7154 | 4-Methylphenyl 2,3-di-O-acetyl-4,6-O-benzylidene-1-thio-β-D-glucopyranoside |
GC3490 | 4-Methylphenyl 2,3-di-O-acetyl-4,6-O-isopropylidene-1-thio-β-D-glucopyranoside |
GC5892 | 4-Methylphenyl 2,3-di-O-benzoyl-4,6-O-benzylidene-1-thio-β-D-glucopyranoside |
GC0429 | 4-Methylphenyl 2,3-di-O-benzyl-1-thio-α-D-mannopyranoside |
GC6736 | 4-Methylphenyl 2,3-di-O-benzyl-1-thio-β-D-glucopyranoside |
GC5500 | 4-Methylphenyl 2,3-di-O-benzyl-4,6-O-benzylidene-1-thio-α-D-mannopyranoside |
GC1691 | 4-Methylphenyl 2,3-di-O-benzyl-4,6-O-benzylidene-1-thio-β-D-glucopyranoside |
GC8918 | 4-Methylphenyl 2,3-O-isopropylidene-1-thio-α-L-rhamnopyranoside |
GC3603 | 4-Methylphenyl 2,3,4-tri-O-acetyl-1-thio-α-L-fucopyranoside |
GC9943 | 4-Methylphenyl 2,3,4-tri-O-acetyl-1-thio-α-L-rhamnopyranoside |
GC4788 | 4-Methylphenyl 2,3,4-tri-O-acetyl-1-thio-β-D-glucopyranosiduronic acid methyl ester |
GC5737 | 4-Methylphenyl 2,3,4-tri-O-acetyl-1-thio-β-D-xylopyranoside |
GC9917 | 4-Methylphenyl 2,3,4-tri-O-acetyl-1-thio-β-L-fucopyranoside |
GC9915 | 4-Methylphenyl 2,3,4-tri-O-acetyl-6-O-tert-butyldiphenylsilyl-1-thio-β-D-glucopyranoside |
GC8690 | 4-Methylphenyl 2,3,4-tri-O-allyl-1-thio-β-D-xylopyranoside |
GC4332 | 4-Methylphenyl 2,3,4-tri-O-benzyl-1-thio-β-D-glucopyranoside |
GC4119 | 4-Methylphenyl 2,3,4-tri-O-benzyl-1-thio-β-D-glucopyranosiduronic acid |
GC0500 | 4-Methylphenyl 2,3,4-tri-O-benzyl-1-thio-β-D-xylopyranoside |
GC7908 | 4-Methylphenyl 2,3,4-tri-O-benzyl-1-thio-β-L-fucopyranoside |
GC5024 | 4-Methylphenyl 2,3,4,6-tetra-O-acetyl-1-thio-α-D-mannopyranoside |
GC9493 | 4-Methylphenyl 2,3,4,6-tetra-O-acetyl-1-thio-β-D-glucopyranoside-1,2,3,4,5,6-13C6 |
GC2857 | 4-Methylphenyl 2,3,4,6-tetra-O-acetyl-b-D-thiogalactopyranoside |
GC5807 | 4-Methylphenyl 2,3,4,6-tetra-O-acetyl-b-D-thioglucopyranoside |
GC3037 | 4-Methylphenyl 2,3,4,6-tetra-O-benzyl-1-thio-β-D-galactopyranoside |
GC5938 | 4-Methylphenyl 2,3,6-tri-O-acetyl-1-thio-β-D-glucopyranoside |
GC0498 | 4-Methylphenyl 2,4-di-O-acetyl-1-thio-β-D-glucopyranosylurono-6,3-lactone |
GC2275 | 4-Methylphenyl 2,4-di-O-acetyl-3-O-benzyl-1-thio-β-D-glucopyranosiduronic acid methyl ester |
GC5490 | 4-Methylphenyl 2,4,6-tri-O-acetyl-1-thio-β-D-galactopyranoside |
GC1791 | 4-Methylphenyl 2,4,6-tri-O-acetyl-3-O-benzyl-1-thio-β-D-glucopyranoside |
GC9156 | 4-Methylphenyl 3-O-benzoyl-4,6-O-benzylidene-1-thio-α-D-mannopyranoside |
GC9328 | 4-Methylphenyl 3-O-benzyl-4,6-O-benzylidene-1-thio-β-D-galactopyranoside |
GC7960 | 4-Methylphenyl 3,4,6-tri-O-acetyl-2-O-benzyl-1-thio-β-D-galactopyranoside |
GC0536 | 4-Methylphenyl 4-O-benzyl-1-thio-α-L-rhamnopyranoside |
GC2287 | 4-Methylphenyl 4,6-O-benzylidene-1-thio-α-D-mannopyranoside |
GC0654 | 4-Methylphenyl 4,6-O-benzylidene-b-D-thioglucopyranoside |
GC5071 | 4-Methylphenyl 4,6-O-Benzylidene-β-D-thiogalactopyranoside |
GC4505 | 4-Methylphenyl 4,6-O-isopropylidene-1-thio-β-D-glucopyranoside |
GC4801 | 4-Methylphenyl 6-O-acetyl-2,3-di-O-benzyl-1-thio-β-D-glucopyranoside |
GC4274 | 4-Methylphenyl 6-O-acetyl-2,3,4-tri-O-benzyl-1-thio-D-glucopyranoside |
GC0990 | 4-Methylphenyl 6-O-acetyl-2,3,4-tri-O-benzyl-1-thio-α-D-glucopyranoside |
GC0402 | 4-Methylphenyl b-D-thioglucopyranoside |
GC6589 | 4-Methylphenylthio-β-D-galactopyranoside |
GE8143 | 4-Methylumbelliferone |
GC7128 | 4-Methylumbelliferyl 2-acetamido-2-deoxy-b-D-glucopyranoside |
GC6703 | 4-Methylumbelliferyl 3-O-α-D-xylopyranosyl-β-D-glucopyranoside |
GC5401 | 4-Methylumbelliferyl a-D-galactopyranoside |
GC1434 | 4-Methylumbelliferyl a-D-glucopyranoside |
GC3812 | 4-Methylumbelliferyl a-L-idopyranosiduronic acid |
GC5543 | 4-Methylumbelliferyl a-L-idopyranosiduronic acid sodium salt |
GC1749 | 4-Methylumbelliferyl acetate |
GC6773 | 4-Methylumbelliferyl b-D-cellobioside |
GC7534 | 4-Methylumbelliferyl b-D-cellohexoside |
GC6850 | 4-Methylumbelliferyl b-D-cellopentoside |
GC9821 | 4-Methylumbelliferyl b-D-cellotetroside |
GC7245 | 4-Methylumbelliferyl b-D-cellotrioside |
GC6034 | 4-Methylumbelliferyl b-D-galactopyranoside |
GC0596 | 4-Methylumbelliferyl b-D-glucopyranoside |
GC5027 | 4-Methylumbelliferyl b-D-glucuronide hydrate |
GC0151 | 4-Methylumbelliferyl b-D-glucuronide trihydrate |
GW3653 | 4-Methylumbelliferyl beta-D-glucuronide dihydrate |
GC0011 | 4-Methylumbelliferyl butyrate |
GC0745 | 4-Methylumbelliferyl caprylate |
GW1688 | 4-Methylumbelliferyl heptanoate |
GE8516 | 4-Methylumbelliferyl nonanoate |
GC3615 | 4-Methylumbelliferyl oleate |
GC1583 | 4-Methylumbelliferyl phosphate |
GC5745 | 4-Methylumbelliferyl phosphate disodium salt |
GC5001 | 4-Methylumbelliferyl sulfate potassium salt |
GC6550 | 4-Methylumbelliferyl α-L-rhamnopyranoside |
GC7144 | 4-Methyphenyl 4,7,8,9-tetra-O-acetyl-2-thio-β-N-acetylneuraminic acid methyl ester |
GK3210 | 4-Nitrobenzaldehyde |
GK5397 | 4-Nitrobenzoic acid |
GK7618 | 4-Nitrobenzyl chloroformate |
GE4873 | 4-Nitroimidazole |
GK3547 | 4-Nitrophenol |
GC5753 | 4-Nitrophenoxycarbonyl 2,3,4-tri-O-acetyl-β-D-glucopyranuronic acid methyl ester |
GC9252 | 4-Nitrophenoxycarbonyl 2,3,4-tri-O-benzyl-β-D-glucopyranuronic acid benzyl ester |
GC1726 | 4-Nitrophenyl 2-acetamido-2-deoxy-3-O-(b-D-galactopyranosyl)-b-D-glucopyranoside |
GC8698 | 4-Nitrophenyl 2-acetamido-2-deoxy-b-D-glucopyranoside |
GC9827 | 4-Nitrophenyl 2,3,4-tri-O-acetyl-β-L-fucopyranoside |
GC8979 | 4-Nitrophenyl 2,3,4,6-Tri-O-acetyl-α-D-mannopyranoside |
GC1104 | 4-Nitrophenyl 2,4-di-O-acetyl-3-O-allyl-6-O-trityl-α-D-mannopyranoside |
GC6978 | 4-Nitrophenyl 3,6-di-O-(α-D-mannopyranosyl)-α-D-mannopyranoside |
GC5779 | 4-Nitrophenyl 6-O-diphenylphosphoryl-α-D-mannopyranoside |
GC8292 | 4-Nitrophenyl a-D-galactopyranoside |
GC9732 | 4-Nitrophenyl a-D-glucopyranoside |
GC4497 | 4-Nitrophenyl a-L-fucopyranoside |
GC1109 | 4-Nitrophenyl b-D-cellobioside |
GC3225 | 4-Nitrophenyl b-D-galactopyranoside |
GC1754 | 4-Nitrophenyl b-D-glucopyranoside |
GC6761 | 4-Nitrophenyl b-D-glucuronide |
GC2716 | 4-Nitrophenyl b-D-thioglucopyranoside |
GC8126 | 4-Nitrophenyl b-D-xylopyranoside |
GC2204 | 4-Nitrophenyl b-L-fucopyranoside |
GC0487 | 4-Nitrophenyl hepta-O-acetyl-b-lactoside |
GK3996 | 4-Nitrophenyl palmitate |
GX6852 | 4-Nitrophenyl phosphate |
GC6147 | 4-Nitrophenyl phosphate bis(tris(hydroxymethyl)amino methane) |
GC2733 | 4-Nitrophenyl phosphate disodium salt hexahydrate |
GC1051 | 4-Nitrophenyl α-D-mannopyranoside |
GC0414 | 4-Nitrophenyl β-D-lactopyranoside |
GK7452 | 4-Nitrophthalic anhydride |
GT7803 | 4-Nitrophthalonitrile |
GC7889 | 4-O-(6-Azido-6-deoxy-β-D-glucopyranosyl)-D-glucose |
GL8371 | 4-O-Caffeoylquinic acid |
GC0892 | 4-O-Methyl-D-glucose |
GC4328 | 4-O-Methyl-D-glucuronic acid |
GC8905 | 4-O-α-D-Galactopyranosyl-D-glucose |
GC4091 | 4-O-α-D-Galactopyranosyl-D-sucrose |
GC5625 | 4-O-β-D-Galactopyranosyl-D-sucrose |
GT4901 | 4-Phenylazomaleinanil |
GN0818 | 4-Thiothymidine |
GN6085 | 4-Thiouridine |
GW4968 | 4-trans-Hydroxyglibenclamide |
GW3023 | 4,4''-Bis(bromomethyl)biphenyl |
GX2406 | 4,4''-Bis(diethylamino)benzophenone |
GK4774 | 4,4''-Dihydroxybenzophenone |
GL5989 | 4,4''-Dihydroxybiphenyl |
GE3209 | 4,4''-Dimethoxytritylchloride |
GK1576 | 4,4''-Dimethyl-2,2''-dipyridyl |
GW9195 | 4,4′-Diazido-2,2′-stilbenedisulfonic acid disodium salt tetrahydrate |
GY3789 | 4,5-Dicaffeoylquinic acid |
GT3175 | 4,5-Methylenedioxy-1,2-phenylenediamine dihydrochloride |
GK1943 | 4,6-Dihydroxy-2-methylpyrimidine |
GC9369 | 4,6-O-Benzylidene-D-maltose |
GW8878 | 4''-Diethylamino-3-hydroxyflavone |
GL1668 | 4''-Hydroxydiclofenac |
GK6743 | 4''-Isobutylacetophenone |
GK6399 | 4''-Methoxyacetophenone |
GT2414 | 4'',6-Diamidino-2-phenylindole dihydrochloride |
GL2665 | 4alpha-Phorbol 12-myristate 13-acetate |
GK9754 | 5-(4-Dimethylaminobenzylidene)rhodanine |
GN2626 | 5-(E)-(2-Bromovinyl)-2''-deoxyuridine |
GW7259 | 5-[(4-Propyloxyphenyl)methylene] 2,4-thiazolidinedione |
GC6856 | 5-Acetamidofluorescein-di-(b-D-galactopyranoside) |
GC1250 | 5-Aldo-1,2-O-isopropylidene-a-D-xylofuranose |
GW5733 | 5-Amino TAMRA |
GK3683 | 5-Amino-1(H)-tetrazole hydrate |
GE8160 | 5-Amino-2,3-dihydro-1,4- phthalazinedione sodium salt (Sodium Luminol) |
GW4015 | 5-Aminoeosin |
GW7444 | 5-Aminofluorescein diacetate |
GM8475 | 5-Aminolevulinic acid hydrochloride |
GK4042 | 5-Aminonicotinic acid |
GM5644 | 5-Aminosalicylic acid |
GP1241 | 5-Aza-2''-deoxycytidine |
GA4671 | 5-Azacytidine |
GE1043 | 5-Benzylthio-1H-tetrazole |
GE3595 | 5-Bromo-2''-deoxyuridine |
GC1105 | 5-Bromo-3-indolyl-b-D-galactopyranoside |
GC8338 | 5-Bromo-4-chloro-3-indolyl 2-acetamido-2-deoxy-b-D-glucopyranoside |
GC5824 | 5-Bromo-4-chloro-3-indolyl a-D-galactopyranoside |
GC1995 | 5-Bromo-4-chloro-3-indolyl a-D-glucopyranoside |
GE8805 | 5-Bromo-4-chloro-3-indolyl a-L-arabinopyranoside |
GC3237 | 5-Bromo-4-chloro-3-indolyl b-D-galactopyranoside |
GC5699 | 5-Bromo-4-chloro-3-indolyl b-D-glucopyranoside |
GC8906 | 5-Bromo-4-chloro-3-indolyl b-D-glucuronide cyclohexylammonium salt |
GC1526 | 5-Bromo-4-chloro-3-indolyl b-D-xylopyranoside |
GC2869 | 5-Bromo-4-chloro-3-indolyl phosphate disodium salt |
GC5463 | 5-Bromo-4-chloro-3-indolyl phosphate p-toluidine-salt |
GC7540 | 5-Bromo-4-chloro-3-indolyl β-D-cellotetraoside |
GC9954 | 5-Bromo-4-chloro-3-indolyl β-D-cellotrioside |
GA6057 | 5-Bromo-5-nitro-1,3-dioxane |
GC6247 | 5-Bromo-6-chloro-3-indolyl b-D-galactopyranoside |
GC6120 | 5-Bromo-6-chloro-3-indolyl b-D-glucuronide cyclohexylammonium salt |
GC4671 | 5-Bromo-6-chloro-3-indolyl phosphate p-toluidine salt |
GK6698 | 5-Bromonicotinic acid |
GN9949 | 5-Bromouridine |
GW5240 | 5-Carboxy-2'',7''-dichlorofluorescein DA |
GT3783 | 5-Carboxyfluorescein |
GL8762 | 5-Carboxyfluorescein diacetate |
GK4616 | 5-Carboxyfluorescein,succinimidyl ester |
GT5624 | 5-Carboxytetramethylrhodamine |
GW3686 | 5-CFDA ethanedioic-S-phenylmethyl ester |
GW3017 | 5-CFDA N-succinimidyl ester |
GK7497 | 5-Chloro-1-phenyltetrazole |
GK5171 | 5-Chloro-2-methyl-4-isothiazolin-3-one |
GK7391 | 5-Chloro-8-hydroxyquinoline |
GC7949 | 5-Chloro-8-hydroxyquinoline sulfate |
GC4825 | 5-Chloro-8-hydroxyquinoline β-D-glucuronide |
GC8838 | 5-Deoxy-1,2-O-isopropylidene-α-D-xylofuranose |
GC8954 | 5-Deoxy-5-iodo-1,2-O-isopropylidene-α-D-xylofuranose |
GE3047 | 5-Deoxy-D-ribose |
GC1634 | 5-Dodecanoylaminoflorescein di-b-D-galactopyranoside |
GW7056 | 5-Dodecanoylaminofluorescein |
GW5346 | 5-DTAF hydrochloride |
GE7013 | 5-Ethylthio-1(H)-tetrazole |
GW8985 | 5-FITC DA |
GE9614 | 5-Fluoro-2-methylbenzoic acid |
GP7931 | 5-Fluoro-5''-deoxyuridine |
GA6771 | 5-Fluorocytosine |
GK0555 | 5-Fluoroindole |
GK4345 | 5-Fluoroisatin |
GK4291 | 5-Fluoroorotic acid |
GP6168 | 5-Fluorouracil |
GW5609 | 5-Geranyloxy-7-methoxycoumarin |
GW8797 | 5-Hexadecanoylaminofluorescein |
GL5192 | 5-Hydroxy-2-methyl-4-chromanone |
GM9337 | 5-Hydroxy-L-tryptophan |
GW5578 | 5-Hydroxydiclofenac |
GW9123 | 5-Hydroxyferulic acid |
GN9819 | 5-Hydroxymethyl-2''-deoxycytidine |
GW0468 | 5-Hydroxymethylfluorescein diacetate |
GK9725 | 5-Hydroxynicotinic acid |
GP1769 | 5-Iodo-2''-deoxyuridine |
GW6174 | 5-Maleimido-eosin |
GK5733 | 5-Mercapto-1-methyltetrazole |
GW9728 | 5-Methoxy-2,3,3-trimethyl-1-(4-sulfobutyl)-indolium, inner salt |
GL5991 | 5-Methoxypsoralen |
GL4839 | 5-Methoxysterigmatocystin |
GX2343 | 5-Methoxyuracil |
GE5158 | 5-Methyl-2''-deoxycytidine |
GE4109 | 5-Methylcytidine |
GL1986 | 5-Methylmellein |
GK4297 | 5-Nitro-2-furaldehyde |
GK3255 | 5-Nitro-2-furaldehyde semicarbazone |
GK3359 | 5-Nitrosalicylaldehyde |
GW3720 | 5-Nonanol |
GC0465 | 5-O-Acetyl-4''-O-tert-butyldimethylsilyl-genistein |
GC2624 | 5-O-Benzyl-1,2-O-isopropylidene-α-D-glucofuranuronic acid, γ-lactone |
GW2330 | 5-ROX |
GK1236 | 5-Sulfosalicylic acid dihydrate |
GW5614 | 5-TAMRA N-succinimidyl ester |
GW0175 | 5,5''-Difluoro BAPTA-AM |
GK9458 | 5,5''-Dithio-bis(2-nitrobenzoic acid) |
GK3851 | 5,6-Dimethylbenzimidazole |
GA6096 | 5,7-Dichloro-8-hydroxy-2-methylquinoline |
GC7270 | 5,7-Dichloro-8-hydroxyquinoline sulfate, sodium salt |
GC5825 | 5,7-Dichloro-8-hydroxyquinoline β-D-glucuronide |
GW2645 | 5,7-Dihydroxytryptamine hydrobromide |
GX5299 | 5,7-Dinitro-8-quinolinol |
GN0695 | 5''-Amino-5''-deoxyadenosine |
GN5056 | 5''-Chloro-5''-deoxyadenosine |
GN1624 | 5''-Deoxyuridine |
GN3343 | 5''-DMT-2''-O-TBDMS-N2-acetyl-guanosine phosphoramidite |
GN5170 | 5''-Ethynyl-2''-deoxyuridine |
GW5634 | 5(6)-Amino-TAMRA |
GW3634 | 5(6)-Aminofluorescein (Mixture of isomers) |
GE4671 | 5(6)-Carboxyfluorescein |
GT5678 | 5(6)-Carboxyfluorescein diacetate N-succinimidyl ester |
GT9499 | 5(6)-Carboxyfluorescein N-hydroxysuccinimide ester |
GW3794 | 5(6)-CFDA |
GW3793 | 5(6)-FITC DA |
GW9624 | 5(6)-ROX |
GW4789 | 5(6)-ROX N-succinimidyl ester |
GW9780 | 5(6)-TAMRA |
GW0444 | 5(6)-TAMRA N-succinimidyl ester |
GX3697 | 5% Pd/C Degussa Type E 101 O/W (water wet) |
GX3445 | 5% Pd/C Degussa Type E 101 R/W (water wet) |
GX7836 | 5% Pd/C Degussa Type E 105 CA/W (water wet) |
GX3188 | 5% Pt/Al2O3 Degussa Type F 214 SP/D |
GX6125 | 5% Ru/C Degussa Type H 105 XBA/W (water wet) |
GW2839 | 6-(4-Acetamido-1,8-naphthalamido) hexanoic acid |
GL5650 | 6-(Dimethylamino)purine |
GW3669 | 6-(Fluorescein-5-carboxamido)hexanoic acid |
GW9800 | 6-(Fluorescein-5-carboxamido)hexanoic acid N-succinimidyl ester |
GW5042 | 6-(Fluorescein-5(6)-carboxamido)hexanoic acid |
GW4127 | 6-(Fluorescein-6-carboxamido)hexanoic acid |
GW1403 | 6-(Fluorescein-6-carboxamido)hexanoic acid N-succinimidyl ester |
GL5083 | 6-[4-(2-Piperidin-1-ylethoxy)phenyl]-3-pyridin-4-ylpyrazolo[1,5-a]pyrimidine |
GT7214 | 6-[Fluorescein-5(6)-carboxamido]hexanoic acid N-hydroxysuccinimide ester |
GW9877 | 6-Amino TAMRA |
GC4758 | 6-Amino-6-deoxy-D-glucopyranose, hydrochloride |
GL4478 | 6-Amino-8-trifluoromethylphenanthridine |
GX0537 | 6-Amino-D-luciferin |
GT0384 | 6-Aminofluorescein |
GM8394 | 6-Aminohexanoic acid |
GM9885 | 6-Aminohexanoic acid, USP grade |
GA3817 | 6-Aminopenicillanic acid |
GL4332 | 6-Aminophenanthridine |
GE4170 | 6-Aminoquinoline N-succinimidyl ester |
GW0943 | 6-Aminoseleno-D-luciferin |
GC6916 | 6-Azido-6-deoxy-1,2-O-isopropylidene-α-D-glucofuranose |
GC3605 | 6-Azido-6-deoxy-2,3-O-isopropylidene-α-L-sorbofuranose |
GC5096 | 6-Azido-6-deoxy-D-galactose |
GC7385 | 6-Azido-6-deoxy-D-glucopyranose |
GC0219 | 6-Azido-6-deoxy-β-D-glucopyranosylamine |
GC3815 | 6-Azido-L-fucose |
GE8289 | 6-Benzylaminopurine |
GX2922 | 6-Bromonicotinic acid |
GW0085 | 6-Carboxy-2'',7''-dichlorofluorescein DA |
GT3614 | 6-Carboxy-X-rhodamine |
GT6690 | 6-Carboxyfluorescein |
GK5482 | 6-Carboxyfluorescein diacetate |
GT3778 | 6-Carboxyfluorescein N-hydroxysuccinimide ester |
GT0256 | 6-Carboxytetramethylrhodamine |
GW2572 | 6-Chloro-2-methoxy-9-phenoxyacridine |
GC0743 | 6-Chloro-3-indolyl b-D-galactopyranoside |
GC3677 | 6-Chloro-3-indolyl b-D-glucopyranoside |
GN7678 | 6-Chloro-9-(b-D-ribofuranosyl)purine |
GK1105 | 6-Chloropurine |
GC8489 | 6-Deoxy-1,2:3,4-di-O-isopropylidene-6-iodo-a-D-galactopyranose |
GC7702 | 6-Deoxy-6-fluoro-D-galactopyranose |
GC9802 | 6-Deoxy-6-fluoro-D-lactose |
GC0781 | 6-Deoxy-6-iodo-D-glucopyranose |
GK7261 | 6-Deoxy-8-O-methylrabelomycin |
GC4641 | 6-Deoxy-D-glucose |
GL0816 | 6-ECDCA |
GL5586 | 6-Ethylmercaptopurine |
GW5145 | 6-FITC |
GW0761 | 6-FITC DA |
GC7639 | 6-Fluoro-L-fucose |
GW9265 | 6-HEX dipivaloate |
GL3045 | 6-Hydroxy-2,5,7,8-tetramethylchroman-2-carboxylic acid |
GX1011 | 6-Hydroxybenzothiazole-2-carbonitrile |
GW0392 | 6-IAF |
GY5625 | 6-Iodo Diosmin |
GT3645 | 6-JOE SE |
GW5580 | 6-Methoxy-N-(3-sulfopropyl)quinolinium |
GK0812 | 6-Methoxyquinoline |
GC4415 | 6-O-(2-Acetamido-2-deoxy-β-D-glucopyranosyl)-D-galactose |
GC4163 | 6-O-(Carboxymethyl)-D-glucose |
GC1190 | 6-O-(E)-Feruloyl-D-glucose |
GC4494 | 6-O-Acetyl-2-azido-3,4-di-O-benzyl-2-deoxy-D-glucopyranose |
GC6687 | 6-O-Acetyl-D-glucopyranose |
GC5322 | 6-O-b-D-Galactopyranosyl-D-glucopyranose |
GC9405 | 6-O-Benzoyl-3-O-benzyl-1,2-O-isopropylidene-5-O-mesyl-α-D-glucofuranose |
GC3271 | 6-O-beta-D-Galactopyranosyl-D-galactose |
GC5599 | 6-O-Methyl-D-glucose |
GV2243 | 6-O-Palmitoyl-L-ascorbic acid |
GC3025 | 6-O-Propargyl-D-glucose |
GC4702 | 6-O-Tosyl-β-D-glucopyranosyl azide |
GC3835 | 6-O-Trityl-D-galactopyranose |
GC0998 | 6-O-Trityl-D-glucose |
GC1417 | 6-O-Trityl-D-mannopyranose |
GC6442 | 6-O-α-D-Galactopyranosyl-D-galactopyranose |
GC5909 | 6-Phosphogluconic acid trisodium salt |
GK3084 | 6-Propyl-2-thiouracil |
GY8937 | 6-Shogaol |
GW0891 | 6-TAMRA N-succinimidyl ester |
GW4639 | 6-TET dipivaloate |
GP0033 | 6-Thioguanine |
GW5465 | 6-TRITC |
GX9409 | 6,13-Di(ethoxycarbonyl)-7,12-dimethyldibenzo[b,i]-1,4,8,11-tetraaza[14]-annulenato(2-)cobalt(II); 99+% |
GC2126 | 6,6''-Diazido-6,6''-dideoxy-α,α-D-trehalose |
GC0817 | 6,6''-Diazido-6,6''-dideoxy-α,α-D-trehalose hexaacetate |
GW4567 | 6,7-Diethoxy-4-(trifluoromethyl) coumarin |
GW3873 | 6,7-Diethoxy-4-methylcoumarin |
GW9414 | 6,7-Dihydroxy-4-coumarinylacetic acid |
GW2028 | 6,7-Dimethoxy-4-(trifluoromethyl) coumarin |
GW6907 | 6,7-Dimethoxy-4-coumarinylacetic acid |
GC9598 | 6,8-Difluoro-4-methylumbelliferyl β-D-cellotrioside |
GC9951 | 6,8-Difluoro-4-methylumbelliferyl β-D-glucuronide |
GC0090 | 6,8-Difluoro-4-methylumbelliferyl-b-D-glucopyranoside |
GW9110 | 6,8-Difluoro-7-ethoxy-4-methylcoumarin |
GW1517 | 6,8-Difluoro-7-hydroxy-2-oxo-2H-1-benzopyran-3-carboxylic acid |
GW5785 | 6,8-Difluoro-7-hydroxy-4-methylcumarin |
GC6734 | 6''-Deoxy-6''-iodo-β-D-cellobiose |
GC6827 | 6''''-O-(α-D-Galactopyranosyl)-D-maltotriose |
GC7743 | 6''''-O-(α-D-Glucopyranosyl)-D-maltotriose |
GC5806 | 6''''-O-Acetyldaidzin |
GC7592 | 6''''-O-Acetylgenistin |
GC5251 | 6''''-O-Malonyldaidzin |
GC3342 | 6''''-O-Malonylgenistin |
GC3367 | 6α-Mannobiose octaacetate |
GC7777 | 6β-Naltrexol-1,2,5,6,7,7-d6 |
GW0193 | 7-(2-Oxiranylethoxy)-2H-1-benzopyran-2-one |
GW2024 | 7-(Diethylamino)-3-(imidazol-1-ylcarbonyl)-1-benzopyran-2-one |
GT7462 | 7-(Diethylamino)-3-phenylcoumarin |
GW5613 | 7-(Diethylamino)coumarin-3-carbohydrazide |
GT5363 | 7-(Dimethylamino)-4-methylcoumarin |
GT7967 | 7-(p-Methoxybenzylamino)-4-nitrobenz-2-oxa-1,3-diazole |
GW3070 | 7-[(2-Oxocyclopentyl)oxy]-2H-1-benzopyran-2-one |
GN8466 | 7-Allyl-7,8-dihydro-8-oxoguanosine |
GT4475 | 7-Amino-4-methylcoumarin |
GW3701 | 7-Amino-4-nitro-2,1,3-benzoxadiazole |
GT0896 | 7-Amino-4-trifluoromethylcoumarin |
GA3296 | 7-Aminoactinomycin D |
GA9837 | 7-Aminodesacetoxycephalosporanic acid |
GK7272 | 7-Azaindole |
GL6932 | 7-Azido-4-methylcoumarin |
GK8132 | 7-Benzyloxy-4-trifluoromethylcoumarin |
GK0634 | 7-Benzyloxyquinoline |
GL3845 | 7-beta-Hydroxycholesterol |
GL8522 | 7-Dehydrocholesterol |
GT9922 | 7-Diethylamino-3-(4-maleimidophenyl)-4-methylcoumarin |
GW0385 | 7-Diethylamino-3-[N-(4-maleimidoethyl)carbamoyl]coumarin |
GW2688 | 7-Diethylamino-3-[N-(4-maleimidopropyl)carbamoyl]coumarin |
GT1222 | 7-Diethylamino-4-methylcoumarin |
GW8483 | 7-Diethylaminocoumarin-3-carboxylic acid |
GW9735 | 7-Diethylaminocoumarin-3-carboxylic acid ethyl ester |
GW0529 | 7-Diethylaminocoumarin-3-carboxylic acid N-succinimidyl ester |
GW2126 | 7-Diethylaminocoumarin-3,4-dicarboxylic acid |
GW8372 | 7-Ethoxy-4-methylcoumarin |
GW8855 | 7-Ethoxy-4-trifluoromethylcoumarin |
GP6652 | 7-Ethyl-10-hydroxycamptothecin |
GX5733 | 7-Fluoroisatin |
GK3240 | 7-Hydroxy-1-tetralone |
GE5358 | 7-Hydroxy-4-aminomethylcoumarin |
GW7328 | 7-Hydroxy-4-methyl-2(1H)-quinolone |
GT6413 | 7-Hydroxycoumarin-3-carboxylic acid |
GK2679 | 7-Hydroxycoumarin-4-acetic acid |
GW0885 | 7-Methoxy-4-(trifluoromethyl)coumarin |
GE1869 | 7-Methoxy-4-aminomethylcoumarin |
GW6921 | 7-Methoxy-4-methylcoumarin |
GW7439 | 7-Methoxycoumarin-3-carbonyl azide |
GW4028 | 7-Methoxycoumarin-3-carboxylic acid |
GW7575 | 7-Methoxycoumarin-3-carboxylic acid N-succinimidyl ester |
GK6412 | 7-Methoxycoumarin-4-acetic acid |
GT4414 | 7-Methoxycoumarin-4-acetic Acid N-Succinimidyl Ester |
GW0899 | 7-Methylguanine |
GW3952 | 7beta-Hydroxy-cholesteryl-bishemisuccinate-diethanolamine salt |
GL0006 | 7BIO |
GW6816 | 8-Acetoxypyrene-1,3,6-trisulfonic acid trisodium salt |
GW9424 | 8-Amino-2-naphthol |
GK7810 | 8-Aminonaphthalene-1,6-disulfonic acid |
GT2378 | 8-Anilino-1-naphthalenesulfonic acid |
GN5443 | 8-Bromoguanosine 3'',5''-cyclic monophosphate sodium salt |
GW8980 | 8-Butyryloxy-pyren-1,3,6-trisulfonic acid |
GK4030 | 8-Chlorotheophylline |
GY5383 | 8-Geranopsoralen |
GK6104 | 8-Hydroxy-1,3,6-pyrenetrisulfonic acid, trisodium salt |
GK4132 | 8-Hydroxy-5-nitroquinoline |
GW8063 | 8-Hydroxy-N,N,N'',N'',N'''',N''''-hexamethyl-pyrene-1,3,6-trisulfonamide |
GT8956 | 8-Hydroxyjulolidine |
GA0472 | 8-Hydroxyquinoline |
GK7141 | 8-Hydroxyquinoline citrate |
GC9186 | 8-Hydroxyquinoline-b-D-galactopyranoside |
GT5671 | 8-Methoxypyrene-1,3,6-trisulfonic acid trisodium salt |
GW0644 | 8-Phenyl-1-octanol |
GY1353 | 8-Prenylnaringenin |
GA3030 | 8-Quinolinol hemisulfate salt |
GT6060 | 9-(2-Carboxy-2-cyanovinyl)julolidine |
GN2070 | 9-(b-D-Arabinofuranosyl)guanine |
GN6878 | 9-(b-D-Ribofuranosyl)purine |
GW5286 | 9-(Hydroxymethyl)-10-carbamoylacridan |
GP6992 | 9-Aminoacridine hydrochloride monohydrate |
GK0832 | 9-Anthracenecarboxylic acid |
GK5039 | 9-Anthraldehyde |
GK9920 | 9-Chloromethylanthracene |
GW8077 | 9-Methylguanine |
GW3436 | 9,10-Anthracenedipropanoic acid |
GW0020 | 9,10-Anthracenediyl-bis(methylene)dimalonic acid |
GX4434 | 9,10-Bis(chloromethyl)anthracene |
GW8813 | A-443654 |
GW8742 | A-674563 (free base) |
GE5380 | A-769662 |
GC5340 | a-D-Galactose-1-phosphate dipotassium salt pentahydrate |
GC3160 | a-D-Mannose pentaacetate |
GC7225 | a-Solanine |
GW9828 | A2B2-Ionophore |
GP1173 | Abacavir |
GC2122 | Abacavir 5''-b-D-glucuronide |
GP9949 | Abacavir sulfate |
GC3099 | Abamectin |
GT6137 | ABD-F |
GP8507 | Abiraterone |
GP3228 | Abiraterone acetate |
GC6132 | Abiraterone O-β-D-glucuronide |
GY7768 | Abscisic acid |
GW8845 | ABT-737 |
GE7230 | ABTS |
GW6725 | Ac-Ala-Asn-Trp-AMC |
GL7574 | Ac-Arg-Leu-Arg-AMC |
GW0179 | Ac-Pro-Ala-Leu-AMC |
GW3560 | Ac-Trp-Leu-Ala-AMC |
GL4467 | Acacetin |
GP6637 | Acadesine |
GC8557 | Acarbose |
GP9829 | Aceclofenac |
GC3947 | Acedoben acyl-β-D-glucuronide |
GC6232 | Acemetacin acyl-β-D-glucuronide |
GK1639 | Acenaphthene |
GP6873 | Acepromazine maleate |
GB7796 | ACES |
GW2990 | Acesulfame K |
GL9642 | Acetamide |
GL1221 | Acetamide, pure |
GC6170 | Acetaminophen D-glucuronide |
GK4448 | Acetamiprid |
GK9995 | Acetanilide |
GV2353 | Acetic acid |
GV9212 | Acetic acid, glacial, Ph. Eur. grade |
GS5817 | Acetic Acid, GlenDry?, anhydrous |
GS0690 | Acetic acid, GlenPure?, analytical grade |
GX7648 | Acetoacetamide |
GC3316 | Acetobromo-a-D-glucuronic acid methyl ester |
GC7520 | Acetobromo-alpha-D-glucose |
GC2695 | Acetobromo-α-D-galactose |
GC7417 | Acetobromofucose |
GA3561 | Acetomycin |
GK3021 | Acetone |
GK5043 | Acetone oxime |
GK3913 | Acetone, 99.8%, for analysis |
GS2410 | Acetone, GlenDry?, anhydrous |
GS1428 | Acetone, GlenPure?, analytical grade |
GS5770 | Acetone, GlenPure?, analytical grade low in methanol |
GS9563 | Acetone, GlenUltra?, analytical grade, for GC |
GK1492 | Acetonitrile |
GS0969 | Acetonitrile 10, GlenBiol?, suitable for molecular biology |
GS1866 | Acetonitrile 190, GlenPure?, analytical grade far UV/gradient quality |
GS0853 | Acetonitrile 200, GlenPure?, analytical grade far UV |
GS8649 | Acetonitrile 30, GlenBiol?, suitable for molecular biology |
GS0247 | Acetonitrile 50, GlenBiol?, suitable for molecular biology |
GS0493 | Acetonitrile, GlenDry?, anhydrous |
GS0555 | Acetonitrile, GlenDry?, anhydrous over molecular sieve |
GS7079 | Acetonitrile, GlenUltra?, analytical grade, for GC |
GS6636 | Acetonitrile, GlenUltra?, analytical grade, for LC |
GX7956 | Acetophenone |
GL8669 | Acetyl coenzyme A lithium salt |
GK4759 | Acetyl coenzyme A sodium salt |
GW1345 | Acetyl-L-alanyl-L-glutamine |
GK5992 | Acetyl-L-carnitine hydrochloride |
GK4207 | Acetylacetone |
GL2912 | Acetylsalicylic acid |
GL0865 | Acetylsalicylic acid, USP grade |
GE4789 | Acetylthiocholine iodide |
GT2925 | Acid Blue 29 |
GT4451 | Acid Blue 40 (C.I. 62125) |
GT9286 | Acid Blue 80 |
GT8266 | Acid Fuchsin (C.I. 42685) |
GT7822 | Acid Fuchsin calcium salt |
GT1171 | Acid Green 50 |
GT6503 | Acid Red 1 (C.I. 18050) |
GT8248 | Acid Red 114 |
GT4801 | Acid Violet 17 (C.I. 42650) |
GK7831 | Acid Violet 43 |
GT0748 | Acid Yellow 99 (C.I. 13900) |
GP9248 | Acitretin |
GK1633 | Aconitine |
GT5850 | Acridine Orange 10-nonyl bromide |
GT9731 | Acridine Orange base |
GT9224 | Acridine Orange hemi(zinc chloride) salt (C.I. 46005) |
GL1836 | Acridine Orange hydrochloride hydrate |
GT5724 | Acridine Yellow G (C.I. 46025) |
GT3998 | Acriflavine hydrochloride (C.I. 46000) |
GT4120 | Acriflavine neutral |
GP6436 | Acrivastin |
GE3215 | Acrylamide 4X solution |
GK0096 | Acrylamide, 98% |
GK5651 | Acrylamide, suitable for electrophoresis |
GE5044 | Acrylamide/Bis-acrylamide, 19:1, 30% solution |
GE0418 | Acrylamide/Bis-acrylamide, 19:1, 40% solution |
GE4227 | Acrylamide/Bis-acrylamide, 29:1, 30% solution |
GE0513 | Acrylamide/Bis-acrylamide, 29:1, 40% solution |
GE4329 | Acrylamide/Bis-acrylamide, 37.5:1, 30% solution |
GE2988 | Acrylamide/Bis-acrylamide, 37.5:1, 40% solution |
GW1963 | Actagardin |
GA0481 | Actinomycin D |
GA7901 | Actinomycin D, GlenCell?, suitable for cell culture, USP grade |
GL3366 | Actinomycin X2 |
GA8851 | Actinonin |
GX9755 | Activated carbon, granules 2.5 mm |
GX2452 | Activated carbon, powder max. 100 micron |
GX1921 | Activated charcoal, powder, EP grade |
GW3239 | ACY-775 |
GA7641 | Acyclovir |
GM7835 | ADA |
GB0256 | ADA disodium salt |
GP9483 | Adapalene |
GP5887 | Adefovir |
GP5823 | Adefovir dipivoxil |
GE7863 | Adenine |
GA0167 | Adenine 9-beta-D-arabinofuranoside |
GE9458 | Adenine monohydrochloride |
GE5051 | Adenine sulfate |
GE2110 | Adenine sulfate dihydrate |
GE1212 | Adenosine |
GL9725 | Adenosine 5''-triphosphate disodium salt hydrate |
GE3544 | Adenosine 3''-,5''-cyclic monophosphate |
GN9482 | Adenosine 5''-diphosphate |
GE3988 | Adenosine 5''-diphosphate disodium salt |
GN8647 | Adenosine 5''-diphosphate potassium salt hydrate |
GK3475 | Adenosine 5''-diphosphate sodium salt |
GV7058 | Adenosine 5''-monophosphate |
GN7778 | Adenosine 5''-monophosphate disodium salt |
GE4953 | Adenosine 5''-monophosphate monohydrate |
GN1040 | Adenosine 5''-monophosphate sodium salt |
GL3641 | Adenosine 5''-O-thiomonophosphate dilithium salt |
GK2348 | Adipic acid |
GM8712 | Adipic acid dihydrazide |
GL6438 | AdipoRon |
GL0874 | AdipoRon hydrochloride |
GE4678 | AEBSF hydrochloride |
GA7949 | Aerothionin |
GW6150 | Afatinib |
GL4073 | Aftin-4 |
GL5855 | Aftin-5 |
GW6755 | AG-13958 |
GK9085 | Agar, high gel strength |
GK2227 | Agar, low gel strength |
GC6234 | Agar, low gel strength, suitable for microbiology |
GE7747 | Agarose, high EEO |
GE0001 | Agarose, low EEO |
GE6258 | Agarose, low EEO, GlenBiol?, suitable for molecular biology |
GE4750 | Agarose, medium EEO |
GW0219 | AGD |
GL9007 | Ageladine A TFA |
GW1673 | AGI-5198 |
GL9494 | Agistatin B |
GL7855 | Agistatin D |
GL8855 | Agistatin E |
GP5692 | Agmatine sulfate |
GP5210 | Ajmalicine |
GY4956 | Ajmaline |
GL8955 | AK-7 |
GW4346 | Akt-I-1 |
GW0863 | Akt-I-2 hydrochloride |
GM2362 | Ala-Gly |
GA6884 | Albendazole |
GL9307 | Albocycline |
GT8542 | Alcian Blue 8 GX (C.I. 74240) |
GE7998 | Alcian Blue, 1% solution in 3% acetic acid, pH 2.5 |
GT4246 | Alcian Yellow (C.I. 12840) |
GP9293 | Alclometasone dipropionate |
GW6765 | Aldicarb |
GP1402 | Alendronate sodium salt trihydrate |
GP9489 | Alfacalcidol |
GC9046 | Alginic acid |
GE7494 | Alginic acid sodium salt |
GT5801 | Alizarin (C.I. 58000) |
GT6797 | Alizarin Complexone |
GT6383 | Alizarin Red S (C.I. 58005) |
GT5959 | Alizarin Yellow GG (C.I. 14025) |
GT3658 | Alkali Blue 6B (C.I. 42765) |
GP0435 | Allantoin |
GP4954 | Allopurinol |
GP1499 | Alloxan monohydrate |
GT7523 | Allura Red AC (C.I. 16035) |
GC1574 | Allyl 2,3,4,6-tetra-O-acetyl-b-D-glucopyranoside |
GD8934 | Allylsulfonic acid sodium salt |
GL5648 | Aloe-emodin |
GL5632 | Aloeresin A |
GL7079 | Aloesin |
GC9451 | Aloin |
GC6065 | Aloin A, 97% |
GW0189 | Alpelisib |
GX9354 | alpha Iron(III) oxide Nanopowder, (Hamatite); 99.5%, red [APS 50 - 100 nm] |
GK5589 | alpha-(2,4-Dichlorophenyl)-(1H)-imidazole-1-ethanol |
GX4775 | alpha-Aluminium oxide Nanopowder, 99,5 % |
GX1021 | alpha-Aluminium oxide Nanopowder, 99,85 % |
GX2399 | alpha-Aluminium oxide Nanopowder, 99,9 % |
GX2901 | alpha-Aluminium oxide Nanopowder, 99+ % |
GE7409 | alpha-Amylase (with starch) |
GK2343 | alpha-Amylase, liquid |
GC6524 | alpha-Arbutin |
GK5749 | alpha-Bisabolol |
GL0668 | alpha-Cyano-4-hydroxycinnamic acid |
GC6443 | alpha-Cyclodextrin |
GC4753 | alpha-D-Glucose Pentaacetate |
GC8391 | alpha-D-Mannopyranosyl azide |
GC9989 | alpha-D-Mannopyranosylphenyl isothiocyanate |
GL2083 | alpha-Ecdysone |
GL2066 | Alpha-Galactosylceramide |
GW9375 | alpha-Galactosylceramide Analog 8 |
GZ1265 | alpha-Glucosidase |
GX7168 | alpha-Iron(III) oxide Nanopowder (H?matite); 99.5% |
GX9549 | alpha-Iron(III) oxide-Nano Powder, 98+% |
GK4316 | alpha-Mangostin |
GL1199 | alpha-Mannosylceramide |
GT1431 | alpha-Naphtholbenzein |
GT9609 | alpha-Naphtholphthalein |
GL7078 | alpha-NETA |
GK3356 | alpha-Pinene |
GL0054 | alpha-Terpineol, natural |
GE8243 | alpha,alpha-Azoisobutyronitrile |
GT7468 | Alphazurine A |
GP1537 | Alprostadil |
GL8214 | Alsterpaullone |
GA5056 | Altenusin |
GW2387 | Alternariol |
GA2124 | Alternariol monomethyl ether |
GA8400 | Altersolanol A |
GX8900 | Aluminium acetate, basic |
GK4077 | Aluminium ammonium sulfate dodecahydrate |
GX6532 | Aluminium boride |
GX0222 | Aluminium carbide, 98% |
GK1055 | Aluminium chloride hexahydrate |
GX1271 | Aluminium chloride hexahydrate, BP, Ph. Eur. grade |
GX5192 | Aluminium chloride, anhydrous, 99.9+% |
GX0139 | Aluminium chloride, anhydrous, 99.99+% |
GK6958 | Aluminium chloride, anhydrous, granular, 98% |
GX2534 | Aluminium ethoxide, 97% |
GX0876 | Aluminium fluoride hydrate |
GX7045 | Aluminium fluoride hydrate, 99.99% |
GK1147 | Aluminium fluoride trihydrate |
GX1880 | Aluminium Foil 0.008 mm, annealed, 99+% |
GX4505 | Aluminium Foil 0.012 mm, annealed, 99+% |
GX9180 | Aluminium Foil 0.02 mm, annealed, 99+% |
GX8209 | Aluminium Foil 0.025 mm, annealed, 99+% |
GX9255 | Aluminium Foil 0.035 mm, annealed, 99+% |
GX3493 | Aluminium Foil 0.05 mm, 99.99+% |
GX1641 | Aluminium Foil 0.05 mm, 99.999% |
GX7144 | Aluminium Foil 0.1 mm, 99.5+% |
GX3348 | Aluminium Foil 0.1 mm, 99.99+% |
GX1008 | Aluminium Foil 0.1 mm, 99.9999% |
GX0335 | Aluminium Foil 0.125 mm, 99.999% |
GX1520 | Aluminium Foil 0.125 mm, annealed, 99.5% |
GX8531 | Aluminium Foil 0.125 mm, hard, 99.0% |
GX4728 | Aluminium Foil 0.2 mm, hard, 99.5% |
GX6415 | Aluminium Foil 0.25 mm, 99.5% |
GX4952 | Aluminium Foil 0.25 mm, 99.999% |
GX1496 | Aluminium Foil 0.5 mm, 99.5% |
GX7260 | Aluminium Foil 0.5 mm, 99.99+% |
GX9340 | Aluminium Foil 0.8 mm, 99.5% |
GX3335 | Aluminium Foil 1.0 mm, 99.5% |
GX3854 | Aluminium Foil 1.0 mm, 99.999% |
GX6842 | Aluminium Foil 1.5 mm, 99.5% |
GX1759 | Aluminium Foil 2.0 mm, 99.5% |
GX1307 | Aluminium Foil 2.0 mm, 99.999% |
GX0235 | Aluminium Foil 3.0 mm, 99.5% |
GX8966 | Aluminium Foil 5.0 mm, 99.5% |
GX8270 | Aluminium Granules 0.6-1.2 mm, 99.8% |
GX0187 | Aluminium Granules 2-10 mm, 99.9% |
GX7495 | Aluminium Granules 2-10 mm, 99.99% |
GX3374 | Aluminium Granules 2-5 mm, 99.5+% |
GX5607 | Aluminium Granules max. 12 mm, 99.99% |
GX3489 | Aluminium hydroxide hydrate |
GX6650 | Aluminium Ingot, 99.999% |
GK9569 | Aluminium isopropoxide |
GX6777 | Aluminium magnesium isopropoxide, 99.95% |
GX0595 | Aluminium metaphosphate |
GX3628 | Aluminium molybdate, 99+% |
GX4607 | Aluminium nitrate hydrate, 98% |
GX1335 | Aluminium nitrate hydrate, 99.998% |
GX7841 | Aluminium nitride, 99% |
GX5326 | Aluminium oxide Rod 10 mm diameter, 99.5% |
GX5526 | Aluminium oxide-Nano Powder, 99.5% |
GX1565 | Aluminium oxide-Nano Powder, 99.97% |
GX8819 | Aluminium oxide-Nano Powder, 99.97% |
GX5889 | Aluminium oxide-Nano Powder, 99% |
GX0712 | Aluminium oxide, 98+% |
GX0283 | Aluminium oxide, 99.99% |
GX2525 | Aluminium oxide, 99.99% |
GX6914 | Aluminium oxide, 99.999% |
GX0767 | Aluminium oxide, activated, acidic |
GX6654 | Aluminium oxide, activated, basic |
GK0599 | Aluminium oxide, activated, neutral |
GX4562 | Aluminium Pellets 1.6 x 0.5 mm, 99.999% |
GX5129 | Aluminium Pellets 3.9 x 2.5 mm, 99.999% |
GX0821 | Aluminium Pellets 6 x 6 mm, 99.999% |
GX5270 | Aluminium Pellets 9.5 x 3.2 mm, 99.999% |
GX5147 | Aluminium phosphate, 99.99% |
GX0196 | Aluminium potassium sulfate dodecahydrate, 99% |
GX6483 | Aluminium Powder -100 mesh, 99.8% |
GX8511 | Aluminium Powder -100, +325 mesh, 99.97% |
GX7099 | Aluminium Powder max. 1000 micron, 98.5% |
GX0409 | Aluminium Powder max. 250 micron, 98.5% |
GX5638 | Aluminium Rod 10 mm diameter, 99.9999% |
GX6039 | Aluminium Rod 25 mm diameter, 99.5% |
GX2804 | Aluminium Rod 25 mm diameter, 99.99% |
GX6410 | Aluminium Rod 5.0 mm diameter, 99.9999% |
GX4558 | Aluminium Rod 6.0 mm diameter, 99.999% |
GX1262 | Aluminium Shot 3-6 mm, 99.9999% |
GX5453 | Aluminium sulfate anhydrous, 99.99% |
GX6647 | Aluminium sulfate hydrate |
GX8744 | Aluminium titanate, 99+% |
GX7939 | Aluminium Tube 10.0 mm diameter, 1.0 mm wall thickness, 99.7% |
GX7456 | Aluminium Wire 0.050 mm diameter, hard, 99.999% |
GX2009 | Aluminium Wire 0.20 mm diameter, hard, 99.5% |
GX6341 | Aluminium Wire 0.25 mm diameter, 99.995% |
GX2970 | Aluminium Wire 0.25 mm diameter, annealed, 99.5% |
GX0533 | Aluminium Wire 0.5 mm diameter, 99.95% |
GX8086 | Aluminium Wire 0.5 mm diameter, 99.999% |
GX4840 | Aluminium Wire 1.0 mm diameter, 99.95% |
GX7920 | Aluminium Wire 1.0 mm diameter, 99.999% |
GX8576 | Aluminium Wire 2.0 mm diameter, 99.5+% |
GX7866 | Aluminium Wire 2.0 mm diameter, 99.95% |
GX3845 | Aluminium Wire 2.0 mm diameter, 99.999% |
GX6811 | Aluminium, powder |
GX5194 | Aluminium? 2,4-pentanedionate, 97+% |
GX3387 | Aluminium(III) nitride Nanopowder, 99 % |
GX5582 | Aluminium(III) nitride Nanopowder, 99 % |
GX2226 | Aluminum Lactate |
GP0461 | Amantadine |
GP6034 | Amantadine hydrochloride |
GA1330 | Amastatin hydrochloride |
GL9680 | Amauromine |
GP8090 | Ambroxol hydrochloride |
GL8920 | Ambuic acid |
GW0411 | AMCA-H |
GW4752 | AMCA-H N-succinimidyl ester |
GW7519 | AMCA-X |
GW0447 | AMCA-X N-succinimidyl ester |
GK7176 | AMD3100 octahydrochloride hydrate |
GW1838 | AMG-1 |
GW5854 | AMG-25 |
GW6572 | AMG-458 |
GW3616 | AMG-47a |
GW3598 | AMG-51 |
GW5501 | AMG-Tie2-1 |
GL5806 | AMI-1 |
GW3845 | Amicarbazone |
GL4453 | Amidepsine A |
GL4968 | Amidepsine D |
GT9555 | Amido Black 10B (C.I. 20470) |
GW3472 | Amidoflumet |
GA5426 | Amikacin |
GA2441 | Amikacin disulfate salt |
GA9944 | Amikacin hydrate |
GA9402 | Amikacin sulfate salt |
GP9032 | Amiloride hydrochloride dihydrate |
GE4689 | Aminoguanidine bicarbonate |
GE7773 | Aminoguanidine hemisulfate salt |
GK1374 | Aminoguanidine hydrochloride |
GE6366 | Aminophylline |
GK2974 | Aminopterin dihydrate |
GP5750 | Amiodarone hydrochloride |
GC8608 | Amiprilose hydrochloride |
GW3176 | Amisulbrom |
GP0164 | Amisulpride |
GP9065 | Amlexanox |
GP9536 | Amlodipine |
GP6347 | Amlodipine besylate |
GE3336 | Ammonia hydroxide, 25% solution in water |
GE1331 | Ammonia hydroxide, 28% solution in water |
GS8853 | Ammonia solution, GlenBiol?, suitable for molecular biology |
GT7479 | Ammonium 7-Fluoro-2,1,3-benzoxadiazole-4-sulfonate |
GK8850 | Ammonium acetate |
GX2678 | Ammonium acetate 5M solution, GlenBiol?, suitable for molecular biology |
GX5459 | Ammonium acetate 7.5M solution, GlenBiol?, suitable for molecular biology |
GK1129 | Ammonium acetate, Ultrapure, for HPLC and LC-MS |
GW0398 | Ammonium bicarbonate |
GX7991 | Ammonium bismuth citrate |
GX7114 | Ammonium bromide |
GX9596 | Ammonium bromide, 99.9% |
GX4036 | Ammonium bromide, 99+% |
GK5772 | Ammonium carbonate |
GK7644 | Ammonium cerium(IV) nitrate |
GX1995 | Ammonium cerium(IV) nitrate, 99+% |
GX1817 | Ammonium cerium(IV) sulfate dihydrate |
GX5873 | Ammonium cerium(IV) sulfate dihydrate, 99+% |
GK0575 | Ammonium chloride |
GB7832 | Ammonium chloride-ammonium hydroxide buffer solution, 5% in water |
GX5993 | Ammonium chloride, 99.99% |
GX0686 | Ammonium chloride, 99.999% |
GL7832 | Ammonium citrate tribasic |
GK8477 | Ammonium dihydrogen phosphate |
GX2056 | Ammonium dihydrogen phosphate, 99.999% |
GX6407 | Ammonium dihydrogen phosphate, 99% |
GX2607 | Ammonium fluoride |
GX0593 | Ammonium formate, 97% |
GX3901 | Ammonium formate, 98% |
GX1942 | Ammonium formate, 99% |
GX6384 | Ammonium hexabromoplatinate(IV) |
GX5144 | Ammonium hexachloroiridate(III) hydrate, 99.95% (metals basis) |
GX2629 | Ammonium hexachloroiridate(IV); 99.95% (metals basis) |
GX3446 | Ammonium hexachloropalladate(IV); 99.95% (metals basis) |
GX0581 | Ammonium hexachloroplatinate(IV) |
GX3877 | Ammonium hexachlororhenate(IV) |
GX1016 | Ammonium hexachlororhodate(III); 99.9+% |
GX7954 | Ammonium hexafluorophosphate |
GX6397 | Ammonium hexafluorosilicate, 98% |
GX5944 | Ammonium hexanitritorhodate(III) |
GX0333 | Ammonium hydrogen sulfate, 99.9% |
GX8488 | Ammonium iodide, 99% |
GK4017 | Ammonium iron(II) sulfate hexahydrate |
GK1122 | Ammonium iron(III) citrate (Red) |
GK9348 | Ammonium iron(III) sulfate dodecahydrate |
GK0181 | Ammonium iron(lll) citrate (Brown) |
GK6140 | Ammonium iron(lll) citrate (Green) |
GK9128 | Ammonium iron(lll) citrate (Green); Iron content 14 - 16 % |
GK3854 | Ammonium L-(+)-tartrate |
GC2144 | Ammonium L-lactate |
GK4368 | Ammonium metavanadate |
GK3904 | Ammonium molybdate tetrahydrate |
GX0076 | Ammonium molybdate tetrahydrate, 99.5% |
GX9451 | Ammonium oxalate, monohydrate, 98% |
GK3205 | Ammonium pentaborate octahydrate |
GX3119 | Ammonium pentachloroaquorhodate(III) |
GX3003 | Ammonium perrhenate, 99.9% |
GE6204 | Ammonium persulfate |
GL1791 | Ammonium pyrrolidinedithiocarbamate |
GX6382 | Ammonium succinate |
GK6102 | Ammonium sulfamate |
GE2543 | Ammonium sulfate |
GX4152 | Ammonium sulfate, 99.9999% |
GX5799 | Ammonium tetrachloroaurate(III) |
GX0589 | Ammonium tetrachloropalladate(II) |
GX7520 | Ammonium tetrachloroplatinate(II) |
GK7498 | Ammonium tetrachloroplatinate(II); 99.9% |
GK3645 | Ammonium thiocyanate |
GX9978 | Ammonium tungstate hydrate, 99% |
GX3138 | Ammonium-L-tartrate, 99% |
GX5161 | Ammonium-nitrido-octachlorodiaquodiruthenate(IV); 99.95% (metals basis) |
GW4834 | Amorfrutin A |
GW3206 | Amorfrutin B |
GP0831 | Amorolfine hydrochloride |
GP0775 | Amoxicillin sodium salt |
GA7845 | Amoxicillin trihydrate, BP, EP grade |
GA8986 | Amphotericin B |
GA7355 | Ampicillin sodium salt |
GA0283 | Ampicillin sodium salt, cell culture grade |
GA2117 | Ampicillin trihydrate |
GA8774 | Ampicillin trihydrate, USP grade |
GA3049 | Ampicillin, anhydrous |
GX3272 | Amplisyn Red |
GW2882 | AMQI |
GP7331 | Amrinone |
GL7076 | Amsacrine hydrochloride |
GW6762 | Amuvatinib |
GC5067 | Amygdalin |
GK9299 | Anacardic acid |
GK3145 | Ancymidol |
GL6670 | Andrastin A |
GP9833 | Andrographolide |
GL5865 | Androsterone |
GW9602 | Anhydrotetracycline hydrochloride |
GT2666 | Aniline Blue (C.I. 42755) |
GE8239 | Aniline Blue, 2.5% solution in 2% acetic acid |
GX1132 | Anisole |
GS7223 | Anisole, GlenDry?, anhydrous |
GA2328 | Anisomycin |
GL4628 | Anomalin A |
GA9248 | Ansatrienin A |
GP5451 | Antazoline hydrochloride |
GW6771 | Anthracene-9,10-dipropionic acid disodium salt |
GK6811 | Anthracene, 99% |
GW3595 | Anthrance A |
GK9102 | Anthranilic acid |
GL8529 | Anthraquinone |
GT1240 | Anthrone |
GL7021 | Antibiotic L-696,474 |
GA6727 | Antibiotic PF 1052 |
GX8708 | Antimony Ingot, 99.999% |
GX7081 | Antimony Ingot, 99.9999% |
GX7845 | Antimony Pieces, 99.999% |
GX8733 | Antimony Pieces, 99.9999% |
GX2647 | Antimony Powder -325 mesh, 99.5% |
GX3000 | Antimony Powder max. 250 micron, 99.999% |
GX5626 | Antimony Rod 6 mm diameter, 99.999% |
GX9225 | Antimony Rod 8 mm diameter, 99.999% |
GX5423 | Antimony Shot 1-3 mm, 99.999% |
GX3665 | Antimony Shot 1-3 mm, 99.9999% |
GX2461 | Antimony tin oxide (ATO); 99,95 % |
GX2870 | Antimony tin oxide, 99.95 % |
GX1593 | Antimony(III) chloride, 99.99+% |
GX2593 | Antimony(III) chloride, 99% |
GX8250 | Antimony(III) fluoride, 99% |
GX5562 | Antimony(III) iodide, 99.999% |
GX8352 | Antimony(III) oxide, 98+% |
GX1943 | Antimony(III) oxide, 99.9% |
GX8841 | Antimony(III) oxide, 99.99+% |
GX5942 | Antimony(III) sulfide |
GX8478 | Antimony(V) chloride |
GX8145 | Antimony(V) pentasulfide |
GA1794 | Antimycin A1 |
GL6582 | Antipain dihydrochloride |
GW2316 | AP-III-a4 . HCl |
GW2135 | Apcin |
GA6433 | Aphidicolin |
GL1264 | Aphidicolin 17-acetate |
GL4049 | Aphidicolin-3alpha,18-acetonide |
GA4500 | Apicidin |
GP1532 | Apigenin |
GL6788 | Apigenin 7-glucuronide |
GC2419 | Apigenin-7-glucoside |
GP7497 | Apixaban |
GE6422 | apo-Transferrin |
GA8829 | Apramycin sulfate salt |
GP4641 | Aprepitant |
GP2268 | Aprotinin |
GC8174 | Arabinogalactan |
GE1829 | Arachidic acid |
GA1926 | Aranciamycin |
GL9104 | Aranorosin |
GC0919 | Arbutin |
GY3454 | Arctigenin |
GC9872 | Arctiin |
GP0770 | Arecoline hydrobromide |
GP6176 | Argatroban |
GL1974 | Arglabin |
GP6754 | Aripiprazole |
GT9304 | Arsenazo III |
GX6492 | Arsenic Pieces 2-12 mm, 99.999% |
GX3954 | Arsenic Pieces 2-12 mm, 99.9999% |
GX1254 | Arsenic Powder -20 mesh, 99% |
GX0144 | Arsenic Powder max. 250 micron, 99.999% |
GX8607 | Arsenic Powder max. 250 micron, 99.9999% |
GL9620 | Artemether |
GP0718 | Artemisinin |
GP3905 | Artesunate |
GA7503 | Artesunate |
GW1967 | Articaine hydrochloride |
GL6666 | AS-252424 |
GW2970 | AS-703026 |
GK4694 | ASB-14 |
GL7015 | Ascolactone |
GA1406 | Ascomycin |
GX9315 | Ascorbyl tetraisopalmitate |
GP0603 | Asenapine maleate |
GL0518 | Asiatic acid |
GC7829 | Asiaticoside |
GE0967 | Aspartame |
GL8441 | Aspergillimide |
GL4853 | Aspergillin PZ |
GA4051 | Asperlactone |
GL6261 | Asperloxine A |
GW0191 | Asperphenamate |
GL0242 | Asperulosidic acid |
GL7840 | Aspinonene |
GL7290 | Aspochalasin I |
GW8838 | ASPT |
GL9151 | Aspterric acid |
GA6290 | Aspyrone |
GW9454 | AST-487 |
GP5817 | Astaxanthin |
GP5099 | Astemizole |
GL4939 | Astilbin |
GT8099 | Astra Blue |
GL0129 | Astragaloside IV |
GW4564 | AT7519 hydrochloride |
GW8696 | AT9283 |
GP7849 | Atazanavir sulphate |
GP1091 | Atenolol |
GW1919 | Athidathion |
GP8528 | Atomoxetine hydrochloride |
GP7735 | Atorvastatin |
GP5009 | Atorvastatin calcium salt |
GP1551 | Atovaquone |
GA9503 | Atpenin A5 |
GP8154 | Atracurium besylate |
GP8423 | Atrazine |
GP2470 | Atropine |
GP0750 | Atropine sulfate monohydrate |
GL4681 | Aucubin |
GT5481 | Auramine O (C.I. 41000) |
GP1600 | Auranofine |
GL7432 | Aurantimycin A |
GA0085 | Aureothin |
GA0186 | Aureothricin |
GL9736 | Aurintricarboxylic acid |
GE0325 | Aurintricarboxylic acid ammonium salt |
GA7019 | Aurodox |
GW8342 | AV-412 |
GX0016 | Avanafil |
GA8250 | Avarol |
GL1965 | Averantin |
GW8417 | AVG-Cl |
GE2842 | Avidin, from chicken egg white |
GX3450 | Aviptadil Acetate |
GP9798 | Axitinib |
GW8438 | AZ 960 |
GW4801 | AZ191 |
GW4253 | AZ9482 |
GP1145 | Azathioprine |
GW6998 | AZD 7545 |
GW4562 | AZD-1208 |
GW5430 | AZD-2014 |
GW1592 | AZD-26 |
GW7781 | AZD-7762 hydrochloride |
GW4102 | AZD-8055 |
GW3804 | AZD-8330 |
GK0163 | Azelaic acid, 99% |
GP1332 | Azelastine hydrochloride |
GP5829 | Azelnidipine |
GC8183 | Azido 2-Acetamido-2-deoxy-3,4,6-tri-O-acetyl-β-D-glucopyranoside |
GX5951 | Azilsartan medoxomil |
GW4869 | Azimsulfuron |
GA2043 | Azithromycin dihydrate |
GA9075 | Azlocillin sodium salt |
GW4098 | Azo-Carob Galactomannan |
GT2939 | Azomethine-H monosodium salt hydrate |
GT1311 | Azorubine S (C.I. 16185) |
GX7276 | Azoxystrobin |
GA5815 | Aztreonam |
GP3751 | Azulene |
GT3888 | Azur C (C.I. 52002) |
GT4045 | Azure A (C.I. 52005) |
GT6233 | Azure B (C.I. 52010) |
GT3719 | Azure II |
GT3741 | Azure II eosinate |
GC0862 | b-D-Allopyranose |
GC5758 | b-D-Galactopyranosyl azide |
GC1902 | b-D-Glucopyranosyl azide |
GC8145 | b-D-Maltose octaacetate |
GN8530 | b-Nicotinamide adenine dinucleotide phosphate hydrate |
GN9337 | b-Nicotinamide-adenine dinucleotide phosphate tetrasodium salt, reduced |
GA7992 | Bacampicillin hydrochoride |
GL9266 | Bacimethrin |
GA3759 | Bacitracin |
GA1078 | Bacitracin zinc salt |
GW4947 | Bafetinib |
GA6363 | Bafilomycin A1 |
GA8347 | Bafilomycin B1 |
GA5404 | Bafilomycin C1 |
GW7574 | Bafilomycin D (high purity) |
GC0614 | Baicalin 7-b-D-glucuronide |
GA6854 | Balofloxacin |
GP7662 | Balsalazide |
GP7647 | Balsalazide disodium salt |
GW2497 | BAPTA tetraethyl ester |
GK3735 | BAPTA tetrasodium salt hydrate |
GK6150 | BAPTA-AM |
GW9910 | Baricitinib |
GX5645 | Barium acetate, 98+% |
GX6609 | Barium aluminate, 99+% |
GX7895 | Barium bromide, dihydrate, 98+% |
GX7796 | Barium carbonate, 99.99% |
GX2376 | Barium carbonate, 99.999% |
GX0451 | Barium carbonate, 99% |
GX3602 | Barium carbonate, 99%, ACS grade |
GK4364 | Barium chloride dihydrate |
GX7010 | Barium chloride, anhydrous, 99.9% |
GX6201 | Barium chloride, anhydrous, 99+% |
GX0287 | Barium diphenylamine-4-sulfonate |
GX3351 | Barium fluoride, 97+% |
GX0087 | Barium fluoride, 99.9% |
GX4346 | Barium fluoride, 99.9% |
GX1455 | Barium hydroxide octahydrate, 98% |
GX9343 | Barium nitrate, 99.95% |
GX5821 | Barium nitrate, 99% |
GX2723 | Barium oxide, 99.5% |
GX6077 | Barium Rod 22 mm diameter, under argon, 0,8% Sr, 99.3% |
GX7923 | Barium Rod 22 mm diameter, under paraffin oil, 0,8% Sr, 99.3% |
GX5859 | Barium sulfate, 99% |
GX8528 | Barium tetracyanoplatinate(II) |
GX4731 | Barium titanate Nanopowder, 100nm, 99.9% |
GX3373 | Barium titanate Nanopowder, 99,95 % |
GX2521 | Barium titanate, 99.9% |
GX6158 | Barium titanate, 99.9% |
GX5396 | Barium titanate, 99.99% |
GX5010 | Barium titanate, 99% |
GX1134 | Barium tungstate, 99.9% |
GX3559 | Barium zirconate, 99% |
GX2292 | Barium-thd, 99.99% |
GT2169 | Basic Fuchsin (C.I. 42510) |
GT2106 | Basic Fuchsin, for flagella staining, certified |
GW4671 | Basic Red 12 |
GX4798 | Basic Red 14 |
GT8545 | Basic Yellow 40 |
GT0734 | Bathocuproinedisulfonic acid disodium salt |
GE7942 | Bathophenanthroline, 98% |
GK8638 | Bay 11-7082 |
GW7810 | BAY 58-2667 . hydrochloride |
GN2518 | Bay 60-7550 |
GW9599 | Bayer-18 |
GW8385 | BBT594 |
GW9074 | BE-31405 |
GA8043 | Beauvericin |
GA2534 | Becatecarin |
GP9547 | Beclometasone dipropionate |
GL6346 | Benadrostin |
GP6515 | Bendamustine hydrochloride |
GP2430 | Benfotamine |
GP1567 | Benidipine hydrochloride |
GP7664 | Benserazide hydrochloride |
GW3290 | Bentamapimod |
GW6316 | Benthiavalicarb-isopropyl |
GK5897 | Benzaldehyde |
GK4276 | Benzalkonium chloride |
GK7966 | Benzalkonium chloride, 50% solution in water |
GK6397 | Benzalphthalide |
GL3631 | Benzamide |
GK9678 | Benzamidine hydrochloride hydrate |
GP8819 | Benzbromarone |
GK4809 | Benzene |
GL0202 | Benzenesulfonamide |
GK6136 | Benzethonium chloride |
GK2243 | Benzhydrol |
GK7106 | Benzil |
GP2011 | Benzocaine |
GC9109 | Benzocaine glucoside |
GK5967 | Benzoic acid |
GC8363 | Benzoic acid acyl-β-D-glucuronide |
GK1108 | Benzoin |
GX1471 | Benzonitrile |
GK3488 | Benzophenone |
GK5506 | Benzophenone oxime |
GK8288 | Benzotriazole |
GE4655 | Benzotriazole-1-yl-oxy-tris-pyrrolidino-phosphonium hexafluorophosphate |
GK7133 | Benzoyl peroxide |
GC7198 | Benzyl 2-acetamido-2-deoxy-3-O-β-D-galactopyranosyl-α-D-galactopyranoside |
GC3510 | Benzyl 2-acetamido-2-deoxy-3,6-di-O-benzyl-β-D-glucopyranoside |
GC3736 | Benzyl 2-acetamido-2-deoxy-4,6-O-isopropylidene-a-D-glucopyranoside |
GC9798 | Benzyl 2-acetamido-2-deoxy-4,6-O-isopropylidene-b-D-glucopyranoside |
GC3861 | Benzyl 2-acetamido-2-deoxy-α-D-glucopyranoside |
GC3420 | Benzyl 2-acetamido-2-deoxy-β-D-glucopyranoside |
GC1254 | Benzyl 2-acetamido-3-O-acetyl-4,6-O-benzylidene-2-deoxy-α-D-glucopyranoside |
GC1718 | Benzyl 2-acetamido-3-O-acetyl-6-O-benzyl-2-deoxy-α-D-glucopyranoside |
GC1619 | Benzyl 2-acetamido-3,4-di-O-acetyl-2-deoxy-α-D-glucopyranoside |
GC9130 | Benzyl 2-acetamido-3,4-di-O-benzyl-2-deoxy-α-D-glucopyranoside |
GC8758 | Benzyl 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-b-D-glucopyranoside |
GC5472 | Benzyl 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-α-D-galactopyranoside |
GC8179 | Benzyl 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-β-D-galactopyranoside |
GC1709 | Benzyl 2-acetamido-4,6-O-benzylidene-2-deoxy-α-D-glucopyranoside |
GC6994 | Benzyl 2-acetamido-6-O-benzyl-2-deoxy-4-O-β-D-galactopyranosyl-α-D-glucopyranoside |
GC3989 | Benzyl 2-deoxy-2-phthalimido-3,4,6-tri-O-acetyl-β-D-glucopyranoside |
GC4482 | Benzyl 2-deoxy-2-phthalimido-4,6-O-benzylidene-β-D-glucopyranoside |
GC6228 | Benzyl 2-deoxy-2-phthalimido-β-D-glucopyranoside |
GC7555 | Benzyl 2-O-tosyl-β-D-arabinopyranoside |
GC9059 | Benzyl 2,2'',3,3'',6-penta-O-acetyl-4'',6''-O-benzylidene-β-D-lactoside |
GC8540 | Benzyl 2,3-anhydro-4-O-benzyl-β-D-ribopyranoside |
GC5854 | Benzyl 2,3-anhydro-4-O-β-D-xylopyranosyl-β-D-ribopyranoside |
GC8866 | Benzyl 2,3-anhydro-4-O-β-D-xylopyranosyl-β-D-ribopyranoside triacetate |
GC7844 | Benzyl 2,3-anhydro-β-D-ribopyranoside |
GC5434 | Benzyl 2,3-di-O-acetyl-4,6-O-benzylidene-α-D-mannopyranoside |
GC5829 | Benzyl 2,3-di-O-acetyl-4,6-O-benzylidene-β-D-glucopyranoside |
GC0482 | Benzyl 2,3-di-O-benzyl-4-O-methyl-β-D-glucopyranosiduronic acid benzyl ester |
GC3659 | Benzyl 2,3-di-O-benzyl-4,6-O-benzylidene-β-D-glucopyranoside |
GC5678 | Benzyl 2,3-di-O-benzyl-β-D-glucopyranoside |
GC4013 | Benzyl 2,3-O-isopropylidene-6-O-tosyl-α-L-sorbofuranoside |
GC4371 | Benzyl 2,3-O-isopropylidene-α-D-erythrofuranoside |
GC1773 | Benzyl 2,3-O-isopropylidene-α-D-mannofuranoside |
GC9072 | Benzyl 2,3-O-isopropylidene-β-D-erythrofuranoside |
GC3906 | Benzyl 2,3,4-tri-O-benzyl-α-D-mannopyranoside |
GC3291 | Benzyl 2,3,4-tri-O-benzyl-β-D-galactopyranoside |
GC2972 | Benzyl 2,3,4-tri-O-benzyl-β-D-glucopyranoside |
GC2551 | Benzyl 2,3,4,6-tetra-O-acetyl-β-D-galactopyranoside |
GC4665 | Benzyl 2,3,4,6-tetra-O-acetyl-β-D-Glucopyranoside |
GC5736 | Benzyl 2,3:4,6-di-O-isopropylidene-α-L-sorbofuranoside |
GC8598 | Benzyl 2,3:5,6-Di-O-isopropylidene-α-D-mannofuranoside |
GC0595 | Benzyl 2,6-di-O-acetyl-3,4-O-isopropylidene-β-D-galactopyranoside |
GC6574 | Benzyl 2,6-di-O-acetyl-β-D-galactopyranoside |
GC2050 | Benzyl 2,6-di-O-benzyl-β-D-galactopyranoside |
GC5116 | Benzyl 3-O-allyl-2-O-benzyl-4,6-O-benzylidene-β-D-glucopyranoside |
GC4481 | Benzyl 3-O-allyl-2-O-benzyl-β-D-glucopyranoside |
GC9199 | Benzyl 3-O-allyl-4,6-O-benzylidene-β-D-glucopyranoside |
GC8780 | Benzyl 3-O-allyl-β-D-glucopyranoside |
GC8385 | Benzyl 3,4-di-O-acetyl-2-deoxy-2-phthalimido-6-O-trityl-β-D-glucopyranoside |
GC5245 | Benzyl 3,4-O-isopropylidene-6-tosyl-β-D-galactopyranoside |
GC1508 | Benzyl 3,4-O-isopropylidene-β-D-arabinopyranoside |
GC2012 | Benzyl 3,4-O-isopropylidene-β-D-galactopyranoside |
GC8326 | Benzyl 4-O-benzyl-β-D-glucopyranoside |
GC0395 | Benzyl 4,6-O-benzylidene-α-D-mannopyranoside |
GC7543 | Benzyl 4,6-O-benzylidene-β-D-glucopyranoside |
GC1499 | Benzyl 6-O-trityl-α-D-mannopyranoside |
GC7422 | Benzyl a-D-mannopyranoside |
GK3443 | Benzyl alcohol |
GC6168 | Benzyl b-D-glucopyranoside |
GK8148 | Benzyl benzoate |
GK6722 | Benzyl benzoate, BP, Ph. Eur. grade |
GL2673 | Benzyl isothiocyanate |
GX1705 | Benzyl nicotinate |
GK7651 | Benzyl salicylate |
GC6185 | Benzyl α-D-erythrofuranoside |
GC5315 | Benzyl β-D-arabinopyranoside |
GC4129 | Benzyl β-D-erythrofuranoside |
GC1553 | Benzyl β-D-xylobioside |
GC3700 | Benzyl β-D-xylobioside pentaacetate |
GC4752 | Benzyl-13C6 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-α-D-galactopyranoside |
GK0249 | Benzylamine |
GW8120 | Benzylamine hydrochloride |
GK2853 | Benzyldimethyltetradecylammonium chloride dihydrate |
GK5113 | Benzyltriethylammonium bromide |
GK4969 | Benzyltriphenylphosphonium chloride |
GW1294 | BEP |
GY3340 | Berbamine |
GL6182 | Berbamine dihydrochloride |
GK8292 | Berberine hydrochloride |
GL2537 | Bergamot oil |
GP8615 | Bergenin |
GK1240 | Beryllium fluoride, 33% (w/w) aqueous solution |
GX0158 | Beryllium oxide, 98+% |
GX5210 | Beryllium oxide, 99.98% |
GB4358 | BES |
GB9133 | BES sodium salt |
GA7849 | Bestatin hydrochloride |
GC1069 | beta-Alanine |
GC3427 | beta-Alanine ethyl ester hydrochloride |
GZ8786 | beta-Amylase, from soy |
GP8334 | beta-Carotene |
GP5152 | beta-Cyclocitral |
GC8805 | beta-Cyclodextrin |
GC6118 | beta-Cyclodextrin phosphate sodium salt |
GL7051 | beta-D-Glucan, from yeast |
GZ4898 | beta-Glucosidase, from almonds |
GK9068 | beta-Glycerol phosphate disodium salt pentahydrate |
GC5831 | beta-Lactose |
GW4983 | beta-Mannosylceramide |
GW2463 | beta-Naphthocyclinone |
GV0860 | beta-Nicotinamide adenine dinucleotide |
GE9477 | beta-Nicotinamide adenine dinucleotide phosphate disodium salt |
GL2728 | beta-Nicotinamide adenine dinucleotide phosphate sodium salt hydrate |
GK2960 | beta-Nicotinamide adenine dinucleotide reduced form, disodium salt |
GE9996 | beta-Nicotinamide mononucleotide |
GA9971 | beta-Rubromycin |
GP9580 | beta-Sitosterol, 97% |
GE3671 | Betaine hydrochloride |
GE7265 | Betaine monohydrate |
GE1604 | Betaine, anhydrous |
GP0290 | Betamethasone |
GP7353 | Betamethasone 17-valerate |
GK8107 | Betamethasone 21-phosphate disodium |
GP3604 | Betamethasone dipropionate |
GP0555 | Betaxolol hydrochloride |
GP5633 | Betulin |
GP1450 | Betulinic acid |
GW1189 | BGG463 |
GW3237 | BGT226 maleate |
GW2372 | BHHCT |
GW6604 | BHHT |
GW2893 | BI-D1870 |
GA6808 | Biapenem |
GP8076 | Bicalutamide |
GK3616 | Bicinchoninic acid disodium salt hydrate |
GB1591 | BICINE |
GL5486 | Bicyclohexyl |
GT7414 | Biebrich Scarlet (C.I. 26905) |
GT0753 | Biebrich scarlet-acid fuchsin solution |
GP7972 | Bifemelane hydrochloride |
GW3628 | Bifenazate |
GP7347 | Bifonazole |
GL1296 | Bikaverin |
GX6607 | Bile salts |
GE4042 | Bilirubin |
GX7154 | Bimatoprost |
GL6265 | BIO |
GP7014 | Biochanin A |
GC6476 | Biochanin A b-D-glucuronide |
GK3055 | Biocytin |
GW9801 | Biotin-(5-fluorescein)-conjugate |
GW6213 | Biotin-X-NHS |
GE2365 | Biotinyl tyramide |
GL2355 | Biphenyl |
GK8116 | Bis-trifluoroacetoxyiodobenzene |
GB6605 | BIS-TRIS |
GK3758 | BIS-TRIS hydrochloride |
GB2945 | BIS-TRIS propane |
GP2575 | Bis(2-carboxyethylgermanium(IV) sesquioxide) |
GS9884 | bis(2-Methoxyethyl) Ether, GlenDry?, anhydrous |
GS2001 | bis(2-Methoxyethyl) Ether, GlenDry?, anhydrous over molecular sieve |
GW0709 | Bis(2,2′-bipyridine)-(5-isothiocyanato-phenanthroline)ruthenium bis(hexafluorophosphate) |
GW8154 | Bis(4-bromophenyl)iodonium triflate |
GW1863 | Bis(4-fluorophenyl)iodonium triflate |
GW1986 | Bis(4-iodophenyl)-iodonium tetrafluoroborate |
GW9067 | Bis(4-methylphenyl)iodonium hexafluorophosphate |
GW7661 | Bis(4-tert-Butylphenyl) iodoniumhexafluorophosphate |
GT6965 | Bis(cyclohexanone)oxaldihydrazone |
GX4516 | Bis(cyclopentadienyl)iron, recrystallized |
GX7749 | Bis(cyclopentadienyl)zirconium dichloride, 97+% |
GX7504 | Bis(dibenzylideneacetone) palladium(0) |
GX3036 | Bis(ethylenediamine) palladium(II) chloride, 99.95% (metals basis) |
GK6469 | Bis(pinacolato)diboron |
GW7867 | Bis(trifluoromethane)sulfonimide lithium salt |
GK0113 | Bis(trimethylsilyl)trifluoroacetamide with 1% TMCS |
GX9696 | Bis(triphenylphosphine) palladium(II) chloride, 99.95% (metals basis) |
GX9818 | Bis(triphenylphosphine)nickel (II) chloride |
GX7392 | Bis(triphenylphosphine)rhodium carbonyl chloride, 99% |
GX2503 | Bis(triphenylphosphine)ruthenium dicarbonyl dichloride |
GT5082 | Bisbenzimide H 33258 Fluorochrome trihydrochloride |
GL2668 | Bisindolylmaleimide I base |
GL1078 | Bisindolylmaleimide II |
GL9260 | Bisindolylmaleimide III |
GK6792 | Bisindolylmaleimide IV |
GL4877 | Bisindolylmaleimide IX methansulfonate |
GL9254 | Bisindolylmaleimide V |
GL4749 | Bisindolylmaleimide VIII acetate salt |
GL8289 | Bisindolylmaleimide X hydrochloride |
GT3348 | Bismarck Brown Y (C.I. 21000) |
GT3092 | Bismark Brown (C.I. 21010) |
GW3055 | Bismerthiazol |
GX8987 | Bismuth acetate, 99.999% |
GX2199 | Bismuth Bar, 99.99% |
GX3856 | Bismuth Bar, 99.999% |
GX8757 | Bismuth Bar, 99.9999% |
GX3304 | Bismuth bromide, 99% |
GX9572 | Bismuth carbonate basic, 98% |
GX2068 | Bismuth carbonate basic, 99% |
GX6524 | Bismuth chloride hydrate, 99.99+% |
GX6173 | Bismuth chloride oxide, 99.9% |
GX9190 | Bismuth chloride oxide, 99.99% |
GX1996 | Bismuth Granules 0.5-2 mm, 99.99% |
GX5286 | Bismuth Granules 0.5-2 mm, 99.997% |
GX0318 | Bismuth Granules 1-10 mm, 99.999% |
GX7283 | Bismuth hydroxide, 99.9% |
GX0561 | Bismuth iodide, 99% |
GX7978 | Bismuth molybdate, 99.5% |
GX7502 | Bismuth Needles, 99.997% |
GX1365 | Bismuth nitrate hydrate, 98+% |
GX3159 | Bismuth nitrate hydrate, 99.999% |
GX8756 | Bismuth nitrate oxide 71% Bi |
GX8193 | Bismuth oxide (beta)-Nano Powder, 99.9+% |
GX9845 | Bismuth oxide, 99.8% |
GX8289 | Bismuth oxide, 99.9% |
GX3472 | Bismuth oxide, 99.9% |
GX3752 | Bismuth oxide, 99.99% |
GX4730 | Bismuth oxide, 99.999% |
GX1608 | Bismuth oxide, 99.9995% |
GX2132 | Bismuth Pieces, 99.999% |
GX4649 | Bismuth Pieces, 99.9999% |
GX1211 | Bismuth Powder -100, +325 mesh, 99.5% |
GX4739 | Bismuth Powder -100, +325 mesh, 99.99% |
GX3632 | Bismuth Powder -200 mesh, 99.999% |
GX0171 | Bismuth Powder -325 mesh, 99.9% |
GX5673 | Bismuth Powder -325 mesh, 99% |
GX6127 | Bismuth Powder max. 250 micron, 99.995% |
GX6294 | Bismuth Rod 10 mm diameter, 99.999% |
GK1477 | Bismuth subnitrate |
GK6111 | Bismuth subnitrate, USP grade |
GX1330 | Bismuth-thd, 99.9% |
GX8399 | Bismuth(III) citrate |
GX3049 | Bismuth(III) fluoride, 99.999% |
GK5350 | Bismuth(III) gallate basic hydrate |
GK8852 | Bismuth(III) oxide |
GP0667 | Bisoprolol hemifumarate salt |
GL8984 | Bisphenol A |
GW3575 | Bistrifluron |
GL8763 | Bithionol |
GT9214 | Biuret |
GL8747 | BIX 01294 base |
GL6636 | BIX 01294 trihydrochloride |
GW3612 | BIX02565 |
GW6773 | BKM120 |
GA9443 | Blasticidine S hydrochloride |
GA7621 | Bleomycin sulfate |
GL2252 | BLZ-945 |
GW1704 | BMS-2 |
GW5318 | BMS-3 |
GW9859 | BMS-309403 |
GW8214 | BMS-387032 hydrochloride |
GW8582 | BMS-5 |
GW5097 | BMS-540215 |
GW8409 | BMS-599626 |
GM9790 | Boc-Ala-OH |
GM4593 | Boc-Ala-OMe |
GM9595 | Boc-Asn(Trt)-OH |
GK5098 | Boc-Asp(OMe)-fluoromethyl ketone |
GM9023 | Boc-Cys(Trt)-OH |
GM2534 | Boc-D-Asp(OBzl)-OH |
GM5576 | Boc-D-Glu-OBzl |
GM3032 | Boc-D-Lys(2-Cl-Z)-OH |
GM0960 | Boc-D-Met-OH |
GM7978 | Boc-D-phenylalaninol |
GM7243 | Boc-D-Ser(Bzl)-OH |
GM0738 | Boc-Gln-OH |
GM6033 | Boc-Glu(OBzl)-OH |
GM8629 | Boc-Glu(OcHx)-OH |
GM0543 | Boc-His(Boc)-OH dicyclohexylammonium salt |
GM4410 | Boc-Ile-OH |
GM1634 | Boc-L-Lys(Boc)-OH |
GM3676 | Boc-L-prolinal |
GL3169 | Boc-Leu-Arg-Arg-AMC |
GM1662 | Boc-Leu-OH hydrate |
GM4502 | Boc-Lys(Alloc)-OH dicyclohexylammonium salt |
GM6002 | Boc-Lys(Boc)-OSu |
GM3592 | Boc-Lys(Fmoc)-OH |
GM8936 | Boc-Lys(Z)-OH |
GM5675 | Boc-Ser(Bzl)-OH |
GM3219 | Boc-Thr(Bzl)-OH |
GM5211 | Boc-Tle-OH |
GM7699 | Boc-Tyr(Me)-OH |
GM1187 | Boc-Val-OH |
GP0844 | Boceprevir |
GL5712 | Borage oil |
GE4425 | Boric acid |
GX5588 | Boric acid, 99.9% |
GX7729 | Boric acid, 99.999% |
GL6068 | Boromycin |
GX9439 | Boron carbide |
GX3429 | Boron carbide nanopowder, 50nm, 99% |
GX8717 | Boron nitride |
GX5901 | Boron nitride Nanopowder, 99.0% |
GX5307 | Boron nitride Nanopowder, 99.0% [APS 70 nm] |
GX1186 | Boron nitride, rod |
GX5870 | Boron oxide, 97+% |
GX5890 | Boron oxide, 99.9% |
GX8642 | Boron oxide, 99.99% |
GX7757 | Boron oxide, 99.999% |
GX9595 | Boron phosphate, anhydrous (powder max. 250 microns) |
GX2027 | Boron Pieces, crystalline, 1-20 mm, 99% |
GX4761 | Boron Powder max. 1000 micron, crystalline, doping grade, 99.995% |
GX6932 | Boron Powder, amorphous, 2 micron, 99,9% |
GX7777 | Boron Powder, amorphous, 95-97% |
GX6952 | Boron Powder, crystalline, 40 micron, 99% |
GX2200 | Boron Powder, crystalline, -4 mesh, 99.95+% |
GA9584 | Borrelidin |
GP0262 | Bortezomib |
GP5893 | Bosentan hydrate |
GW5061 | Bostrycin |
GE1877 | Bovine Serum Albumin |
GE3699 | Bovine Serum Albumin, 98% by electrophoresis |
GK9808 | Bovine Serum Albumin, 99% |
GX5685 | Bovine Serum Albumin, fatty acid free |
GX7143 | Bovine Serum Albumin, GlenCell?, suitable for cell culture |
GX4209 | Bovine Serum Albumin, pH 5.2 |
GK4012 | Bovine Serum Albumin, protease free |
GW0930 | BPTES |
GL1210 | bpV(bipy) |
GW1112 | bpV(bipy) |
GL1269 | bpV(HOpic) |
GL3049 | bpV(phen) |
GL2206 | bpV(pic) |
GL7446 | BQ-123 sodium salt |
GK9247 | BQ-788 |
GT1202 | Bradford Reagent |
GL7727 | Bradykinin |
GA2848 | Brefeldin A |
GW0185 | Brigatinib |
GD4393 | Brij 35 (Laureth-23) |
GD6153 | Brij 35, 10% solution in water |
GD7901 | Brij 35, 30% solution in water |
GT6953 | Brilliant Black BN (C.I. 28440) |
GT9275 | Brilliant Cresyl Blue (C.I. 51010) |
GT8393 | Brilliant Crocein (C.I. 27290) |
GT6123 | Brilliant Green (C.I. 42040) |
GP5583 | Brinzolamide |
GP1791 | Brivanib alaninate |
GE4830 | Bromelain |
GP2862 | Bromelain, 1200 GDU/g |
GL4176 | Bromfenac sodium |
GP8354 | Bromhexine hydrochloride |
GC9191 | Bromo 2,3,4-Tri-O-acetyl-α-D-xylopyranoside |
GC8096 | Bromo-2,3,4-tri-O-benzoyl-α-D-glucuronic acid methyl ester |
GK9405 | Bromobenzene |
GT1727 | Bromobimane |
GW7200 | Bromobutide |
GT2674 | Bromochlorophenol Blue |
GT4023 | Bromocresol Green |
GT3714 | Bromocresol Green sodium salt |
GT6323 | Bromocresol Purple |
GT2398 | Bromocresol Purple sodium salt |
GP6938 | Bromocryptine mesylate |
GK6888 | Bromomethyl acetate |
GP1233 | Bromopheniramine maleate |
GT2874 | Bromophenol Blue |
GT3694 | Bromophenol Blue sodium salt |
GT7578 | Bromophenol Red |
GT3415 | Bromophenol Red sodium salt |
GW6693 | Bromophenylacetyl chloride |
GT1579 | Bromopyrogallol Red |
GT6837 | Bromothymol Blue |
GT8636 | Bromothymol Blue sodium salt |
GK0957 | Bromotrimethylsilane |
GT8506 | Bromoxylenol Blue |
GW6003 | BTBCT |
GP6149 | Bucillamine |
GP1820 | Budesonide |
GL7257 | Bufalin |
GP6678 | Bufexamac |
GE6195 | Buffer solution, pH 10.0 |
GE5959 | Buffer solution, pH 4.0 |
GE8685 | Buffer solution, pH 7.0 |
GE5737 | Buffer solution, pH 7.4 |
GE4974 | Buffer solution, pH 9.0 |
GP0360 | Bumetanide |
GP0621 | Bupivacaine |
GP3506 | Bupivacaine hydrochloride |
GP7829 | Busulfan |
GX4252 | Butafosfan |
GS5432 | Butan-1-ol, GlenDry?, anhydrous |
GS7439 | Butan-1-ol, GlenPure?, analytical grade |
GW2762 | Butocarboxim |
GW5987 | Butroxydim |
GP2383 | Butyl 4-aminobenzoate |
GY1184 | Butyl 4-hydroxybenzoate |
GK3603 | Butyl acetate |
GK7014 | Butylamine |
GK0616 | Butylated hydroxyanisole |
GK4584 | Butylated hydroxytoluene |
GL4464 | Butylcycloheptylprodigiosin |
GK6366 | Butyltriphenylphosphonium bromide |
GL3233 | Butyramide |
GK5603 | Butyric acid |
GL5462 | Butyrolactone 3 |
GL5924 | Butyrolactone I |
GL0025 | Butyrolactone II |
GE4710 | Butyrylcholine chloride |
GE5713 | Butyrylthiocholine chloride |
GE8740 | Butyrylthiocholine iodide |
GW6654 | BX-795 |
GW1300 | BX-912 |
GM1618 | Bz-Arg-OEt hydrochloride |
GL5672 | C646 |
GW5222 | CA77.1 [CMA Activator] |
GK0751 | Cabazitaxel |
GW6378 | Cabozantinib |
GP4726 | Cabozantinib malate |
GK4749 | CABS |
GX8912 | Cadmium acetate anhydrous, 99.999% |
GX5619 | Cadmium acetate dihydrate, 98+% |
GX4807 | Cadmium Bar, 99.999% |
GX2127 | Cadmium carbonate, 99.999% |
GX1555 | Cadmium chloride, anhydrous, 99+% |
GX8224 | Cadmium fluoride, 99.99+% |
GX2581 | Cadmium Foil 0.125mm, 99.999% |
GX0787 | Cadmium Foil 0.25mm, 99.99% |
GX2652 | Cadmium Foil 0.5mm, 99.99% |
GX7681 | Cadmium Foil 1.0mm, 99.99% |
GX2578 | Cadmium Granules 1-5 mm, 99.999% |
GX7208 | Cadmium Granules 1-5 mm, 99.9999% |
GX5272 | Cadmium iodide, 99% |
GX6089 | Cadmium oxide, 99.9% |
GX5303 | Cadmium oxide, 99.999% |
GX1084 | Cadmium Powder -325 mesh, 99.5% |
GX4548 | Cadmium Rod 10 mm diameter, 99.9% |
GX1723 | Cadmium Rod 8 mm diameter, 99.999% |
GX6596 | Cadmium selenide, 99.99+% |
GX9718 | Cadmium sulfate hydrate, 98+% |
GX7317 | Cadmium sulfate, anhydrous, 99.99+% |
GX1026 | Cadmium telluride, 99.99+% |
GX6019 | Cadmium Wire 1.0 mm diameter, 99.999% |
GW9174 | Cadusafos |
GX0291 | Caerulein, Ceruletide, Cerulein |
GE7657 | Caesium chloride |
GP1593 | Caffeic acid |
GC3896 | Caffeic acid 3-b-D-glucoside |
GC3370 | Caffeic acid 3-O-β-D-glucuronide |
GK2776 | Caffeic acid phenethyl ester |
GP1191 | Caffeine, 99% |
GP3094 | Caffeine, Ph. Eur., USP grade |
GK2524 | Calcein |
GT0291 | Calcein-AM |
GP9482 | Calcitriol |
GX2908 | Calcium 2,4-pentanedionate |
GE2473 | Calcium acetate hydrate |
GX9364 | Calcium aluminate, 99% |
GX2588 | Calcium boride |
GX1601 | Calcium carbonate, 99.9% |
GK3384 | Calcium carbonate, 99% |
GX0868 | Calcium carbonate, 99%, precipitated, Ph. Eur., BP, USP, FCC grade |
GK8162 | Calcium carbonate, technical |
GX4694 | Calcium caseinate |
GK9858 | Calcium chloride dihydrate |
GX0152 | Calcium chloride dihydrate, fine crystals, Ph. Eur., USP grade |
GK3739 | Calcium chloride, anhydrous |
GE5772 | Calcium chloride, anhydrous, 95%, granular, 1 mm |
GK8811 | Calcium chloride, anhydrous, granular, 1 - 6 mm |
GC7882 | Calcium D-gluconate monohydrate |
GX2796 | Calcium fluoride, 99.5% |
GX8804 | Calcium fluoride, 99.9% |
GK2342 | Calcium fluoride, 99% |
GX2349 | Calcium formiate, tech. |
GE8136 | Calcium glycerophosphate |
GX0580 | Calcium Granules -6 mesh, 99.5% |
GX1137 | Calcium Granules 2-6 mm, 98.5+% |
GP2596 | Calcium hopantenate |
GK0014 | Calcium hydroxide |
GX9138 | Calcium hydroxide, 96% |
GX2264 | Calcium hypophosphite |
GX6762 | Calcium iodide hydrate, tech. |
GE5436 | Calcium Ionophore A23187 |
GC5958 | Calcium L-threonate |
GE4641 | Calcium lactate pentahydrate |
GE9273 | Calcium nitrate tetrahydrate |
GX3982 | Calcium orthophosphate |
GX6350 | Calcium oxalate hydrate, 99% |
GX1175 | Calcium oxide |
GX5050 | Calcium oxide max. 10 microm, 99.99% |
GX3058 | Calcium oxide, 99.95% |
GL2559 | Calcium phosphate dibasic dihydrate |
GL2117 | Calcium phosphate dibasic, anhydrous, EP, USP grade |
GX5985 | Calcium phosphate monobasic monohydrate |
GE2503 | Calcium phosphate tribasic |
GX2539 | Calcium propionate |
GX9424 | Calcium pyrophosphate, 96+% |
GE6492 | Calcium pyruvate |
GK5845 | Calcium stearate, non-animal origin |
GK5062 | Calcium sulfate dihydrate |
GX7586 | Calcium sulfate dihydrate, BP, Ph. Eur. grade |
GK9093 | Calcium sulfate, anhydrous, 99% |
GX0429 | Calcium titanate, 99% |
GX9049 | Calcium tungstate, 99+% |
GK3350 | Calconcarboxylic acid |
GT2244 | Calmagite |
GK5680 | Calpain Inhibitor I |
GK6416 | Calpain Inhibitor II |
GP3712 | Calphostin C |
GL7024 | Calpinactam |
GK1704 | Calycosin |
GP4306 | Camostat mesylate |
GL6884 | Camphor |
GT1682 | Canada balsam |
GC9385 | Canagliflozin 3-O-β-D-glucuronide |
GP6212 | Candesartan cilexetil |
GW7411 | Canertinib |
GC5631 | Canrenone-2,2,21,21-d4 |
GA2874 | Capastat sulphate |
GP6220 | Capecitabine |
GX0795 | Capryloyl salicylic acid |
GB0318 | CAPS |
GP1219 | Capsaicin, natural |
GP2777 | Capsaicin, USP grade |
GK3881 | Capsicum oleoresin, 50%, USP grade |
GB7246 | CAPSO |
GB4515 | CAPSO sodium salt |
GP2833 | Captopril |
GP8250 | Carbamazepine |
GL9772 | Carbamoylcholine chloride |
GL8921 | Carbamyl-beta-methylcholine chloride |
GT3190 | Carbazole |
GP4639 | Carbendazole |
GA1299 | Carbenicillin disodium salt |
GL0800 | Carbetapentane citrate salt |
GP7031 | Carbidopa |
GP8410 | Carbimazole |
GP7553 | Carbinoxamine maleate salt |
GM0472 | Carbobenzyloxy-L-valine |
GP3206 | Carbocisteine |
GX4445 | Carbofuran |
GT3597 | Carbol Fuchsin |
GS7652 | Carbon Disulphide, GlenDry?, anhydrous |
GS8675 | Carbon Disulphide, GlenPure?, analytical grade low in benzene |
GW8064 | Carbonate ionophore VII |
GL5456 | Carbonyl cyanide 3-chlorophenylhydrazone |
GX3600 | Carbonyl dihydrido tris (triphenylphosphine) ruthenium(II); 99.95% (metals basis) |
GX8694 | Carbonyltriphenylphosphine-rhodium(I)-2,4-pentanedionate, 99.95% (metals basis) |
GW7075 | Carbophenothion |
GA9420 | Carboplatin |
GW4492 | Carboxy-DCF |
GW5389 | Carboxy-DCFDA |
GW9790 | Carboxy-DCFDA N-succinimidyl ester |
GC2160 | Carboxymethyl chitosan |
GC7698 | Carboxymethylcellulose sodium salt, high viscosity |
GC7604 | Carboxymethylcellulose sodium salt, low viscosity |
GC2916 | Carboxymethylcellulose sodium salt, medium viscosity |
GC0321 | Carboxymethylcellulose sodium salt, very low viscosity |
GK7814 | Carboxytolbutamide |
GK9563 | Cardamonin |
GT1409 | Cardiogreen |
GT1101 | Cardiogreen, 95%, USP grade |
GP8753 | Carfilzomib |
GP0362 | Carisoprodol |
GT9400 | Carmine (C.I. 75470) |
GT3566 | Carmine (C.I. 75470); certified |
GT8708 | Carminic acid |
GP5925 | Carmofure |
GP0434 | Carnosol |
GW2787 | Caroverin |
GP6077 | Carprofen |
GP9460 | Carvacrol |
GP1095 | Carvedilol |
GE4125 | Casein |
GE5861 | Casein sodium salt |
GP8659 | Caspofungin acetate |
GP5690 | Castanospermine |
GL4383 | Castor oil, EP grade |
GC8147 | Catalpol |
GP5013 | Catechin |
GW5918 | CC-401 hydrochloride |
GW0047 | CCT244747 |
GK8139 | CD-3 |
GL6882 | Cedar oil |
GA0871 | Cefaclor |
GA2276 | Cefadroxil monohydrate |
GA1648 | Cefalexin |
GA5297 | Cefalonium hydrate |
GA3485 | Cefalotin |
GA7688 | Cefamandole nafate |
GA9567 | Cefamandole sodium salt |
GP5306 | Cefapirin sodium salt |
GA2577 | Cefazolin |
GA4751 | Cefazolin sodium salt |
GA4490 | Cefdinir |
GA6734 | Cefditoren pivoxil |
GA4627 | Cefditoren sodium salt |
GA3114 | Cefepime dihydrochloride hydrate |
GA2558 | Cefixime trihydrate |
GA4116 | Cefmetazole sodium salt |
GA8575 | Cefoperazone |
GA8838 | Cefoperazone sodium salt |
GA3583 | Cefotaxime sodium salt |
GA5476 | Cefotetan disodium salt |
GL6662 | Cefotiam dihydrochloride hydrate |
GA4412 | Cefoxitin sodium salt |
GA2123 | Cefpirome sulfate |
GA5004 | Cefpodoxime free acid |
GA2186 | Cefpodoxime proxetil |
GA7534 | Cefpodoxime sodium salt |
GA0910 | Cefprozil monohydrate |
GA1461 | Cefsulodin sodium salt hydrate |
GA6002 | Ceftazidime hydrate |
GA1898 | Ceftazidime hydrate, contains approx. 10% sodium carbonate |
GA7818 | Ceftibuten hydrate |
GA7212 | Ceftiofur |
GA9252 | Ceftiofur hydrochloride |
GA9758 | Ceftiofur sodium salt |
GA1367 | Ceftizoxime |
GA1247 | Ceftizoxime sodium salt |
GA6812 | Ceftriaxone disodium salt hemi(heptahydrate) |
GA9610 | Cefuroxime |
GA1625 | Cefuroxime sodium salt |
GP7348 | Celastrol |
GP8233 | Celecoxib |
GC8644 | Celecoxib carboxylic acid acyl-b-D-glucuronide |
GT3004 | Celestine blue |
GC2580 | Cellobiulose |
GC5469 | Cellotetraose |
GV0115 | Cellulose, microcrystalline powder, 50 micron |
GV9004 | Cellulose, microcrystalline powder, 50 micron, BP, Ph. Eur., USP grade |
GV9019 | Cellulose, microcrystalline powder, 90 micron |
GV7681 | Cellulose, microcrystalline powder, 90 micron, BP, Ph. Eur., USP grade |
GW6518 | CEP-33779 |
GL7294 | Cephalochromin |
GX7542 | Cephalotaxine |
GA6496 | Cephalothin sodium salt |
GP8908 | Cepharanthine |
GA8023 | Cephradine |
GA1747 | Cercosporin |
GX5397 | Cerium Foil 0.25mm, 99.9% |
GX0145 | Cerium hydroxide, 99.9% |
GX4393 | Cerium hydroxide, 99.99% |
GX3427 | Cerium phosphate hydrate, 99.9% |
GX9155 | Cerium Pieces max. 13 mm, 99.9% |
GX2972 | Cerium Rod 12.5 mm diameter, 99.9% |
GX3674 | Cerium Wire 1 mm diameter, 99.9% |
GX6721 | Cerium(III) acetate hydrate, 99.9% |
GX6980 | Cerium(III) acetate hydrate, 99.999% |
GX4341 | Cerium(III) bromide, anhydrous, 99.9% |
GX5012 | Cerium(III) carbonate hydrate, 99.9% |
GX7567 | Cerium(III) carbonate hydrate, 99.99% |
GX4404 | Cerium(III) carbonate hydrate, 99.999% |
GK0556 | Cerium(III) chloride heptahydrate |
GX8358 | Cerium(III) chloride hydrate, 99.9% |
GX1327 | Cerium(III) chloride hydrate, 99.99% |
GX5741 | Cerium(III) chloride hydrate, 99.999% |
GX6202 | Cerium(III) chloride, anhydrous, 99.5+% |
GX2205 | Cerium(III) chloride, anhydrous, 99.9% |
GX1483 | Cerium(III) fluoride anhydrous, 99.9% |
GX6513 | Cerium(III) fluoride anhydrous, 99.999% |
GX3407 | Cerium(III) fluoride, 99.9% |
GX8403 | Cerium(III) fluoride, 99% |
GK5085 | Cerium(III) nitrate hexahydrate |
GX4597 | Cerium(III) nitrate hexahydrate, 99.9% |
GX1603 | Cerium(III) oxalate, 99.9% |
GX1669 | Cerium(III) sulfate, anhydrous, 99.9% |
GX1915 | Cerium(IV) oxide-Nano Powder, 99.5+% |
GX5584 | Cerium(IV) oxide-Nano Powder, 99.5+% |
GX3994 | Cerium(IV) oxide, 99.9% |
GX7459 | Cerium(IV) oxide, 99.9% |
GX9234 | Cerium(IV) oxide, 99.99% |
GX1622 | Cerium(IV) oxide, 99.999% |
GX7584 | Cerium(IV) oxide, 99.999% |
GX1156 | Cerium(IV) oxide, 99% |
GX5310 | Cerium(IV) oxide, nanopowder, 99.95% |
GX0322 | Cerium(IV) sulfate |
GX7470 | Cerium(IV) sulfate anhydrous, 99% |
GX9863 | Cerium(IV) sulfate tetrahydrate |
GA8298 | Cerulenin |
GX8142 | Cesium acetate, 99.9% |
GX3596 | Cesium acetate, 99.99% |
GX2996 | Cesium acetate, 99% |
GX7343 | Cesium bromide, 99.9% |
GX1093 | Cesium bromide, 99% |
GX4299 | Cesium carbonate, 99.9% |
GX9334 | Cesium carbonate, 99.99% |
GX4672 | Cesium carbonate, 99.995% |
GX3537 | Cesium carbonate, 99% |
GX3346 | Cesium chloride, 99.9% |
GX3401 | Cesium chloride, 99.99% |
GX6704 | Cesium chloride, 99% |
GX5259 | Cesium fluoride, 99.9% |
GX3712 | Cesium fluoride, 99.99% |
GX0633 | Cesium fluoride, 99.999% |
GX3811 | Cesium hydrogen carbonate, 99.99% |
GX5386 | Cesium hydrogen carbonate, 99% |
GX5111 | Cesium iodide, 99.9% |
GX6626 | Cesium iodide, 99.99% |
GX8661 | Cesium iodide, 99.999% |
GX0604 | Cesium iodide, 99% |
GX4170 | Cesium nitrate, 99.9% |
GX8481 | Cesium nitrate, 99.99% |
GX3362 | Cesium nitrate, 99.999% |
GX3250 | Cesium nitrate, 99% |
GX6120 | Cesium sulfate, 99.5% |
GX6406 | Cesium sulfate, 99.9% |
GX4854 | Cesium sulfate, 99.99% |
GP4015 | Cetirizine dihydrochloride |
GP9031 | Cetrimide |
GK0601 | Cetyldimethylethylammonium bromide |
GK4657 | Cetylpyridinium bromide |
GA9566 | Cetylpyridinium chloride monohydrate |
GW2058 | CFI-400437 |
GL2101 | cGAMP disodium salt |
GK5122 | CGP-53353 |
GW6344 | CH4987655 |
GW5885 | CH5132799 |
GL4649 | Chaetoglobosin A |
GW3177 | Chaetoglobosin C |
GW6792 | Chaetoglobosin F |
GL0398 | Chaetoviridin A |
GL8173 | Chalcomycin |
GY2537 | Chamazulene |
GB6883 | CHAPS |
GB7497 | CHAPSO |
GA4206 | Chartreusin |
GY5277 | Chebulagic acid |
GK3169 | Chebulinic acid |
GP2808 | Chelerythrine chloride |
GP7061 | Chenodeoxycholic acid |
GL7692 | Chenodeoxycholic acid sodium salt |
GB1106 | CHES |
GA8919 | Chetomin |
GK9771 | Chicago Sky Blue 6B |
GL0945 | Chicoric acid |
GC0425 | Chitin |
GC1909 | Chitosan |
GP5480 | Chitosan (10 cps); very low molecular weight |
GP7325 | Chitosan (100 - 300 cps); low molecular weight |
GP5053 | Chitosan (1000 - 2000 cps); high molecular weight |
GP8689 | Chitosan (2000 - 3500 cps); very high molecular weight |
GP8523 | Chitosan (30 - 100 cps); low molecular weight |
GP8956 | Chitosan (300 - 1000 cps); medium molecular weight |
GP2129 | Chitosan (3000 - 6500 cps); very high molecular weight |
GP1318 | Chitosan (5 cps); ultra low molecular weight |
GU8920 | Chitosan hydrochloride (10 - 120 cps) |
GU0761 | Chitosan oligosaccharide |
GE4907 | Chitosan, from squid |
GC9009 | Chitosan, low molecular weight |
GC1115 | Chitotriose trihydrochloride |
GE3211 | Chloral hydrate, 99% |
GP0879 | Chlorambucil |
GE5939 | Chloramine T trihydrate |
GA0258 | Chloramphenicol |
GA5075 | Chloramphenicol palmitate |
GA0505 | Chloramphenicol, USP grade |
GX0195 | Chloranilic acid, barium salt |
GT4928 | Chlorazol Black (C.I. 30235) |
GX8839 | Chlorfenapyr |
GP9341 | Chlorhexidine |
GA1676 | Chlorhexidine diacetate salt hydrate |
GP2120 | Chlorhexidine digluconate, 20% in water |
GW4279 | Chlornitrofen |
GK6154 | Chloroacetic acid |
GS9671 | Chlorobenzene, GlenDry?, anhydrous |
GS4307 | Chlorobenzene, GlenPure?, analytical grade |
GP8327 | Chlorobutanol |
GS1454 | Chloroform, GlenDry?, anhydrous stabilised with amylene |
GS1447 | Chloroform, GlenDry?, anhydrous stabilised with amylene over molecular sieve |
GS0166 | Chloroform, GlenPure?, analytical grade stabilised with amylene |
GS8231 | Chloroform, GlenPure?, analytical grade stabilised with ethanol |
GX1862 | Chloroform:Isoamyl alcohol 24:1 |
GE3686 | Chlorogenic acid |
GL6075 | Chloroguanabenz acetate |
GT3722 | Chlorophenol Red |
GT3351 | Chlorophenol Red sodium salt |
GC5710 | Chlorophenol red β-D-cellotrioside |
GK0681 | Chloroplatinic acid hexahydrate |
GX8564 | Chloroplatinic acid hydrate |
GA7477 | Chloroquine diphosphate salt |
GK4650 | Chlorotrimethylsilane |
GK8706 | Chlorotriphenylmethane |
GP7266 | Chlorpromazine hydrochloride |
GL6406 | Chlorpropamide |
GX2033 | Chlorpropham |
GE2650 | Chlorsulfuron |
GA8098 | Chlortetracycline hydrochloride |
GP6973 | Chlorzoxazone |
GT2746 | Chocolate Brown HT (C.I. 20285) |
GV0048 | Cholecalciferol |
GE1295 | Cholesterol |
GE7110 | Cholesterol, non-animal origin |
GE0100 | Cholesterol, USP/NF grade, from lanolin |
GE0043 | Cholesteryl acetate |
GW6273 | Cholesteryl coumarin-3-carboxylate |
GL2093 | Cholesteryl phenylacetate |
GD0884 | Cholic acid |
GD5134 | Cholic acid sodium salt hydrate |
GL2853 | Choline bitartrate |
GV0497 | Choline chloride |
GV9961 | Choline chloride, USP grade |
GC6763 | Chondroitin sulfate A sodium salt |
GC0982 | Chondroitin sulfate, from bovine origin |
GC3554 | Chondroitin sulfate, from bovine origin, USP grade |
GK9782 | Chrome Azurol S |
GT5884 | Chromeazurol B |
GX0027 | Chromium boride |
GX4494 | Chromium boride, 99+% |
GX2872 | Chromium boride, 99+% |
GX2744 | Chromium carbide max. 10 micron |
GX3062 | Chromium carbide, 99% |
GX8032 | Chromium carbide, 99% |
GX0410 | Chromium electrolytic pieces, 99.9% |
GX0257 | Chromium Foil 0.5 mm, 99.95% |
GX1682 | Chromium Foil 1 mm, 99.95% |
GX7997 | Chromium Granules 0.5-2 mm low oxygen, 99.98% |
GX7311 | Chromium Granules 1-3 mm, 99.94+% |
GX7377 | Chromium Granules 1-3 mm, 99+% |
GX6873 | Chromium Nanopowder, coated with oleic acid, 99,5 % |
GX4749 | Chromium nitride, 99% |
GV9468 | Chromium picolinate |
GX2285 | Chromium Pieces 1-6 mm, 99.998% |
GX5688 | Chromium Pieces 2-4.7 mm, 99.99% |
GX4156 | Chromium Pieces 3-6 mm, 99.99% |
GX7117 | Chromium Pieces max. 25 mm, 99.99% |
GX9992 | Chromium Pieces max. 25 mm, 99+% |
GX7481 | Chromium Powder -100, +325 mesh, 99.99% |
GX9375 | Chromium Powder max. 160 micron, 99+% |
GX0993 | Chromium Powder max. 500 micron, 99.9% |
GX6846 | Chromium Rod 1 mm diameter, 99.9+% |
GX3857 | Chromium Rod 2 mm diameter, 99.9+% |
GX8217 | Chromium Rod 3 mm diameter, 99.9+% |
GX7727 | Chromium Rod 5 mm diameter, 99.9+% |
GX3634 | Chromium Rod 6 mm diameter, 99.7% |
GX6042 | Chromium silicide, 99.5% |
GX4955 | Chromium(II) fluoride |
GX8870 | Chromium(III) 2,4-pentanedionate |
GX7557 | Chromium(III) chloride hexahydrate |
GX6223 | Chromium(III) chloride, anhydrous, 97% |
GX6343 | Chromium(III) chloride, hexahydrate, 99.995% |
GX7644 | Chromium(III) nitrate, nonahydrate, 97% |
GX0244 | Chromium(III) oxide Nanopowder, 99+ % |
GX0492 | Chromium(III) oxide, 99.97% |
GX8616 | Chromium(III) potassium sulfate dodecahydrate |
GT1771 | Chromoionophore I |
GT1481 | Chromotrope 2B |
GT8047 | Chromotrope 2R (C.I. 16570) |
GL4239 | Chromotrope FB (C.I. 14720) |
GT6352 | Chromotropic acid sodium salt |
GP8179 | Chrysin |
GA3480 | Chrysomycin A |
GA9550 | Chrysomycin B |
GL8838 | CHS-828 |
GT9393 | Cibacron Brilliant Red 3B-A |
GP3015 | Ciclopirox |
GA7329 | Ciclopirox olamine |
GP0753 | Cidofovir hydrate |
GL8018 | Ciglitizone |
GP8376 | Cilastatin sodium salt |
GP7846 | Cilostazol |
GP0061 | Cimetidine |
GW9831 | Cinchocaine |
GP1244 | Cinchonidine |
GK1431 | Cinchonine |
GL3074 | Cinnamon oil, from leaf |
GL7838 | Cinnamtannin B-1 |
GW9974 | Cinnamyltriphenylphosphonium chloride |
GP9214 | Cinnarizine |
GT8023 | Cinnoline hydrochloride |
GP7595 | Cinobufagin |
GA2067 | Cinoxacin |
GC0593 | Ciprofibrate acyl-β-D-glucuronide |
GA2367 | Ciprofloxacin hydrochloride monohydrate |
GP3881 | Ciprofloxacin, 98% |
GA9068 | Ciprofloxacin, USP grade |
GW0717 | cis-11-Methyl-2-dodecenoic acid |
GW0247 | cis-2-Decenoic acid |
GW3885 | cis-2-Dodecenoic acid |
GK0953 | cis-4,7,10,13,16,19-Docosahexaenoic acid, 98% |
GK4054 | cis-5,8,11,14,17-Eicosapentaenoic acid, 96% |
GX4154 | cis-Dichlorodiamine platinum(II); 99.95% (metals basis) |
GL0434 | Cisapride monohydrate |
GA8978 | Cisplatin |
GP8111 | Citalopram hydrobromide |
GP4568 | Citicoline sodium salt |
GL7641 | Citral |
GE4475 | Citrate buffer, 0.09M solution |
GB4634 | Citrate concentrated buffer, 4% solution |
GK0024 | Citric acid monohydrate |
GK9002 | Citric acid monohydrate, Ultrapure |
GV4009 | Citric acid, anhydrous, 99.5%, BP, Ph. Eur., USP grade |
GV2911 | Citric acid, anhydrous, 99% |
GW5425 | Citrinalin A |
GP8412 | Citrinin |
GL9602 | CJ-21058 |
GW4210 | CK2 Inhibitor 10 |
GA3225 | Cladospirone bisepoxide |
GA8846 | Clarithromycin |
GW3158 | Clarithromycin N-oxide |
GK6045 | clasto-Lactacystin b-lactone |
GP8280 | Clevudine |
GA1965 | Climbazole |
GA6414 | Clinafloxacin |
GA9308 | Clindamycin 2-phosphate |
GA5034 | Clindamycin hydrochloride |
GA2166 | Clindamycin palmitate hydrochloride |
GP2221 | Clobetasol propionate |
GP0268 | Clobetasol propionate, USP grade |
GP6103 | Clodronate disodium salt hydrate |
GA9061 | Clofazimine |
GK6504 | Clofibric acid |
GP4170 | Clomiphene citrate |
GP9545 | Clomipramine hydrochloride |
GP5303 | Clonidine hydrochloride |
GA0864 | Clopidol |
GP9491 | Cloprostenol sodium salt |
GW1684 | Clothianidin-d3 |
GA8137 | Clotrimazole |
GK8390 | Clove oil |
GA4688 | Cloxacillin sodium salt |
GP7633 | Clozapine |
GY5145 | Cnidicin |
GX5107 | Cobalt boride |
GX9431 | Cobalt Flake, electrolytic, 99.9% |
GX5174 | Cobalt Foil 0.1 mm, 99.9% |
GX1228 | Cobalt Foil 0.1 mm, 99.99+% |
GX3725 | Cobalt Foil 0.125 mm, 99.9% |
GX3367 | Cobalt Foil 0.25 mm, 99.95% |
GX4517 | Cobalt Foil 0.5 mm, 99.9% |
GX6216 | Cobalt Granules 1-1.5 mm, 99.99% (metals basis) |
GX4966 | Cobalt Nanopowder, 99,8 % |
GX9558 | Cobalt Pellets 6.35 x 6.35 mm, 99.95% |
GX8242 | Cobalt Powder - 200, + 325 mesh (Ni max. 1500 ppm); 99.8+% |
GX8234 | Cobalt Powder -200 mesh, 99.9% |
GX2161 | Cobalt Powder -50 mesh (Ni max. 1500 ppm); 99.99% |
GX4468 | Cobalt Powder 2-4 micron, 99.5% |
GX6439 | Cobalt Rod 12 mm diameter, 99.95% |
GX6761 | Cobalt Rod 5 mm diameter, 99.995% |
GX0438 | Cobalt Rod 5.0 mm diameter, 99.95% |
GX8510 | Cobalt Shot max. 13 mm (Ni max. 2000 ppm); 99.5% |
GX6736 | Cobalt thiocyanate, 98% |
GX7689 | Cobalt Wire 0.5 mm diameter, 99.95% |
GX1752 | Cobalt Wire 1.0 mm diameter, 99.998% |
GX7928 | Cobalt Wire 2.0 mm diameter, 99.99+% |
GX5497 | Cobalt(II,III) oxide-Nano Powder, 99.8% |
GX6239 | Cobalt(II,III) oxide, 98+% |
GX8543 | Cobalt(II,III) oxide, 99.97+% |
GX9460 | Cobalt(II) 2,4-pentanedionate, 98% |
GK1133 | Cobalt(II) acetate tetrahydrate |
GX5571 | Cobalt(II) acetate, anhydrous |
GK0520 | Cobalt(II) chloride hexahydrate |
GX7281 | Cobalt(II) chloride-1,5-Tetrahydrofuran |
GK0658 | Cobalt(II) chloride, anhydrous |
GX6043 | Cobalt(II) fluoride |
GX0081 | Cobalt(II) hydroxide |
GK6333 | Cobalt(II) nitrate hexahydrate |
GX7772 | Cobalt(II) sulfate heptahydrate |
GX8406 | Cobalt(III) 2,4-pentanedionate, 98% |
GX1019 | Cobalt(III) fluoride, 99% |
GW8373 | Cochliodone A |
GK0114 | Coenzyme A hydrate |
GL9113 | Coenzyme A sodium salt hydrate |
GE3164 | Coenzyme A trilithium salt |
GP8985 | Coenzyme B12 |
GP6626 | Coenzyme Q10 |
GP6620 | Colchicine |
GA2961 | Colistin sodium methanesulfonate |
GA9867 | Colistin sulfate salt |
GW9578 | Collagenase Chromophore-Substrate Component A |
GW5573 | Collagenase-Chromophore-Substrate Test Substance |
GK1470 | Combretastatin A4 |
GL3740 | Compound 112254 |
GL8859 | Compound 112254 hydrochloride |
GL2080 | Compound 34 |
GL3746 | Compound E |
GA7236 | Concanamycin A |
GL5497 | Concanamycin B |
GA8504 | Concanamycin C |
GT5674 | Congo Red (C.I. 22120) |
GW2714 | Convulxin |
GT0353 | Coomassie Brilliant Blue G250 (C.I. 42655) |
GT3543 | Coomassie Brilliant Blue R250 (C.I. 42660) |
GX9861 | Copovidone |
GX3180 | Copper aluminate, 99+% |
GX1957 | Copper Bar, 99.999% |
GX9218 | Copper Bar, 99.9998 |
GX6999 | Copper Clippings 2.4 x 5 mm, 99.99% |
GX9961 | Copper Foil (OFHC) 0.1 mm, 99.99% |
GX6963 | Copper Foil (OFHC) 0.25 mm, 99.95+% |
GX8989 | Copper Foil (OFHC) 0.5 mm, 99.95+% |
GX7255 | Copper Foil (OFHC) 1.0 mm, annealed, 99.99% |
GX5618 | Copper Foil 0.025 mm, 99.9% |
GX4083 | Copper Foil 0.035 mm, 99.95% |
GX3203 | Copper Foil 0.05 mm (OFHC); hard, 99.95+% |
GX1206 | Copper Foil 0.05 mm, 99.995+% |
GX9753 | Copper Foil 0.05 mm, hard, 99.9% |
GX6307 | Copper Foil 0.07 mm, 99.95% |
GX2765 | Copper Foil 0.1 mm, 99.99+% |
GX0632 | Copper Foil 0.1 mm, annealed, 99.998% |
GX1695 | Copper Foil 0.125 mm (OFHC); annealed, 99.99% |
GX3150 | Copper Foil 0.125 mm, 99.995% |
GX4010 | Copper Foil 0.25 mm, 99.9% |
GX3491 | Copper Foil 0.25 mm, 99.99+% |
GX5230 | Copper Foil 0.25 mm, 99.995% |
GX9034 | Copper Foil 0.5 mm, 99.99+% |
GX5226 | Copper Foil 0.5 mm, 99.995+% |
GX0796 | Copper Foil 1.0 mm, 99.99+% |
GX8621 | Copper Gauze 40 mesh, woven from 0.224 mm diameter wire, 99.9% |
GX2423 | Copper Gauze 50 mesh, woven from 0.18 mm diameter wire, 99.9% |
GX1781 | Copper Nanopowder, 99,9 % |
GX2223 | Copper nanopowder, 99.5% [50nm] |
GX3076 | Copper Pellets 15 mm, 99.9% |
GX9321 | Copper Pellets 6 x 6 mm, 99.99% |
GX4414 | Copper Powder -20, +50 mesh, 99.95% |
GX9201 | Copper Powder Cu-OF atomized >=10 micron, d50 = 15 micron, 99.95% |
GX6222 | Copper Powder max. 100 micron, 99.8% |
GX0368 | Copper Powder max. 150 micron, spherical, 99.99% |
GX1935 | Copper Powder max. 250 micron, 99.8% |
GX8965 | Copper Powder max. 500 micron, 99.8% |
GX4942 | Copper Powder, spherical -325 mesh, 99% |
GX7202 | Copper Rod (OFHC) 12.7 mm diameter , 99.95+% |
GX8539 | Copper Rod (OFHC) 25 mm diameter, 99.99+% |
GX9645 | Copper Rod (OFHC) 50 mm diameter, 99.99% |
GX9447 | Copper Rod (OFHC) 6.35 mm diameter, 99.99+% |
GX6906 | Copper Rod (OFHC) 80 mm diameter, 99.99+% |
GX0571 | Copper Rod 13.5 mm diameter, 99.999% |
GX4210 | Copper Rod 3.2 x 150 mm, 99.99+% |
GX6693 | Copper Rod 9.0 mm diameter, 99.98% |
GX6217 | Copper Sheet (OFHC) 2 mm, 99.95+% |
GX9478 | Copper Sheet (OFHC) 3.15 mm, 99.99% |
GX8012 | Copper Sheet (OFHC) 6.35 mm, 99.99% |
GX0908 | Copper Sheet 2 mm, 99.995+% |
GX8885 | Copper Sheet 3.15 mm, 99.995+% |
GX2241 | Copper Sheet 6.35 mm, 99.995+% |
GX0360 | Copper Shot 2-6 mm, 99.9% |
GX4110 | Copper Shot 2-6 mm, 99.999% |
GX3657 | Copper Shot 3-5 mm, 99.9999% |
GX2252 | Copper Shot max. 6 mm, vacuum melted, 99.999% |
GX0341 | Copper tetramethylheptanedionate, 99.9% |
GX9426 | Copper tungstate, 99.5% |
GX8473 | Copper vanadate, 99.5% |
GX2464 | Copper Wire (OFHC) 0.05 mm diameter, annealed, 99.99% |
GX9269 | Copper Wire (OFHC) 0.1 mm diameter, annealed, 99.9% |
GX2254 | Copper Wire (OFHC) 0.125 mm diameter, annealed, 99.99% |
GX1090 | Copper Wire (OFHC) 0.2 mm diameter, annealed, 99.99% |
GX0943 | Copper Wire (OFHC) 0.25 mm diameter, annealed, 99.99% |
GX3655 | Copper Wire (OFHC) 0.4 mm diameter, annealed, 99.99% |
GX3345 | Copper Wire (OFHC) 0.5 mm diameter, 99.95+% |
GX4550 | Copper Wire (OFHC) 0.75 mm diameter, 99.99% |
GX0672 | Copper Wire (OFHC) 1.0 mm diameter, annealed, 99.99% |
GX1053 | Copper Wire (OFHC) 1.5 mm diameter, annealed, 99.99% |
GX7589 | Copper Wire (OFHC) 2.0 mm diameter, annealed, 99.99% |
GX2547 | Copper Wire 0.1 mm diameter, 99.995+% |
GX8929 | Copper Wire 0.125 mm diameter, annealed, 99.998% |
GX4746 | Copper Wire 0.25 mm diameter, 99.9% |
GX4831 | Copper Wire 0.25 mm diameter, 99.995+% |
GX4330 | Copper Wire 0.5 mm diameter, 99.9% |
GX3607 | Copper Wire 0.5 mm diameter, annealed, 99.995+% |
GX8177 | Copper Wire 0.75 mm diameter, annealed, 99.995+% |
GX3143 | Copper Wire 1.0 mm diameter, 99.9% |
GX6629 | Copper Wire 1.0 mm diameter, 99.99+% |
GX2512 | Copper Wire 1.0 mm diameter, annealed, 99.998% |
GX8874 | Copper Wire 1.5 mm diameter, annealed, 99.999% |
GX7867 | Copper Wire 2.0 mm diameter, annealed, 99.995+% |
GX1888 | Copper(I) bromide |
GX7017 | Copper(I) chloride, anhydrous, 97+% |
GX2675 | Copper(I) iodide, 99.999% |
GX4471 | Copper(I) oxide |
GX3380 | Copper(I) oxide, 99% |
GX3738 | Copper(I) sulfide, 98+% |
GX5762 | Copper(I) thiocyanate |
GX7274 | Copper(II) 2,4-pentanedionate |
GK0898 | Copper(II) acetate monohydrate |
GK0122 | Copper(II) acetate, anhydrous |
GK3536 | Copper(II) bromide |
GX6283 | Copper(II) carbonate basic, Cu min. 55% |
GK5717 | Copper(II) chloride dihydrate |
GK8996 | Copper(II) chloride, anhydrous |
GC2612 | Copper(II) D-gluconate |
GW7206 | Copper(II) ionophore IV |
GX6874 | Copper(II) nitrate trihydrate |
GX4787 | Copper(II) nitrate, hydrate, 99.999% |
GX2222 | Copper(II) oxide Nanopowder, 99,9 % |
GX1818 | Copper(II) oxide, 99.999% |
GX6347 | Copper(II) oxide, 99% |
GX4332 | Copper(II) oxide, tech.,96+% |
GX3834 | Copper(II) pyrophosphate |
GK0112 | Copper(II) sulfate pentahydrate |
GK6560 | Copper(II) sulfate pentahydrate, 99%, Ph. Eur. grade |
GX8887 | Copper(II) sulfate, anhydrous, 98% |
GK7077 | Copper(II) sulfate, anhydrous, Ph. Eur. grade |
GX4112 | Copper(II) sulfide, 99.5% |
GW2432 | Copper(II) tartrate hydrate |
GX6318 | Copper(II) tetrafluoroborate, 50% solution |
GX7476 | Copper(lI) oxide, 99.99% |
GK8335 | Copper(ll) dioctadecanoate |
GA1331 | Cordycepin |
GC8106 | Corilagin |
GL7753 | Corn oil |
GL8496 | Corosolic acid |
GP7495 | Cortisone |
GX8820 | Costunolide |
GL3259 | Cottonseed oil |
GW5505 | Coumaphos |
GK2204 | Coumarin |
GK3599 | Coumarin 6 |
GL8151 | Coumarin 7 |
GW9386 | Coumarin-6-sulfonyl chloride |
GW3270 | CP-724714 |
GE9561 | Creatine monohydrate |
GE7721 | Creatine phosphate disodium salt hydrate |
GV1128 | Creatine, anhydrous |
GK8780 | Creatinine |
GT0793 | Cresol Red |
GT1602 | Cresol Red sodium salt |
GT8071 | Cresyl Violet acetate |
GW2561 | Crizotinib |
GT0121 | Crocein Orange G |
GT9692 | Croconic acid |
GP8420 | Cromolyn sodium salt |
GX1396 | Crotaline |
GP2631 | Crotamiton |
GT6539 | Crystal Ponceau 6R (C.I. 16250) |
GA9809 | Crystal Violet (C.I. 42555) |
GA0011 | Crystal Violet (C.I. 42555); USP grade |
GA9396 | Crystal violet, 1% solution |
GW1762 | CTPB |
GY2441 | Cucurbitacin B |
GY1460 | Cucurbitacin E |
GT0764 | Cupferron |
GP8291 | Curcumin |
GC7926 | Curcumin 4-O-β-D-glucuronide |
GP7022 | Curcumin, pure, 98% |
GL2917 | Curdlan |
GA6429 | Curvularin |
GL0062 | Curvulin |
GW7982 | CX-4945 hydrochloride |
GW7022 | CX-6258 |
GK7537 | Cyanidin chloride |
GC2852 | Cyanidin-3-O-galactoside chloride |
GC4701 | Cyanidin-3-O-glucoside |
GW0803 | CYC116 |
GL3913 | Cyclic Pifithrin-alpha hydrobromide |
GL3526 | Cycloaspeptide A |
GW9900 | Cycloastragenol |
GP8769 | Cyclobenzaprine hydrochloride |
GK7632 | Cyclohexane, 99% |
GS5948 | Cyclohexane, GlenDry?, anhydrous |
GS5141 | Cyclohexane, GlenDry?, anhydrous over molecular sieve |
GS6572 | Cyclohexane, GlenPure?, analytical grade |
GS6038 | Cyclohexanone, GlenDry?, anhydrous |
GS3077 | Cyclohexanone, GlenPure?, analytical grade |
GA3429 | Cycloheximide |
GW9837 | Cyclohexyl isocyanate |
GK9927 | Cyclohexyl salicylate |
GL2803 | Cyclopamine |
GL0615 | Cyclopenin |
GK6770 | Cyclopenol |
GK2037 | Cyclophosphamide monohydrate |
GA6323 | Cyclosporin A |
GA2331 | Cyclosporin A, USP grade |
GP9440 | Cyclosporin D |
GL1342 | Cyclosporin H |
GW7399 | Cyflufenamid |
GL3276 | Cynarin |
GY8068 | Cynaropicrin |
GL0073 | Cypermethrin |
GA6777 | Cyproconazole |
GL4393 | Cyproheptadine hydrochloride sesquihydrate |
GP5710 | Cyromazin |
GK9885 | Cystamine dihydrochloride |
GK6502 | Cysteamine hydrochloride |
GP6403 | Cytarabine |
GC1136 | Cytidine |
GN9992 | Cytidine 5''-diphosphate disodium salt |
GE2975 | Cytidine 5''-monophosphate |
GN9752 | Cytidine 5''-triphosphate disodium salt |
GE9117 | Cytidine-5''-diphosphate trisodium salt dihydrate |
GP9015 | Cytidine-5’-triphosphate disodium salt |
GP1733 | Cytisine |
GA2080 | Cytochalasin B |
GL9543 | Cytochalasin H |
GL7048 | Cytochalasin J |
GE9437 | Cytochrome C, from equine heart |
GE8084 | Cytosine |
GE8537 | Cytosine-beta-D-arabinofuranoside-5''-monophosphate |
GL5051 | Cytostatin |
GC9540 | D-(-)-Erythrose |
GC9966 | D-(-)-Fructose |
GK0142 | D-(-)-Mandelic acid |
GX9487 | D-(-)-Pantolactone |
GE1274 | D-(-)-Quinic acid |
GC2963 | D-(-)-Tagatose |
GC7600 | D-(+)-Arabitol |
GV9012 | D-(+)-Biotin, 98% |
GV4685 | D-(+)-Biotin, EP, USP grade |
GL5750 | D-(+)-Camphoric acid |
GC8006 | D-(+)-Cellobiose |
GC0754 | D-(+)-Cellotriose |
GC6238 | D-(+)-Fucose |
GC4603 | D-(+)-Galactosamine hydrochloride |
GC7360 | D-(+)-Galactose |
GC8777 | D-(+)-Galactose, non-animal origin |
GC6294 | D-(+)-Galacturonic acid monohydrate |
GC5349 | D-(+)-Glucose monohydrate |
GC9110 | D-(+)-Glucose monohydrate, Ph. Eur., USP grade |
GC6947 | D-(+)-Glucose, anhydrous |
GC0103 | D-(+)-Glucose, anhydrous, Ph. Eur., USP grade |
GC1102 | D-(+)-Maltose monohydrate, 95% |
GC5556 | D-(+)-Maltose monohydrate, USP/NF grade |
GC7397 | D-(+)-Mannose |
GC8181 | D-(+)-Mannose, 99%, from wood |
GC6165 | D-(+)-Melezitose hydrate |
GC9604 | D-(+)-Melibiose monohydrate |
GC7900 | D-(+)-Trehalose dihydrate |
GC1201 | D-(+)-Trehalose dihydrate, Ph. Eur. grade |
GC1516 | D-(+)-Trehalose, anhydrous |
GC5855 | D-(+)-Turanose |
GC9897 | D-(+)-Xylose |
GC4822 | D-(+)-Xylose, USP grade |
GK9553 | D-a-Tocopherol succinate |
GM9575 | D-Alanine |
GC3267 | D-Allose |
GM7112 | D-Allylglycin |
GK2339 | D-alpha-Tocopherol polyethylene glycol succinate |
GC6439 | D-Arabinose |
GM7267 | D-Arginine |
GM5489 | D-Arginine monohydrochloride |
GM5903 | D-Asparagine monohydrate |
GM9048 | D-Asparagine, anhydrous |
GM2767 | D-Aspartic acid |
GW9462 | D-Biotin p-nitrophenyl ester |
GC9824 | D-Cellobiitol |
GC3050 | D-Cellobionic acid, ammonium salt |
GC9481 | D-Cellobiose octaacetate |
GC5850 | D-Cellobiose-1''-13C |
GC3538 | D-Cellobiosyl trichloroacetimidate heptaacetate |
GC0849 | D-Cellotetraose tetradecaacetate |
GC4690 | D-Cellotriose undecaacetate |
GA9717 | D-Cycloserine |
GM7143 | D-Cysteine |
GM8208 | D-Cysteine hydrochloride monohydrate |
GM5889 | D-Cystine |
GW2520 | D-erythro-Dihydrosphingosine 1-phosphate |
GC6103 | D-Fructofuranuronic acid |
GC5619 | D-Fructose 1,6-diphosphate trisodium salt octahydrate |
GC1976 | D-Fructose 1,6-diphosphate trisodium salt, anhydrous |
GC1944 | D-Fructose-6-phosphate disodium salt |
GC8555 | D-Galactal |
GC0117 | D-Galactose diethyldithioacetal |
GC5981 | D-Galacturonic acid benzyl ester |
GC4898 | D-Galacturonic acid sodium salt |
GC5777 | D-Globotriose undecaacetate |
GC9693 | D-Glucal |
GC7683 | D-Glucofuranuronic acid, γ-lactone-1,6-13C2 |
GX4314 | D-Gluconic acid, 50% solution |
GC5247 | D-Glucono-1,5-lactone |
GC0780 | D-Glucopyranuronic acid |
GC9126 | D-Glucosamine 2-sulfate sodium salt |
GC2859 | D-Glucosamine hydrochloride |
GC4951 | D-Glucosamine hydrochloride, USP grade |
GC1036 | D-Glucosamine sulfate, potassium chloride salt |
GC2964 | D-Glucose-1-13C |
GC9936 | D-Glucose-1,2,3,4,5,6-13C6 |
GC7048 | D-Glucose-1,6-13C2 |
GC9849 | D-Glucose-6-phosphate disodium salt |
GC0472 | D-Glucose-6-phosphate monosodium salt |
GC9013 | D-Glucuronic acid |
GC8431 | D-Glucuronic acid sodium salt monohydrate |
GC2507 | D-Glucurono-3,6-lactone |
GE7245 | D-Glutamic acid |
GM5255 | D-Glutamine |
GM2039 | D-Histidine |
GE0015 | D-Isoleucine |
GC9781 | D-Lactitol monohydrate |
GM7879 | D-Leucine |
GP9319 | D-Luciferin |
GW9100 | D-Luciferin potassium salt |
GP8979 | D-Luciferin sodium salt |
GM3691 | D-Lysine |
GM4656 | D-Lysine monohydrochloride |
GC8890 | D-Maltose 2,2'',3,3'',4'',6,6''-heptaacetate |
GC4590 | D-Maltotriose undecaacetate |
GC5587 | D-Mannitol |
GC1282 | D-Mannitol, EP, USP grade |
GC0915 | D-Mannofuranuronic acid, γ-lactone |
GC6042 | D-Mannoheptulose |
GC9575 | D-Mannopyranuronic acid |
GC5971 | D-Mannopyranuronic acid, sodium salt |
GC1764 | D-Mannosamine hydrochloride |
GM6497 | D-Methionine |
GL2499 | D-NMMA monoacetate |
GM2284 | D-Ornithine monohydrochloride |
GP3689 | D-Pantethine hydrate |
GP8490 | D-Panthenol |
GE3451 | D-Pantothenic acid calcium salt |
GE9583 | D-Pantothenic acid calcium salt, USP grade |
GA2413 | D-Penicillamine |
GA5612 | D-Penicillamine, USP grade |
GM8043 | D-Phenylalanine |
GM6313 | D-Phenylalanine methyl ester hydrochloride |
GM9107 | D-Proline |
GC4633 | D-Raffinose pentahydrate |
GC0856 | D-Ribose |
GC1803 | D-Ribose-5-phosphate disodium salt hydrate |
GC4870 | D-Salicin |
GW8825 | D-Selenocystine |
GM2756 | D-Serine |
GM2636 | D-Serine methyl ester hydrochloride |
GC2278 | D-Sorbitol |
GC1670 | D-Sorbitol, Ph. Eur., USP/NF grade |
GK1855 | D-Tartaric acid |
GM1465 | D-tert-Leucine |
GM7406 | D-Threonine |
GM5015 | D-Tryptophan |
GM7921 | D-Tryptophan methyl ester hydrochloride |
GM2446 | D-Tyrosine |
GM5893 | D-Valine |
GM9253 | D-Valine methyl ester hydrochloride |
GC9922 | D-Xylobiose |
GK8620 | D(+)-Lactose monohydrate |
GW3056 | DAABD-AE |
GW8521 | DABPH |
GA1142 | Dacarbazine |
GW3554 | DACB-CN |
GW8060 | DACM |
GT2309 | DAF-2 |
GW5342 | DAF-2 DA |
GW0500 | DAF-2 DA Solution |
GW5419 | DAF-2T |
GW6609 | DAF-2T Solution |
GW9642 | DAF-4 DA |
GW8107 | DAF-4 DA Solution |
GW3304 | DAF-4T |
GP3581 | Daidzein |
GC3816 | Daidzin |
GL0893 | DAMGO |
GP5327 | Daminozide |
GE3985 | Danshensu sodium salt |
GK1213 | Dansyl chloride, 95% |
GK5103 | Dansyl chloride, 99% |
GW4407 | Dansylamide |
GW0087 | Dansylcadaverine |
GP0222 | Dantrolene sodium salt |
GW8108 | Danusertib |
GP5853 | Dapagliflozin |
GC4120 | Dapagliflozin 2-O-β-D-glucuronide |
GC0515 | Dapagliflozin 3-O-β-D-glucuronide |
GW9134 | Dapansutrile |
GP6841 | Dapoxetine hydrochloride |
GA5546 | Dapsone |
GK0567 | DAPT |
GA1723 | Daptomycin |
GW7529 | DAR-1 |
GW9719 | DAR-1 Solution |
GW5595 | DAR-1T |
GW0136 | DAR-1T Solution |
GW8659 | DAR-2 |
GW5599 | DAR-2 Solution |
GW5966 | DAR-2T |
GW3895 | DAR-4 |
GW6996 | DAR-4 Solution |
GW9829 | DAR-4M |
GW9618 | DAR-4M Solution |
GW2770 | DAR-4MT |
GW2711 | DAR-4MT Solution |
GW1186 | DAR-4T |
GW2484 | DAR-4T Solution |
GW1128 | DAR-M |
GW7701 | DAR-M Solution |
GW1738 | DAR-MT |
GW3215 | DAR-MT Solution |
GP5767 | Darunavir |
GW1808 | Darunavir . ethanolate |
GW6480 | Dasatinib |
GA7448 | Daunorubicin hydrochloride |
GW3799 | DCFDA |
GW4157 | DCIA |
GE2726 | DEAE-Cellulose, preswollen |
GL5342 | Debromohymenialdisine |
GK1190 | Decanal |
GL8578 | Decarestrictine D |
GA0244 | Decoyinine |
GC7081 | Decyl b-D-glucopyranoside |
GC0811 | Decyl b-D-maltopyranoside, 99% |
GC3210 | Decyl b-D-thioglucopyranoside |
GK7126 | Decyltrimethylammonium bromide |
GC7251 | Deferasirox acyl-β-D-glucuronide |
GC2279 | Deferiprone 3-O-b-D-glucuronide |
GP7998 | Deflazacort |
GP8945 | Dehydroandrographolide |
GP3148 | Dehydroequol |
GW5337 | Delanzomib [CEP-18770] |
GK1634 | Deltamethrin |
GA7186 | Demeclocycline hydrochloride |
GP5459 | Demecolcine |
GL0560 | Demethoxycurcumin |
GE9090 | Denatonium benzoate |
GE7887 | Denatonium benzoate, granules |
GY6383 | Dendrobine |
GD8955 | Deoxycholic acid |
GD5695 | Deoxycholic acid sodium salt |
GL5039 | Deoxymanumycin A |
GZ2164 | Deoxyribonuclease I |
GE7850 | Dequalinium chloride |
GW3015 | Dermcidin-1L (human) . TFA |
GW2786 | Desacetylcolchicine d-u200btartrate |
GE5475 | Desethylamodiaquine |
GP5073 | Desferrioxamine B mesylate |
GP7090 | Desmopressin acetate |
GE1466 | Dess-Martin Periodinane |
GW1968 | Destaining bags, ethidium bromide |
GP9626 | Desvenlafaxine succinate |
GX0380 | Devarda's alloy |
GP8543 | Dexamethasone |
GC9546 | Dexamethasone 21-O-β-D-galactopyranoside |
GL6086 | Dexamethasone 21-phosphate disodium salt |
GC5559 | Dexibuprofen acyl-β-D-glucuronide |
GW7920 | Dexmedetomidine hydrochloride |
GP2739 | Dexrazoxane |
GE1910 | Dextran 1,000 |
GC0854 | Dextran 10,000 |
GC6054 | Dextran 100,000 |
GC9974 | Dextran 200,000 |
GC7757 | Dextran 250,000 |
GE2215 | Dextran 40,000 |
GC5456 | Dextran 5,000 |
GE4231 | Dextran 70,000 |
GC2426 | Dextran sulfate sodium salt, MW approx. 500,000 |
GC6810 | Dextrin |
GL9006 | Dextromethorphan hydrobromide monohydrate |
GW8162 | DHPDS |
GW9563 | Di-(2-picolyl)amine |
GT0430 | Di-8-ANEPPS |
GK1214 | di-Ammonium hydrogen citrate |
GK0736 | di-Ammonium hydrogen phosphate |
GS1865 | Di-iso-propyl Ether, GlenDry?, anhydrous stabilised with BHT |
GS7207 | Di-iso-propyl Ether, GlenPure?, analytical grade stabilised with BHT |
GS7181 | Di-iso-propylethylamine, GlenBiol?, suitable for molecular biology |
GS9122 | Di-iso-propylethylamine, GlenDry?, anhydrous |
GK7879 | Di-p-toluoyl-L-tartaric acid |
GE6381 | di-Potassium hydrogen phosphate trihydrate |
GB6304 | di-Potassium hydrogen phosphate, 1M solution |
GK8010 | di-Potassium hydrogen phosphate, anhydrous |
GX5630 | di-Potassium hydrogen phosphate, anhydrous, ACS grade |
GK7412 | di-Potassium hydrogen phosphate, anhydrous, Ph. Eur. grade |
GB0899 | di-Sodium hydrogen phosphate anhydrous, EP, USP grade |
GK8671 | di-Sodium hydrogen phosphate dihydrate, Ph. Eur., USP grade |
GK0517 | di-Sodium hydrogen phosphate dodecahydrate, 99%, Ph. Eur., USP grade |
GK3179 | di-Sodium hydrogen phosphate, anhydrous |
GE4403 | Di-tert-butyl dicarbonate |
GW1040 | Di-tert-butylcyclopentadiene |
GX5999 | Di-u-chloro bis[chloro(cyclohexene) platinum(II)], 99.95% (metals basis) |
GW2158 | Dianilinopyrimidine_01 |
GL2663 | Diastovaricin I |
GP5034 | Diatrizoic acid dihydrate |
GL3756 | Diatrizoic acid dihydrate, USP grade |
GW2095 | DIB-Cl |
GA4403 | Dibekacin sulfate |
GK5381 | Dibenzothiophene |
GX8535 | Dibenzyl phosphate |
GW7767 | Dibenzylfluorescein |
GW2933 | Dibucaine hydrochloride |
GX4306 | Dibutyltin diacetate |
GX3063 | Dibutyltin dichloride, 98% |
GK8171 | Dicamba |
GX0614 | Dichloro (cycloocta-1,5-dienyl) palladium(II); 99.95% (metals basis) |
GX3739 | Dichloro (cycloocta-1,5-dienyl) ruthenium(II) polymer |
GX6600 | Dichloro(cycloocta-1,5-dienyl) platinum(II); 99.95% (metals basis) |
GX3273 | Dichloro[1,1''-ferrocenylbis(diphenylphosphine)]palladium(II)dichloromethane adduct |
GE0235 | Dichloroacetic acid sodium salt |
GX7724 | Dichlorobis(acetonitrile) palladium(II); 99% |
GX4755 | Dichlorobis(benzonitrile) palladium(II) |
GX2546 | Dichlorodiammine palladium(II); 99.95% (metals basis) |
GK1713 | Dichloroisocyanuric acid sodium salt |
GK1784 | Dichloroisocyanuric acid sodium salt dihydrate |
GK9913 | Dichloromethane |
GS0032 | Dichloromethane, GlenBiol?, suitable for molecular biology stabilised with amylene |
GS3987 | Dichloromethane, GlenDry?, anhydrous stabilised with amylene |
GS5271 | Dichloromethane, GlenDry?, anhydrous stabilised with amylene extra dry |
GS0168 | Dichloromethane, GlenDry?, anhydrous stabilised with amylene over molecular sieve |
GS2852 | Dichloromethane, GlenPure?, analytical grade stabilised with amylene |
GS0199 | Dichloromethane, GlenUltra?, analytical grade, stabilised with amylene, for LC |
GS9127 | Dichloromethane, GlenUltra?, analytical grade, stabilised with cyclohexene/amylene, for GC |
GP6995 | Diclazuril |
GC8579 | Diclofenac acyl-D-glucuronide |
GX9078 | Diclofenac potassium salt |
GP9539 | Diclofenac sodium salt |
GX8255 | Diclofenac, free acid |
GW7731 | Diclofop |
GW6887 | Diclofop-methyl |
GA0338 | Dicloxacillin sodium salt monohydrate |
GK1149 | Dicyandiamide |
GP9351 | Didanosine |
GK7231 | Didecyldimethylammonium chloride |
GK0001 | Didecyldimethylammonium chloride, 50% solution |
GX5162 | Dienogest |
GK1823 | Diethanolamine |
GS6907 | Diethyl Ether, GlenDry?, anhydrous stabilised with BHT |
GS5963 | Diethyl Ether, GlenDry?, anhydrous stabilised with BHT over molecular sieve |
GS1781 | Diethyl Ether, GlenDry?, anhydrous stabilised with ethanol |
GS8536 | Diethyl Ether, GlenDry?, anhydrous stabilised with ethanol over molecular sieve |
GS4017 | Diethyl Ether, GlenPure?, analytical grade stabilised with BHT |
GS7637 | Diethyl Ether, GlenPure?, analytical grade stabilised with copper |
GS4510 | Diethyl Ether, GlenPure?, analytical grade stabilised with ethanol |
GE8191 | Diethyl pyrocarbonate |
GK1276 | Diethyl succinate |
GK3170 | Diethylamine |
GK2667 | Diethylene glycol |
GK5457 | Diethylene glycol monoethyl ether, 99% |
GK8265 | Diethylenetriamine pentaacetic acid |
GA2223 | Difenoconazole |
GE3953 | Differentiation Solution for Regressive Staining |
GL5210 | Differolide |
GA5618 | Difloxacin hydrochloride |
GX3395 | Diflufenican |
GL2053 | Diflunisal |
GC2602 | Diflunisal acyl-β-D-glucuronide |
GW1953 | Difluoromethyl phenyl sulfone |
GC6858 | Digeneaside, sodium salt |
GC7189 | Digitonin |
GC1807 | Digoxin |
GP1911 | Dihydralazine sulfate |
GW6730 | Dihydro-beta-naphthocyclinone |
GY7819 | Dihydroartemisinin |
GP2727 | Dihydroartemisinin |
GC9321 | Dihydroartemisinin O-β-D-glucuronide |
GK0514 | Dihydrocapsaicin |
GW6716 | Dihydrocapsiate |
GW5990 | Dihydrochlamydocin |
GP0119 | Dihydroergotoxine mesylate |
GK8945 | Dihydroethidium |
GW1298 | Dihydrofluorescein diacetate |
GX0885 | Dihydrogen hexabromoplatinate(IV) hydrate |
GX7672 | Dihydrogen hexachloroplatinate(IV); solution |
GX9297 | Dihydrogen hexachloroplatinate(lV) hydrate, 99.95% (metals basis) |
GX5103 | Dihydrogen hexahydroxyplatinate(lV); 99.95% (metals basis) |
GX2846 | Dihydrogenhexachloroiridate(IV); solution |
GL0334 | Dihydromanumycin A |
GY5058 | Dihydromyricetin |
GK1010 | Dihydroproscar |
GT4594 | Dihydrorhodamine 123 |
GA8949 | Dihydrostreptomycin sesquisulfate |
GW4271 | Dihydroxy-MEID |
GX7746 | Diisoheptyl phthalate |
GK5790 | Diisopropyl azodicarboxylate |
GX0839 | Diisopropyl ether, 99%, stabilised |
GP7645 | Diloxanide furoate |
GP1599 | Diltiazem hydrochloride |
GE2418 | Dimedone |
GP7751 | Dimenhydrinate |
GK0623 | Dimethyl fumarate |
GX0667 | Dimethyl germanium dichloride |
GX0455 | Dimethyl phthalate |
GX8036 | Dimethyl sulfone |
GK2245 | Dimethyl sulfoxide |
GT5992 | Dimethyl Yellow (C.I. 11020) |
GS8952 | Dimethylacetamide, GlenDry?, anhydrous |
GS5607 | Dimethylacetamide, GlenPure?, analytical grade |
GK9552 | Dimethylethylammoniumpropane sulfonate |
GS6580 | Dimethylformamide, GlenBiol?, suitable for molecular biology |
GS3406 | Dimethylformamide, GlenBiol?, suitable for molecular biology with molecular sieve |
GS4658 | Dimethylformamide, GlenDry?, anhydrous over molecular sieve |
GS8409 | Dimethylformamide, GlenPure?, analytical grade |
GE1844 | Dimethylglyoxime |
GK3403 | Dimethylglyoxime disodium salt |
GW0892 | Dimethylindodicarbocyanine |
GW6008 | Dimethylsulfoniopropionate . HCl |
GW1571 | Dimethylvinphos |
GA4721 | Dimetridazole |
GT2471 | Dimidium bromide |
GT1911 | Dimidium bromide, 95% |
GA5509 | Diminazene diaceturate |
GP6244 | Dinoprost tromethamine |
GW5174 | Dinotefuran |
GK2341 | Dioctyl sulfosuccinate sodium salt |
GX3368 | Dioctyltin oxide, 97+% |
GC9259 | Dioscin |
GP5659 | Diosgenin |
GC1309 | Diosmetin 3''-O-β-D-glucuronide |
GC2826 | Diosmetin 3'',7-di-O-β-D-glucuronide |
GY4535 | Diosmetin 7-O-β-D-glucuronide |
GC4611 | Diosmin |
GP7830 | Diphenhydramine hydrochloride |
GK5426 | Diphenyl ether |
GT3395 | Diphenylamine |
GK6653 | Diphenylamine-4-sulfonic acid sodium salt |
GX4696 | Diphenylcarbazone |
GW1913 | Diphenyliodonium hexafluorophosphate |
GW9227 | Diphenyliodonium triflate |
GD3668 | Dipropylene glycol |
GK6793 | Dipropylene glycol monomethyl ether |
GB6832 | DIPSO |
GB8985 | DIPSO sodium salt |
GK9666 | Dipyridamole |
GT1468 | Direct Blue 199 (C.I. 74190) |
GT1078 | Direct Red 80 (C.I. 35780) |
GT5274 | Direct Yellow 50 (C.I. 29025) |
GA7887 | Dirithromycin |
GK8134 | Disodium hydrogen citrate sesquihydrate |
GK9860 | Disodium hydrogen phosphate heptahydrate, USP grade |
GE2883 | Disopyramide |
GT6746 | Disperse Blue 14 |
GX7065 | Dithiooxamide |
GT8493 | Dithizone |
GC2421 | Dithranol |
GM8773 | DL-3-Aminoisobutyric acid |
GW2691 | DL-3-Hydroxybutyric acid sodium salt |
GW5908 | DL-3-Hydroxyisobutyric acid sodium salt |
GM1654 | DL-5-Hydroxylysine hydrochloride |
GM4363 | DL-Alanine |
GM3513 | DL-Alanine ethyl ester hydrochloride |
GK9120 | DL-alpha-Lipoic acid |
GK1941 | DL-alpha-Lipoic acid, USP grade |
GP5981 | DL-alpha-Tocopherol |
GV2512 | DL-alpha-Tocopherol acetate, 50% powder form |
GV8989 | DL-alpha-Tocopherol acetate, 50% powder form, Ph. Eur., USP grade |
GV1022 | DL-alpha-Tocopherol acetate, EP/USP/FCC grade |
GC1241 | DL-Arabinose |
GM7749 | DL-Arginine |
GM7171 | DL-Arginine hydrochloride |
GM5023 | DL-Asparagine monohydrate |
GM6777 | DL-Aspartic acid |
GH7212 | DL-Aspartic acid magnesium salt tetrahydrate |
GM8717 | DL-Carnitine hydrochloride |
GM6393 | DL-Cysteine |
GE1122 | DL-Cysteine hydrochloride monohydrate |
GM5088 | DL-Cystine |
GC3928 | DL-Dithiothreitol, 98% |
GC1199 | DL-Dithiothreitol, 99% |
GM4302 | DL-Glutamic acid monohydrate |
GM6216 | DL-Histidine |
GM7239 | DL-Histidine monohydrochloride monohydrate |
GM0565 | DL-Homoserine |
GV8998 | DL-Isocitric acid trisodium salt hydrate |
GM0912 | DL-Isoleucine |
GC2885 | DL-Lactic acid, 85% solution |
GM9742 | DL-Leucine |
GM9803 | DL-Lysine |
GM5914 | DL-Lysine monohydrochloride |
GK7059 | DL-Malic acid |
GX1468 | DL-Malic acid disodium salt |
GK9854 | DL-Mandelic acid |
GL0768 | DL-Menthol |
GM2607 | DL-Methionine |
GM0955 | DL-Norleucine |
GM0521 | DL-Ornithine monohydrochloride |
GX6080 | DL-Pantolactone |
GM5287 | DL-Phenylalanine |
GE2316 | DL-Phenylalanine methyl ester hydrochloride |
GM7043 | DL-Proline |
GM9506 | DL-Serine |
GE1397 | DL-Serine ethyl ester hydrochloride |
GM7745 | DL-Serine methyl ester hydrochloride |
GK1879 | DL-Tartaric acid |
GM7260 | DL-tert-Leucine |
GL2922 | DL-Thiorphan |
GM8351 | DL-Threonine |
GK5665 | DL-Tropic acid |
GM0325 | DL-Tryptophan |
GE0673 | DL-Tryptophan methyl ester hydrochloride |
GM6469 | DL-Tyrosine |
GM3274 | DL-Valine |
GC6865 | DL-Xylose |
GW8766 | DMAPB |
GW4248 | DMAT |
GL6369 | DMNQ |
GP5102 | Docetaxel |
GL6499 | Docosane |
GC7623 | Dodecanoyl-D-sucrose |
GK5416 | Dodecenylsuccinic acid |
GC5636 | Dodecyl a-D-maltopyranoside |
GC4399 | Dodecyl b-D-maltopyranoside |
GE9576 | Dodecyltrimethylammonium bromide |
GE1100 | Dodecyltrimethylammonium bromide, 99%, for IPC |
GC7041 | Dodecyltrimethylammonium chloride |
GP8363 | Dofetilide |
GP5620 | Domiphen bromide |
GP3849 | Domperidone |
GP8656 | Donepezil hydrochloride |
GA9212 | Doripenem |
GP4335 | Dorzolamide hydrochloride |
GP6685 | Doxapram hydrochloride |
GP9708 | Doxazosin mesylate |
GP9056 | Doxorubicin hydrochloride, 98% |
GA4969 | Doxorubicin hydrochloride, USP grade |
GA1726 | Doxycycline hyclate |
GA4252 | Doxycycline hydrochloride |
GA1221 | Doxycycline monohydrate |
GW2555 | DPM |
GK3734 | DPQ |
GK2734 | Dried Aluminium Hydroxide Gel |
GK1474 | Drometrizole trisiloxane |
GP5350 | Dronedarone hydrochloride |
GP1726 | Droperidol |
GK1621 | Drospirenone |
GP2082 | Drotaverine hydrochloride |
GL0837 | Ds(+)-threo-Isocitric acid trisodium salt |
GW5435 | DSP-1 |
GW5273 | DSP-2 |
GW6830 | DSP-3 |
GW4214 | DTTCI |
GC5527 | Dulcitol |
GP0383 | Dutasteride |
GP9526 | Dynasore hydrate |
GW8556 | DYRK1 Inhibitor Negative Control AnnH79 |
GW2289 | DYRK1A/B Inhibitor AnnH31 |
GW9805 | DYRK1A/B Inhibitor AnnH75 |
GX9699 | Dysprosium acetate hydrate, 99.9% |
GX7296 | Dysprosium acetate hydrate, 99.999% |
GX3671 | Dysprosium carbonate hydrate, 99.999% |
GX0213 | Dysprosium Chips, 99.9% |
GX8367 | Dysprosium chloride hydrate, 99.9% |
GX6115 | Dysprosium chloride hydrate, 99.99% |
GX7443 | Dysprosium fluoride, anhydrous, 99.9% |
GX1664 | Dysprosium Foil 0.25mm, 99.9% |
GX7912 | Dysprosium Foil 0.5mm, 99.9% |
GX4427 | Dysprosium nitrate hydrate, 99.9% |
GX3037 | Dysprosium oxide-Nano Powder, 99.9% |
GX3451 | Dysprosium oxide, 99.9% |
GX8951 | Dysprosium oxide, 99.99% |
GX1902 | Dysprosium oxide, 99.999% |
GX7421 | Dysprosium oxide, 99.999% |
GX6051 | Dysprosium Pieces 13 mm, 99.9% |
GX0465 | Dysprosium Pieces distilled, 99.99% |
GX8361 | Dysprosium Powder, 99.9% |
GX6568 | Dysprosium Rod 12.5 mm diameter, 99.9% |
GX7609 | Dysprosium Rod 6.35 mm diameter, 99.9% |
GX1115 | Dysprosium sulfate hydrate, 99.9% |
GX8494 | Dysprosium sulfate hydrate, 99.999% |
GX5087 | Dysprosium sulfide, 99.9% |
GL4130 | E-64 protease inhibitor |
GL9790 | E-64d protease inhibitor |
GW2433 | E7080 |
GP4285 | Ebselen |
GY5332 | Eclalbasaponin I |
GA7153 | Econazole |
GA5978 | Econazole nitrate salt |
GC6273 | Ecopipam O-β-D-glucuronide |
GC7047 | Ecopipam-d6 |
GC5186 | Ecopipam-d6 O-β-D-glucuronide |
GE1963 | Ectoine |
GC2219 | Edaravone O-β-D-glucuronide |
GP0849 | EDC hydrochloride |
GE1219 | Edetic acid, BP, Ph. Eur. grade |
GE4011 | EDTA |
GE8581 | EDTA calcium disodium salt dihydrate, BP, Ph. Eur., USP grade |
GE5635 | EDTA dipotassium salt dihydrate |
GE3023 | EDTA disodium salt dihydrate |
GX8832 | EDTA disodium salt dihydrate, 99%, Ph. Eur. grade |
GX3802 | EDTA disodium zinc salt hydrate |
GE7700 | EDTA ferric sodium salt |
GE3956 | EDTA magnesium disodium salt hydrate |
GX6009 | EDTA manganese disodium salt hydrate |
GE7722 | EDTA solution, 0.1M in water |
GE5993 | EDTA solution, 0.5M in water |
GK0795 | EDTA tetrasodium salt dihydrate |
GE3450 | EDTA tetrasodium salt hydrate |
GL1464 | EDTA tripotassium salt dihydrate |
GE9701 | EDTA trisodium salt dihydrate |
GP6354 | Efavirenz |
GE7249 | EGTA |
GE9981 | EGTA, 99% |
GP1385 | EIDD-2801 |
GP5778 | Elacridar |
GL7222 | Elasnin |
GL1320 | Elastatinal microbial |
GW9811 | Elbasvir |
GP7432 | Ellagic acid, 90%, technical |
GP5363 | Ellagic acid, 95% |
GC5494 | Eltrombopag acyl-β-D-glucuronide |
GP4572 | Elvitegravir |
GL0042 | EM574 |
GP2114 | Emamectin benzoate, 95% |
GA2860 | Emetine dihydrochloride hydrate |
GP5697 | Emodin |
GX6640 | Empagliflozin |
GC7615 | Empagliflozin 2-O-β-D-glucuronide |
GC6323 | Empagliflozin 3-O-β-D-glucuronide |
GC6156 | Empagliflozin 4-O-β-D-glucuronide |
GC6310 | Empagliflozin 6-O-β-D-glucuronide |
GP7326 | Emtricitabine |
GP7214 | Enalapril maleate salt |
GW0255 | Enalaprilat |
GP3972 | Enalaprilat hydrate |
GW5616 | Enniatin A |
GW9382 | Enniatin A1 |
GW8528 | Enniatin B1 |
GA5196 | Enoxacin |
GP8041 | Enoxolone |
GP1750 | Enprofylline |
GA3066 | Enrofloxacin |
GP9755 | Entacapone |
GP8732 | Entecavir hydrate |
GL6982 | Enterocin |
GX7514 | Entfettungssalz Typ A / Degreasing salt Type A |
GP3697 | Entinostat |
GT8630 | Eosin B |
GT6445 | Eosin B (C.I. 45400) |
GT2503 | Eosin Y (C.I. 45380:2) |
GT2884 | Eosin Y disodium salt (C.I. 45380) |
GT0244 | Eosin Y solution, 1% aqueous |
GT9663 | Eosin Y solution, alcoholic |
GT8474 | Eosin Y solution, alcoholic with phloxine |
GW1599 | Eosin-5-isothiocyanate |
GW6692 | Epacadostat |
GL3272 | epi-Aszonalenin A |
GP6146 | Epiandrosterone |
GP7016 | Epicatechin gallate |
GP4379 | Epicatechin, 95% |
GC6613 | Epicellobiose |
GL6737 | Epicoprostanol |
GP2119 | Epigallocatechin |
GP0260 | Epigallocatechin gallate |
GC9893 | Epimaltose |
GP2165 | Epinephrine |
GP2175 | Epirubicin hydrochloride |
GP0150 | Eplerenone |
GW0951 | Epoxidised linseed oil |
GW6988 | Epoxidized soya bean oil |
GL3424 | Epoxomicin |
GW5052 | EPZ-6438 |
GW5417 | EPZ015666 |
GC7067 | Equilin 3-O-β-D-glucuronide |
GW5144 | ER 172594-06 hydrobromide |
GX5093 | Erbium acetate hydrate, 99.9% |
GX6288 | Erbium acetate hydrate, 99.999% |
GX7977 | Erbium carbonate hydrate, 99.9% |
GX1788 | Erbium carbonate hydrate, 99.999% |
GX3754 | Erbium Chips, 99.9% |
GX3099 | Erbium chloride anhydrous, 99.9% |
GX3951 | Erbium chloride hydrate, 99.9% |
GX5135 | Erbium chloride hydrate, 99.99% |
GX9751 | Erbium chloride hydrate, 99.999% |
GX4766 | Erbium fluoride anhydrous, 99.9% |
GX6921 | Erbium Foil 0.25mm, 99.9% |
GX9661 | Erbium Foil 0.5mm, 99.9% |
GX3638 | Erbium hydroxide, 99.999% |
GX1257 | Erbium nitrate hydrate, 99.9% |
GX6639 | Erbium oxalate hydrate, 99.9% |
GX5412 | Erbium oxalate hydrate, 99.999% |
GX9056 | Erbium oxide-Nano Powder, 99.9% |
GX1956 | Erbium oxide, 99.9% |
GX2558 | Erbium oxide, 99.99% |
GX6503 | Erbium oxide, 99.999% |
GX7624 | Erbium oxide, 99.999% |
GX4431 | Erbium oxide, 99+% |
GX1857 | Erbium Pieces 13 mm, 99.9% |
GX6516 | Erbium Powder, 99.9% |
GX1877 | Erbium Rod 6.35 mm diameter, 99.9% |
GX8034 | Erbium sulfate hydrate, 99.9% |
GX0295 | Erbium sulfate octahydrate, 99.999% |
GX6121 | Erbium Wire 1 mm diameter, 99.9% |
GX1722 | Erbium-thd, 99.9% |
GL0564 | Eremofortin A |
GL2057 | Eremofortin B |
GL1651 | Ergosterol |
GT9710 | Erichrome Blue Black R (C.I. 15705) |
GT2024 | Eriochrome Black T (C.I. 14645) |
GT1416 | Eriochrome Black T (C.I. 14645); ACS grade |
GT5063 | Eriochrome blue-black B (C.I. 14640) |
GT6219 | Eriochrome Cyanine R (C.I. 43820) |
GT2562 | Erioglaucine (C.I. 42090) |
GP0576 | Erlotinib |
GP3306 | Erlotinib hydrochloride |
GA8176 | Ertapenem sodium salt |
GC5043 | Ertugliflozin 3-O-β-D-glucuronide |
GA1145 | Erythromycin |
GT6599 | Erythrosin B |
GT2668 | Erythrosin B sodium salt (C.I. 45430) |
GT8461 | Erythrosin B sodium salt (C.I. 45430); certified |
GC8310 | Escin |
GP5432 | Escitalopram oxalate |
GC4131 | Esculin hydrate |
GL2953 | Eserine hemisulfate salt |
GP0973 | Esmolol hydrochloride |
GL1313 | Esomeprazole magnesium salt hydrate |
GP5980 | Esomeprazole sodium salt hydrate |
GP9683 | Estradiol |
GC7268 | Estradiol 17-O-β-D-glucuronide |
GC1668 | Estradiol 3-O-β-D-glucuronide |
GK5552 | Estrone 3-methyl ether |
GL8298 | Estrone 3-sulfate sodium salt |
GC9570 | Estrone b-D-glucuronide |
GC2791 | Estrone-2,4,16,16-d4 |
GC5815 | Estrone-2,4,16,16-d4 3-O-β-D-glucuronide |
GA3438 | Ethacridine lactate salt monohydrate |
GA7275 | Ethambutol dihydrochloride |
GK6948 | Ethanolamine |
GK0319 | Ethanolamine hydrochloride |
GS8411 | Ethanolamine, GlenPure?, analytical grade |
GT1710 | Ethidium bromide |
GT5677 | Ethidium bromide monoazide |
GT9211 | Ethidium bromide, 10mg/ml in water |
GT0540 | Ethidium homodimer I |
GP3324 | Ethinylestradiol |
GA6196 | Ethionamide |
GP7068 | Ethisterone |
GK2628 | Ethoxylated hydrogenated castor oil |
GX9766 | Ethyl (hydroxyimino)cyanoacetate |
GC6710 | Ethyl 1-thio-α-L-rhamnopyranoside |
GC1322 | Ethyl 1-thio-β-D-xylopyranoside |
GC1237 | Ethyl 2-deoxy-1-thio-2-trichloroacetylamino-β-D-glucopyranoside |
GC1560 | Ethyl 2-O-benzoyl-3-O-benzyl-1-thio-β-D-glucopyranoside |
GC8803 | Ethyl 2-thio-α-D-fructofuranoside |
GC2672 | Ethyl 2-thio-β-D-fructofuranoside |
GC6715 | Ethyl 2,3-Di-O-benzyl-4,6-O-benzylidene-1-deoxy-1-thio-α-D-mannopyranoside S-Oxide |
GC3205 | Ethyl 2,3-di-O-benzyl-4,6-O-benzylidene-1-thio-β-D-galactopyranoside |
GC9919 | Ethyl 2,3,4-tri-O-acetyl-1-thio-α-L-rhamnopyranoside |
GC1219 | Ethyl 2,3,4-tri-O-acetyl-1-thio-β-D-xylopyranoside |
GC2352 | Ethyl 2,3,4-tri-O-acetyl-1-thio-β-L-rhamnopyranoside |
GC8924 | Ethyl 2,3,4-tri-O-benzyl-1-thio-β-D-xylopyranoside |
GC3494 | Ethyl 2,3,4,6-tetra-O-acetyl-1-thio-D-mannopyranoside (min. 85% α-anomer) |
GC1120 | Ethyl 2,3,4,6-tetra-O-acetyl-1-thio-β-D-mannopyranoside |
GC0667 | Ethyl 2,3,4,6-tetra-O-acetyl-a-D-thioglucopyranoside |
GC5656 | Ethyl 2,3,4,6-tetra-O-acetyl-b-D-thiogalactopyranoside |
GC7327 | Ethyl 2,3,4,6-Tetra-O-acetyl-α-D-thiomannopyranoside |
GC7492 | Ethyl 2,3,4,6-tetra-O-benzyl-b-D-thiogalactopyranoside |
GC8484 | Ethyl 2,3,4,6-tetra-O-benzyl-b-D-thioglucopyranoside |
GC8775 | Ethyl 2,3,6-tri-O-benzyl-1-thio-β-D-galactopyranoside |
GC4895 | Ethyl 2,4,6-tri-O-acetyl-3-O-allyl-1-thio-β-D-glucopyranoside |
GC6395 | Ethyl 2,4,6-tri-O-acetyl-3-O-benzyl-1-thio-β-D-glucopyranoside |
GC9083 | Ethyl 3-O-acetyl-2-deoxy-2-phthalimido-1-thio-β-D-glucopyranose |
GC5951 | Ethyl 3-O-acetyl-2-deoxy-4-O-mesyl-2-phthalimido-1-thio-β-D-glucopyranose |
GC5676 | Ethyl 3-O-acetyl-4,6-O-benzylidene-2-deoxy-2-phthalimido-1-thio-β-D-glucopyranoside |
GC3597 | Ethyl 3-O-allyl-2-O-benzyl-4,6-O-benzylidene-1-thio-β-D-galactopyranoside |
GC8670 | Ethyl 3-O-allyl-4-O-benzyl-2-O-naphthylmethyl-1-thio-β-D-glucopyranoside |
GC2392 | Ethyl 3-O-allyl-4-O-benzyl-2-O-naphthylmethyl-1-thio-β-D-glucopyranosiduronic acid benzyl ester |
GC9995 | Ethyl 3-O-allyl-4-O-levulinoyl-2-O-naphthylmethyl-1-thio-β-D-glucopyranosiduronic acid benzyl ester |
GC6223 | Ethyl 3-O-allyl-4,6-O-benzylidene-1-thio-β-D-glucopyranoside |
GC1543 | Ethyl 3-O-allyl-4,6-O-benzylidene-2-O-levulinoyl-1-thio-β-D-glucopyranoside |
GC7343 | Ethyl 3-O-allyl-4,6-O-benzylidene-2-O-naphthylmethyl-1-thio-β-D-glucopyranoside |
GC4046 | Ethyl 3-O-benzyl-1-thio-β-D-glucopyranoside |
GC4833 | Ethyl 3-O-benzyl-2-O-(4-methoxybenzyl)-1-thio-β-D-glucopyranosiduronic acid benzyl ester |
GC6484 | Ethyl 3-O-benzyl-2-O-levulinoyl-1-thio-β-D-glucopyranoside |
GC0503 | Ethyl 3-O-benzyl-2-O-levulinoyl-6-O-trityl-1-thio-β-D-glucopyranoside |
GC1097 | Ethyl 3-O-benzyl-4,6-O-benzylidene-1-thio-β-D-glucopyranoside |
GC3904 | Ethyl 3-O-benzyl-4,6-O-benzylidene-2-O-levulinoyl-1-thio-β-D-glucopyranoside |
GC6962 | Ethyl 3,4-di-O-acetyl-2-deoxy-2-phthalimido-1-thio-β-D-glucopyranoside |
GC7887 | Ethyl 3,4-di-O-benzyl-2-O-levulinoyl-1-thio-β-D-glucopyranosiduronic acid benzyl ester |
GC3581 | Ethyl 3,4-O-isopropylidene-1-thio-β-D-galactopyranoside |
GC9636 | Ethyl 3,4,6-tri-O-acetyl-2-deoxy-1-thio-2-trichloroacetylamino-β-D-glucopyranoside |
GC1914 | Ethyl 3,4,6-tri-O-acetyl-2-deoxy-2-phthalimido-b-D-thioglucopyranoside |
GC3959 | Ethyl 3,4,6-tri-O-benzyl-1-thio-β-D-galactopyranoside |
GK8938 | Ethyl 4-hydroxybenzoate |
GK5881 | Ethyl 4-hydroxybenzoate sodium salt, Ph. Eur. grade |
GC3623 | Ethyl 4-O-allyl-3,6-di-O-benzyl-2-O-levulinoyl-1-thio-β-D-glucopyranoside |
GC8375 | Ethyl 4,6-O-benzylidene-b-D-thiogalactopyranoside |
GK9497 | Ethyl acetate |
GS7058 | Ethyl Acetate, GlenDry?, anhydrous |
GS4125 | Ethyl Acetate, GlenDry?, anhydrous over molecular sieve |
GS6927 | Ethyl Acetate, GlenPure?, analytical grade |
GS0494 | Ethyl Acetate, GlenUltra?, analytical grade, for LC |
GW4571 | Ethyl azidoacetate |
GW9984 | Ethyl azidoacetate Solution 25% in ethanol |
GW2091 | Ethyl azidoacetate Solution, 25% in toluene |
GW0665 | Ethyl azidoacetate Solution, 30% in methylene chloride |
GL4777 | Ethyl benzoate |
GK4787 | Ethyl carbazate |
GC4298 | Ethyl cellulose, 100 cP |
GT8354 | Ethyl eosin |
GK4257 | Ethyl formate |
GW7721 | Ethyl fumaroyl chloride |
GX0837 | Ethyl maltol |
GX0446 | Ethyl methanesulfonate |
GK7670 | Ethyl oleate |
GT4651 | Ethyl Orange sodium salt |
GW7673 | Ethyl pentafluoropropionate |
GT2065 | Ethyl Violet (C.I. 42600) |
GC3831 | Ethyl β-D-cellobioside |
GC9652 | Ethyl β-D-cellobioside heptaacetate |
GC3642 | Ethyl β-D-galactopyranoside |
GC1447 | Ethyl β-D-Thiogalactopyranoside |
GX8942 | Ethyl-2-bromoisovalerate |
GK7641 | Ethylene glycol |
GK5741 | Ethylenediamine |
GK6724 | Ethylenediamine dihydrochloride |
GP3560 | Etidronate disodium salt |
GW5449 | Etobenzanid |
GP1738 | Etodolac |
GP6181 | Etofenamate |
GC1751 | Etonogestrel 17-O-β-D-glucuronide |
GA8194 | Etoposide |
GP7329 | Etoricoxib |
GW3400 | Etoxazole |
GK9909 | Eugenol |
GL0095 | Eupatilin |
GY2280 | Euphol |
GX2865 | Europium acetate hydrate, 99.999% |
GX5832 | Europium carbonate hydrate, 99.9% |
GX9779 | Europium carbonate hydrate, 99.999% |
GX3876 | Europium chloride hydrate, 99.9% |
GX2404 | Europium chloride hydrate, 99.999% |
GX9209 | Europium D-3-trifluoroacetylcamphorate |
GX1197 | Europium fluoride anhydrous, 99.9% |
GX9328 | Europium fluoride anhydrous, 99.999% |
GX5469 | Europium nitrate hexahydrate, 99.9% |
GX9920 | Europium oxalate hydrate, 99.9% |
GX2616 | Europium oxide, 99.9% |
GX9376 | Europium oxide, 99.99+% |
GX7218 | Europium oxide, 99.999+% |
GX9979 | Europium Pieces distilled, 99.99% |
GX6710 | Europium Pieces, 99.9% (partially oxidized, under mineral oil) |
GX6834 | Europium sulfate hydrate, 99.999% |
GX4035 | Europium-fod, 99% |
GX1796 | Europium-thd |
GT1064 | Evans Blue (C.I. 23860) |
GP1203 | Everolimus |
GP6452 | Exemestane |
GP8120 | Ezetimibe |
GC0776 | Ezetimibe b-D-glucuronide |
GW8230 | FAMC |
GP8401 | Famciclovir |
GP1586 | Famotidine |
GT6286 | Fast Black K salt hemi zinc chloride |
GT7674 | Fast Blue B salt |
GT8040 | Fast Blue BB (C.I. 37175) |
GT5977 | Fast Blue BB salt |
GT4853 | Fast Garnet GBC base |
GT3407 | Fast Green FCF (C.I. 42053) |
GT5711 | Fast Red KL salt |
GT3891 | Fast Red RC salt |
GT1478 | Fast Red TR hemi(zinc chloride) salt |
GT6181 | Fast Sulphon Black F (C.I. 26990) |
GT4837 | Fat Brown B |
GW0159 | Favipiravir |
GP4754 | Febuxostat |
GC3926 | Febuxostat acyl-β-D-glucuronide |
GP8252 | Felodipine |
GP4784 | Fenbendazole |
GP4850 | Fenofibrate |
GP4336 | Fenofibric acid |
GC1783 | Fenofibryl D-glucuronide |
GP8749 | Fenoldopam mesylate |
GC6842 | Fenoprofen acyl-β-D-glucuronide |
GC0166 | Fenoprofen-d9 acyl-β-D-glucuronide |
GL1828 | Fenpropimorph |
GP8861 | Fenretinide |
GP1083 | Fenticonazole nitrate |
GL6974 | Fenvalerate |
GW0492 | Ferimzone |
GC7340 | Ferrous L-lactate |
GT7999 | Ferrozine |
GP6734 | Ferulic acid |
GP5447 | Fexofenadine hydrochloride |
GA3227 | Fidaxomicin |
GP8835 | Finasteride |
GP1210 | Finasteride, USP grade |
GW3619 | FINDY |
GP3498 | Fingolimod hydrochloride |
GK6304 | Fipronil |
GL7384 | Fisetin |
GY3086 | Fisetin, 90% |
GK6971 | FK-506 monohydrate |
GL7680 | FK-866 |
GV4061 | Flavin adenine dinucleotide disodium salt hydrate |
GP3700 | Flecainide acetate salt |
GA2775 | Fleroxacin |
GW2705 | Flibanserin |
GA3827 | Florfenicol |
GC8043 | Floridoside |
GE3010 | Florisil, 60 - 100 mesh |
GP4098 | Floxuridine |
GW8182 | Fluazifop |
GW2901 | Fluazifop solution 10 μg/ml in ethyl acetate |
GA1291 | Flubendazol |
GA4540 | Flubendazol, Ph. Eur. grade |
GA1968 | Flucloxacillin sodium salt |
GA4147 | Fluconazole |
GP0418 | Fludarabine phosphate |
GL8956 | Fludrocortisone acetate |
GX9953 | Flufenacet |
GP1380 | Flumazenil |
GA3854 | Flumequine |
GA2414 | Flumethasone |
GW1206 | Flumetsulam |
GW0293 | Flumiclorac |
GP9404 | Flunarizine hydrochloride |
GL3822 | Flunixin meglumine |
GK9773 | Fluo 3-AM suitable for fluorescence |
GW2736 | Fluo-3 |
GP1949 | Fluocinolone acetonide |
GE4837 | Fluorene |
GT9946 | Fluorescamine |
GT3509 | Fluorescein (C.I. 45350) |
GT8666 | Fluorescein 5(6)-isothiocyanate |
GT5229 | Fluorescein diacetate |
GW4006 | Fluorescein diacetate 5-u200bmaleimide |
GW7708 | Fluorescein diacetate 6-maleimide |
GW8666 | Fluorescein dibutyrate |
GW0286 | Fluorescein dicaproate |
GW8115 | Fluorescein dioctanoate |
GW0957 | Fluorescein dipropionate |
GT3648 | Fluorescein isothiocyanate isomer I, 97.5% |
GC4008 | Fluorescein methyl ester β-D-cellobioside |
GC5422 | Fluorescein methyl ester β-D-glucopyranoside |
GW3408 | Fluorescein octadecyl ester |
GT1410 | Fluorescein sodium salt, 90% (C.I. 45350) |
GT3976 | Fluorescein sodium salt, 98% (C.I. 45350) |
GW8567 | Fluorescein-5-thiosemicarbazide |
GT9206 | Fluoresceinamine, isomer I |
GL8131 | Fluorescent Brightener 28 |
GW5754 | Fluorescin |
GP8238 | Fluorometholone |
GP4431 | Fluoxetine hydrochloride |
GP2994 | Fluphenazine hydrochloride |
GP0623 | Flupirtine maleate salt |
GW8432 | Flupropanate |
GW4390 | Flupyrsulfuron-methyl sodium |
GA8630 | Flurbiprofen |
GC4336 | Flurbiprofen D-glucitol ester |
GC2879 | Flurbiprofen D-mannitol ester |
GK2844 | Fluridone |
GY4609 | Flurprimidol |
GW3742 | Flusulfamide |
GP6311 | Flutamide |
GP5011 | Fluticasone propionate |
GP9431 | Fluvastatin sodium salt |
GP8417 | Fluvoxamine maleate |
GE3236 | Fmoc chloride |
GM5706 | Fmoc N-hydroxysuccinimide ester |
GM2728 | Fmoc-1-Nal-OH |
GM0242 | Fmoc-6-Ahx-OH |
GM7432 | Fmoc-Ala-OH |
GM9958 | Fmoc-Arg(Pbf)-OH |
GM3743 | Fmoc-Asn-OH |
GM6525 | Fmoc-Asn(Trt)-OH |
GM2923 | Fmoc-Asp-OAll |
GM4936 | Fmoc-Asp-OH |
GM6999 | Fmoc-Asp(OtBu)-OH |
GM6924 | Fmoc-Cha-OH |
GX2966 | Fmoc-Cys(STmp)-OH |
GM8515 | Fmoc-Cys(Trt)-OH |
GM0704 | Fmoc-D-Cys(Acm)-OH |
GM3440 | Fmoc-D-Gln(Trt)-OH |
GM6386 | Fmoc-D-Phe-OH |
GM0291 | Fmoc-D-Ser(tBu)-OH |
GM2517 | Fmoc-D-Trp(Boc)-OH |
GM1475 | Fmoc-D-Tyr(tBu)-OH |
GM7760 | Fmoc-Dap(Boc)-OH |
GM6370 | Fmoc-Dap(Fmoc)-OH |
GM7436 | Fmoc-Gln-OH |
GM4670 | Fmoc-Gln(Trt)-OH |
GZ0287 | Fmoc-Glu-OtBu |
GM6206 | Fmoc-Glu(OAll)-OH |
GM7333 | Fmoc-Glu(OtBu)-OH |
GM1343 | Fmoc-Gly-OH |
GM2917 | Fmoc-His(Trt)-OH |
GM5252 | Fmoc-Hyp(tBu)-OH |
GM4384 | Fmoc-Ile-OH |
GM9237 | Fmoc-L-Lys(Dde)-OH |
GM2337 | Fmoc-L-Val-OSu |
GM6129 | Fmoc-Leu-OH |
GH6681 | Fmoc-Leu-Ser(Psi(Me,Me)pro)-OH |
GM9940 | Fmoc-Lys(Alloc)-OH |
GM4549 | Fmoc-Lys(biotinyl)-OH |
GM7550 | Fmoc-Lys(Boc)-OH |
GM6452 | Fmoc-Lys(Mtt)-OH |
GM6487 | Fmoc-Met-OH |
GM7903 | Fmoc-N-(2-Boc-aminoethyl)-Gly-OH |
GM6383 | Fmoc-N-Me-Ala-OH |
GM6456 | Fmoc-N-Me-Asp(OtBu)-OH |
GM2661 | Fmoc-N-Me-Glu(OtBu)-OH |
GM4616 | Fmoc-N-Me-Ile-OH |
GM8614 | Fmoc-N-Me-Phe-OH |
GM3655 | Fmoc-N-Me-Ser(tBu)-OH |
GM1535 | Fmoc-N-Me-Val-OH |
GM7876 | Fmoc-O-ethyl-D-tyrosine |
GM0032 | Fmoc-Orn(Alloc)-OH |
GM2306 | Fmoc-Orn(Boc)-OH |
GM5097 | Fmoc-Phe-OH |
GM1025 | Fmoc-Phe(4-Boc2-guanidino)-OH |
GM2265 | Fmoc-Pro-OH |
GM6914 | Fmoc-Pro-OPfp |
GM4391 | Fmoc-propargyl-Gly-OH |
GM8696 | Fmoc-Sar-OH |
GM5887 | Fmoc-Sar-OPfp |
GM5457 | Fmoc-Ser-OH |
GM5621 | Fmoc-Ser(beta-D-GlcNAc(Ac)3)-OH |
GM0224 | Fmoc-Ser(tBu)-OH |
GM0784 | Fmoc-Ser(Trt)-OH |
GM5290 | Fmoc-Thr(TBDMS)-OH |
GM9332 | Fmoc-Thr(tBu)-OH |
GM3465 | Fmoc-Tmb-Gly-OH |
GM9019 | Fmoc-Trp-OH |
GM7354 | Fmoc-Trp(Boc)-OH |
GM6164 | Fmoc-Tyr(tBu)-OH |
GM1305 | Fmoc-Val-OH |
GW2022 | FOAA |
GP3487 | Folic acid |
GP0140 | Folic acid, USP grade |
GP6553 | Folinic acid calcium salt hydrate |
GC5562 | Fondaparinux intermediate |
GP7709 | Foretinib |
GX7106 | Formaldehyde solution, 36.5 - 38.0% |
GE0900 | Formalin, 10% solution, neutral buffered |
GE0227 | Formalin, 10% solution, neutral buffered with 0.03% Eosin |
GE1691 | Formamide |
GS9663 | Formamide, GlenBiol?, suitable for molecular biology |
GK5373 | Formamidine disulfide dihydrochloride |
GK4394 | Formic acid |
GP6496 | Formononetin |
GC1919 | Formononetin-b-D-glucuronide sodium salt |
GK0194 | Formoterol fumarate dihydrate |
GP2059 | Forskolin |
GP9120 | Fosfomycin tromethamine |
GA9030 | Fostriecin |
GA3510 | Framycetin sulfate |
GW0280 | Fridamycin A |
GW3457 | Fridamycin B |
GW7288 | Fridamycin E |
GC4489 | Fructosazine |
GL8499 | FSL-1 |
GP9451 | Fulvestrant |
GL6056 | Fulvic acid |
GA9027 | Fumagillin |
GP3315 | Fumaric acid |
GW1267 | Fumigaclavine A |
GA2954 | Fumitremorgin C |
GL6785 | Funalenone |
GK7854 | Fura 2 pentapotassium salt |
GK3824 | Fura 2-AM |
GC3407 | Furaneol β-D-glucopyranoside |
GW3446 | Furanone C-30 |
GW3062 | Furanone C-56 |
GA1580 | Furazolidone |
GL4799 | Furfural |
GL5996 | Furil |
GP0523 | Furosemide |
GC1299 | Furosemide acyl-b-D-glucuronide |
GL1111 | Fuscin |
GA1848 | Fusidic acid |
GA1411 | Fusidic acid sodium salt |
GA8310 | Fusidic acid sodium salt, EP grade |
GA2946 | G418 disulphate salt |
GC0885 | GA1-Ganglioside |
GC5605 | GA2-Ganglioside |
GP0653 | Gabapentin |
GX8768 | Gadolinium acetate hydrate, 99.9% |
GX6633 | Gadolinium acetate hydrate, 99.999% |
GX5428 | Gadolinium carbonate hydrate, 99.999% |
GX9153 | Gadolinium Chips, 99.9% |
GX1913 | Gadolinium chloride anhydrous, 99.9% |
GX0630 | Gadolinium chloride hydrate, 99.99% |
GX5115 | Gadolinium chloride hydrate, 99.999% |
GX5835 | Gadolinium fluoride anhydrous, 99.9% |
GX0112 | Gadolinium fluoride anhydrous, 99.99% |
GX9517 | Gadolinium fluoride anhydrous, 99.999% |
GX5380 | Gadolinium Foil 0.25mm, 99.9% |
GX8762 | Gadolinium gallium oxide, 99.9+% |
GX5536 | Gadolinium hydroxide, 99.999% |
GX6783 | Gadolinium nitrate hexahydrate, 99.9% |
GX4565 | Gadolinium oxalate hydrate, 99.9% |
GX3089 | Gadolinium oxalate hydrate, 99.99% |
GX7750 | Gadolinium oxide, 99.9% |
GX6036 | Gadolinium oxide, 99.99% |
GX2903 | Gadolinium oxide, 99.99% |
GX5926 | Gadolinium oxide, 99.999% |
GX0489 | Gadolinium oxide, 99.9999% |
GX8269 | Gadolinium oxide, 99.9999% |
GX9822 | Gadolinium Pieces distilled, 99.99% |
GX8860 | Gadolinium Pieces, 99.9% |
GX8077 | Gadolinium Powder, 99.9% |
GX3282 | Gadolinium Rod 12.5 mm diameter, 99.9% |
GX6274 | Gadolinium Rod 6.35 mm diameter, 99.9% |
GX8991 | Gadolinium sulfate hydrate, 99.9% |
GX1347 | Gadolinium sulfate hydrate, 99.999% |
GX7383 | Gadolinium Wire 2 mm diameter, 99.9% |
GX3860 | Gadolinium(III) chloride hexahydrate, 99.9% |
GP0136 | Galangin |
GC4006 | Gallic acid 3-O-β-D-glucopyranoside |
GC2783 | Gallic acid 4-O-β-D-glucopyranoside |
GK3777 | Gallic acid monohydrate |
GK7318 | Gallic acid, anhydrous |
GK3445 | Gallic acid, anhydrous, ACS grade |
GX0988 | Gallium antimonide, 99.99% |
GX0470 | Gallium arsenide, 99.999% |
GX3243 | Gallium arsenide, 99.9999% |
GX5196 | Gallium bromide, anhydrous, 99.999% |
GX0846 | Gallium nitride, 99.99% |
GX2239 | Gallium Pellets max. 8 mm, 99.99% |
GX6258 | Gallium Pellets max. 8 mm, 99.999% |
GX3229 | Gallium Pellets max. 8 mm, 99.9999% |
GX8408 | Gallium phosphide, 99.999% |
GX4776 | Gallium Pieces, |
GX7573 | Gallium Pieces, 99.99% |
GX1351 | Gallium Pieces, 99.9999% |
GX9105 | Gallium Pieces, 99.99999% |
GX3127 | Gallium,Indium,Tin-alloy 66,20.5,13.5%, Eutectic alloy, m.p.ca. 15°C, 99.99+% |
GX3722 | Gallium(II) telluride, 99.999% |
GX6560 | Gallium(III) chloride, anhydrous, 99.999% |
GX3798 | Gallium(III) ethoxide, 99.9% |
GX4847 | Gallium(III) iodide, anhydrous, 99.999% |
GX0816 | Gallium(III) nitrate solution |
GX2811 | Gallium(III) nitrate, hydrate, 99.9% |
GX4498 | Gallium(III) oxide, 99.99% |
GX5811 | Gallium(III) oxide, 99.995+% |
GX8608 | Gallium(III) sulfate hydrate, 99.99% |
GX1805 | Gallium(III) sulfide, 99.95% |
GT7909 | Gallocyanine |
GC5312 | Gamithromycin |
GE4986 | Gamma globulin, human |
GX3420 | gamma-Aluminium oxide Nanopowder, 99,9 % |
GX9359 | gamma-Aluminium oxide Nanopowder, 99%+ [APS 20 nm, SSA LT 300m2/g] |
GX1999 | gamma-Aluminium oxide, nanopowder, 99.95% |
GC9842 | gamma-Cyclodextrin |
GL2105 | gamma-Glu-Leu |
GX8246 | gamma-Iron(III) oxide nanopowder |
GL5132 | Ganaxolone |
GA3804 | Ganciclovir |
GL7283 | GANT61 |
GL7339 | Gardiquimod |
GP2111 | Gatifloxacin hydrate |
GW8774 | GCI1746 |
GC3309 | GD1a-Ganglioside |
GC0141 | GD1b-Ganglioside |
GC7995 | GD3-Ganglioside |
GW2186 | GDC-0032 |
GW5412 | GDC-046 |
GW4351 | GDC-0941 |
GP9843 | Gefitinib |
GE2739 | Gelatin, powdered, from porcine skin, 240g bloom |
GE1298 | Gelatin, powdered, from porcine skin, 280g bloom |
GA6838 | Geldanamycin |
GX3344 | Gellan Gum, high acyl |
GP9877 | Gemcitabine |
GP8917 | Gemcitabine hydrochloride |
GP1460 | Gemfibrozil |
GC3133 | Gemfibrozil b-D-glucuronide |
GK9185 | Genapol X-080 |
GL8880 | Genipin |
GP7710 | Genistein |
GC2802 | Genistin |
GA1270 | Gentamicin C1 pentaacetate salt |
GA4559 | Gentamicin C1a pentaacetate salt |
GA2476 | Gentamicin C2 pentaacetate salt |
GA7939 | Gentamicin sulfate |
GC3903 | Gentiopicroside |
GK7955 | Gentisic acid |
GA9165 | Geodin |
GK9543 | Geraniol |
GC0550 | Geranyl b-D-glucoside |
GX2887 | Germanium chloride, 99.999% |
GX2202 | Germanium Pieces max. 2 cm (50 Ohm cm); 99.9999+% |
GX6006 | Germanium Pieces max. 2 cm, 99.999% |
GX5891 | Germanium Powder, ltn. 250 microns, 99.99% |
GX3772 | Germanium(II) telluride, 99.999% |
GX6261 | Germanium(IV) oxide electronic grade, 99.999% |
GC7516 | Gestodene 17-O-β-D-glucuronide |
GK2857 | GF 109203X hydrochloride |
GK0226 | Gibberellic acid |
GL8740 | Gibberellin A4 (contains A7) |
GT6821 | Giemsa Stain |
GT7801 | Giemsa stain, powder |
GT5290 | Giemsa stain, powder, certified |
GA3547 | Gilvocarcin V |
GW1779 | Gimeracil |
GP9109 | Ginkgolide A |
GP5638 | Ginkgolide B |
GP0779 | Ginkgolide C |
GC8201 | Ginsenoside Rb1 |
GC4250 | Ginsenoside Rg3 |
GC5991 | Ginsenoside Ro |
GW0261 | Gitoxin |
GL7457 | Glabridin |
GP1424 | Glimepiride |
GP6193 | Glipizide |
GP4220 | Gliquidone |
GW4142 | Globosuxanthone A |
GC0735 | Globotriose |
GW4741 | GLPG0634 |
GC6800 | Gluconic acid manganese salt |
GC6411 | Gluconic acid zinc(II) salt |
GZ1910 | Glucose Oxidase |
GZ3212 | Glucose-6-phosphate dehydrogenase |
GX1626 | Glufosinate ammonium |
GC0694 | Glutaraldehyde solution, 25% in water |
GC4387 | Glutaraldehyde solution, 50% in water |
GK5553 | Glutaric acid |
GK8999 | Glutaric anhydride |
GE1520 | Glutathione reduced |
GB5355 | Gly-Gly |
GM2651 | Gly-Leu |
GM6220 | Gly-Pro |
GP8701 | Glybenclamide |
GC2187 | Glycerol |
GC3178 | Glycerol formal, 99%, stabilised |
GX3699 | Glycerol Monocaprylocaprate |
GC7456 | Glycerol phosphate disodium salt hydrate, 99% |
GC3404 | Glycerol-1-phosphate magnesium salt hydrate |
GC5551 | Glycerol, 99.5%, Ph. Eur., USP, Ultrapure |
GM2385 | Glycine |
GM7497 | Glycine benzyl ester hydrochloride |
GB7317 | Glycine buffer solution |
GM6023 | Glycine ethyl ester hydrochloride |
GE1802 | Glycine hydrochloride |
GM6763 | Glycine tert-butyl ester hydrochloride |
GM2320 | Glycine, EP, USP grade |
GL7698 | Glycitein |
GC2327 | Glycitin |
GK7114 | Glycochenodeoxycholic acid sodium salt |
GM1948 | Glycocholic acid |
GC7172 | Glycogen |
GC1413 | Glycogen, from plant |
GV0978 | Glycolic acid |
GE5631 | Glycolic acid, 70% solution in water |
GL3345 | Glycopyrrolate |
GL1421 | Glycoursodeoxycholic acid |
GH2981 | Glycyl-L-glutamine monohydrate |
GC9316 | Glycyrrhizic acid |
GK2256 | Glycyrrhizic acid ammonium salt |
GK1723 | Glyoxylic acid hydrate |
GK2369 | Glyoxylic acid, 50% in water |
GC2176 | GM1-Ganglioside |
GC6057 | GM2-Ganglioside |
GC6381 | GM3-Ganglioside |
GW3723 | GNE-477 |
GW1637 | GNE-490 |
GW9776 | GNE-493 |
GW4938 | GNF-5837 |
GX8617 | Gold conducting paste 85-90% Au |
GX2515 | Gold Foil 0.01mm, 99.9% |
GX2305 | Gold Foil 0.025mm, 99.99% |
GX5660 | Gold Foil 0.05mm, 99.9% |
GX8161 | Gold Foil 0.127mm, 99.99% |
GX2217 | Gold Foil 0.1mm, 99.9% |
GX6369 | Gold Foil 0.1mm, 99.995% |
GX0893 | Gold Foil 0.25mm, 99.9% |
GX9858 | Gold Foil 0.25mm, 99.99% |
GX4983 | Gold Foil 0.5mm, 99.9% |
GX0324 | Gold Gauze 1024 mesh/cm2, 0.06 mm wire diameter, 99.99% |
GX7159 | Gold Granules 0.2-0.5 mm, 99.99% (metals basis) |
GX7927 | Gold Granules max. 1.5 mm, 99.999% (metals basis) |
GX1742 | Gold Granules max. 5 mm, 99.99% |
GX1014 | Gold Powder 0.3-3 micron, 99.9+% |
GX7015 | Gold Powder 1.5-4 micron, 99.9+% |
GX4428 | Gold Powder max. 1 micron, 99.9+% |
GX3698 | Gold Wire 0.025 mm diameter, 99.99% |
GX5523 | Gold Wire 0.05 mm diameter, 99.99% |
GX1233 | Gold Wire 0.1 mm diameter, 99.99% |
GX5981 | Gold Wire 0.1 mm diameter, 99.995% |
GX5149 | Gold Wire 0.127 mm diameter, 99.99% |
GX6172 | Gold Wire 0.25 mm diameter, 99.9% |
GX1122 | Gold Wire 0.25 mm diameter, 99.995% |
GX7550 | Gold Wire 0.3 mm diameter, 99.9% |
GX0024 | Gold Wire 0.5 mm diameter, 99.9% |
GX9641 | Gold Wire 0.5 mm diameter, 99.995% |
GX7904 | Gold Wire 1.0 mm diameter, 99.9% |
GX5838 | Gold Wire 1.0 mm diameter, 99.99% |
GX1838 | Gold Wire 1.0 mm diameter, 99.999% |
GX5878 | Gold Wire 1.5 mm diameter, 99.9% |
GX5094 | Gold Wire 1.5 mm diameter, 99.995% |
GX9759 | Gold Wire 2.0 mm diameter, 99.9% |
GX1821 | Gold Wire 2.0 mm diameter, 99.995% |
GX5128 | Gold(I)pinanylmercaptide |
GX9027 | Gold(III) bromide |
GX8162 | Gold(III) chloride anhydrous, 99.99% |
GX2564 | Gold(III) iodide, 99.95% (metals basis) |
GX3756 | Gold(III) oxide hydrate |
GX3779 | Gold/Germanium 88/12 wt% Granules max. 3 mm, 99.99% (metals basis) |
GP6680 | Gossypol |
GX3431 | Gossypol-acetic acid |
GC8688 | GQ1b-Ganglioside |
GT5199 | Gram''s Iodine |
GW9675 | Gram’s Decolorizer Solution |
GP3615 | Granisetron hydrochloride |
GX6750 | Graphene Nanopowder, 99.5 %, 11 - 15 nm |
GX3231 | Graphene Nanopowder, 99.5 %, 6 - 8 nm |
GX7364 | Graphene Nanopowder, 99.5 %, approx. 2nm |
GX0782 | Graphite foil 0.25 x 100 x 200 mm, 0,5-1% ash |
GX4132 | Graphite foil 0.5 x 100 x 200 mm, 0,5-1% ash |
GX3597 | Graphite foil 1.0 x 250 x 500 mm, 0,5-1% ash |
GX0508 | Graphite Nanopowder, 99.9 % |
GX3891 | Graphite plate 2mm, 0.5-1% ash |
GX4018 | Graphite powder 40-100 micron, 0,4% ash, 99+% |
GX4790 | Graphite powder max. 100 micron, max. 300ppm ash, 99.9+% |
GX8018 | Graphite rod 17 mm diameter, max. 5 ppm ash |
GX8341 | Graphite rod 20 x 300 mm, max. 10 ppm ash |
GX7130 | Graphite rod 20 x 300 mm, max. 100 ppm ash |
GX6587 | Graphite rod 3.05 x 300 mm max. 10 ppm ash, 99.999+% |
GX6273 | Graphite rod 30 x 300 mm, max. 10 ppm ash |
GX2987 | Graphite rod 30 x 300 mm, max. 100 ppm ash |
GX6512 | Graphite rod 60 mm diameter |
GP1475 | Grazoprevir |
GW6492 | Green CMFDA |
GA6599 | Griseofulvin |
GW8225 | GS-441524 (Remdesivir Metabolite) |
GW8376 | GSH-OEt |
GL0956 | GSK-429286 |
GW0843 | GSK-A1 |
GW7601 | GSK-F1 |
GW4131 | GSK-J1 |
GW7563 | GSK1120212 |
GW9665 | GSK2126458 |
GW4758 | GSK25 |
GE1408 | GSK2606414 |
GW7934 | GSK2837808A |
GW3442 | GSK690693 |
GC4593 | GT1b-Ganglioside |
GK7789 | Guaiacol |
GP0595 | Guaiacol glyceryl ether |
GP1667 | Guanfacine hydrochloride |
GE4739 | Guanidine hydrochloride solution, 6M |
GE1001 | Guanidine hydrochloride solution, 8M |
GE1914 | Guanidine hydrochloride, 99% |
GE1694 | Guanidine thiocyanate |
GE0617 | Guanine |
GE6103 | Guanine hydrochloride |
GE8690 | Guanosine |
GK2200 | Guanosine 5''-[beta,gamma-imido]triphosphate tetralithium salt hydrate |
GE3702 | Guanosine 5''-diphosphate disodium salt |
GE5826 | Guanosine 5''-monophosphate disodium salt hydrate |
GN6493 | Guanosine 5''-triphosphate sodium salt hydrate |
GE2026 | Guanosine-5''-triphosphate disodium salt |
GC3578 | Guar |
GL6162 | Guinea Green B |
GC5029 | Gum arabic |
GC0655 | Gum arabic, Ph. Eur., USP grade |
GC1863 | Gum rosin |
GC6544 | Gum storax |
GW8614 | GW-441756 |
GW5601 | GW-806742X |
GL5444 | GW1929 |
GW4055 | GW311616A hydrochloride |
GW9340 | GW501516 |
GL5577 | GW7647 |
GL7524 | GYY 4137 |
GK6037 | H-8 dihydrochloride |
GK1902 | H-89 dihydrochloride hydrate |
GH0012 | H-Cys-Gly-OH |
GM6197 | H-D-Pro-NH2 |
GW8955 | H-D-Val-Leu-Lys-pNA . 2HCl |
GW7750 | H-Met-AMC |
GW5494 | H1152 |
GL3466 | H2S Donor 5a |
GT7295 | Haematoxylin (C.I. 75290) |
GT2100 | Haematoxylin, 75% (C.I. 75290) |
GX8475 | Hafnium boride, 99+% |
GX4386 | Hafnium carbide, 99+% |
GX5747 | Hafnium chloride, 98% |
GX5457 | Hafnium fluoride |
GX6916 | Hafnium Foil 0.25mm, 99+% |
GX0390 | Hafnium hydride, 99.5+% |
GX3057 | Hafnium nitride, 99% |
GX5486 | Hafnium oxide dichloride hydrate, 98+% |
GX8601 | Hafnium oxide, 99.9% |
GX7878 | Hafnium oxide, 99.9% |
GX2093 | Hafnium oxide, 99.95% |
GX2511 | Hafnium oxide, 99+% (contains max. 0.5% Zr) |
GX4340 | Hafnium oxide, 99+% (contains max. 4.5% Zr) |
GX6390 | Hafnium Pieces max. 55 mm appr. 100-300 g (price per weight); 99.8% |
GX4121 | Hafnium Pieces, 99.9% |
GX0485 | Hafnium Powder -325 mesh, 99.8% |
GX0157 | Hafnium Rod 6.35 mm diameter, 99.8% |
GX1173 | Hafnium silicide, 99.5% |
GX8723 | Hafnium t-butoxide, 99.9% |
GX1874 | Hafnium Wire 1.0 mm diameter, 99+% |
GW1930 | Halofenozide |
GK8532 | Halofuginone hydrobromide |
GE0651 | Hanks' Balanced Salt Solution (HBSS) without phenol red |
GP4309 | Harmine |
GP8204 | Harmol hydrochloride hydrate |
GE0815 | Hartman’s Fixative |
GA1613 | Harzianopyridone |
GL2700 | Harzianum A |
GE0156 | HATU |
GE0864 | HBTU |
GW2310 | HCPI |
GY6797 | Hederacoside C |
GL2626 | Helenalin |
GL8551 | Heliquinomycin |
GW8826 | Hellebrin |
GL0753 | Helvolic acid |
GT7429 | Hematein |
GT4757 | Hematoxylin Solution, Gill No. 1 |
GT3728 | Hematoxylin Solution, Gill No. 2 |
GT7060 | Hematoxylin Solution, Gill No. 3 |
GT0111 | Hematoxylin Solution, Harris Modified |
GT4631 | Hematoxylin Solution, Mayer''s |
GE9985 | Hemin |
GL7038 | Hemoglobin |
GL6667 | Heneicosane |
GC2822 | Heparin lithium salt |
GC2310 | Heparin sodium salt |
GC9695 | Heparin sodium salt, Ph. Eur. grade |
GK1938 | HEPBS |
GB3086 | HEPES |
GK6272 | HEPES hemisodium salt |
GB9181 | HEPES sodium salt |
GE8587 | HEPES sodium salt, 1M solution |
GM5581 | HEPES, 99.5%, GlenCell?, suitable for cell culture |
GB8306 | HEPPS |
GB2637 | HEPPSO |
GC0495 | Hepta-O-acetyl-b-lactosyl azide |
GL9144 | Heptadecanoic acid |
GC9584 | Heptakis(2,6-di-O-methyl)-b-cyclodextrin |
GS8770 | Heptane fraction, GlenDry?, anhydrous |
GS8315 | Heptane fraction, GlenPure?, analytical grade |
GK7040 | Heptane, technical grade |
GL6923 | Heptelidic acid |
GW8820 | Heptenophos |
GC5331 | Heptyl b-D-glucopyranoside |
GC8635 | Heptyl beta-D-thioglucopyranoside |
GA2466 | Herbimycin A |
GW6376 | Herquline A |
GP5086 | Hesperetin |
GC7197 | Hesperetin 3''-O-β-D-glucuronide |
GC7470 | Hesperetin 3'',7-di-O-β-D-glucuronide |
GC2489 | Hesperetin 7-O-β-D-glucopyranoside |
GC1198 | Hesperetin 7-O-β-D-glucuronide |
GC6376 | Hesperidin |
GX6519 | Hexaammine cobalt(III) chloride, 99.999% |
GX0711 | Hexabutylditin, 98+% |
GA6437 | Hexachlorophene |
GL0310 | Hexacyclinic acid |
GC1423 | Hexadecyl β-D-glucopyranoside |
GC1149 | Hexadecyl β-D-xylopyranoside |
GE9991 | Hexadecyltrimethylammonium chloride |
GS9159 | Hexafluoropropan-2-ol, GlenPure?, analytical grade |
GK4253 | Hexahydro-1,3,5-tris(hydroxyethyl)-s-triazine, 74% solution in water |
GC6012 | Hexakis (2,3,6-tri-O-methyl)-alpha-cyclodextrin |
GK9101 | Hexamethyldisilane |
GK5441 | Hexamethylenetetramine |
GK9166 | Hexamidine diisethionate |
GK6193 | Hexanal |
GS2256 | Hexane fraction, GlenDry?, anhydrous |
GS6546 | Hexane fraction, GlenPure?, analytical grade |
GK3289 | Hexanoic acid |
GC4449 | Hexyl b-D-glucopyranoside |
GM5145 | Hippuric acid |
GM2902 | Hippuric acid sodium salt |
GE0339 | Histamine dihydrochloride |
GW9327 | HITCI |
GZ3821 | HL-Nuclease |
GE0426 | HOBt hydrate |
GW7550 | Hoechst 33342 |
GW7787 | Hoechst 34580 |
GW9897 | Hoechst 34580 solution (20 mM in water); 11.2 mg/ml in water |
GX8652 | Holmium acetate hydrate, 99.999% |
GX8856 | Holmium Chips, 99.9% |
GX8485 | Holmium chloride hydrate, 99.9% |
GX6686 | Holmium fluoride, anhydrous, 99.9% |
GX6207 | Holmium fluoride, anhydrous, 99.999% |
GX4423 | Holmium Foil 0.25mm, 99.9% |
GX4706 | Holmium hydroxide hydrate, 99.9% |
GX3168 | Holmium oxalate hydrate, 99.9% |
GX8215 | Holmium oxide, 99.9% |
GX8140 | Holmium oxide, 99.99% |
GX7869 | Holmium oxide, 99.999% |
GX7544 | Holmium oxide, 99.999% |
GX3447 | Holmium Pieces distilled, 99.99% |
GX2124 | Holmium Pieces, 99.9% |
GX8288 | Holmium Powder, 99.9% |
GX0352 | Holmium sulfate hydrate, 99.9% |
GX2709 | Holmium sulfate hydrate, 99.999% |
GX4392 | Holmium sulfide, 99.9% |
GX8998 | Holmium Wire 1 mm diameter, 99.9% |
GX5335 | Holmium-fod, 99% |
GE3427 | Homatropine hydrobromide |
GC7606 | Homofuraneol β-D-glucopyranoside |
GA3648 | Honokiol |
GL5849 | Hordenine |
GL0121 | Hormaomycin |
GK1476 | Hyaluronic acid |
GC4582 | Hyaluronic acid sodium salt, m.w. 1.0 - 1.5 MDa |
GC7932 | Hyaluronic acid sodium salt, m.w. 1.5MDa |
GC3902 | Hyaluronic acid sodium salt, m.w. 2.0 MDa |
GC0118 | Hyaluronic acid sodium salt, m.w. 200 - 400 kDa |
GC9726 | Hyaluronic acid sodium salt, m.w. 3,000 - 5,000 |
GC6191 | Hyaluronic acid sodium salt, m.w. 30,000 - 50,000 |
GC0005 | Hyaluronic acid sodium salt, m.w. 50,000 - 100,000 |
GC7733 | Hyaluronic acid sodium salt, m.w. 750 kDa - 1.0 MDa |
GE8970 | Hyaluronidase |
GW9866 | Hydramethylnon |
GK6594 | Hydrazine dihydrochloride |
GK4864 | Hydrazine sulfate |
GK5212 | Hydrindantin dihydrate |
GX3547 | Hydriodic acid, stabilised, 57% solution in water |
GS1085 | Hydrochloric acid 1% |
GK5744 | Hydrochloric acid 36%, GlenCell?, suitable for cell culture |
GK2225 | Hydrochloric acid 37% |
GE3443 | Hydrochloric acid, 4% (w/v) in water |
GX0143 | Hydrochloric acid, 6M solution |
GE0436 | Hydrochlorothiazide |
GP8860 | Hydrocortisone |
GK1717 | Hydrocortisone 21-hemisuccinate sodium salt |
GA8586 | Hydrocortisone acetate |
GP5848 | Hydrocortisone butyrate |
GP1580 | Hydrocortisone hemisuccinate |
GS6394 | Hydrogen Chloride 4M, GlenDry?, anhydrous in 1,4-dioxan |
GE1911 | Hydrogen peroxide, 30% |
GE7978 | Hydrogen peroxide, 35% |
GE3243 | Hydrogen peroxide, 6% in water |
GS8182 | Hydrogen peroxide, 7.5% in water |
GX2720 | Hydrogen tetrachloroaurate(III) hydrate |
GX6701 | Hydrogen tetrachloroaurate(III) hydrate, 99.95% (metals basis) |
GK2942 | Hydrogen tetrachloroaurate(III) trihydrate |
GX6315 | Hydrogen tetrachloroaurate(III); solution |
GK8747 | Hydroquinidine hydrochloride |
GK0341 | Hydroquinone |
GX0225 | Hydroxethyl-p-phenylenediamine sulfate |
GE5819 | Hydroxocobalamin acetate |
GT4927 | Hydroxy naphthol blue disodium salt |
GX1336 | Hydroxyapatite |
GC2271 | Hydroxychloroquine O-β-D-glucuronide |
GK2606 | Hydroxychloroquine sulfate |
GC2093 | Hydroxyethyl cellulose, high viscosity |
GC0004 | Hydroxyethyl cellulose, low viscosity |
GC2547 | Hydroxyethyl cellulose, medium viscosity |
GC9711 | Hydroxyethyl cellulose, very low viscosity |
GE6505 | Hydroxylamine hydrochloride |
GE5136 | Hydroxylamine sulfate |
GK3561 | Hydroxylamine-O-sulfonic acid |
GK6032 | Hydroxymethyl EDOT |
GT3182 | Hydroxynaphthol blue |
GC4566 | Hydroxypropyl cellulose |
GW9028 | Hydroxystilbamidine bis(methanesulfonate) |
GP0795 | Hydroxyurea |
GK7844 | Hydroxyzine dihydrochloride |
GA7834 | Hygromycin B |
GA0644 | Hymeglusin |
GW0536 | Hymenidin |
GE3688 | Hyodeoxycholic acid |
GL2427 | Hyperforin (dicyclohexylammonium) salt |
GE3282 | Hypericin |
GA6404 | Hypothemycin |
GE9204 | Hypoxanthine |
GW4589 | I-BET762 |
GP8563 | Ibandronate sodium salt monohydrate |
GP8742 | Ibrutinib |
GP7898 | Ibudilast |
GP1763 | Ibuprofen |
GC2836 | Ibuprofen acyl-b-D-glucuronide |
GW8964 | IC87114 |
GC6166 | Icariin |
GK0375 | ID-8 |
GW0448 | IDA |
GP4628 | Idebenone |
GC9783 | Iguratimod-d5 |
GL3175 | IHR-1 |
GL6686 | IHR-NAc |
GL6740 | Ilimaquinone |
GK4753 | Ilomastat |
GP4375 | Imatinib mesylate |
GA4370 | Imazalil |
GE4955 | Imidacloprid |
GP3008 | Imidapril hydrochloride |
GB9580 | Imidazole |
GK1136 | Imidazole hydrochloride |
GB4854 | Imidazole, 99.5% |
GM8284 | Iminodiacetic acid |
GK8864 | Iminostilbene |
GA1119 | Imipenem |
GP8148 | Imipenem and Cilastatin sodium salt (1:1 mixture, with added sodium bicarbonate) |
GP9049 | Imiquimod |
GW3483 | Immersion oil |
GL5875 | Imperatorin |
GY7220 | Incensole |
GY7797 | Incensole acetate |
GP2749 | Indapamide |
GT6891 | Indigo (C.I. 73000) |
GT4851 | Indigo Carmine (C.I. 73015) |
GP6821 | Indinavir sulphate hydrate |
GX8407 | Indium antimonide, 99.999% |
GX3071 | Indium arsenide, 99.999% |
GX4048 | Indium Bar, 99.999% |
GX1607 | Indium Bar, 99.9999% |
GX0765 | Indium Foil 0.05 mm, 99.995% |
GX8197 | Indium Foil 0.1 mm, 99.995% |
GX9681 | Indium Foil 0.1 mm, 99.999% |
GX0445 | Indium Foil 0.125 mm, 99.99% |
GX0323 | Indium Foil 0.20 mm, 99.999% |
GX4026 | Indium Foil 0.25 mm, 99.99% |
GX0416 | Indium Foil 0.25 mm, 99.999% |
GX0587 | Indium Foil 0.5 mm, 99.99% |
GX9490 | Indium Foil 1.0 mm, 99.99% |
GX3517 | Indium hydroxide, 99.99% |
GX9666 | Indium oxide-Nano Powder, 99.99% |
GX8681 | Indium oxide, 99.9% |
GX7726 | Indium oxide, 99.99% |
GX8152 | Indium oxide, 99.999% |
GX0999 | Indium Pieces, 99.999% |
GX7682 | Indium Powder + 2% MgO, max. 200 micron, 99.99% |
GX1238 | Indium Powder +2% MgO, max. 200 micron, 99.999% |
GX3108 | Indium Rod 10 mm diameter, 99.999% |
GX7598 | Indium Rod 10 mm diameter, 99.9999% |
GX3208 | Indium Shot 1-3 mm, 99.99% |
GX0950 | Indium Shot 1-3 mm, 99.999% |
GX1279 | Indium Shot 1-3 mm, 99.9999% |
GX1779 | Indium telluride, 99.999% |
GX7572 | Indium tin oxide-Nano Powder, 99.99% |
GX8938 | Indium tin oxide, 99.99% |
GX9776 | Indium Wire 0.25 mm diameter, 99.99% |
GX5545 | Indium Wire 0.5 mm diameter, 99.99% |
GX7095 | Indium Wire 0.5 mm diameter, 99.999% |
GX4005 | Indium Wire 1.0 mm diameter, 99.99% |
GX7210 | Indium Wire 1.0 mm diameter, 99.999% |
GX5038 | Indium Wire 1.5 mm diameter, 99.99% |
GX1285 | Indium Wire 1.5 mm diameter, 99.999% |
GX8640 | Indium Wire 1.6 mm diameter, 99.995% |
GX8626 | Indium Wire 2.0 mm diameter, 99.99% |
GX0648 | Indium Wire 2.0 mm diameter, 99.999% |
GX9072 | Indium Wire 3.0 mm diameter, 99.99% |
GX5124 | Indium Wire 3.0 mm diameter, 99.999% |
GX4571 | Indium-thd, 99.9% |
GX6379 | Indium,Bismuth 66.3,33.7 Rod 6 mm |
GX9378 | Indium(III) bromide, anhydrous, 99.99+% |
GX9970 | Indium(III) chloride, anhydrous |
GX7018 | Indium(III) iodide, 99.99% |
GX7637 | Indium(III) nitrate, 99.99% |
GX6252 | Indium(III) sulfate, 98%, anhydrous |
GX6224 | Indium(III) sulfate, 99.99%, anhydrous |
GK5410 | Indo 1-AM |
GW0741 | Indo-1 pentapotassium salt |
GK0968 | Indole |
GV0584 | Indole-3-acetic acid sodium salt |
GK7772 | Indole-3-butyric acid |
GE0004 | Indole-3-butyric acid potassium salt |
GK5424 | Indole-3-carbinol |
GK9020 | Indole-3-carboxaldehyde |
GA3090 | Indomethacin |
GC0423 | Indomethacin acyl-b-D-glucuronide |
GW1194 | INDY |
GL8088 | Ingenol-3-angelate |
GL4474 | Ingenol-5,20-acetonide |
GE4681 | Inosine |
GL1863 | Inosine 5''-monophosphate disodium salt hydrate |
GE1021 | Insulin Human, recombinant |
GC4090 | Inulin |
GX5278 | Iodic acid, 99.5+% |
GX5466 | Iodine pentoxide, 99% |
GX9934 | Iodine Powder, crystalline, resublimed, ACS, 99.8+% |
GX1393 | Iodine trichloride |
GX5831 | Iodine, 99% |
GK5945 | Iodine, Ph. Eur. |
GX7564 | Iodine, resublimed, 99.5% |
GP8799 | Iodixanol |
GK6681 | Iodoacetamide |
GP9090 | Iohexol |
GA7872 | Ionomycin |
GA1562 | Ionomycin calcium salt |
GC3873 | iota-Carrageenan, Type II |
GW3149 | IPI-145 |
GL5159 | Ipratropium bromide monohydrate |
GC6586 | IPTG |
GC2102 | IPTG, 99.5%, dioxane free |
GW5488 | IR-783 |
GP0710 | Irbesartan |
GX2934 | Iridium Foil 0.125mm, 99.9% |
GX3365 | Iridium Wire 0.13 mm diameter, 99+% |
GX6867 | Iridium Wire 1mm diameter, 99.9% |
GX4455 | Iridium(III) 2,4-pentanedionate, 99.95% (metals basis) |
GX4338 | Iridium(III) chloride, insoluble |
GP2560 | Irinotecan hydrochloride trihydrate |
GL3227 | Iromycin A |
GX1690 | Iron boride, 99% |
GX0263 | Iron disilicide, 99+% |
GX0830 | Iron Flakes, electrolytic, 99.9% |
GX4046 | Iron Foil 0.025 mm, hard (coated with oil); 99.5% |
GX5450 | Iron Foil 0.05 mm, hard, 99.5% |
GX9346 | Iron Foil 0.125 mm, hard (coated with oil); 99.5% |
GX4418 | Iron Foil 0.25mm, 99.5% |
GX7684 | Iron Foil 0.5mm, 99.5% |
GX6896 | Iron Foil 0.5mm, 99.99+% |
GX4057 | Iron Foil 1.0mm, 99.5% |
GX8892 | Iron Foil 1.0mm, 99.995% |
GX2751 | Iron Foil 1.5mm, 99.5% |
GX0385 | Iron Nanopowder, 99.7% [50nm] |
GX0077 | Iron Pellets 6 x 6 mm, 99.9% |
GX2614 | Iron Pieces 0.5-1.5 mm, 99.97% |
GX5945 | Iron Pieces max. 25 mm, 99.9% |
GX8550 | Iron Pieces max. 25 mm, 99.99% |
GX2565 | Iron Powder -140, +325 mesh, 99.9% |
GX6948 | Iron Powder ex carbonyl, 10 micron, 99.5% |
GX1889 | Iron Powder, 99.99+% |
GX4767 | Iron Rod 12.7 mm diameter, 99.9% |
GX2304 | Iron Rod 19 mm diameter, 99.98% |
GX8876 | Iron Rod 2.0 mm diameter, 99.99+% |
GX6462 | Iron Rod 5.0 mm diameter, 99.99% |
GX8646 | Iron Rod 9.5 mm diameter, 99.9% |
GX0670 | Iron Sheet 2mm, 99.8% |
GC0709 | Iron sucrose |
GX9047 | Iron Wire 0.25 mm diameter, 99.5% |
GX8463 | Iron Wire 0.25 mm diameter, 99.99+% |
GX9432 | Iron Wire 0.5 mm diameter, 99.5% |
GX7070 | Iron Wire 0.5 mm diameter, 99.99+% |
GX4113 | Iron Wire 1.0 mm diameter, 99.5% |
GX7401 | Iron Wire 1.0 mm diameter, 99.99+% |
GX6228 | Iron Wire 2.0 mm diameter, 99.99+% |
GX4317 | Iron,Cobalt 90,10 wt% Wire 0.5 mm diameter |
GX6983 | Iron,Nickel 90,10 wt% Wire 0.5 mm diameter |
GX0576 | Iron(II, III) oxide, 97% |
GX9050 | Iron(II, III) oxide, 99.5% |
GX6555 | Iron(II,III) oxide nanopowder (Magnetite); 98% [20 - 30 nm] |
GX8025 | Iron(II) bromide anhydrous, 99.5% |
GX2777 | Iron(II) chloride tetrahydrate |
GX3755 | Iron(II) chloride, anhydrous, 99.99% |
GX0652 | Iron(II) fluoride, 99.5% |
GX1573 | Iron(II) fumarate |
GX4628 | Iron(II) gluconate dihydrate |
GX0698 | Iron(II) oxalate, dihydrate, 99.99+% |
GK7413 | Iron(II) sulfate heptahydate, 99.5% |
GK8990 | Iron(II) sulfate heptahydate, technical |
GX1941 | Iron(II) sulfate, dried |
GX2147 | Iron(II) sulfide, 99.9% |
GK1880 | Iron(III) acetylacetonate |
GK2873 | Iron(III) chloride hexahydrate |
GK5389 | Iron(III) chloride hexahydrate, 97% |
GX5845 | Iron(III) chloride, anhydrous, 99.7% |
GK4573 | Iron(III) citrate hydrate |
GX6381 | Iron(III) ethoxide, 99.9% |
GX2125 | Iron(III) fluoride, 99.5% |
GX4191 | Iron(III) nitrate nonahydrate, 98% |
GK6075 | Iron(III) oxide, 98% |
GX6044 | Iron(III) oxide, 99.9% |
GX9035 | Iron(III) oxide, 99.9% |
GX6461 | Iron(III) oxide, 99.99% |
GK9337 | Iron(III) pyrophosphate hydrate |
GK2787 | Iron(III) sulfate, hydrate |
GK7897 | Isatin |
GX6547 | Isatropolone A |
GA5158 | Isepamicin sulfate |
GK0622 | Isethionic acid sodium salt |
GS8728 | iso-Hexane 95%, GlenDry?, anhydrous |
GS3569 | iso-Hexane 95%, GlenPure?, analytical grade |
GP7416 | Isoalantolactone |
GK2830 | Isoamyl acetate |
GC1362 | Isobutyl β-D-glucuronide |
GL6777 | Isobutyric acid |
GW7275 | Isocarbostyril |
GA9375 | Isoconazole nitrate |
GK8663 | Isocytosine |
GX9398 | Isoeugenyl acetate |
GP3912 | Isoflurane |
GL9030 | Isofusidienol A |
GP4188 | Isoliquirtigenin |
GC6174 | Isomaltitol |
GA2329 | Isoniazid |
GK6108 | Isonicotinic acid |
GL5871 | Isoorientin |
GC8307 | Isopentyl β-D-glucuronide |
GC6339 | Isopentyl-d11 β-D-glucuronide |
GP0338 | Isoprenaline hydrochloride |
GK9172 | Isopropanol |
GE9802 | Isopropanol, 70% in water |
GC2750 | Isopropyl 2-acetamido-2-deoxy-α-D-glucopyranoside |
GC9038 | Isopropyl 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-α-D-glucopyranoside |
GC5706 | Isopropyl 2-acetamido-3,4,6-tri-O-ethyl-2-deoxy-α-D-glucopyranoside |
GC2530 | Isopropyl 2,3,4,6-tetra-O-acetyl-1-thio-β-D-glucopyranoside |
GX9567 | Isopropyl acetate |
GK0184 | Isopropyl myristate |
GC4395 | Isopropyl β-D-thioglucopyranoside |
GW1341 | Isoprothiolane |
GP5169 | Isorhamnetin |
GC8734 | Isosorbide 5-mononitrate 2-b-D-glucuronide |
GC9368 | Isosorbide-2-mononitrate |
GC3382 | Isosorbide-2-mononitrate 5-O-β-D-glucuronide |
GC2243 | Isosorbide-5-mononitrate-1,2,3,4,5,6-13C6 |
GP6510 | Isotretinoin |
GL2536 | Isovaleric acid |
GK6240 | Isovanillin |
GL4384 | Isovitexin |
GW3469 | Isoxathion |
GK9099 | Itaconic acid |
GW6546 | Itaconic acid 4-octyl ester [4-Octyl itaconate] |
GK7326 | Itaconic anhydride |
GA0307 | Itraconazole |
GL4861 | IU1 |
GK8601 | Ivabradine hydrochloride |
GC9403 | Ivacaftor O-β-D-glucuronide |
GA9725 | Ivermectin |
GW9762 | IWR-1-endo |
GW1595 | Ixazomib [MLN2238] |
GW4808 | Ixazomib citrate [MLN9708] |
GW5327 | Jak/Src Inhibitor 1 hydrochloride |
GT0491 | Janus Green B (C.I. 11050) |
GL4314 | Jasplakinolide |
GT4210 | JC-1 |
GT5545 | Jenner''s Stain |
GT1148 | Jenner''s Stain, certified |
GL5097 | Jervine |
GW9904 | JNJ-38158471 |
GW6703 | JNJ-38877605 |
GW4079 | JNJ-7706621 |
GL1962 | Jojoba oil |
GA0246 | Josamycin |
GL3770 | K-252a |
GL4832 | K-252c |
GW4409 | K777 [K11777] |
GL2059 | Kaempferitrin |
GP7425 | Kaempferol |
GL9890 | Kaempferol 3-glucoside |
GY4480 | Kaempferol 3-glucuronide |
GE2501 | Kaiser''s glycerol gelatine, phenol free |
GP2512 | Kanamycin B |
GA8523 | Kanamycin disulfate salt |
GA0531 | Kanamycin monosulfate salt |
GA9089 | Kanamycin monosulfate salt, EP |
GE4162 | Kaolin |
GC6839 | kappa-Carrageenan |
GL2030 | Kaurenoic acid |
GW1807 | KBU2046 |
GA5047 | Kendomycin |
GL9943 | Ketanserin (+)-tartrate salt |
GA6740 | Ketoconazole |
GP1294 | Ketoprofen |
GC1924 | Ketoprofen acyl-b-D-glucuronide |
GP8482 | Ketorolac tris salt |
GT8694 | Khellin |
GW9361 | Ki20227 |
GC4430 | Kifunensine |
GE0287 | Kinetin |
GK9774 | Kirenol |
GA9046 | Kirromycin |
GP7816 | Kitasamycin |
GX2819 | KN-92 |
GK3376 | KN-93 |
GP4738 | Kojic acid |
GX0578 | Kolliphor EL |
GK2557 | Konjac glucomannan |
GW7110 | KU-0063794 |
GX0742 | Kupferbad 500 sauer / Copper bath 500 acidic |
GX3626 | Kupferbad 540 cyanidisch / Copper bath 540 cyanidic |
GW3410 | KW-2449 hydrochloride |
GK3380 | L-(-)-Bornyl acetate |
GL7635 | L-(-)-Camphoric acid |
GC7288 | L-(-)-Fucose |
GC5727 | L-(-)-Galactose |
GK8399 | L-(-)-Malic acid |
GC8426 | L-(-)-Mannose |
GC0157 | L-(+)-Arabinose |
GV5017 | L-(+)-Ascorbic acid |
GV9871 | L-(+)-Ascorbic acid, 99.5%, BP, Ph. Eur., USP grade |
GP6833 | L-(+)-Ergothioneine |
GE6812 | L-(+)-Lactic acid lithium salt |
GA8192 | L-(+)-Lactic acid, 80% |
GA6729 | L-(+)-Lactic acid, 98% |
GK6462 | L-(+)-Mandelic acid |
GC9031 | L-(+)-Ribose |
GE2092 | L-(+)-Selenomethionine |
GM2424 | L-2,3-Diaminopropionic acid hydrochloride |
GM7206 | L-2,4-Diaminobutyric acid dihydrochloride |
GL7643 | L-703,606 oxalate salt hydrate |
GM7668 | L-Alanine |
GM3156 | L-Alanine 2-naphthylamide |
GM3770 | L-Alanine methyl ester hydrochloride |
GM9104 | L-Alanine tert-butyl ester hydrochloride |
GC8079 | L-Alanine-7-amido-4-methylcoumarin trifluoroacetic acid salt |
GM0361 | L-Alanine, GlenCell?, suitable for cell culture |
GL8388 | L-Alanyl-L-1-aminoethylphosphonic acid |
GE7036 | L-Alanyl-L-glutamine |
GE4398 | L-Alanyl-L-glutamine, GlenCell?, suitable for cell culture |
GE1414 | L-alpha-Phosphatidyl inositol |
GC1947 | L-Arabitol |
GM7438 | L-Arginine |
GM1602 | L-Arginine ethyl ester dihydrochloride |
GM7506 | L-Arginine hydrochloride |
GM1323 | L-Arginine hydrochloride, 99%, non-animal origin |
GM1372 | L-Arginine hydrochloride, GlenCell?, suitable for cell culture |
GM0108 | L-Arginine hydrochloride, Ph. Eur., USP grade |
GH1375 | L-Arginine L-aspartate |
GM1092 | L-Arginine, GlenCell?, suitable for cell culture |
GV6147 | L-Ascorbic acid 2-phosphate sesquimagnesium salt hydrate |
GX2339 | L-Asparaginase |
GM7827 | L-Asparagine monohydrate |
GM4262 | L-Asparagine tert-butyl ester hydrochloride |
GM9590 | L-Asparagine, anhydrous |
GM5992 | L-Aspartic acid hemimagnesium salt dihydrate |
GK5821 | L-Aspartic acid potassium salt |
GM5569 | L-Aspartic acid sodium salt monohydrate |
GM1049 | L-Aspartic acid, 99% |
GM0348 | L-Aspartic acid, GlenCell?, suitable for cell culture |
GM3196 | L-Aspartic acid, Ph. Eur. grade |
GM0457 | L-beta-Leucine hydrochloride |
GP4736 | L-Bupivacaine |
GV3498 | L-Carnitine |
GX6145 | L-Carnitine fumarate |
GM4580 | L-Carnitine hydrochloride |
GM4342 | L-Carnitine tartrate |
GE5095 | L-Carnosine |
GM7920 | L-Citrulline |
GC0182 | L-Colitose |
GM3760 | L-Cysteine |
GM3732 | L-Cysteine ethyl ester hydrochloride |
GM4222 | L-Cysteine hydrochloride monohydrate |
GM0119 | L-Cysteine hydrochloride monohydrate, 99%, non-animal origin |
GM2919 | L-Cysteine hydrochloride monohydrate, Ph. Eur., USP grade |
GM1539 | L-Cysteine hydrochloride, anhydrous |
GM9033 | L-Cysteine hydrochloride, anhydrous, 99% |
GM8797 | L-Cysteine, 99%, non-animal origin |
GM4173 | L-Cystine |
GE0295 | L-Cystine dihydrochloride |
GM7327 | L-Cystine dimethyl ester dihydrochloride |
GE3746 | L-Cystine disodium salt |
GM2911 | L-Cystine, non-animal origin |
GP5151 | L-Deoxyalliin |
GC1019 | L-Erythrose |
GC4559 | L-Erythrulose |
GC5724 | L-Fructose |
GC5081 | L-Fucitol |
GC6718 | L-Glucose |
GM3277 | L-Glutamic acid |
GM4234 | L-Glutamic acid ammonium salt |
GM4212 | L-Glutamic acid gamma-benzyl ester |
GM4841 | L-Glutamic acid gamma-ethyl ester |
GE1700 | L-Glutamic acid hydrochloride |
GM5912 | L-Glutamic acid monosodium salt monohydrate |
GL2267 | L-Glutamic acid potassium salt monohydrate |
GM8976 | L-Glutamic acid, GlenCell?, suitable for cell culture |
GM6582 | L-Glutamine |
GM8887 | L-Glutamine, GlenCell?, suitable for cell culture |
GM2001 | L-Glutamine, USP grade, non-animal origin |
GM8655 | L-Glutathione oxidised, 98% |
GC5865 | L-Gulurono-6,3-lactone |
GM0900 | L-Histidine monohydrochloride monohydrate, 99%, non-animal origin |
GM1189 | L-Histidine monohydrochloride monohydrate, EP grade |
GM2021 | L-Histidine monohydrochloride monohydrate, GlenCell?, suitable for cell culture |
GM5566 | L-Histidine, 99% |
GM1595 | L-Histidine, Ph. Eur., USP grade |
GW5330 | L-Homoserine lactone hydrobromide |
GC4237 | L-Iduronic acid sodium salt |
GC0609 | L-Iduronic acid-1,6-13C2 |
GM6591 | L-Isoleucine |
GM4168 | L-Isoleucine methyl ester hydrochloride |
GM8967 | L-Isoleucine, GlenCell?, suitable for cell culture |
GK1495 | L-Lactide |
GM6205 | L-Leucine |
GC8248 | L-Leucine 7-amido-4-methylcoumarin hydrochloride salt |
GM6647 | L-Leucine methyl ester hydrochloride |
GM0001 | L-Leucine, GlenCell?, suitable for cell culture |
GM5722 | L-Lysine |
GM2435 | L-Lysine dihydrochloride |
GM2935 | L-Lysine ethyl ester dihydrochloride |
GM4839 | L-Lysine methyl ester dihydrochloride |
GM0350 | L-Lysine monohydrate |
GM7532 | L-Lysine monohydrochloride |
GM9011 | L-Lysine monohydrochloride, GlenCell?, suitable for cell culture |
GC8121 | L-Malic acid diethyl ester |
GK4093 | L-Menthol |
GC9565 | L-Menthyl β-D-glucopyranoside |
GM0532 | L-Methionine |
GM9348 | L-Methionine, 99%, GlenCell?, suitable for cell culture, Ph. Eur., USP grade |
GM7307 | L-NAME hydrochloride |
GK0019 | L-Noradrenaline |
GM2431 | L-Ornithine monohydrochloride |
GE6926 | L-Ornithine-L-aspartate |
GM3245 | L-Penicillamine |
GM4385 | L-Phenylalanine |
GM0968 | L-Phenylalanine benzyl ester hydrochloride |
GM3785 | L-Phenylalanine ethyl ester hydrochloride |
GM0002 | L-Phenylalanine methyl ester hydrochloride |
GM7895 | L-Phenylalanine, GlenCell?, suitable for cell culture |
GP5595 | L-Phenylephrine |
GM1129 | L-Proline |
GM6324 | L-Proline benzyl ester hydrochloride |
GM3370 | L-Proline methyl ester hydrochloride |
GM7977 | L-Proline tert-butyl ester |
GM9897 | L-Proline, GlenCell?, suitable for cell culture |
GM2961 | L-Pyroglutamic acid |
GM6959 | L-Pyroglutamic acid beta-naphthylamide |
GE3158 | L-Quebrachitol |
GC1712 | L-Rhamnose monohydrate |
GM1114 | L-Serine |
GM9860 | L-Serine ethyl ester hydrochloride |
GM2197 | L-Serine methyl ester hydrochloride |
GM7000 | L-Serine, GlenCell?, suitable for cell culture |
GC3235 | L-Sorbose |
GK7799 | L-Tartaric acid |
GM4241 | L-tert-Leucine |
GM8477 | L-Theanine |
GM4509 | L-Threonine |
GM2600 | L-Threonine methyl ester hydrochloride |
GM4012 | L-Threonine, GlenCell?, suitable for cell culture |
GP9966 | L-Thyroxine |
GP5241 | L-Thyroxine sodium pentahydrate |
GM0674 | L-Tryptophan |
GM4833 | L-Tryptophan ethyl ester hydrochloride |
GM5869 | L-Tryptophan methyl ester hydrochloride |
GM0192 | L-Tryptophan, GlenCell?, suitable for cell culture |
GM8690 | L-Tyrosine |
GE4061 | L-Tyrosine disodium salt hydrate |
GM1285 | L-Tyrosine ethyl ester hydrochloride |
GM6239 | L-Tyrosine methyl ester |
GM3836 | L-Tyrosine methyl ester hydrochloride |
GM9358 | L-Tyrosine tert-butyl ester |
GM1911 | L-Tyrosine, USP grade, non-animal origin |
GM6473 | L-Valine |
GM7880 | L-Valine methyl ester hydrochloride |
GM3894 | L-Valine, GlenCell?, suitable for cell culture |
GM8064 | L-Valinol |
GC6785 | L-Xylose |
GP7675 | Labetalol hydrochloride |
GP9532 | Lacidipine |
GT5015 | Lacmoid (C.I. 51400) |
GK3911 | Lactacystin |
GC9869 | Lactic acid, 30% solution |
GC2172 | Lactic acid, 40% solution |
GC9491 | Lactic acid, 90% solution |
GC3782 | Lactobionic acid |
GW1152 | Lactofen |
GC3204 | Lactose octaacetate |
GC4307 | Lactose, anhydrous |
GC1111 | Lactose, anhydrous, Ph. Eur., USP grade |
GC9831 | Lactulose, 98% |
GC1952 | Lactulose, Ph. Eur. grade |
GE1836 | Laemmli Sample Buffer 4X (without 2-Mercaptoethanol) |
GC6852 | Laminaribiose |
GC1446 | Laminarihexaose |
GC2662 | Laminarin, from Eisenia Bicyclis |
GC6459 | Laminaripentaose |
GC0886 | Laminaritetraose |
GC6869 | Laminaritriose |
GP6029 | Lamivudine |
GP8797 | Lamotrigine |
GE3627 | Lanolin |
GP3911 | Lanosterol, 50% |
GP5308 | Lansoprazole |
GX6085 | Lanthanum acetate hydrate, 99.9% |
GX4963 | Lanthanum acetate hydrate, 99.999% |
GX1012 | Lanthanum boride, 98% |
GX0970 | Lanthanum carbonate hydrate, 99.9% |
GX1674 | Lanthanum carbonate hydrate, 99.99% |
GX1698 | Lanthanum carbonate hydrate, 99.999% |
GX3350 | Lanthanum Chips, 99.9% |
GK5624 | Lanthanum chloride heptahydrate |
GX3448 | Lanthanum chloride hydrate, 99.9% |
GX4194 | Lanthanum chloride hydrate, 99.99% |
GX4994 | Lanthanum fluoride, anhydrous, 99.9% |
GX1559 | Lanthanum fluoride, anhydrous, 99.99% |
GX2605 | Lanthanum fluoride, anhydrous, 99.99% |
GX1050 | Lanthanum fluoride, anhydrous, 99.999% |
GX4636 | Lanthanum Foil 0.25mm, 99.9% |
GX5525 | Lanthanum nitrate hexahydrate, 99.99% |
GX7969 | Lanthanum nitrate hexahydrate, 99% |
GX1997 | Lanthanum oxalate hydrate, 99.9% |
GX6132 | Lanthanum oxalate hydrate, 99.999% |
GX0653 | Lanthanum oxide, 99.9% |
GX9038 | Lanthanum oxide, 99.99% |
GX9729 | Lanthanum oxide, 99.999% |
GX4998 | Lanthanum oxide, 99.999% |
GX8840 | Lanthanum oxide, 99.9999% |
GX4914 | Lanthanum Pieces max. 10 mm, 99.9% |
GX6829 | Lanthanum Powder, 99.9% |
GX4327 | Lanthanum Rod 6.35 mm diameter, 99.9% |
GX6096 | Lanthanum sulfate hydrate, 99.9% |
GX9924 | Lanthanum Wire 1 mm diameter, 99.9% |
GX9811 | Lanthanum-fod, 99% |
GX1361 | Lanthanum-Nickel alloy (LaNi5, pieces max. 12 mm); 99.9% |
GX9124 | Lanthanum-thd |
GP6924 | Lapatinib |
GP0452 | Lapatinib tosylate |
GL6572 | Lariatin A |
GW9729 | Lasalocid A sodium salt |
GW0266 | Lasalocid A sodium salt Solution, ~100 μg/ml in acetonitrile |
GP3013 | Latanoprost |
GL4689 | Latrunculin A |
GL0565 | Latrunculin B |
GW3779 | Laurdan |
GK3297 | Lauric acid |
GW0546 | LDK378 |
GX3165 | Lead carbonate basic, 99.9% |
GX7022 | Lead Foil 0.125mm, 99.99% |
GX3900 | Lead Foil 0.25 mm, 99.95+% |
GX6473 | Lead Foil 0.25mm, 99.999% |
GX1826 | Lead Foil 0.5 mm, 99.95+% |
GX4682 | Lead Foil 0.5mm, 99.999% |
GX0645 | Lead Foil 1.0 mm, 99.99% |
GX1368 | Lead Foil 2.0 mm, 99.8% |
GX9068 | Lead Granules 1-5 mm, 99.999% |
GX8107 | Lead Granules 1-5 mm, 99.9995% |
GX3133 | Lead Granules 3 mm, 99.9+% |
GX9614 | Lead Pellets 6 x 6 mm, 99.9+% |
GX1060 | Lead Powder |
GX9983 | Lead Rod 10 mm, 99.999% |
GX1656 | Lead Rod 6 mm diameter, 99.99% |
GX3646 | Lead Rod 8 mm, 99.999% |
GX2757 | Lead Shot 0.4-0.8 mm, 99.9+% |
GX9735 | Lead titanate, 99.9% |
GX7052 | Lead tungstate, 99.9% |
GX6889 | Lead Wire 0.5 mm diameter, 99% |
GX2458 | Lead Wire 1.0 mm diameter, 99.9+% |
GX6765 | Lead Wire 1.0 mm diameter, 99.99% |
GX9548 | Lead Wire 1.0 mm diameter, 99.999% |
GX4054 | Lead Wire 1.6 mm diameter, 99.99% |
GX3985 | Lead Wire 2.0 mm diameter, 99.9+% |
GX7021 | Lead Wire 2.0 mm diameter, 99.99% |
GX6713 | Lead Wire 2.0 mm diameter, 99.999% |
GX1998 | Lead Wire 3.0 mm diameter, 99.999% |
GX5440 | Lead zirconate, 99.7% |
GX9319 | Lead, Antimony alloy, 2.5-3.5% Sb, shot 2-3 mm |
GX5771 | Lead(II) acetate hydrate, 99.999% |
GX8891 | Lead(II) acetate trihydrate, 99.5+% |
GX2019 | Lead(II) fluoride, 99.9% |
GX9701 | Lead(II) fluoride, 99.99% |
GX4360 | Lead(II) iodide, 98% |
GX5822 | Lead(II) iodide, 99.999% |
GX2548 | Lead(II) molybdate, 99.9% |
GX1570 | Lead(II) niobate, 99.9% |
GX5568 | Lead(II) oxide, 99.999% |
GX3757 | Lead(II) oxide, 99% |
GX3979 | Lead(II) selenide, 99% |
GX4153 | Lead(II) sulfate, 98% |
GX2788 | Lead(II) sulfate, 99.999% |
GX1891 | Lead(II) telluride, 99.999% |
GX0028 | Lead(II) tetrafluoroborate solution, 50% |
GX2437 | Lead(II) thiocyanate, 98+% |
GL7758 | Ledol |
GW0606 | LEE011 |
GP6125 | Leflunomide |
GT6256 | Leishman''s stain |
GP6222 | Lenalidomide |
GP2959 | Lentinan |
GL0192 | Leptomycin B |
GP1426 | Letrozole |
GL8276 | Leucettine L41 |
GT6330 | Leucocrystal Violet |
GT7606 | Leucomalachite Green |
GE7125 | Leupeptin hemisulfate |
GP2433 | Leuprolide acetate |
GA3670 | Levamisol hydrochloride |
GP1133 | Levetiracetam |
GP7550 | Levocetirizine dihydrochloride |
GA6417 | Levofloxacin |
GA2496 | Levofloxacin hydrochloride |
GC7426 | Levoglucosenone |
GP7196 | Levosimendan |
GP2472 | Levosulpiride |
GC3263 | Lichenan |
GK6463 | Lidocaine |
GP7771 | Lidocaine hydrochloride monohydrate, 98% |
GP3932 | Lidocaine hydrochloride monohydrate, EP grade |
GT6845 | Light Green SF Yellowish (C.I. 42095) |
GX1374 | Lignosulfonic acid calcium salt |
GX8328 | Lignosulfonic acid potassium salt |
GX2755 | Lignosulfonic acid sodium salt |
GK0995 | Lilial |
GP4085 | Limonin |
GP5216 | Linagliptin |
GP6851 | Linalool |
GC5398 | Linamarin |
GC6460 | Linarin |
GA3892 | Lincomycin hydrochloride |
GL2031 | Lindane |
GA2609 | Linezolid |
GW0425 | Linifanib |
GK5161 | Linoleic acid |
GK5074 | Linoleic acid, 99% |
GL9596 | Linolenic acid |
GW4278 | Lipofermata |
GC1330 | Liquiritin |
GX3695 | Liraglutide |
GP1712 | Lisinopril |
GX6845 | Lithium acetate 99+% |
GK2943 | Lithium acetate dihydrate |
GX0577 | Lithium benzoate, 99% |
GX7315 | Lithium bromide, anhydrous, 99% |
GX7417 | Lithium bromide, anhydrous, 99+% |
GX5986 | Lithium bromide, hydrate, 99.95% |
GK3300 | Lithium carbonate |
GX5892 | Lithium carbonate, 99.99% |
GE1934 | Lithium chloride |
GX8309 | Lithium chloride hydrate, 99.9+% |
GX2369 | Lithium chloride, 99.9+% |
GX0243 | Lithium citrate tetrahydrate, 99+% |
GX0522 | Lithium dihydrogen phosphate, 97% |
GD2271 | Lithium dodecyl sulfate |
GD3001 | Lithium dodecyl sulfate, 99% |
GX1571 | Lithium hexafluorophosphate(V); 98% |
GK9443 | Lithium hydroxide monohydrate |
GX0545 | Lithium hydroxide, anhydrous, 99% |
GX0487 | Lithium hydroxide, monohydrate, 98+% |
GX0436 | Lithium metaborate, 99.995+% |
GX7565 | Lithium metaborate, anhydrous |
GX1194 | Lithium metaborate, anhydrous, 99.9% |
GX4591 | Lithium niobate, 99.9% |
GX9809 | Lithium nitrate, anhydrous |
GX9077 | Lithium nitrate, anhydrous, 99.995% |
GX9030 | Lithium perchlorate, anhydrous |
GX8112 | Lithium phenyl-2,4,6-trimethylbenzoylphosphinate |
GX3466 | Lithium phosphate |
GX2584 | Lithium sulfate monohydrate, 99% |
GX9097 | Lithium sulfate, anhydrous, 99% |
GX7464 | Lithium sulfate, monohydrate, 99.9+% |
GX7269 | Lithium tantalate, 99.9% |
GX0594 | Lithium tetraborate, 99.95+% |
GX3587 | Lithium tetraborate, 99% |
GX4801 | Lithium tetrahydridoborate, 95% |
GW7003 | Lithium tetrakis(pentafluorophenyl)borate ethyl etherate |
GX5534 | Lithium tungstate, 99.9% |
GX8731 | Lithium vanadate, 99.9% |
GX9730 | Lithium zirconate, 99% |
GW7435 | Litihium ionophore III |
GT7868 | Litmus |
GP3753 | Lobenzarit disodium salt |
GC1233 | Locust bean gum |
GC0918 | Locust bean gum, pure, 2400 - 2800 cps |
GA6534 | Lomefloxacin hydrochloride |
GP1101 | Loperamide hydrochloride |
GP6351 | Lopinavir |
GP7681 | Loratadine |
GC8253 | Lorcaserin carbamoyl-β-D-glucuronide |
GP4427 | Lorcaserin hydrochloride hemihydrate |
GP9841 | Lornoxicam |
GP6564 | Losartan |
GP5105 | Loteprednol etabonate |
GP4839 | Lovastatin |
GP5830 | Loxapine succinate salt |
GL5446 | Luisol A |
GC4054 | Lumacaftor acyl-β-D-glucuronide |
GP8383 | Luminol |
GC0838 | Lumiracoxib acyl-b-D-glucuronide |
GT0556 | Lumogallion |
GL2733 | Lupeol |
GP5376 | Luteolin |
GK3885 | Luteolin 7-rutinoside |
GC0559 | Luteolin-7-O-D-glucopyranoside |
GW6055 | Luteoreticulin |
GX7889 | Lutetium acetate hydrate, 99.9% |
GX2224 | Lutetium acetate hydrate, 99.999% |
GX9080 | Lutetium carbonate hydrate, 99.9% |
GX1554 | Lutetium carbonate hydrate, 99.999% |
GX2950 | Lutetium Chips, 99.9% |
GX7959 | Lutetium chloride anhydrous, 99.9% |
GX3720 | Lutetium chloride hydrate, 99.9% |
GX4754 | Lutetium fluoride anhydrous, 99.9% |
GX4704 | Lutetium Foil 0.25mm, 99.9% |
GX8216 | Lutetium hydroxide hydrate, 99.99% |
GX3667 | Lutetium nitrate hydrate, 99.9% |
GX0687 | Lutetium oxalate hydrate, 99.9% |
GX3917 | Lutetium oxalate hydrate, 99.999% |
GX3675 | Lutetium oxide, 99.9% |
GX4879 | Lutetium oxide, 99.99% |
GX2559 | Lutetium oxide, 99.999% |
GX6774 | Lutetium oxide, 99.9999% |
GX3800 | Lutetium oxide, 99.9999% |
GX1068 | Lutetium Pieces, 99.9% |
GX9538 | Lutetium Pieces, 99.99% |
GX3553 | Lutetium Powder, 99.9% |
GX1411 | Lutetium sulfate hydrate, 99.9% |
GX4039 | Lutetium sulfate hydrate, 99.999% |
GL4623 | LY-294,002 |
GL8919 | LY-333,531 hydrochloride |
GW5071 | LY2784544 |
GW3922 | LY2801653 |
GW8945 | LY2835219 |
GK5538 | LY311727 |
GP3363 | Lycopene |
GK0766 | Lycorine hydrochloride |
GP3340 | Lynestrenol |
GA1731 | Lysolipin I |
GE8228 | Lysozyme, from chicken egg white |
GX9002 | m-Cresol |
GT6972 | m-Cresol Purple |
GT4965 | m-Cresol Purple sodium salt |
GK3515 | m-Phenylenediamine |
GW2119 | M-Phisyl-chloride |
GK1312 | m-Xylene |
GS6320 | m-Xylene, GlenPure?, analytical grade |
GW2168 | MAC-545496 |
GA1224 | Macrosphelide A |
GP8236 | Mafenamide acetate |
GX2500 | Magnesium 2,4-pentanedionate, 98% |
GK4886 | Magnesium acetate tetrahydrate |
GX7832 | Magnesium boride, 96+% |
GX3683 | Magnesium bromide hexahydrate |
GX8370 | Magnesium chloride anhydrous, 99.9% |
GK8228 | Magnesium chloride hexahydrate |
GK0382 | Magnesium chloride hexahydrate, BP, Ph. Eur. grade |
GK5046 | Magnesium chloride, anhydrous |
GX9805 | Magnesium chloride, hexahydrate, 99.995% |
GK3304 | Magnesium citrate tribasic hydrate |
GC8065 | Magnesium D-gluconate hydrate |
GX3844 | Magnesium fluoride, 99.9% |
GX9551 | Magnesium fluoride, 99.99% |
GX7432 | Magnesium fluoride, tech. |
GX2130 | Magnesium Foil 0.25 mm, 98% |
GX1938 | Magnesium Foil 0.5 mm, 98% |
GX4157 | Magnesium gluconate, USP grade |
GX9719 | Magnesium hexafluorosilicate, hexahydrate, 99% |
GX7640 | Magnesium hydroxide, 95.0% |
GK3533 | Magnesium L-lactate hydrate |
GX1101 | Magnesium molybdate, 99.9% |
GK0164 | Magnesium nitrate hexahydrate |
GX1786 | Magnesium nitrate, hexahydrate, 99+%, ACS |
GK6094 | Magnesium oxide |
GX8585 | Magnesium oxide Nanopowder + Stearic Acid, 99,9 % |
GX1655 | Magnesium oxide Nanopowder, 99.9% [APS 35 nm/ SSA g.t.50 m2/g] |
GX9231 | Magnesium oxide-Nano Powder, 99+% |
GX1357 | Magnesium oxide, 98+% |
GX5258 | Magnesium oxide, 99.9% |
GX1148 | Magnesium oxide, 99.99% |
GX0575 | Magnesium Pellets 4x4 mm, 99.99% |
GX2611 | Magnesium perchlorate |
GX3181 | Magnesium phosphate hydrate |
GX7837 | Magnesium Powder 315-630 micron, 99% |
GK9627 | Magnesium ribbon |
GX4432 | Magnesium Rod 25.4 mm diameter, 99.9% |
GX0894 | Magnesium Rod 6.35 mm diameter, 99.9+% |
GX2592 | Magnesium Rod 9.5 mm diameter, 99.9+% |
GX2119 | Magnesium Sheet 1 mm, 98% |
GX4358 | Magnesium Sheet 2 mm, 98% |
GE2971 | Magnesium silicate |
GX8335 | Magnesium stearate |
GX1421 | Magnesium stearate, EP, USP grade |
GK8109 | Magnesium sulfate heptahydrate |
GK9094 | Magnesium sulfate, anhydrous |
GK9199 | Magnesium sulfate, dried, USP grade |
GX5447 | Magnesium thiosulfate, hexahydrate |
GX3912 | Magnesium tungstate, 99.9% |
GX3323 | Magnesium Turnings 2-5 mm, 99.5% |
GX0005 | Magnesium vanadate, 99.9% |
GX9156 | Magnesium-thd, 99.9% |
GX0342 | Magnesium, powder, 150 - 350 mesh |
GY6402 | Magnoflorine |
GA6326 | Magnolol |
GL5069 | Makisterone A |
GT7477 | Malachite green carbinol base |
GT8088 | Malachite Green carbinol hydrochloride |
GT6969 | Malachite Green hydrochloride |
GT8926 | Malachite Green oxalate salt (C.I. 42000) |
GE7108 | Malachite Green solution, 1% in water |
GK3899 | Maleic acid |
GK2279 | Maleic anhydride |
GK6384 | Maleimide |
GL8069 | Malformin A1 |
GA2351 | Malformin C |
GK0631 | Malonic acid |
GK9243 | Malononitrile |
GC8744 | Maltodextrin (DE 17.0 - 20.0) |
GC9534 | Maltodextrin (DE 9.0 - 15.0) |
GC5959 | Maltooctaose |
GC6488 | Maltotetraitol |
GC0323 | Maltotriitol |
GC9153 | Maltotriose |
GW7662 | Mancozeb |
GX6480 | Manganese carbonate, 99.9+% |
GX5474 | Manganese Flakes max. 4 mm, 99.8% |
GX0468 | Manganese Foil 1 mm, casted, 99.9% |
GX4003 | Manganese Foil 2 mm, casted, 99.9+% |
GX0978 | Manganese Pieces, irregular, 3-12 mm, 99.99% |
GX7475 | Manganese Pieces, irregular, 99.9% |
GX5828 | Manganese Powder -325 mesh, 99.6% |
GX4231 | Manganese Powder -60 mesh, 99.98% |
GX1283 | Manganese Powder 125-500 micron, low oxygen, 99.8+% |
GX9611 | Manganese silicide, 99.5% |
GX1823 | Manganese titanate, 99+% |
GX4905 | Manganese tungstate, 99.9% |
GX9457 | Manganese(II) acetate tetrahydrate, 99% |
GX4047 | Manganese(II) acetate, tetrahydrate, 99.99% |
GX3940 | Manganese(II) bromide, tetrahydrate, 98% |
GX2705 | Manganese(II) carbonate, tech. |
GK2508 | Manganese(II) chloride tetrahydrate |
GX4690 | Manganese(II) chloride, tetrahydrate, 99.99% |
GX2034 | Manganese(II) fluoride, 99% |
GX7077 | Manganese(II) hypophosphite hydrate, 98+% |
GX8825 | Manganese(II) nitrate tetrahydrate, 97.5% |
GX6886 | Manganese(II) nitrate, hydrate, 99.99% |
GX5655 | Manganese(II) oxide, 99% |
GK7776 | Manganese(II) sulfate monohydrate |
GK2450 | Manganese(II) sulfate monohydrate, EP, USP grade |
GX5773 | Manganese(III) 2,4-pentanedionate |
GX2857 | Manganese(III) fluoride, 99.5% |
GX1319 | Manganese(III) oxide Nanopowder, 98+ % |
GK4401 | Manganese(IV) oxide, 99.9% |
GP1065 | Manidipine dihydrochloride |
GC1955 | Mannide monooleate, animal origin |
GC9067 | Manninotriose |
GC1530 | Mannose triflate |
GK1762 | Manool |
GL8712 | Manumycin A |
GA7050 | Manumycin B |
GL9994 | Manzamine A |
GW9765 | MAPTAM |
GP7878 | Maraviroc |
GA7058 | Marbofloxacin |
GL7951 | Martinomycin |
GL3107 | Martius Yellow (C.I. 10315) |
GW8580 | Masatinib |
GL6116 | Maslinic acid |
GP0925 | Matrine |
GT5626 | May-Grunwald Stain (powder) |
GW2485 | MBIMPH |
GW9422 | MBIMPH F-Analog 1 . hydrochloride |
GW5526 | MBIMPH F-Analog 2 |
GW9082 | MBP146-78 |
GL1674 | MCC950 sodium salt |
GW0130 | MCPA-thioethyl |
GL0946 | MDL 72527 |
GL4627 | Me6BIO |
GL5857 | Me7BIO |
GA6625 | Mebendazole |
GA6807 | Mecillinam |
GL0681 | Meclofenamic acid sodium salt |
GW3464 | Medetomidine HCl |
GP1772 | Medroxyprogesterone-17-acetate |
GP6603 | Mefenamic acid |
GC0454 | Mefenamic acid acyl-β-D-glucuronide |
GP7880 | Mefloquine hydrochloride |
GP0681 | Mefloquine hydrochloride, BP, Ph. Eur., USP grade |
GW8894 | Mefluidide |
GP9359 | Megestrol acetate |
GK4761 | Melanin |
GP8408 | Melatonin |
GT0259 | Meldola's blue |
GA3853 | Meleagrin |
GP4959 | Meloxicam |
GP0943 | Melphalan |
GP3789 | Melphalan, USP grade |
GP8214 | Memantine hydrochloride |
GC5534 | Memantine lactose adduct |
GC4334 | Memantine N-β-D-glucuronide |
GK8847 | MEN-10,376 |
GA0934 | Menadione sodium bisulfite |
GL6920 | Mensacarcin |
GL1129 | Mephenytoin |
GP8247 | Mepivacaine hydrochloride |
GW4610 | Meptyldinocap |
GP4255 | Mequitazine |
GW6872 | Merafloxacin |
GY5847 | Meranzin |
GL6500 | Meranzin hydrate |
GK8337 | Mercaptosuccinic acid |
GW2210 | Merck-5 |
GX4953 | Mercury(I) nitrate, dihydrate, 98+% |
GX3557 | Mercury(II) acetate, 98.5+% |
GX7412 | Mercury(II) oxide, yellow, 99+% |
GW5978 | Merocyanin 540 |
GP7412 | Meropenem trihydrate |
GB1243 | MES |
GB7345 | MES hemisodium salt |
GB1307 | MES monohydrate |
GB6040 | MES potassium salt |
GB1926 | MES sodium salt |
GE5702 | MES, 1M solution |
GP4428 | Mesna |
GC1722 | meso-Erythritol |
GW5398 | meso-Tetraphenyl-tetrabenzoporphine palladium complex |
GL5207 | Mesoridazine benzenesulfonate |
GW3908 | Mesuximide |
GE4337 | meta-Topolin |
GE4311 | meta-Topolin riboside |
GK9681 | Metamifop |
GW9256 | Metamitron |
GT1665 | Metanil Yellow (C.I. 13065) |
GP2747 | Metformin hydrochloride |
GK8835 | Methanesulfonic acid |
GX5097 | Methanol |
GS3517 | Methanol 205, GlenPure?, analytical grade gradient quality |
GS8324 | Methanol 215, GlenPure?, analytical grade |
GS3434 | Methanol 225, GlenPure?, analytical grade |
GS7398 | Methanol, for HPLC, gradient grade, 99.9% |
GS1617 | Methanol, GlenDry?, anhydrous |
GS1114 | Methanol, GlenDry?, anhydrous over molecular sieve |
GS0087 | Methanol, GlenUltra?, analytical grade, for GC |
GS0625 | Methanol, GlenUltra?, analytical grade, for LC |
GW8008 | Methasulfocarb |
GP2312 | Methimazole |
GA6211 | Methotrexate hydrate |
GW4017 | Methoxyfenozide |
GK7979 | Methoxymethyl triphenylphosphonium chloride |
GD3605 | Methoxypolyethylene glycol 500 |
GC7370 | Methyl 1,2,3,4-Tetra-O-acetyl-α-L-idopyranuronate |
GC6266 | Methyl 1,2,3,4-tetra-O-acetyl-β-D-glucuronate |
GC1352 | Methyl 2-acetamido-3-O-acetyl-4,6-O-benzylidene-2-deoxy-α-D-glucopyranoside |
GC8983 | Methyl 2-acetamido-3-O-benzyl-2-deoxy-α-D-glucopyranoside |
GC8446 | Methyl 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-α-D-glucopyranoside |
GC1837 | Methyl 2-acetamido-3,6-di-O-acetyl-2-deoxy-α-D-glucopyranoside |
GC7980 | Methyl 2-acetamido-4,6-O-benzylidene-2-deoxy-α-D-glucopyranoside |
GK7282 | Methyl 2-aminobenzoate |
GC4706 | Methyl 2-deoxy-2-fluoro-L-arabinofuranoside |
GC6148 | Methyl 2-deoxy-3,5-di-O-benzoyl-D-ribofuranoside |
GC9261 | Methyl 2,2'',2'''',3,3'',3''''-hexa-O-acetyl-6,6'',6''''-trideoxy-6,6'',6''''-triiodo-β-D-cellotrioside |
GC2948 | Methyl 2,2'',3,3'',4'',6,6''-hepta-O-acetyl-β-D-maltoside |
GC6876 | Methyl 2,2'',3,3'',4'',6,6''-hepta-O-benzyl-α-D-maltoside |
GC2265 | Methyl 2,2'',3,3'',4'',6''-hexa-O-acetyl-6-O-benzyl-β-D-cellobioside |
GC3853 | Methyl 2,3-anhydro-b-D-ribopyranoside |
GC5077 | Methyl 2,3-di-O-acetyl-4,6-O-benzylidene-a-D-glucopyranoside |
GC8840 | Methyl 2,3-di-O-acetyl-4,6-O-benzylidene-β-D-glucopyranoside |
GC7059 | Methyl 2,3-di-O-acetyl-α-D-glucopyranoside |
GC8809 | Methyl 2,3-di-O-benzyl-4,6-O-benzylidene-β-D-glucopyranoside |
GC2185 | Methyl 2,3-di-O-benzyl-a-D-glucopyranoside |
GC2559 | Methyl 2,3-O-isopropylidene-5-O-(p-tolylsulfonyl)-β-D-ribofuranoside |
GC4596 | Methyl 2,3-O-isopropylidene-6-O-tosyl-α-D-mannofuranoside |
GC1216 | Methyl 2,3-O-isopropylidene-α-L-lyxofuranoside |
GC3492 | Methyl 2,3-O-Isopropylidene-β-D-ribofuranoside |
GC3555 | Methyl 2,3,4-tri-O-acetyl-6-azido-6-deoxy-α-D-glucopyranoside |
GC5177 | Methyl 2,3,4-tri-O-acetyl-6-deoxy-6-iodo-α-D-glucopyranoside |
GC8150 | Methyl 2,3,4-tri-O-acetyl-6-deoxy-6-iodo-β-D-glucopyranoside |
GC6280 | Methyl 2,3,4-tri-O-acetyl-6-deoxy-α-D-glucopyranoside |
GC6447 | Methyl 2,3,4-tri-O-acetyl-b-D-glucopyranuronosyl azide |
GC6267 | Methyl 2,3,4-tri-O-acetyl-β-D-galactopyranoside |
GC7322 | Methyl 2,3,4-tri-O-benzyl-α-D-glucuronide benzyl ester |
GC5294 | Methyl 2,3,4-Tri-O-benzyl-β-D-xylopyranoside |
GC4282 | Methyl 2,3,4-Tri-O-isobutyryl-1-O-trichloroacetimidoyl-α-D-glucopyranuronate |
GC8388 | Methyl 2,3,4,6-Tetra-O-benzyl-α-D-glucopyranoside |
GC5444 | Methyl 2,3,4,6-Tetra-O-benzyl-α-D-mannopyranoside |
GC7271 | Methyl 2,3,6-tri-O-acetyl-a-D-glucopyranoside |
GC6980 | Methyl 2,3,6-tri-O-acetyl-β-D-glucopyranoside |
GC3052 | Methyl 2,3,6-Tri-O-benzoyl-α-D-galactopyranoside |
GC9026 | Methyl 2,3,6-tri-O-benzyl-b-D-glucopyranoside |
GC9612 | Methyl 2,3:4,6-di-O-isopropylidene-α-D-mannopyranoside |
GC7559 | Methyl 2,3:5,6-di-O-isopropylidene-α-D-mannofuranoside |
GC0083 | Methyl 2,4-di-O-acetyl-3,6-anhydro-α-D-glucopyranoside |
GC8615 | Methyl 2,4-di-O-acetyl-3,6-anhydro-β-D-glucopyranoside |
GC0680 | Methyl 2,4,6-tri-O-acetyl-3-O-(2,3,4,6-tetra-O-acetyl-α-D-galactopyranosyl)-α-D-galactopyranoside |
GC1329 | Methyl 2,4,6-tri-O-acetyl-3-O-benzyl-β-D-galactopyranoside |
GC3864 | Methyl 2,6-di-O-benzyl-β-D-galactopyranoside |
GC9950 | Methyl 3-amino-3-deoxy-α-D-mannopyranoside hydrochloride |
GC9971 | Methyl 3-O-(2-acetamido-2-deoxy-b-D-glucopyranosyl)-b-D-galactopyranoside |
GC8274 | Methyl 3-O-(2-acetamido-2-deoxy-α-D-galactopyranosyl)-α-D-galactopyranoside |
GC8857 | Methyl 3-O-(2-acetamido-2-deoxy-α-D-galactopyranosyl)-β-D-galactopyranoside |
GC7414 | Methyl 3-O-(2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-β-D-glucopyranosyl)-2,4,6-tri-O-acetyl-β-D-galactopyranoside |
GC3830 | Methyl 3-O-(3,4,6-tri-O-acetyl-2-deoxy-2-phthalimido-β-D-glucopyranosyl)-2,4,6-tri-O-acetyl-β-D-galactopyranoside |
GC1161 | Methyl 3-O-acetyl-4-O-benzyl-β-D-xylopyranoside |
GC4564 | Methyl 3-O-benzoyl-4,6-O-benzylidene-α-D-mannopyranoside |
GC7791 | Methyl 3-O-benzyl-4,6-O-benzylidene-N-Cbz-α-D-glucopyranosaminide |
GC6669 | Methyl 3-O-benzyl-4,6-O-benzylidene-β-D-galactopyranoside |
GC4389 | Methyl 3-O-benzyl-N-Cbz-α-D-glucopyranosaminide |
GC5033 | Methyl 3-O-benzyl-β-D-galactopyranoside |
GC8146 | Methyl 3-O-α-D-galactopyranosyl-β-D-galactopyranoside |
GK2306 | Methyl 3,3-dimethoxypropionate |
GC6903 | Methyl 3,4-di-O-acetyl-2-deoxy-2-fluoro-β-D-xylopyranoside |
GC1471 | Methyl 3,4-di-O-acetyl-D-glucuronal |
GC7854 | Methyl 3,4-O-isopropylidene-2-O-tosyl-β-D-arabinopyranoside |
GC3241 | Methyl 3,4-O-isopropylidene-β-D-galactopyranoside |
GC5929 | Methyl 3,4:5,6-di-O-isopropylidene-D-gluconate |
GC8080 | Methyl 3,5-di-O-benzyl-D-xylofuranoside |
GC1967 | Methyl 4-Deoxy-4-fluoro-α-D-glucose Tribenzoate |
GC0716 | Methyl 4-deoxy-4-fluoro-β-D-glucopyranoside |
GK8191 | Methyl 4-hydroxybenzoate sodium salt |
GE2869 | Methyl 4-hydroxybenzoate, Ph. Eur. grade |
GC2115 | Methyl 4-O-(2-acetamido-2-deoxy-β-D-glucopyranosyl)-β-D-galactopyranoside |
GC1502 | Methyl 4-O-(a-D-galactopyranosyl)-a-D-galactopyranoside |
GC5419 | Methyl 4,6-dichloro-4,6-dideoxy-α-D-galactopyranoside |
GC0775 | Methyl 4,6-O-((R,S)-4-nitrobenzylidene)-α-D-galactopyranoside |
GC8957 | Methyl 4,6-O-((S)-4-nitrobenzylidene)-α-D-galactopyranoside |
GC1134 | Methyl 4,6-O-benzylidene-2,3-di-O-benzyl-a-D-glucopyranoside |
GC9854 | Methyl 4,6-O-benzylidene-a-D-glucopyranoside |
GC3351 | Methyl 4,6-O-benzylidene-b-D-galactopyranoside |
GC0277 | Methyl 4,6-O-benzylidene-N-Cbz-2-deoxy-α-D-glucopyranosaminide |
GC0636 | Methyl 4,6-O-Benzylidene-α-D-glucopyranoside |
GW0383 | Methyl 5-aminopyridine-3-carboxylate |
GC8132 | Methyl 5-deoxy-5-iodo-2,3-O-isopropylidene-α-L-lyxofuranoside |
GW3545 | Methyl 5-hydroxy-3-pyridinecarboxylate |
GC3991 | Methyl 6-deoxy-6-iodo-α-D-glucopyranoside |
GC3503 | Methyl 6-deoxy-6-iodo-β-D-glucopyranoside |
GC6357 | Methyl 6-deoxy-a-D-glucopyranoside |
GC9921 | Methyl 6-deoxy-β-D-glucopyranoside |
GW1291 | Methyl 6-hydroxy-5-nitropyridine-3-carboxylate |
GC9611 | Methyl 6-O-(N-heptylcarbamoyl)-a-D-glucopyranoside |
GC8781 | Methyl 6-O-acetyl-3-O-benzyl-2-benzyloxycarbonylamino-2-deoxy-a-D-glucopyranose |
GC2561 | Methyl 6-O-acetyl-3-O-benzyl-N-Cbz-2-deoxy-4-O-(methyl 2-O-acetyl-3-O-benzyl-α-L-idopyranuronosyl)-α-D-glucopyranosaminide |
GC7747 | Methyl 6-O-tosyl-β-D-galactopyranoside |
GC7495 | Methyl 6-O-trityl-α-D-mannopyranoside |
GC7023 | Methyl 6-O-trityl-β-D-galactopyranoside |
GC3568 | Methyl 6,6'',6''''-trideoxy-6,6'',6''''-triiodo-β-D-cellohexaoside |
GC4378 | Methyl 6,6'',6''''-trideoxy-6,6'',6''''-triiodo-β-D-cellotrioside |
GX8432 | Methyl acetate |
GC6741 | Methyl alpha-D-galactopyranoside |
GC8691 | Methyl alpha-D-glucopyranoside |
GC7658 | Methyl b-D-arabinopyranoside |
GC6893 | Methyl b-D-xylopyranoside |
GL2503 | Methyl benzoate |
GC7084 | Methyl beta-D-glucopyranoside |
GT6506 | Methyl Blue (C.I. 42780) |
GL0200 | Methyl butyrate |
GC0717 | Methyl cellulose |
GC4606 | Methyl D-galactofuranoside |
GC1699 | Methyl D-glucofuranoside |
GX7351 | Methyl DL-lactate |
GS2497 | Methyl Ethyl Ketone, GlenDry?, anhydrous |
GS6653 | Methyl Ethyl Ketone, GlenPure?, analytical grade |
GT7495 | Methyl Green (C.I. 42585) |
GT9540 | Methyl Green zinc chloride salt (C.I. 42590) |
GT9160 | Methyl Green-Pyronin solution |
GK5147 | Methyl heptadecanoate |
GS8140 | Methyl iso-Butyl Ketone, GlenDry?, anhydrous |
GS6627 | Methyl iso-Butyl Ketone, GlenPure?, analytical grade |
GK5973 | Methyl linoleate, 95% |
GC2856 | Methyl N-acetyl-alpha-D-glucosaminide |
GC8314 | Methyl N-Cbz-α-D-glucopyranosaminide |
GK8409 | Methyl nicotinate |
GT1067 | Methyl Orange (C.I. 13025) |
GK1777 | Methyl palmitate |
GW8412 | Methyl phthaloyl chloride |
GL9842 | Methyl propionate |
GT1411 | Methyl Red (C.I. 13020) |
GT3952 | Methyl Red sodium salt (C.I. 13020) |
GK9357 | Methyl salicylate |
GK6996 | Methyl stearate |
GS9559 | Methyl tert-Butyl Ether, GlenDry?, anhydrous |
GS6316 | Methyl tert-Butyl Ether, GlenPure?, analytical grade |
GK0547 | Methyl tridecanoate |
GK1205 | Methyl undecanoate |
GT4491 | Methyl Violet 2B (C.I. 42535) |
GC2898 | Methyl α-D-lactoside |
GC1172 | Methyl α-D-maltoside |
GC2632 | Methyl α-D-mannofuranoside |
GC4594 | Methyl β-D-cellobioside heptaacetate |
GC8035 | Methyl β-D-fructopyranoside |
GC2228 | Methyl β-D-maltoside |
GC7204 | Methyl β-D-Mannopyranoside Isopropylate |
GC3075 | Methyl β-L-arabinopyranoside |
GC3614 | Methyl-beta-cyclodextrin |
GL3979 | Methylbenzethonium chloride |
GV9033 | Methylcobalamin hydrate |
GS2668 | Methylcyclohexane, GlenDry?, anhydrous |
GS1672 | Methylcyclohexane, GlenPure?, analytical grade |
GS6662 | Methylcyclopentane 95%, GlenDry?, anhydrous |
GW7537 | Methyldymron |
GT8594 | Methylene Blue solution, 0.5% in water |
GT0735 | Methylene Blue trihydrate (C.I. 52015) |
GT1060 | Methylene Blue, anhydrous (C.I. 52015) |
GL0650 | Methylene Violet 3RAX |
GL9346 | Methylglyoxal solution 40% in water |
GT5950 | Methylthymol Blue sodium salt |
GW2944 | Methyltrioctadecylammonium bromide |
GP2886 | Methysergide maleate salt |
GP5892 | Metoclopramide hydrochloride |
GP5935 | Metolazone |
GP2424 | Metoprolol tartrate |
GA3859 | Metronidazole |
GP6954 | Metronidazole benzoate |
GC6083 | Metronidazole O-β-D-glucuronide |
GP8770 | Metyrapone |
GA8933 | Mevastatin |
GP5333 | Mexiletine hydrochloride |
GA3267 | Mezlocillin sodum salt |
GW0254 | MI-2 [MALT1 Inhibitor] |
GX5973 | Micafungin sodium |
GA8311 | Miconazole |
GA3642 | Miconazole nitrate salt |
GP7563 | Midodrine hydrochloride |
GP8226 | Mifepristone |
GW2470 | Mildronate dihydrate |
GL2721 | Miltefosine |
GX1229 | Mineral oil |
GA7395 | Minocycline hydrochloride |
GP5950 | Minoxidil |
GP8215 | Minoxidil sulfate salt |
GC3808 | Mirabegron carbamoyl-β-D-glucuronide |
GP8422 | Mirtazapine |
GA1050 | Mithramycin A |
GC2356 | Mitiglinide acyl-β-D-glucuronide |
GA9147 | Mitomycin C |
GP2417 | Mitoxantrone |
GE4193 | MK-2206 dihydrochloride |
GW5073 | MK-2461 |
GW7013 | MK-4827 tosylate |
GL9206 | MK-571 sodium salt |
GC3946 | MLN 4924 |
GW9035 | MLN0128 |
GL5377 | MnTBAP chloride |
GL8780 | MnTMPyP pentachloride |
GX8738 | Molecular sieve 13X, 0.4-0.8 mm beads (8.5 Angstrom pore size) |
GX7122 | Molecular sieve 13X, 3-5 mm beads (8.5 Angstrom pore size) |
GX1569 | Molecular sieve 13X, powder (8.5 Angstrom pore size) |
GX1358 | Molecular sieve 3A, 0.4-0.8 mm beads (3 Angstrom pore size) |
GX1505 | Molecular sieve 3A, 3 - 5 mm, beads |
GX5452 | Molecular sieve 3A, powder (3 Angstrom pore size) |
GX8202 | Molecular sieve 4A, 2-3 mm beads (4 Angstrom pore size) |
GX2780 | Molecular sieve 4A, 3-5 mm beads (4 Angstrom pore size) |
GX7674 | Molecular sieve 4A, 3-5 mm beads (4 Angstrom pore size) |
GX7863 | Molecular sieve 4A, 3-5 mm beads (4 Angstrom pore size) |
GX7192 | Molecular sieve 5A, 1.6 - 2.5 mm beads (5 Angstrom pore size) |
GX4420 | Molecular sieve 5A, 3-5 mm beads (5 Angstrom pore size) |
GX1049 | Molecular sieve, 3A, 1.6 - 2.5 mm, beads |
GL1846 | Molsidomine |
GX5774 | Molybdenum boride, 98+% |
GX2434 | Molybdenum boride, 99% |
GX5267 | Molybdenum boride, 99+% |
GX9911 | Molybdenum Foil 0.025mm, 99.9+% |
GX4593 | Molybdenum Foil 0.1 mm, plane, shiny, 99.95% |
GX4416 | Molybdenum Foil 0.15mm, 99.95% |
GX2552 | Molybdenum Foil 0.1mm, 99.95% |
GX8943 | Molybdenum Foil 0.25mm, 99.9+% |
GX1246 | Molybdenum Foil 0.2mm, 99.95% |
GX1962 | Molybdenum Foil 0.3mm, 99.95% |
GX9163 | Molybdenum Foil 0.5mm, 99.95% |
GX9760 | Molybdenum Foil 1.0mm, 99.9+% |
GX5354 | Molybdenum Foil0.05mm, 99.9+% |
GX2699 | Molybdenum Pellets 6 x 12 mm, 99.9+% |
GX9003 | Molybdenum Pellets?6.35 x 6.35 mm, vacuum melted, 99.98% |
GX3538 | Molybdenum Powder max. 100 micron, 99.9% |
GX4223 | Molybdenum Powder, 2-5 micron, 99.95+% |
GX7974 | Molybdenum Rod 1 mm diameter, 99.95% |
GX9336 | Molybdenum Rod 1.5 mm diameter, 99.95% |
GX8980 | Molybdenum Rod 10 mm diameter, 99.95% |
GX0906 | Molybdenum Rod 12 mm diameter, 99.9+% |
GX8666 | Molybdenum Rod 2.0 mm diameter, 99.9+% |
GX3152 | Molybdenum Rod 2.5 mm diameter, 99.9+% |
GX2933 | Molybdenum Rod 20 mm diameter, 99.9+% |
GX6474 | Molybdenum Rod 3.0 mm diameter, 99.9+% |
GX9467 | Molybdenum Rod 30 mm diameter, 99.9+% |
GX5235 | Molybdenum Rod 4.0 mm diameter, 99.9+% |
GX1673 | Molybdenum Rod 5.0 mm diameter, 99.95% |
GX4022 | Molybdenum Rod 6.0 mm diameter, 99.9+% |
GX3370 | Molybdenum Rod 8.0 mm diameter, 99.9+% |
GX9615 | Molybdenum Sheet 1.5mm, 99.9+% |
GX3862 | Molybdenum Sheet 2.5mm, 99.9+% |
GX9338 | Molybdenum Sheet 2mm, 99.9+% |
GX6521 | Molybdenum Sheet 3mm, 99.9+% |
GX2864 | Molybdenum silicide, 99.5% |
GX7396 | Molybdenum Wire 0.1 mm diameter, 99.95% |
GX7146 | Molybdenum Wire 0.25 mm diameter, 99.95% |
GX7025 | Molybdenum Wire 0.3 mm diameter, 99.95% |
GX3073 | Molybdenum Wire 0.5 mm diameter, 99.95% |
GX7237 | Molybdenum Wire 0.7 mm diameter, 99.95% |
GX4703 | Molybdenum Wire 1.0 mm diameter, 99.95% |
GX0574 | Molybdenum Wire 1.5 mm diameter, 99.95% |
GX0175 | Molybdenum Wire 2.0 mm diameter, 99.95% |
GX1923 | Molybdenum(II) carbide, 99.5+% |
GX4987 | Molybdenum(IV) disulfide Nanopowder, 99 % |
GX0932 | Molybdenum(IV) oxide, 99+% |
GX2871 | Molybdenum(IV) sulfide, 98+% |
GX6266 | Molybdenum(VI) oxide, 99.0% |
GX8007 | Molybdenum(VI) oxide, 99.9% |
GK8458 | Molybdic acid, 85% |
GK9021 | Molybdic acid, 85%, ACS grade |
GW7607 | Momelotinib |
GP3167 | Mometasone furoate |
GA4916 | Monensin sodium salt |
GW3578 | Monosultap |
GX0261 | Montelukast sodium salt |
GB2811 | MOPS |
GB5755 | MOPS hemisodium salt |
GB8397 | MOPS sodium salt |
GE4590 | MOPS, 1M solution |
GB3672 | MOPS, 99.5% |
GB6742 | MOPSO |
GB3228 | MOPSO sodium salt |
GA4442 | Morantel citrate salt |
GT3894 | Mordant Blue 13 (C.I. 16680) |
GT7206 | Mordant Orange 1 |
GL8475 | Morin hydrate |
GP7040 | Moroxydine hydrochloride |
GP7199 | Mosapride citrate salt dihydrate |
GW4075 | Motesanib |
GL3071 | MOTS-c (human) |
GW2548 | MOTS-c (K14Q Mutant) (human) |
GA5791 | Moxalactam sodium salt |
GW5324 | Moxidectin |
GA9781 | Moxifloxacin hydrochloride |
GW4614 | MPAC-Br |
GW0372 | MPI_5a |
GW6520 | MPI-0479605 hydrochloride |
GL5031 | MS-1020 |
GW4082 | MSA-2 |
GL7225 | MTEP |
GL1695 | MTSSL |
GT1121 | Mucicarmine stock solution |
GC2824 | muco-inositol |
GA2184 | Mupirocin |
GA7711 | Mupirocin calcium salt |
GA8651 | Mupirocin lithium salt |
GT8960 | Murexide (C.I. 56085) |
GL9489 | Muristerone A |
GA8908 | Mutolide |
GA2175 | Myclobutanil |
GA8210 | Mycophenolic acid |
GC5220 | Mycophenolic acid acyl-b-D-glucuronide |
GC3927 | Mycophenolic acid b-D-glucuronide |
GC3274 | Mycophenolic acid phenolic b-D-glucoside |
GC4902 | myo-Inositol |
GL5441 | Myricetin |
GL7804 | Myristic acid |
GK3652 | Myristoyl chloride |
GP0735 | Myristyltrimethylammonium bromide |
GW8199 | Myxochelin A |
GL8860 | N-(+)-Biotinyl-6-aminohexanoic acid |
GK9342 | N-(1-Naphthyl)ethylenediamine dihydrochloride |
GW9929 | N-(2-Aminoethyl)biotinamide hydrochloride |
GM1937 | N-(2-Aminoethyl)glycine |
GE4065 | N-(2-Chloro-4-pyridyl)-N''-phenylurea |
GE5415 | N-(2-Hydroxy-3-sulfopropyl)- 3,5-dimethoxyaniline sodium salt |
GM8952 | N-(2-Hydroxyethyl)iminodiacetic acid |
GW4617 | N-(3-Bromopropyl)-7-nitro-2,1,3-benzoxadiazol-4-amine |
GW9845 | N-(3-Hydroxydecanoyl)-L-homoserine lactone |
GW1310 | N-(3-Hydroxydecenoyl)-DL-homoserine lactone |
GW6140 | N-(3-Hydroxydodecanoyl)-DL-homoserine lactone |
GW2810 | N-(3-Hydroxyoctanoyl)-DL-homoserine lactone |
GW6930 | N-(3-Hydroxyoctanoyl)-L-homoserine lactone |
GW6859 | N-(3-Hydroxytetradecanoyl)-DL-homoserine lactone |
GW1628 | N-(3-Hydroxytetradecanoyl)-L-homoserine lactone |
GW4695 | N-(3-Isothiocyanatobenzyl)-4-[5-(4-methoxyphenyl)-2-oxazolyl]pyridinium bromide |
GW1888 | N-(3-Isothiocyanatopropyl)-4-(5''-(4''''-methoxyphenyl)-2''-oxazolyl) pyridinium bromide |
GW4930 | N-(3-Oxobutanoyl)-DL-homoserine lactone |
GW5328 | N-(3-Oxobutanoyl)-L-homoserine lactone |
GW8862 | N-(3-Oxodecanoyl)-DL-homoserine lactone |
GW4561 | N-(3-Oxodecanoyl)-L-homoserine lactone |
GW4581 | N-(3-Oxododecanoyl)-L-homoserine lactone |
GW1711 | N-(3-Oxohexadecanoyl)-DL-homoserine lactone |
GW6157 | N-(3-Oxohexadecanoyl)-L-homoserine lactone |
GW3102 | N-(3-Oxononanoyl)-L-homoserine lactone |
GW3536 | N-(3-Oxooctanoyl)-DL-homoserine lactone |
GK8784 | N-(3-Oxooctanoyl)-L-homoserine lactone |
GW8446 | N-(3-Oxopentanoyl)-L-homoserine lactone |
GW7992 | N-(3-Oxotetradecanoyl)-DL-homoserine lactone |
GW6025 | N-(3-Oxotetradecanoyl)-L-homoserine lactone |
GW3519 | N-(3-Oxoundecanoyl)-L-homoserine lactone |
GW1179 | N-(3-Succinimidyloxy-carbonyl-phenyl)-methyl-4-(2-(6-(3,4-dihydro-2H-1-benzopyranyl))-5-oxazolyl)-pyridinium bromide |
GW5624 | N-(3-Succinimidyloxy-carbonyl-phenyl)-methyl-4-(5''-(4''''-methoxy-phenyl)-2''-oxazolyl)-pyridinium bromide |
GM4964 | N-(4-Aminobenzoyl)-L-glutamic acid |
GX7638 | N-(4-Chlorophenyl)-1,2-phenylenediamine |
GW4908 | N-(4-Isothiocyanatobenzyl)-4-[5-(4-methoxyphenyl)-2-oxazolyl]pyridinium bromide |
GW6967 | N-(4-Methylumbelliferyl)-maleinimide |
GW3829 | N-(5-Fluoresceinyl)-maleinimide |
GW7025 | N-(6-Aminohexyl)rhodamine 6G-amide bis(trifluoroacetate) |
GC9049 | N-(b-Hydroxyethyl)-1-deoxynojirimycin |
GK5402 | N-(Hydroxymethyl)phthalimide |
GM7775 | N-(Ketocaproyl)-L-homoserine lactone |
GW5146 | N-(N''-Maleinimidyl-2-ethyl)-4-(2-(6-(3,4-dihydro-2H-1-benzopyranyl))-5-oxyzolyl) pyridinium triflate |
GM3149 | N-(Phosphonomethyl)glycine |
GM8987 | N-(tert-Butoxycarbonyl)-3-iodo-L-alanine methyl ester |
GK4999 | N-(tert-Butyldimethylsilyl)-N-methyl trifluoroacetamide |
GM4380 | N-(β-Ketocaproyl)-L-homoserine lactone |
GC0082 | N-(ε-Aminocaproyl)-β-L-fucopyranosylamine |
GL0609 | N-[(3-(Anilinomethylene)-2-chloro-1-cyclohexen-1-yl)methylene]aniline monohydrochloride |
GL0193 | N-[3-(2-Furyl)acryloyl]-Phe-Gly-Gly, 97% |
GL4411 | N-[3-(2-Furyl)acryloyl]-Phe-Gly-Gly, 99% |
GC6997 | N-5-Carboxypentyl-1-deoxygalactonojirimycin |
GC7526 | N-Acetyl-9-azido-9-deoxy-neuraminic acid |
GM2947 | N-Acetyl-D-alanine |
GK3532 | N-Acetyl-D-galactosamine |
GC7987 | N-Acetyl-D-glucosamine |
GC7366 | N-Acetyl-D-glucosamine 6-phosphate disodium salt |
GC4097 | N-Acetyl-D-glucosamine, USP grade |
GE3308 | N-Acetyl-D-leucine |
GK3319 | N-Acetyl-D-mannosamine |
GM3168 | N-Acetyl-D-methionine |
GC5873 | N-Acetyl-D-quinovosamine |
GM4354 | N-Acetyl-DL-tryptophan |
GM7740 | N-Acetyl-DL-valine |
GM8485 | N-Acetyl-L-aspartic acid |
GM8692 | N-Acetyl-L-carnosine |
GM8803 | N-Acetyl-L-cysteine |
GM2975 | N-Acetyl-L-glutamic acid |
GM6577 | N-Acetyl-L-methionine |
GM0143 | N-Acetyl-L-phenylalanine |
GM7304 | N-Acetyl-L-tryptophan |
GM0216 | N-Acetyl-L-tyrosine |
GM5614 | N-Acetyl-L-tyrosine ethyl ester monohydrate |
GM3549 | N-Acetyl-S-phenyl-L-cysteine |
GC8355 | N-Acetyl-α-D-galactosamine 1-phosphate, disodium salt |
GC6851 | N-Acetyladenosine |
GM1310 | N-Acetylglycine |
GC7214 | N-Acetylneuraminic acid |
GC4738 | N-Acetylneuraminic acid methyl ester |
GC4268 | N-Azidoacetyl-D-glucosamine |
GC8072 | N-Azidoacetyl-β-D-glucosamine tetraacetate |
GM3301 | N-Benzylglycine ethyl ester |
GW7460 | N-Biotinyl-NH-(PEG)2-COOH . DIPEA |
GK3623 | N-BOC-3-pyrrolidinone |
GM9500 | N-Boc-D-proline |
GW9682 | N-Boc-N′-succinyl-4,7,10-trioxa-1,13-tridecanediamine |
GK2411 | N-Bromosuccinimide |
GW9000 | N-Butanoyl-DL-homoserine lactone |
GW8563 | N-Butanoyl-L-homoserine lactone |
GS0744 | n-Butyl Acetate, GlenDry?, anhydrous |
GS8505 | n-Butyl Acetate, GlenPure?, analytical grade |
GC5657 | N-Butyldeoxynojirimycin |
GC0520 | N-Butyldeoxynojirimycin hydrochloride |
GM6326 | N-Carbobenzyloxy-L-glutamic acid O-benzyl ester |
GK4705 | N-Chlorosuccinimide |
GC3438 | N-D-Glucopyranosyl-5-aminosalicylic acid |
GW6346 | N-Dansyldiethyleneamine |
GW4895 | N-Decanoyl-DL-homoserine lactone |
GW7530 | N-Decanoyl-L-homoserine lactone |
GC4712 | N-Decanoyl-N-methylglucamine |
GE2259 | N-Decyl-N,N-dimethyl-3-ammonio-1-propanesulfonate |
GW9638 | N-Desmethylthiamethoxam |
GW7676 | N-Dodecanoyl-DL-homoserine lactone |
GW1498 | N-Dodecanoyl-L-homoserine lactone |
GC8874 | n-Dodecyl beta-D-glucopyranoside |
GD1033 | N-Dodecyl-N,N-dimethyl-3-ammonio-1-propanesulfonate |
GX3225 | n-Dodecyl-phosphocholine |
GW8607 | N-Ethanoyl-DL-homoserine lactone |
GW6620 | N-Ethanoyl-L-homoserine lactone |
GK0313 | N-Ethyl-p-menthane-3-carboxamide |
GK7362 | N-Ethylmaleimide |
GW5852 | N-Fmoc-N-succinyl-4,7,10-trioxa-1,13-tridecanediamine |
GC2820 | N-Glycolylneuraminic acid |
GW9945 | N-Heptafluorobutyrylimidazole |
GS7532 | n-Heptane 95%, GlenDry?, anhydrous |
GS0594 | n-Heptane 95%, GlenDry?, anhydrous over molecular sieve |
GS9561 | n-Heptane 95%, GlenPure?, analytical grade |
GS3303 | n-Heptane 99%, GlenDry?, anhydrous |
GS4505 | n-Heptane 99%, GlenPure?, analytical grade |
GS9305 | n-Heptane 99%, GlenUltra?, analytical grade, for GC |
GS8674 | n-Heptane 99%, GlenUltra?, analytical grade, for LC |
GW4963 | N-Heptanoyl-DL-homoserine lactone |
GW2959 | N-Heptanoyl-L-homoserine lactone |
GW8686 | N-Hexadecanoyl-DL-homoserine lactone |
GW6247 | N-Hexadecanoyl-L-homoserine lactone |
GD7014 | N-Hexadecyl-N,N-dimethyl-3-ammonio-1-propanesulfonate |
GW9901 | N-Hexadecylpyrene-1-sulfonamide |
GS9069 | n-Hexane 95%, GlenDry?, anhydrous |
GS8756 | n-Hexane 95%, GlenDry?, anhydrous over molecular sieve |
GS6914 | n-Hexane 95%, GlenPure?, analytical grade |
GS4390 | n-Hexane 95%, GlenUltra?, analytical grade, for LC |
GS1284 | n-Hexane 99%, GlenPure?, analytical grade |
GS6028 | n-Hexane 99%, GlenUltra?, analytical grade, for GC |
GS9516 | n-Hexane 99%, GlenUltra?, analytical grade, for LC |
GW7698 | N-Hexanoyl-DL-homoserine lactone |
GW7553 | N-Hexanoyl-L-homoserine lactone |
GE3858 | N-Hydroxysuccinimide |
GC9601 | N-Iodoacetylglucosamine tetraacetate |
GK8008 | N-Iodosuccinimide |
GM9986 | N-Lauroylsarcosine sodium salt |
GW7686 | N-Methyl bis[(trifluoromethyl)sulfonyl]imide |
GA2093 | N-Methyl-1-deoxynojirimycin |
GS5724 | N-Methyl-2-pyrrolidone, GlenBiol?, suitable for molecular biology |
GS1826 | N-Methyl-2-pyrrolidone, GlenDry?, anhydrous |
GS4330 | N-Methyl-2-pyrrolidone, GlenDry?, anhydrous over molecular sieve |
GS3413 | N-Methyl-2-pyrrolidone, GlenPure?, analytical grade |
GK0882 | N-Methyl-3-oxodihydroisothiazole, 50% in water |
GL9947 | N-Methyl-D-aspartic acid |
GA1092 | N-Methyl-D-glucamine |
GC5765 | N-Methyl-D-glucamine hydrochloride |
GA0865 | N-Methyl-D-glucamine, USP grade |
GK6777 | N-Methyl-N-(trimethylsilyl)trifluoroacetamide |
GW5462 | N-Methyl-tert-butylamine |
GC4667 | N-Methyl-Topiramate |
GX7429 | N-Methyltetrahydrofolic acid |
GS5545 | n-Nonane 95%, GlenDry?, anhydrous |
GS0826 | n-Nonane 95%, GlenPure?, analytical grade |
GD6177 | N-Nonanoyl-N-methylglucamine |
GC6918 | N-Nonyldeoxynojirimycin |
GW9075 | N-Octadecanoyl-L-homoserine lactone |
GE6613 | N-Octadecyl-N,N-dimethyl-3-ammonio-1- propanesulfonate (SB-18) |
GW3295 | N-Octanoyl-L-homoserine lactone |
GC4276 | N-Octanoyl-N-methylglucamine |
GW7747 | N-Octanyol-DL-homoserine lactone |
GL8823 | N-p-Tosyl-L-phenylalanine chloromethyl ketone |
GX9474 | n-Pentadecyl-phosphocholine |
GS5448 | n-Pentane 95%, GlenDry?, anhydrous |
GS6352 | n-Pentane 95%, GlenPure?, analytical grade |
GS2796 | n-Pentane 99%, GlenUltra?, analytical grade, for GC |
GW7329 | N-Pentanoyl-L-homoserine lactone |
GW0308 | N-Phenyl-benzimidoyl chloride |
GX3512 | N-Phenyl-bis(trifluoromethanesulfonimide) |
GM3079 | N-Phenylanthranilic acid |
GM2111 | N-Phenylglycine |
GW4638 | N-Phenylhydroxylamine |
GK1293 | n-Propionyl coenzyme A lithium salt |
GL1880 | N-Succinyl-Leu-Leu-Val-Tyr-7-Amido-4-Methylcoumarin |
GK3410 | N-tert-Butyl-alpha-phenylnitrone |
GW2349 | N-Tetradecanoyl-DL-homoserine lactone |
GW3072 | N-Tetradecanoyl-L-homoserine lactone |
GW3401 | N-Undecanoyl-L-homoserine lactone |
GK1118 | N-Vanillylnonanamide |
GK2331 | N-Vanillylnonanamide, 98% |
GK5139 | N-Vinyl-2-pyrrolidone |
GW6185 | N,N-Bis(phosphonomethyl)glycine |
GK9307 | N,N-Diethyl-p-phenylenediamine oxalate salt |
GK6622 | N,N-Diethyl-p-phenylenediamine sulfate |
GW0894 | N,N-Dimethyl-6-propionyl-2-naphthylamine |
GT9517 | N,N-Dimethyl-p-phenylenediamine dihydrochloride |
GK5529 | N,N-Dimethylacetamide, 99.5% |
GW2629 | N,N-Dimethylamino-7-nitrobenzofurazan |
GL4652 | N,N-Dimethyldecylamine N-oxide |
GC9735 | N,N-Dimethyldodecylamine N-oxide, 30% solution in water |
GC9190 | N,N-Dimethyldodecylamine N-oxide, 98% |
GK6337 | N,N-Dimethylethanolamine |
GM9748 | N,N-Dimethylglycine |
GM9056 | N,N-Dimethylglycine hydrochloride |
GK7327 | N,N,Dimethylformamide, 99.5% |
GK2289 | N,N,N'',N''-Tetrakis(2-pyridylmethyl)ethylenediamine |
GK6593 | N,N,N'',N''-Tetramethyl-p-phenylenediamine dihydrochloride |
GE3482 | N,N,N'',N''-Tetramethylethylendiamine |
GM5053 | N,N''-Bis(benzyloxycarbonyl)-1H-pyrazole-1-carboxamidine |
GE9348 | N,N''-Carbonyldiimidazole |
GM7379 | N,N''-Di-Boc-1H-pyrazole-1-carboxamidine |
GL8106 | N,N''-Di-tert-butylcarbodiimide |
GW6661 | N,N''-Di-tert-butylthiourea |
GE7579 | N,N''-Dibutylthiourea |
GE6064 | N,N''-Dicyclohexylcarbodiimide |
GK5177 | N,N''-Diphenylthiourea |
GK2739 | N,N''-Ethylenethiourea |
GE8737 | N,N''-Methylene-bis-acrylamide |
GE0658 | N,N''-Methylene-bis-acrylamide 2X solution |
GL0221 | N,N′-Dimethyl-9,9′-biacridinium dinitrate |
GW1353 | N1-Acetylsulfamethoxazol |
GW8839 | N1-Guanyl-1,7-diaminoheptane [GC7] |
GN7727 | N1-Methyladenosine |
GN7133 | N3-Methyluridine |
GN3264 | N4-Acetyl-2''-deoxycytidine |
GN8258 | N4-Acetyl-2''-O-methylcytidine |
GW8421 | N4-Acetylsulfadimethoxine |
GW4238 | N4-Acetylsulfamethoxazole |
GC6677 | N6-(1-Deoxy-D-fructos-1-yl)-L-lysine |
GC0617 | N6-(2-Deoxy-D-glucos-2-yl)-L-lysine |
GY5065 | N6-(2-Isopentenyl)adenine |
GC7916 | N6-[(1,1-Dimethylethoxy)carbonyl]-N2-[(phenylmethoxy)carbonyl]-L-lysine phenylmethyl ester |
GN5101 | N6-Etheno 2''-deoxyadenosine |
GP6800 | Nabumetone |
GP9735 | Nadolol |
GP5144 | Nafamostat mesylate |
GA3972 | Nafcillin sodium salt monohydrate |
GA6545 | Naftifine hydrochloride |
GP5180 | Naftopidil |
GA8450 | Nalidixic acid |
GA0875 | Nalidixic acid sodium salt |
GP4112 | Nalmefene hydrochloride |
GP1662 | Naloxone hydrochloride dihydrate |
GC6127 | Naloxone-1,2,7,7-d4 |
GP0896 | Naloxone-3-glucuronide |
GC2061 | Naloxone-d5 3-O-β-D-glucuronide |
GM3935 | Nalpha,Nalpha-Bis-Fmoc-L-cystine (disulfide bond) |
GP4647 | Naltrexone |
GP1217 | Naltrexone hydrochloride |
GK1007 | Naphazoline nitrate, Ph. Eur. grade |
GK1891 | Naphthalene |
GK4917 | Naphthalene-1-acetic acid |
GT9165 | Naphthol AS |
GW0166 | Naphthol AS-E phosphate |
GT8368 | Naphthol Green B (C.I. 10020) |
GT6579 | Naphthol Yellow S |
GA8617 | Naphthomycin B |
GP1072 | Naproxen sodium salt |
GP2313 | Naproxen sodium salt, USP grade |
GC6440 | Naproxen-d6 acyl-β-D-glucuronide |
GP1103 | Naproxen, 98% |
GP6640 | Naproxen, BP grade |
GL5624 | Narciclasine |
GY3726 | Narcissoside |
GW9057 | Nargenicin A1 |
GP4824 | Naringenin |
GC8747 | Naringenin-7-O-b-D-glucuronide |
GC7515 | Naringin dihydrochalcone |
GC2272 | Naringin hydrate |
GP5047 | Nateglinide |
GW9533 | NBD dodecanoic acid N-succinimidyl ester |
GW4810 | NBD-Cl |
GW4663 | NBD-dodecanoic acid |
GW6497 | NBD-F |
GW0641 | NBD-methylhydrazine |
GW9907 | NBD-PZ |
GW7445 | NBD-undecanoic acid |
GW1491 | NBD-X |
GW4450 | NBD-X SE |
GC2347 | Neamine hydrochloride |
GP6004 | Nebivolol hydrochloride |
GC7574 | Nebivolol-5,5'',7,7'',8,8''-d6 |
GL2538 | Necrostatin-1 |
GL6416 | Necrostatin-5 |
GL1197 | Necrostatin-7 |
GW8903 | Necrosulfonamide |
GP9613 | Nefopam hydrochloride |
GP7332 | Nelfinavir mesylate |
GC1727 | neo-Inositol |
GC7430 | Neocarrabiose |
GL4410 | Neochlorogenic acid |
GX0392 | Neocuproine hemihydrate |
GX2428 | Neodymium acetate hydrate, 99.9% |
GX2153 | Neodymium acetate hydrate, 99.999% |
GX0780 | Neodymium boride, 99.9% |
GX9481 | Neodymium bromide, anhydrous, 99.9% |
GX2772 | Neodymium carbonate hydrate, 99.9% |
GX6511 | Neodymium carbonate hydrate, 99.999% |
GX8391 | Neodymium Chips, 99.9% |
GX7707 | Neodymium chloride hydrate, 99.9% |
GX3146 | Neodymium chloride hydrate, 99.99% |
GX7585 | Neodymium chloride hydrate, 99.999% |
GX5886 | Neodymium chloride, anhydrous, 99.9% |
GX0756 | Neodymium fluoride, anhydrous, 99.9% |
GX9408 | Neodymium fluoride, anhydrous, 99.999% |
GX1802 | Neodymium Foil 0.25mm, 99.9% |
GX7363 | Neodymium Foil 0.5mm, 99.9% |
GX8095 | Neodymium hydroxide hydrate, 99.9% |
GX5670 | Neodymium nitrate hydrate, 99.9% |
GX5291 | Neodymium nitrate hydrate, 99.99% |
GX2706 | Neodymium oxalate hydrate, 99.9% |
GX8883 | Neodymium oxalate hydrate, 99.999% |
GX4576 | Neodymium oxide, 99.9% |
GX7950 | Neodymium oxide, 99.999% |
GX6770 | Neodymium Pieces, 99.9% |
GX2519 | Neodymium Rod 12.5 mm diameter, 99.9% |
GX7625 | Neodymium Rod 6.35 mm diameter, 99.9% |
GX8283 | Neodymium sulfate hydrate, 99.9% |
GX7321 | Neodymium sulfate hydrate, 99.999% |
GX7678 | Neodymium sulfide, 99.9% |
GX6967 | Neodymium Wire 1 mm diameter, 99.9% |
GX9680 | Neodymium-thd, 99% |
GX5515 | Neodymium(III) oxide Nanopowder, 99,9 % |
GC3166 | Neohesperidin dihydrochalcone |
GA6251 | Neomycin sulfate |
GX9266 | Neopentyl glycol diglycidyl ether |
GK7491 | Neostigmine bromide |
GE9022 | Neotame |
GA1670 | Neoxaline |
GL2997 | Nepafenac |
GP9212 | Neratinib |
GA1999 | Netilmicin sulfate salt |
GC1361 | Neu5Ac-α-4MU |
GW9580 | Neuromedin U-25 (human) |
GT0890 | Neutral Red (C.I. 50040); 50% |
GT1293 | Neutral Red (C.I. 50040); 90% |
GP9839 | Nevirapine |
GT3530 | New Methylene Blue (C.I. 52030) |
GW3505 | Nexturastat A |
GW2061 | Nexturastat B |
GW7799 | NG 011 |
GL9289 | NG 012 |
GL3981 | NG-Methyl-L-arginine acetate salt |
GW0681 | NIBR-17 |
GP0799 | Nicardipine |
GW7865 | Nickamine |
GX5806 | Nickel boride, 99% |
GX9344 | Nickel chloride hydrate, 99.999+% |
GX0109 | Nickel Foil 0.125mm, 99.9+% |
GX1422 | Nickel Foil 0.25mm, 99.7% |
GX4470 | Nickel Foil 0.25mm, 99.99% |
GX0516 | Nickel Foil 0.5mm, 99.9% |
GX4137 | Nickel Foil 0.5mm, 99.99% |
GX9700 | Nickel Foil 1.0mm, 99.8% |
GX8146 | Nickel Foil 1.0mm, 99.99% |
GX7603 | Nickel Gauze 130 mesh,25,4 mm, 0.080 mm wire diameter, 99.6% |
GX0127 | Nickel Nanopowder, 99.8%, APS 20nm |
GX6859 | Nickel oxide, black |
GX7200 | Nickel Pellets 6 x 6 mm (Co max. 10 ppm); 99.995% |
GX1740 | Nickel Pellets 6 x 6 mm (Co max. 15 ppm); 99.97% |
GX8113 | Nickel Pellets 6-12 mm, 99.97% |
GX4149 | Nickel peroxide (oxidizing agent, appr. 30% active peroxide) |
GX6574 | Nickel Powder - 100 mesh, 99.99% |
GX8743 | Nickel Powder max. 10 micron, 99.9% |
GX2302 | Nickel Rod 12.7 mm diameter, 99.98% |
GX1331 | Nickel Rod 3.0 mm diameter, 99.9+% |
GX8249 | Nickel Rod 3.0 mm diameter, 99.995% |
GX1584 | Nickel Rod 5.0 mm diameter, 99.9% |
GX0053 | Nickel Rod 5.0 mm diameter, 99.99% |
GX9010 | Nickel Rod 6.25 mm diameter, 99.9% |
GX4569 | Nickel Rod 6.25 mm diameter, 99.99% |
GX7042 | Nickel selenide, 99.9% |
GX7936 | Nickel Sheet 3 mm, 99.98% |
GX2425 | Nickel silicide, 99% |
GX5979 | Nickel silicide, 99% |
GX5905 | Nickel sulfamate hydrate |
GX9294 | Nickel sulfate hexahydrate, 99.999% |
GX8778 | Nickel sulfate hexahydrate, 99% |
GX0308 | Nickel sulfide, 99.9% |
GX6525 | Nickel telluride, 99.9% |
GX1683 | Nickel Thermocouple Wire 0,1 mm diameter (non insulated) |
GX5228 | Nickel Thermocouple Wire 0,2 mm diameter (non insulated) |
GX6183 | Nickel Thermocouple Wire 0,3 mm diameter (non insulated) |
GX9886 | Nickel Thermocouple Wire 0,5 mm diameter (non insulated) |
GX0367 | Nickel titanate, 99.9% |
GX8035 | Nickel Wire 0.1 mm diameter, 99.99% |
GX4556 | Nickel Wire 0.25 mm diameter, 99.9+% |
GX8315 | Nickel Wire 0.5 mm diameter, 99.99% |
GX3412 | Nickel Wire 0.5 mm diameter, 99+% |
GX7591 | Nickel Wire 0.5 mm diameter, annealed, 99+% |
GX8665 | Nickel Wire 1.0 mm diameter, 99.98% |
GX5295 | Nickel Wire 1.0 mm diameter, 99+% |
GX3789 | Nickel Wire 2.0 mm diameter, 99.98% |
GX7670 | Nickel-thd, 99.9% |
GX9276 | Nickel(II) 2,4-pentanedionate hydrate, 98+% |
GX9017 | Nickel(II) acetate tetrahydrate |
GX5968 | Nickel(II) acetate tetrahydrate, 99% |
GX0241 | Nickel(II) chloride hexahydrate |
GX3007 | Nickel(II) nitrate hexahydrate |
GX3641 | Nickel(II) oxide nanopowder, 99.5%, APS approx. 20nm |
GX5877 | Nickel(II) oxide, green, 99% |
GX3227 | Nickel/Chromium Thermocouple Wire 0,1 mm diameter (non insulated) |
GX1237 | Nickel/Chromium Thermocouple Wire 0,2 mm diameter (non insulated) |
GX3686 | Nickel/Chromium Thermocouple Wire 0,3 mm diameter (non insulated) |
GX6656 | Nickel/Chromium Thermocouple Wire 0,5 mm diameter (non insulated) |
GX2843 | Nickel/Chromium-Nickel Thermocouple Wire (glass silk insulated) |
GX9897 | Nickel/Chromium-Nickel Thermocouple Wire (glass silk insulated) |
GX9827 | Nickel/Chromium-Nickel Thermocouple Wire (glass silk insulated) |
GX3715 | Nickelbad 216 H / Nickel bath 216 H |
GX4457 | Nickelbad 218 HG / Nickel bath 218 HG |
GX7794 | Nickelbad 219 G / Nickel bath 219 G |
GA5338 | Niclosamide |
GW0866 | Niclosamide ethanolamine |
GP5693 | Nicorandil |
GX3566 | Nicosulfuron |
GP9346 | Nicotinamide, 99% |
GP9253 | Nicotinamide, 99%, Ph. Eur. grade |
GV8911 | Nicotinic acid |
GC9654 | Nicotinic acid acyl-b-D-glucuronide |
GP5212 | Nifedipine |
GA6233 | Nigericin sodium salt |
GT3707 | Nigrosine (C.I. 50420) |
GT2809 | Nigrosine (C.I. 51180); 5% aqueous solution |
GP1304 | Nikethamide |
GT3036 | Nile Blue A (C.I. 51180) |
GT2331 | Nile Red |
GP5854 | Nilotinib |
GP2955 | Nimodipine |
GT1068 | Ninhydrin |
GW5215 | Nintedanib (free base) |
GX9388 | Niobium boride, 99.5% |
GX7258 | Niobium boride, 99.5% |
GX9412 | Niobium carbide, 99+% |
GX3113 | Niobium Foil 0.025mm, 99.9% |
GX0065 | Niobium Foil 0.05mm, 99.8% |
GX8010 | Niobium Foil 0.1mm, 99.9% |
GX2237 | Niobium Foil 0.25mm, 99.9% |
GX0113 | Niobium Foil 0.5mm, 99.9% |
GX9628 | Niobium Granules 2-10 mm, 99.9% |
GX4846 | Niobium nitride |
GX5739 | Niobium Pellets 6 x 6 mm, 99.9% |
GX7280 | Niobium Powder 70-180 micron, 99.9% |
GX6797 | Niobium Rod 10 mm diameter, 99.9% |
GX9816 | Niobium Rod 12 mm diameter, 99.9% |
GX5947 | Niobium Rod 2.0 mm diameter, 99.9% |
GX2832 | Niobium Rod 3.0 mm diameter, 99.9% |
GX4023 | Niobium Rod 5.0 mm diameter, 99.9% |
GX8284 | Niobium Rod 6 mm diameter, 99.9% |
GX6556 | Niobium Sheet 1.0mm, 99.8% |
GX4934 | Niobium silicide, 99% |
GX4870 | Niobium Tube 8.0 mm diameter, 0.4 mm wall thickness, 99.9% |
GX3819 | Niobium Wire 0.25 mm diameter, 99.9% |
GX0634 | Niobium Wire 0.5 mm diameter, 99.9% |
GX6534 | Niobium Wire 1.0 mm diameter, 99.9% |
GX2365 | Niobium Wire 2.0 mm diameter, 99.9% |
GX6040 | Niobium,Zirconium-99,1 Wire 0.5 mm diameter |
GX7497 | Niobium,Zirconium-99,1 Wire 0.8 mm diameter |
GX9698 | Niobium,Zirconium-99,1 Wire 1 mm diameter |
GX5159 | Niobium,Zirconium-99,1 Wire 2 mm diameter |
GX2625 | Niobium(V) chloride, 99+% |
GX2415 | Niobium(V) n-butoxide |
GX0622 | Niobium(V) oxide, 99.5% |
GX1176 | Niobium(V) oxide, 99.9% |
GX2316 | Niobium(V) oxide, 99.98+% |
GX6706 | Niobium(V) oxide, 99.99% |
GK5500 | Nipecotic acid |
GW0149 | NIR 4d |
GW0618 | NIR-797-isothiocyanate |
GA1106 | Nisin |
GP4494 | Nisoldipine |
GP0229 | Nitazoxanide |
GW4832 | Nitrate Ionophore VI |
GT9637 | Nitrazine Yellow (C.I. 14890) |
GP6940 | Nitrendipine |
GK7834 | Nitric acid |
GW7295 | Nitrilotri(methylphosphonic acid) |
GK5732 | Nitrilotriacetic acid |
GC4263 | Nitroblue tetrazolium chloride |
GA7337 | Nitrocefin |
GA0512 | Nitrofurantoin |
GP8719 | Nobiletin, 95% |
GP8339 | Nobiletin, 98% |
GA4846 | Nocardamine |
GP8428 | Nocodazole |
GP7069 | Nolatrexed dihydrochloride |
GK7344 | Nonanal |
GK9878 | Nonanoic acid |
GD7153 | Nonidet P40 (Substitute) |
GC1498 | Nonyl beta-D-glucopyranoside |
GP1234 | Norcantharidin |
GW0276 | Nordihydrocapsiate |
GC8232 | Norethindrone b-D-glucuronide |
GA8833 | Norfloxacin |
GL5532 | Norfluoxetine hydrochloride |
GL5091 | Norharmane |
GX6488 | NorPro(TM) Aluminium oxide catalyst support |
GX4269 | NorPro(TM) Aluminium oxide catalyst support |
GX3361 | NorPro(TM) Aluminium oxide catalyst support |
GX8659 | NorPro(TM) Aluminium oxide catalyst support |
GX7787 | NorPro(TM) Aluminium oxide catalyst support |
GX2311 | NorPro(TM) Titanium(IV) oxide catalyst support |
GX4074 | NorPro(TM) Zirconium silicate catalyst support |
GP6230 | Nortriptyline hydrochloride |
GY4385 | Noscapine hydrochloride hydrate |
GA3364 | Nourseothricin sulfate |
GW5490 | Novaluron |
GA5711 | Novobiocin sodium salt |
GL9671 | NSC697923 |
GL7670 | NU6102 |
GT3172 | Nuclear Fast Red (C.I. 60760) |
GE1658 | Nuclear Fast Red solution |
GW9334 | NVP-BEZ235 |
GW3341 | NVP-BGJ398 |
GW0088 | NVP-BSK805 dihydrochloride |
GA3995 | Nystatin hydrate |
GP7660 | Nystatin hydrate, 4400 U/mg, USP grade |
GC7871 | Nystose |
GL3915 | Nα-Tosyl-L-lysine chloromethyl ketone hydrochloride |
GE2187 | O-(1H-6-Chlorobenzotriazol-1-yl)-1,1,3,3-tetramethyluronium hexafluorophosphate |
GC4687 | O-(2-Acetamido-2-deoxy-D-glucopyranosylidene)amino N-phenyl carbamate |
GM9905 | O-(Carboxymethyl)hydroxylamine hemihydrochloride |
GT9187 | o-Cresolphthalein |
GT0978 | o-Cresolphthalein complexone |
GL6106 | O-Desmethylnaproxen |
GW4397 | o-Dianisidine |
GT5099 | o-Dianisidine dihydrochloride |
GL8260 | O-Methylisourea hemisulfate salt |
GK5598 | o-Phenylenediamine |
GV2342 | O-Phosphorylethanolamine |
GK7409 | o-Phthaldialdehyde |
GT1956 | o-Tolidine |
GT5901 | o-Toluidine |
GK6646 | o-Vanillin |
GL9542 | o-Xylene |
GS7536 | o-Xylene, GlenPure?, analytical grade |
GC6430 | O-β-D-Galactopyranosyl-(1-4)-O-β-D-glucopyranosyl-(1-4)-D-glucose |
GW3817 | O''-(Carboxymethyl)fluoresceinamide |
GC9805 | Obeticholic acid 3-O-β-D-glucuronide |
GC5072 | Obeticholic acid acyl-β-D-glucuronide |
GL8155 | Obscurolide A1 |
GL6509 | OCH |
GA6945 | Ochratoxin A |
GK5605 | Octadecyl isocyanate |
GW8934 | Octafluoronaphthalene |
GK5959 | Octane |
GK2275 | Octanoic acid |
GC7259 | Octanoyl D-glucopyranoside |
GP2536 | Octenidine dihydrochloride |
GP4360 | Octreotide acetate |
GC0507 | Octyl 2,3,4,6-tetra-O-acetyl-b-D-glucopyranoside |
GC1611 | Octyl alpha-D-glucopyranoside |
GC9098 | Octyl b-D-glucopyranoside |
GC7634 | Octyl b-D-thioglucopyranoside |
GC5159 | Octyl beta-D-galactopyranoside |
GW3561 | Oenanthacid-4-(trifluormethyl)-umbelliferone |
GA7752 | Ofloxacin |
GW0498 | Ohira-Bestmann Reagent |
GW2761 | Ohira-Bestmann Reagent Solution |
GT6537 | Oil Red O (C.I. 26125) |
GT0932 | Oil Red O (C.I. 26125); 0.5% in isopropanol |
GT8113 | Oil Red O (C.I. 26125); 0.5% in propylene glycol |
GL7691 | Okadaic acid |
GL6524 | Okadaic acid ammonium salt |
GK0698 | Okadaic acid potassium salt |
GK2362 | Okadaic acid sodium salt |
GP8311 | Olanzapine |
GP8012 | Olanzapine, USP grade |
GP0126 | Olaparib |
GX5532 | Olaquindox |
GW8900 | Oleacein |
GX9499 | Oleamidopropyl dimethylamine |
GK1669 | Oleanolic acid, 97% |
GY4261 | Oleanonic acid |
GK1568 | Oleic acid, 99% |
GW3064 | Oleocanthal |
GL3237 | Oleuropein |
GL2102 | Oleyl acetate |
GA0390 | Oligomycin A |
GL2132 | Olive oil |
GL3812 | Olive oil, extra virgin, EP grade |
GP5497 | Olmesartan |
GP3934 | Olmesartan medoxomil |
GL1318 | OM173-alphaA |
GP2190 | Omeprazole |
GW9967 | Omeprazole sulfide |
GP5610 | Omeprazole, EP grade |
GP5672 | Ondansetron hydrochloride dihydrate |
GC0066 | Ononin |
GW4334 | ONX 0914 |
GY5087 | Oosporein |
GW1080 | Opaganib |
GA7678 | Ophiobolin A |
GW5115 | Opipramol |
GL4485 | Opipramol dihydrochloride |
GW2060 | Oprozomib [ONX 0912] |
GT5052 | Oracet blue 2R (C.I. 61110) |
GT1429 | Oracet Blue B (C.I. 61515) |
GT7194 | Orange G (C.I. 16230) |
GT2987 | Orange II sodium salt |
GT8334 | Orange OT (C.I. 12100) |
GW2996 | Orantinib |
GA8562 | Orbifloxacin |
GT0012 | Orcein |
GE8094 | Orcinol anhydrous |
GT3752 | Orcinol monohydrate |
GC4819 | Orientin |
GP9255 | Orlistat |
GA0397 | Ornidazole |
GL6913 | Oroxylin A |
GP9944 | Oseltamivir phosphate |
GP3791 | Osimertinib |
GT4710 | Osmium tetroxide |
GX9093 | Osmium(VIII) oxide solution, 4% OsO4 |
GX5054 | Osmium(VIII) oxide, 99.9% |
GP0976 | Osthol |
GC9310 | Ouabain octahydrate, 95% |
GC9218 | Ouabain octahydrate, EP grade |
GA9839 | Oxacillin sodium salt monohydrate |
GK7172 | Oxalic acid dihydrate |
GK3343 | Oxalic acid, anhydrous |
GP0792 | Oxaliplatin |
GC4262 | Oxaprozin acyl-β-D-glucuronide |
GP6085 | Oxibendazole |
GK4423 | Oxindole |
GA2313 | Oxolinic acid |
GW6216 | Oxonol V |
GP3654 | Oxyclozanide |
GP8666 | Oxymatrine |
GP5903 | Oxymetazoline hydrochloride |
GX5694 | Oxyplicacetin |
GP2898 | Oxyresveratrol |
GA7172 | Oxytetracycline dihydrate |
GA3147 | Oxytetracycline hydrochloride |
GV2536 | Oxythiamine chloride hydrochloride |
GP7270 | Ozagrel |
GC9506 | p-Acetamidophenyl β-D-glucuronide sodium salt |
GK9270 | p-Anisaldehyde |
GK0396 | p-Benzoquinone |
GK7861 | p-Cresol |
GL5941 | p-Cymene |
GT5664 | p-Nitroaniline |
GC8584 | p-Nitrophenyl 2,3,4,6-Tetra-O-acetyl-α-D-galactopyranoside |
GK3873 | p-Phenylenediamine |
GT4761 | p-Rosolic acid (C.I. 43800) |
GX7984 | p-Tolualdehyde |
GK6346 | p-Toluenesulfonamide |
GK9853 | p-Toluenesulfonic acid monohydrate |
GK4222 | p-Toluenesulfonyl chloride |
GK5816 | p-Toluenesulfonylmethyl isocyanide |
GS9800 | p-Xylene, GlenPure?, analytical grade |
GA4564 | Paclitaxel |
GK1979 | Paclobutrazol |
GC2063 | Paeoniflorin |
GP6253 | Paeonol |
GP4250 | Palatinitol |
GP6134 | Palatinose |
GX0330 | Palbociclib |
GP3914 | Paliperidone |
GL0442 | Palitantin |
GX4473 | Palladium 5% on Calcium carbonate 5% Pd/CaCO3 (Lindlar) (Heraeus-Type K-0233) |
GX4843 | Palladium Foil 0.025mm, 99.9% |
GX8101 | Palladium Foil 0.5mm, 99.9% |
GX3157 | Palladium Foil 0.5mm, 99.95% |
GX1879 | Palladium Foil 1.0mm, 99.9% |
GX4532 | Palladium on Activated Carbon 1% Pd/C (Heraeus-Type K-0236) |
GX6197 | Palladium on Activated Carbon 3% Pd/C (Heraeus-Type K-0224) |
GX0791 | Palladium on Activated Carbon 3% Pd/C (Heraeus-Type K-0255) |
GX2409 | Palladium on Activated Carbon 3% Pd/C (Heraeus-Type K-0257) |
GX0299 | Palladium on Activated Carbon 3% Pd/C (Heraeus-Type K-0258) |
GX6502 | Palladium on Activated Carbon 3% Pd/C (Heraeus-Type K-0259) |
GX0043 | Palladium on Activated Carbon 3% Pd/C (Heraeus-Type K-0261) |
GX7259 | Palladium on Activated Carbon 3% Pd/C (Heraeus-Type K-0261) |
GX5239 | Palladium on Activated Carbon 4% Pd, 1% Rh/C (Heraeus-Type K-0234) |
GX8667 | Palladium on Activated Carbon 5% Pd/C (Heraeus-Type K-0201) |
GX3964 | Palladium on Activated Carbon 5% Pd/C (Heraeus-Type K-0201S) |
GX5650 | Palladium on Activated Carbon 5% Pd/C (Heraeus-Type K-0209) |
GX0848 | Palladium on Activated Carbon 5% Pd/C (Heraeus-Type K-0219) |
GX8277 | Palladium on Activated Carbon 5% Pd/C (Heraeus-Type K-0227) |
GX9106 | Palladium on Alumina 0,1% Pd/Al2O3 (Heraeus-Type K-0243) |
GX2378 | Palladium on Alumina 0,5% Pd/g-Al2O3 (Heraeus-Type K-0270) |
GX7714 | Palladium on Alumina 5% Pd/Al2O3 (Heraeus-Type K-050) |
GX1737 | Palladium on Barium sulfate 10% Pd/BaSO4 (Heraeus-Type K-0206) |
GX3621 | Palladium on Barium sulfate 5% Pd/BaSO4 (Heraeus-Type K-0205) |
GX5725 | Palladium on Calcium carbonate 10% Pd/CaCO3 (Heraeus-Type K-0208) |
GX5766 | Palladium Powder 1.2-2.5 micron, 99.9+% |
GX9581 | Palladium Rod 3 mm diameter, 99.95% |
GX8541 | Palladium Sponge, 99.9+% |
GX7473 | Palladium Wire 0.025 mm diameter, 99.9% |
GX3082 | Palladium Wire 0.1 mm diameter, 99.9% |
GX6695 | Palladium Wire 0.1 mm diameter, 99.95% |
GX3209 | Palladium Wire 0.125 mm diameter, 99.9% |
GX3044 | Palladium Wire 0.25 mm diameter, 99.9% |
GX5321 | Palladium Wire 0.25 mm diameter, 99.95% |
GX8261 | Palladium Wire 0.3 mm diameter, 99.9% |
GX1922 | Palladium Wire 0.5 mm diameter, 99.9% |
GX2387 | Palladium Wire 0.5 mm diameter, 99.95% |
GX2424 | Palladium Wire 2.0 mm, 99.9% |
GX6280 | Palladium-Gaspurification Catalyst 0.1% Pd/Al2O3 |
GX9203 | Palladium-Gaspurification Catalyst 0.5% Pd/Al2O3 |
GX2141 | Palladium-Gaspurification Catalyst 0.5% Pd/Al2O3 |
GX2954 | Palladium(II) 2,4-pentanedionate, 99.95% (metals basis) |
GX5704 | Palladium(II) chloride solution, approx. 20.0% |
GX7071 | Palladium(II) chloride, 99.9% (metals basis) |
GX2229 | Palladium(II) chloride, 99.95% (metals basis) |
GX4464 | Palladium(II) cyanide |
GX6709 | Palladium(II) decanoate |
GX6464 | Palladium(II) iodide |
GX2060 | Palladium(II) nitrate solution |
GX0824 | Palladium(II) oxide, hydrate |
GX9747 | Palladium(II) sulfate solution |
GX6904 | Palladium(II) sulfide |
GA0743 | Palmarumycin C3 |
GL3161 | Palmarumycin C3-5,8-quinone |
GP2867 | Palmatine hydrochloride hydrate |
GX8678 | Palmitic acid |
GL4626 | Palmitic anhydride |
GK4003 | Palmitoyl chloride |
GK6072 | Palmitoyl-L-carnitine chloride |
GK6226 | Palmitoylethanolamide |
GP2375 | Palonosetron hydrochloride |
GL9146 | Pam3Cys-Ser-(Lys)4 trihydrochloride |
GK3917 | Pamoic acid |
GK6564 | Pamoic acid disodium salt |
GP1463 | Pancuronium bromide |
GK4022 | Pantoprazole sodium hydrate |
GE7465 | Papain |
GT5904 | Papanicolaou Stain, EA 50 |
GT4787 | Papanicolaou Stain, EA 65 |
GT9653 | Papanicolaou Stain, OG-6 |
GP4713 | Papaverine hydrochloride |
GL1297 | Paprotrain |
GL4870 | Papyracillic acid A |
GL4141 | Paraffin oil, BP, Ph. Eur. grade |
GL4115 | Paraffin wax, granular (56 - 60) |
GT3052 | Pararosaniline acetate |
GT4290 | Pararosaniline Base |
GT9522 | Pararosaniline hydrochloride (C.I. 42500) |
GW9069 | Parecoxib |
GW4388 | PARG Inhibitor PDD00017273 |
GA4947 | Paromomycin sulfate salt |
GP8602 | Paroxetine hydrochloride |
GP2300 | Parthenolide |
GT2789 | Patent Blue V calcium salt (C.I. 42051) |
GT9524 | Patent blue V sodium salt (C.I. 42051) |
GT0175 | Patent Blue VF (C.I. 42045) |
GL8865 | Paxilline |
GP3530 | Pazopanib |
GX4287 | Pazopanib hydrochloride |
GA7060 | Pazufloxacin mesylate |
GT6761 | PBFI-AM |
GB4924 | PBS 10X, pH 7.4 solution |
GB4757 | PBS 1X, pH 7.4 solution |
GL5463 | PD 0325901 |
GL2543 | PD 150,606 |
GK2140 | PD 98,059 |
GW0583 | PD-173955 |
GW8987 | PD-173955-Analog1 |
GK9965 | PD184352 |
GW1383 | PDITC |
GK9829 | Peanut oil |
GC7250 | Pectin, amidated, low ester |
GC0736 | Pectin, from apple |
GA7231 | Pefloxacin mesylate dihydrate |
GP5214 | Pelitinib |
GL4065 | Pellitorine |
GP7304 | Penciclovir |
GL8408 | Penicillide |
GA2106 | Penicillin G potassium salt |
GA6076 | Penicillin G procaine |
GA9328 | Penicillin G sodium salt |
GA5943 | Penicillin V potassium salt |
GL9391 | Pentabromopseudilin |
GX0474 | Pentaerythritol |
GK0008 | Pentamidine isethionate salt |
GK5648 | Penthiopyrad |
GC9580 | Pentyl β-D-glucopyranoside |
GE5559 | Pepsin |
GE3524 | Pepstatin A |
GW2134 | Pepstatin A methyl ester |
GW5123 | Perfluorhexane (mixed isomers) |
GC8547 | Perindopril acyl-b-D-glucuronide |
GP1522 | Perindopril erbumine |
GT7361 | Periodic acid |
GT2912 | Periodic acid, 0.1% solution |
GP2606 | Permethrin |
GL1218 | Peroxidase |
GZ9372 | Peroxidase, from horseradish, approx. 200 U/mg |
GX3680 | Perrhenic acid, solution (Hydroxotrioxorhenium(VII) solution) |
GX8828 | Petasol |
GS5534 | Petroleum Ether 100-120°C |
GS3158 | Petroleum Ether 30-40°C, GlenDry?, anhydrous |
GS7254 | Petroleum Ether 30-40°C, GlenPure?, analytical grade |
GS3913 | Petroleum Ether 40-60°C, GlenDry?, anhydrous |
GS4502 | Petroleum Ether 40-60°C, GlenPure?, analytical grade |
GS6258 | Petroleum Ether 60-80 deg C, GlenDry?, anhydrous |
GS1837 | Petroleum Ether 60-80 deg C, GlenPure?, analytical grade |
GS9314 | Petroleum Ether 80-100°C, GlenDry?, anhydrous |
GS1349 | Petroleum Ether 80-100°C, GlenPure?, analytical grade |
GX7846 | Petroleum Jelly |
GW7535 | PF-04217903 |
GW3787 | PF-04979064 |
GW7086 | PF-2545920 |
GW6826 | PF-4618433 |
GL0230 | PF-477736 |
GW4240 | PF-562271 |
GW5834 | PFI-4 |
GH5926 | Phe-Phe-OH |
GK3477 | Phenacetin |
GK2087 | Phenazine |
GT3779 | Phenazine ethosulfate |
GA5685 | Phenazine methosulfate |
GT9844 | Phenol Red |
GT6682 | Phenol Red sodium salt |
GE3590 | Phenol, 80% aqueous solution |
GK0672 | Phenol, 99.5%, detached crystals, BP, Ph. Eur., USP grade |
GK6990 | Phenol, 99% |
GK2423 | Phenol, BP grade 80% aqueous solution |
GC6187 | Phenolphthalein 4''-O-β-D-glucuronide |
GT3980 | Phenolphthalein diphosphate tetrasodium salt |
GE0553 | Phenolphthalein, 98% |
GE8089 | Phenolphthalein, ACS grade |
GT9951 | Phenolphthalein, BP, Ph. Eur. grade |
GT7280 | Phenolphthalin |
GC7684 | Phenophthalein glucuronide sodium salt |
GP7407 | Phentolamine mesylate |
GC8370 | Phenyl 2-azido-2-deoxy-1-seleno-α-D-galactopyranoside |
GC8302 | Phenyl 2-azido-2,6-dideoxy-1-seleno-α-D-galactopyranoside |
GC2400 | Phenyl 3,4,6-tri-O-acetyl-2-azido-2-deoxy-1-seleno-α-D-galactopyranoside |
GC0148 | Phenyl 3,6-di-O-acetyl-2-azido-2-deoxy-1-seleno-α-D-galactopyranoside |
GC4595 | Phenyl 4,6-O-benzylidene-b-D-glucopyranoside |
GC6682 | Phenyl b-D-glucopyranoside |
GC0722 | Phenyl b-D-thioglucopyranoside |
GF7913 | Phenyl isothiocyanate |
GX7854 | Phenyl isothiocyanate, 99% |
GE1672 | Phenyl phosphate disodium salt dihydrate |
GK3262 | Phenyl salicylate |
GK3830 | Phenylbis(2,4,6-trimethylbenzoyl)phosphine oxide |
GK1609 | Phenylboronic acid |
GP0458 | Phenylbutazone |
GT7091 | Phenylhydrazine hydrochloride |
GE4342 | Phenylmethanesulfonyl fluoride |
GL0352 | Phenylmethylene hydantoin |
GW4355 | Phenylpropargyl ether |
GK7310 | Phenylsuccinic acid |
GA6020 | Phleomycin |
GE3120 | Phloretin |
GC6883 | Phloridzin |
GT4554 | Phloroglucinol, anhydrous |
GT5211 | Phloxine B (C.I. 45410) |
GW8143 | Phomopsin A |
GL6612 | Phomoxanthone A |
GK8317 | Phorbol 12-myristate 13-acetate |
GB1588 | Phosphate buffer, 0.1M solution |
GX8368 | Phosphate buffered saline tablets, pH 7.2 (100ml/tablet) |
GX4240 | Phosphatidylserine, 50% powder |
GW8277 | Phosphazenium tetrafluoroborate P2-BF4 |
GE4574 | Phosphoenolpyruvate trisodium salt |
GX3459 | Phosphoenolpyruvic acid monocyclohexylammonium salt |
GT2049 | Phosphomolybdic acid hydrate |
GT0715 | Phosphomolybdic acid solution |
GA9549 | Phosphomycin calcium salt |
GA7173 | Phosphomycin disodium salt |
GK5910 | Phosphoramidon disodium salt |
GK4212 | Phosphoric acid 85% |
GX0083 | Phosphorus Black, pieces max. 4mm 99.9+% |
GX0387 | Phosphorus Red, pieces 2-5 mm, under inert gas, 99.9999% |
GX9946 | Phosphorus Red, pieces, under argon, 99.995% |
GX8180 | Phosphorus Red, pieces, under inert gas, Electronic grade, 99.999+% |
GX9963 | Phosphorus(V) oxide, 98+% |
GE1564 | Phosphotungstic acid hydrate |
GE0157 | Phosphotungstic acid hydrate, 98% |
GK7570 | Phthalic acid |
GK8794 | Phthalic anhydride |
GP2076 | Physcion |
GW3825 | Physil chloride |
GW7873 | Phytane |
GK0311 | Phytic acid |
GC2068 | Phytic acid calcium salt |
GC4746 | Phytic acid dipotassium salt |
GW0859 | Phytic acid sodium salt hydrate |
GK9311 | Phytic acid, 50% (w/w) in water |
GW0508 | PI-1840 [Proteasome Inhibitor] |
GW6652 | PI103 |
GP2416 | Piceatannol |
GY1409 | Picloram |
GC2669 | Picroside 2 |
GL2129 | Pifithrin-alpha |
GW3375 | PIK-294 |
GW8870 | PIK-75 |
GW0576 | PIK-90 |
GW1942 | PIK-93 |
GL7360 | Pikromycin |
GA5100 | Pimaricin |
GW2192 | Pimecrolimus |
GL3504 | Pimprinine |
GP0968 | Pinacidil monohydrate |
GP3150 | Pinoresinol diglucoside |
GP2624 | Pioglitazone |
GP3582 | Pioglitazone hydrochloride |
GA4134 | Piperacillin sodium salt |
GL7244 | Piperafizine B |
GW5458 | Piperafizine B |
GK6010 | Piperazine |
GK2644 | Piperazine hexahydrate |
GK8547 | Piperlongumine |
GB1808 | PIPES |
GB2841 | PIPES dipotassium salt |
GB1799 | PIPES disodium salt |
GB9761 | PIPES monosodium salt |
GB6809 | PIPES sesquisodium salt |
GP1309 | Piracetam |
GA1643 | Pirarubicin |
GP0823 | Pirenzepine dihydrochloride |
GP4948 | Pirfenidone |
GP9213 | Piribedil |
GW8012 | Piroctone olamine |
GP9136 | Piroxicam |
GP8116 | Pitavastatin calcium salt |
GA9689 | Pivmecillinam |
GL7437 | PJ-34 hydrochloride hydrate |
GL4857 | PK 11195 |
GW6750 | PK150 (Sorafenib Analog) |
GX6304 | Platinum 2,4-pentanedionate |
GX9608 | Platinum black 10-20 m2,g |
GX7851 | Platinum black 20-40 m2/g |
GX6248 | Platinum conducting paste for brush application 71% Pt |
GX6475 | Platinum Foil 0.025mm, 99.9% |
GX7231 | Platinum Foil 0.05mm, 99.9% |
GX7698 | Platinum Foil 0.125mm, 99.9% |
GX4997 | Platinum Foil 0.1mm, 99.9% |
GX2917 | Platinum Foil 0.1mm, 99.99% |
GX5455 | Platinum Foil 0.25mm, 99.9% |
GX1775 | Platinum Foil 0.5mm, 99.9% |
GX1914 | Platinum Foil 0.5mm, 99.99% |
GX0039 | Platinum Foil 0.635mm, 99.9% |
GX0239 | Platinum Foil 1.0mm, 99.9% |
GX1073 | Platinum Foil 1.0mm, 99.99% |
GX5372 | Platinum Gauze 1024 mesh/cm2, 0.06 mm wire diameter, 99.9% |
GX7278 | Platinum Gauze 3600 mesh,cm2, 0.04 mm wire diameter, stabilized, 99.9% |
GX9800 | Platinum Gauze 3600 mesh/cm2, 0.04 mm wire diameter, 99.9% |
GX7808 | Platinum Granules 1-6 mm (evaporation grade); 99.99% |
GX8702 | Platinum on Activated Carbon 1% Pt/C (Heraeus-Type K-0114) |
GX6364 | Platinum on Activated Carbon 1% Pt/C (Heraeus-Type K-0117) |
GX5558 | Platinum on Activated Carbon 10% Pt/C (Heraeus-Type K-0119) |
GX7784 | Platinum on Activated Carbon 2% Pt/C (Heraeus-Type K-0130) |
GX2396 | Platinum on Activated Carbon 2% Pt/C (Heraeus-Type K-0131) |
GX2268 | Platinum on Activated Carbon 2% Pt/C (Heraeus-Type K-0132) |
GX4727 | Platinum on Activated Carbon 5% Pt/C (Heraeus-Type K-0124) |
GX6563 | Platinum on Activated Carbon 5% Pt/C (Heraeus-Type K-0125) |
GX5652 | Platinum on Activated Carbon 5% Pt/C (Heraeus-Type K-0127) |
GX8533 | Platinum on Activated Carbon 5% Pt/C (Heraeus-Type K-0129) |
GX4950 | Platinum on Alumina 0,1% Pt/Al2O3 (Heraeus-Type K-0144) |
GX2714 | Platinum Powder 0.2-1.8 micron, 99.95+% |
GX0230 | Platinum Ruthenium Granules ≤ 1mm 50:50, 99.9% (metals basis) |
GX3851 | Platinum Sponge, 99.9% |
GX3679 | Platinum tetrammine hydrogencarbonate |
GX9652 | Platinum Wire 0.018 mm diameter, 99.9% |
GX4772 | Platinum Wire 0.02 mm diameter, 99.9% |
GX7728 | Platinum Wire 0.025 mm diameter, 99.9% |
GX7545 | Platinum Wire 0.05 mm diameter, 99.99% |
GX1892 | Platinum Wire 0.1 mm diameter, 99.9% |
GX8639 | Platinum Wire 0.1 mm diameter, 99.99% |
GX2773 | Platinum Wire 0.125 mm diameter, 99.9% |
GX6665 | Platinum Wire 0.2 mm diameter, 99.9% |
GX6052 | Platinum Wire 0.25 mm diameter, 99.9% |
GX8324 | Platinum Wire 0.25 mm diameter, 99.99% |
GX1042 | Platinum Wire 0.3 mm diameter, 99.9% |
GX1234 | Platinum Wire 0.3 mm diameter, 99.99% |
GX2962 | Platinum Wire 0.4 mm diameter, 99.9% |
GX9532 | Platinum Wire 0.5 mm diameter, 99.9% |
GX0325 | Platinum Wire 0.5 mm diameter, 99.99% |
GX5374 | Platinum Wire 0.6 mm diameter, 99.9% |
GX4099 | Platinum Wire 0.7 mm diameter, 99.9% |
GX3975 | Platinum Wire 0.8 mm diameter, 99.9% |
GX1866 | Platinum Wire 1.0 mm diameter, 99.9% |
GX3111 | Platinum Wire 1.0 mm diameter, 99.99% |
GX8936 | Platinum Wire 2.0 mm diameter, 99.9% |
GX0456 | Platinum Wire 2.0 mm diameter, 99.99% |
GX4943 | Platinum Wool, 0.05 mm wire thickness, 99.9% |
GX9304 | Platinum,Iridium 70,30 wire 0.25 mm diameter, 99.9+% (metals basis) |
GX9896 | Platinum,Iridium 80,20 wire 0.25 mm diameter, 99.9+% (metals basis) |
GX6603 | Platinum,Iridium 80,20 wire 0.5 mm diameter, 99.9+% (metals basis) |
GX1247 | Platinum,Iridium 90,10 rod 2 mm diameter, 99.9+% (metals basis) |
GX4811 | Platinum,Iridium 90,10 wire 0.015 mm diameter, 99.9+% (metals basis) |
GX0547 | Platinum,Iridium 90,10 wire 0.1 mm diameter, 99.9+% (metals basis) |
GX5738 | Platinum,Iridium 90,10 wire 0.2 mm diameter, 99.9+% (metals basis) |
GX2372 | Platinum,Iridium 90,10 wire 0.25 mm diameter, 99.9+% (metals basis) |
GX3804 | Platinum,Iridium 90,10 wire 0.25 mm diameter, aligned, 99.9+% (metals basis) |
GX8346 | Platinum,Iridium 90,10 wire 0.5 mm diameter, 99.9+% (metals basis) |
GX5933 | Platinum,Iridium 90,10 wire 0.6 mm diameter, 99.9+% (metals basis) |
GX6744 | Platinum,Iridium 90,10 wire 1.0 mm diameter (99.9+% metals basis) |
GX5623 | Platinum,Rhodium 90,10 wire 0.5 mm diameter, 99.9+% (metals basis) |
GX5698 | Platinum,Tungsten 92,8 wire 0.225 mm diameter, 99.9+% (metals basis) |
GX2408 | Platinum:Iridium (70:30) wire, 0.1 mm diameter, 99.9+% (metals basis) |
GX2454 | Platinum:Iridium (90:10) wire, 0.3 mm diameter, 99.9% (metals basis) |
GX6181 | Platinum:Rhodium wire, 90:10, 0.25 mm diameter, 99.9+% (metals basis) |
GX2976 | Platinum(II) bromide |
GX5987 | Platinum(II) chloride, 99.9% |
GX5537 | Platinum(II) diammine cyclobutane dicarboxylate, 99.95% (metals basis) |
GX8565 | Platinum(II) iodide, 99.95% (metals basis) |
GX0417 | Platinum(II) nitrate, 99.95% (metals basis) |
GX7338 | Platinum(IV) chloride, 99.9% (metals basis) |
GX0662 | Platinum(IV) oxide hydrate |
GP0472 | Plerixafor |
GD9243 | Pluronic F-68 |
GW1682 | PLX4032 |
GL9916 | PLX4720 |
GW6333 | PMPH |
GX3711 | PNPP sodium salt, 5mg tablets |
GE0412 | Podophyllotoxin |
GP8912 | Polaprezinc |
GX7310 | Poly(acrylic acid); 35% solution in water |
GX4029 | Poly(D-lactide) |
GX8223 | Poly(hexamethylenebiguanide) hydrochloride |
GW3125 | Poly(L-lactide) 1.0 dl/g |
GW1677 | Poly(L-lactide) 2.0 dl/g |
GW3343 | Poly(L-lactide) 4.0 dl/g |
GM4452 | Poly(sucrose-co-epichlorhydrin) |
GW9186 | Poly[(R)-3-hydroxybutyric acid] (natural origin) |
GL7541 | Polyanetholesulfonic acid sodium salt |
GC0081 | Polyethylene glycol 1000 |
GK2627 | Polyethylene glycol 1500 |
GC1353 | Polyethylene glycol 1500, BP, Ph. Eur., USP/NF grade |
GC3410 | Polyethylene glycol 200 |
GC9998 | Polyethylene glycol 300 |
GC0220 | Polyethylene glycol 300, BP, Ph. Eur., USP/NF grade |
GC3481 | Polyethylene glycol 400 |
GC0231 | Polyethylene glycol 400, BP, Ph. Eur., USP/NF grade |
GX6931 | Polyethylene glycol 4000 |
GC0009 | Polyethylene glycol 4000, BP, Ph. Eur., USP/NF grade |
GC2342 | Polyethylene glycol 6000 |
GC0902 | Polyethylene glycol 8000 |
GC2100 | Polyethylene glycol 8000, BP, Ph. Eur., USP/NF grade |
GC8195 | Polygalacturonic acid |
GA4028 | Polyketomycin |
GA4910 | Polymixin B sulfate salt |
GD1579 | Polyoxyethylene (10) cetyl ether |
GD2457 | Polyoxyethylene (20) cetyl ether |
GL5918 | Polyoxyethylene (40) stearate |
GX7347 | Polyoxyl 15 Hydroxystearate USP, Ph. Eur. grade |
GD4801 | Polysorbate 80 |
GC7257 | Polysucrose 400 |
GX7780 | Polyvinyl acetate |
GP0062 | Pomalidomide |
GK7972 | Ponasterone A |
GP1345 | Ponatinib |
GT7227 | Ponceau 4R (C.I. 16255) |
GT2882 | Ponceau S (C.I. 27195) |
GT6288 | Ponceau S, 0.1% (w/v) in 5% acetic acid |
GB0334 | POPSO |
GB6170 | POPSO disodium salt |
GB9768 | POPSO sesquisodium salt |
GP2766 | Posaconazole |
GX7641 | Potassium acetate, 98% |
GX5463 | Potassium acetate, 99.99+% |
GX0998 | Potassium antimonyl tartrate trihydrate, 99.5+% |
GX2928 | Potassium benzoate |
GK4148 | Potassium bromate |
GK0242 | Potassium bromide |
GX4889 | Potassium bromide, 99.999% |
GX6012 | Potassium bromide, BP, Ph. Eur. grade |
GK4171 | Potassium carbonate, anhydrous |
GX3831 | Potassium carbonate, anhydrous, 99.99% |
GK0300 | Potassium carbonate, anhydrous, granular |
GK8545 | Potassium chlorate |
GX1094 | Potassium chloride, 99.99+% |
GE4711 | Potassium chloride, BP, Ph. Eur. grade |
GE8357 | Potassium chloride, FCC grade |
GA1260 | Potassium clavulanate with microcrystalline cellulose |
GX2139 | Potassium dicyanoargentate, 99.95% (metals basis) |
GX1712 | Potassium dicyanoaurate(I) |
GX8115 | Potassium dicyanoaurate(I); 99.95% (metals basis) |
GX4200 | Potassium dihydrogen phosphate, 99.99+% |
GK7805 | Potassium ferricyanide |
GK0288 | Potassium ferrocyanide trihydrate |
GK0754 | Potassium formate |
GC3383 | Potassium gluconate, USP grade, anhydrous |
GX0840 | Potassium hexabromoplatinate(IV) |
GX0623 | Potassium hexachloroiridate(III) hydrate |
GX1058 | Potassium hexachloroiridate(IV); 99.95% (metals basis) |
GX5756 | Potassium hexachloroiridate(IV); 99.99% |
GX1808 | Potassium hexachloroosmate(IV); 99.9% (metals basis) |
GX0120 | Potassium hexachloropalladate(IV); 99.95% (metals basis) |
GK0541 | Potassium hexachloroplatinate(IV) |
GX3794 | Potassium hexachloroplatinate(IV); 99.95% (metals basis) |
GX8871 | Potassium hexachlororhenate(IV); 99.95% (metals basis) |
GX7690 | Potassium hexachlororhodate(III) hydrate, 99.95% (metals basis) |
GX2746 | Potassium hexacyanocobaltate(III); 95% |
GX4161 | Potassium hexacyanoferrate(III); ACS grade |
GX4600 | Potassium hexafluoroarsenate(V) |
GX2465 | Potassium hexafluorophosphate(V) |
GX8687 | Potassium hexafluorosilicate, 99% |
GX3355 | Potassium hexafluorotitanate, 98% |
GX5063 | Potassium hexafluorozirconate, 99% |
GX3916 | Potassium hexaiodoplatinate(IV); 99.9% |
GK1196 | Potassium hydrogen carbonate |
GK2355 | Potassium hydrogen phthalate |
GK6425 | Potassium hydrogen sulfate |
GX4333 | Potassium hydrogen sulfate, 99.9+% |
GX6150 | Potassium hydrogen tartrate |
GK0650 | Potassium hydroxide |
GX9636 | Potassium Ingot, in glass under argon, 99.95% |
GK4467 | Potassium iodate |
GX2298 | Potassium iodide, 99.9+% |
GX7535 | Potassium iodide, 99% |
GP9984 | Potassium iodide, 99%, Ph. Eur., BP, USP grade |
GP9540 | Potassium iodide, BP, Ph. Eur. grade |
GX0303 | Potassium metabisulfite |
GX3502 | Potassium metabisulfite, 98% |
GX6323 | Potassium metaborate |
GX6911 | Potassium metaperiodate, 99+% |
GX1648 | Potassium metaphosphate |
GX2091 | Potassium metavanadate, 99.0% |
GX0194 | Potassium methoxide |
GX9390 | Potassium molybdate |
GX5713 | Potassium molybdate, 99.9% |
GX3865 | Potassium niobate, 99.999% |
GX5250 | Potassium nitrate, 99.99+% |
GK1121 | Potassium nitrate, 99% |
GK2712 | Potassium nitrate, with ACA |
GK7746 | Potassium nitrite |
GK8503 | Potassium oxalate monohydrate |
GX8126 | Potassium oxalate monohydrate, 99.0% |
GX4937 | Potassium perrhenate, 99.95+% |
GX1747 | Potassium perrhenate, 99+% |
GK0579 | Potassium persulfate |
GX9771 | Potassium phosphate hydrate, 98+% |
GK8538 | Potassium phosphate monobasic |
GB8521 | Potassium phosphate monobasic, 1M solution |
GX7212 | Potassium phosphate monobasic, Ph. Eur. grade |
GE0638 | Potassium phosphate tribasic monohydrate |
GL8076 | Potassium phosphate tribasic, anhydrous |
GK4932 | Potassium pyrophosphate |
GK0360 | Potassium sodium tartrate tetrahydrate |
GK8826 | Potassium sorbate |
GK5815 | Potassium sorbate, granular, BP, Ph. Eur., USP, FCC grade |
GK5956 | Potassium sulfate |
GX7768 | Potassium sulfate, 99.9% |
GX5997 | Potassium sulfate, 99.999% |
GX0055 | Potassium sulfite |
GE4642 | Potassium tellurite |
GK6322 | Potassium tert-butoxide, 99% |
GX6800 | Potassium tetraborate tetrahydrate |
GX7268 | Potassium tetrabromoaurate(III) |
GX1391 | Potassium tetrachloroaurate(III); 99.95% (metals basis) |
GX2269 | Potassium tetrachloroplatinate(II); 99.95% (metals basis) |
GX4552 | Potassium tetracyanoaurate(III); 99.95% (metals basis) |
GX3065 | Potassium tetracyanopalladate(II) hydrate, 99.95% (metals basis) |
GX3837 | Potassium tetracyanoplatinate(II) hydrate |
GX7369 | Potassium tetrafluoroborate, 99% |
GX1756 | Potassium tetrakis (4-chlorophenyl) borate, 98+% |
GX4422 | Potassium tetranitritoplatinate(II) |
GK4099 | Potassium tetrathionate |
GK0170 | Potassium thioacetate |
GE7344 | Potassium thiocyanate |
GX0991 | Potassium thiocyanate, 99+%, ACS |
GK6938 | Potassium-8-hydroxyquinoline sulfate |
GA7905 | Povidone iodine |
GP9886 | Povidone K15 |
GP6526 | Povidone K30 |
GP3291 | Povidone K90 |
GK9287 | PP1 |
GL5082 | PP2 |
GW9275 | PP242 |
GP7944 | Pramiracetam |
GP8160 | Pranlukast hydrate |
GX7262 | Praseodymium acetate hydrate, 99.9% |
GX6790 | Praseodymium acetate hydrate, 99.999% |
GX4821 | Praseodymium carbonate hydrate, 98+% |
GX6372 | Praseodymium carbonate hydrate, 99.9% |
GX4713 | Praseodymium carbonate hydrate, 99.999% |
GX8272 | Praseodymium Chips, 99.9% |
GX3759 | Praseodymium chloride anhydrous, 99.9% |
GX9104 | Praseodymium chloride hydrate, 99.9% |
GX0383 | Praseodymium chloride hydrate, 99.99% |
GX9649 | Praseodymium chloride hydrate, 99.999% |
GX7131 | Praseodymium D-3-heptafluorobutyrylcamphorate, 99% |
GX8348 | Praseodymium fluoride, 99.9% |
GX6124 | Praseodymium fluoride, 99.9% [pieces 1-5mm] |
GX3039 | Praseodymium Foil 0.25mm, 99.9% |
GX0812 | Praseodymium hydroxide hydrate, 99.9% |
GX6282 | Praseodymium nitrate hydrate, 99.9% |
GX8581 | Praseodymium nitrate hydrate, 99.99% |
GX9670 | Praseodymium oxalate, 99.999% |
GX2155 | Praseodymium oxide, 96% |
GX5794 | Praseodymium oxide, 99.9% |
GX5475 | Praseodymium oxide, 99.99% |
GX5633 | Praseodymium Pieces, 99.9% |
GX5790 | Praseodymium Powder, 99.9% |
GX7806 | Praseodymium Rod 5 mm diameter, 99.9% |
GX2758 | Praseodymium sulfate hydrate, 99.9% |
GX4907 | Praseodymium sulfate hydrate, 99.999% |
GX6796 | Praseodymium-fod, 99% |
GX3527 | Praseodymium(III) oxide, 99.9% |
GP8415 | Prasugrel hydrochloride |
GK3699 | Pravastatin sodium salt |
GA8950 | Praziquantel |
GP4454 | Prazosin hydrochloride |
GP0011 | Prednisolone |
GP5622 | Prednisone |
GK1748 | Pregnenolone |
GP9589 | Prilocaine |
GP0348 | Prilocaine hydrochloride |
GC0622 | Primaquine carbamoyl-β-D-glucuronide |
GK4808 | Pristane |
GK4509 | Pristinamycin |
GW0719 | Probenazole |
GP9170 | Probenecid |
GC3751 | Probenecid acyl b-D-glucuronide |
GL7337 | Procainamide hydrochloride |
GP5551 | Procaine hydrochloride |
GP0917 | Procarbazine hydrochloride |
GY2840 | Procyanidin A2 |
GL5110 | Procyanidin B2 |
GW3228 | Procyclidine hydrochloride |
GL3187 | Prodigiosin |
GT1397 | Proflavine hemisulfate salt hydrate |
GP3663 | Progesterone |
GL3057 | Proguanil hydrochloride |
GP6310 | Promethazine hydrochloride |
GP3270 | Propafenone hydrochloride |
GS5841 | Propan-1-ol, GlenDry?, anhydrous |
GS5208 | Propan-1-ol, GlenPure?, analytical grade |
GS3865 | Propan-1,2-diol, GlenDry?, anhydrous |
GS5968 | Propan-1,2-diol, GlenPure?, analytical grade |
GS9888 | Propan-2-ol, GlenDry?, anhydrous |
GS1309 | Propan-2-ol, GlenDry?, anhydrous over molecular sieve |
GS4309 | Propan-2-ol, GlenPure?, analytical grade |
GS3897 | Propan-2-ol, GlenUltra?, analytical grade, for LC |
GP8426 | Proparacaine hydrochloride |
GC2385 | Propargyl 2,3,4-tri-O-acetyl-α-L-fucopyranoside |
GC7531 | Propargyl 2,3,4,6-tetra-O-acetyl-α-D-galactopyranoside |
GC0899 | Propargyl α-D-Galactopyranoside |
GC9641 | Propargyl α-D-mannopyranoside |
GC5800 | Propargyl α-L-fucopyranoside |
GC9653 | Propargyl β-D-lactoside |
GC0453 | Propargyl β-D-lactoside heptaacetate |
GC8834 | Propargyl β-D-maltoside |
GC2212 | Propargyl β-D-xylopyranoside |
GP2610 | Propidium iodide |
GK5236 | Propionaldehyde |
GW7817 | Propionaldehyde oxime |
GK9394 | Propionic acid |
GP3553 | Propranolol hydrochloride |
GC9550 | Propranolol-2-O-b-D-glucuronide |
GC5796 | Propyl 2-acetamido-2-deoxy-b-D-glucopyranoside |
GK2194 | Propyl 4-hydroxybenzoate |
GX7720 | Propyl 4-hydroxybenzoate sodium salt |
GK7583 | Propyl 4-hydroxybenzoate, Ph. Eur. grade |
GK8474 | Propyl gallate |
GC0501 | Propyl β-D-lactoside |
GS2468 | Propylene carbonate, GlenDry?, anhydrous |
GS2424 | Propylene carbonate, GlenPure?, analytical grade |
GK2951 | Propylene glycol monomethyl ether acetate |
GK2653 | Propylene glycol, 99% |
GK3409 | Propylene glycol, Ultrapure, 99.5%, BP, Ph. Eur., USP grade |
GW5272 | Propyphenazone |
GW2313 | Proquinazid |
GL2480 | Prostaglandin E2 |
GW9252 | Prosulfocarb |
GW6219 | Prosulfocarb sulfoxide |
GE0990 | Proteinase K |
GZ5904 | Proteinase K solution |
GX3245 | Prothioconazole |
GC2583 | Protodioscin |
GY5620 | Protopine |
GW1561 | PRT-060318 |
GA7347 | Pseudoanguillosporin A |
GL2612 | Pseudolaric Acid B |
GN9104 | Pseudouridine |
GL7387 | Pseurotin A |
GL7731 | Pseurotin D |
GA7357 | Psicofuranine |
GL6155 | Psoralen |
GL6760 | PTACH |
GP6169 | Pterostilbene |
GC0175 | Puerarin |
GC2572 | Pullulan |
GL4211 | Punicalagin |
GK3203 | Purine |
GA1940 | Puromycin dihydrochloride |
GT4917 | Purpurin (C.I. 58205) |
GW8852 | Purpuromycin |
GK0611 | Purvalanol A |
GK1731 | Purvalanol B |
GP9873 | Putrescine dihydrochloride |
GW4130 | PX-12 |
GW3775 | Pyraclonil |
GW5777 | Pyraflufen-ethyl |
GL6921 | Pyranonigrin A |
GA1140 | Pyrazinecarboxamide |
GA3511 | Pyrazinecarboxamide, BP, Ph. Eur., USP grade |
GK6516 | Pyrene |
GA1524 | Pyrenophorol |
GW6153 | Pyribenzoxim |
GW9371 | Pyributicarb |
GW9819 | Pyridafol |
GW7960 | Pyridalyl |
GK4192 | Pyridine |
GE1467 | Pyridine-2-aldoxime methochloride |
GS6659 | Pyridine, GlenBiol?, suitable for molecular biology |
GS8780 | Pyridine, GlenBiol?, suitable for molecular biology with molecular sieve |
GS9957 | Pyridine, GlenDry?, anhydrous over molecular sieve |
GS2076 | Pyridine, GlenPure?, analytical grade |
GK7546 | Pyridinium p-toluenesulfonate |
GW5019 | Pyridomycin |
GP7135 | Pyridostigmine bromide |
GW4288 | Pyridoxal 5''-phosphate monohydrate |
GV5416 | Pyridoxal hydrochloride |
GV7807 | Pyridoxal-5'-phosphate hydrate |
GP8560 | Pyridoxamine dihydrochloride |
GL1150 | Pyridoxatin |
GE2109 | Pyridoxine hydrochloride, 98% |
GE7948 | Pyridoxine hydrochloride, EP, USP grade |
GL7612 | Pyripyropene A |
GW3092 | Pyrithiobac |
GT7600 | Pyrocatechol Violet |
GE8401 | Pyrogallol |
GT7202 | Pyrogallol Red |
GA4930 | Pyronaridine tetraphosphate |
GT6834 | Pyronin Y (C.I. 45005) |
GL6798 | Pyrrolcarbonyltaloside |
GK9750 | Pyrrole |
GK4804 | Pyrrole-2-carboxylic acid |
GZ6634 | Pyruvate Kinase |
GZ4747 | Pyruvate Oxidase |
GK4217 | Pyruvic acid |
GW9955 | PyTC2 |
GK2336 | Q-VD-OPh hydrate |
GL5302 | Q-VE-Oph |
GW8990 | Q-VE-OPh (Negative Control for Q-VD-OPh) |
GC2615 | Quercetin 3-a-L-rhamnoside |
GC9523 | Quercetin 3-b-D-galactoside |
GC9169 | Quercetin 3-b-D-glucoside |
GC3343 | Quercetin 3-D-glucuronide |
GL8454 | Quercetin 3-O-alpha-L-arabinopyranoside |
GP1387 | Quercetin dihydrate |
GT8084 | Quercetin-3-D-xyloside |
GP9232 | Quercetin, anhydrous |
GP9577 | Quetiapine fumarate |
GW1871 | Quinacrine mustard dihydrochloride |
GT7977 | Quinaldine Red |
GE1634 | Quinidine |
GA8217 | Quinine hydrochloride dihydrate |
GE0921 | Quinine sulfate hydrate |
GE6508 | Quinine, anhydrous |
GL5418 | Quinolactacin A |
GT7040 | Quinoline Yellow (C.I. 47000) |
GL4704 | Quinoline Yellow (mono- and disulfonic acids) (C.I. 47005) |
GK9557 | Quinoline-8-sulfonyl chloride |
GA8422 | Quinomycin A |
GK3472 | Quinuclidine |
GW1499 | Quisinostat |
GW8608 | Quizalofop-p |
GW2178 | Quizartinib |
GK7084 | R-(-)-1,2-Propanediol |
GK5164 | R-(-)-1,3-Butanediol |
GW3313 | R-3-Hydroxyisobutyric acid sodium salt |
GW6084 | R-BAIBA |
GW6986 | R406 |
GW4897 | R428 |
GW0002 | R788 disodium salt |
GC7253 | rac etodolac acyl-b-D-glucuronide |
GK4790 | Rac-2,2''-bis(diphenylphosphino)-1,1''-binaphthyl |
GA5957 | Radicicol |
GP7762 | Rafoxanide |
GC0911 | Raloxifene 6,4''-bis-b-D-glucuronide |
GP9444 | Raloxifene hydrochloride |
GC8389 | Raloxifene-4''-D-glucuronide lithium salt |
GC1964 | Raloxifene-6-D-glucuronide lithium salt |
GP5721 | Raltegravir potassium salt |
GC5462 | Raltegravir-d4 |
GP4045 | Ramipril |
GP4580 | Ranitidine hydrochloride |
GA7417 | Rapamycin |
GE7112 | Rapid decalcifier solution for histology |
GW6507 | Raptinal |
GW6554 | Rasfonin |
GY7168 | Raspberry Ketone |
GT6783 | Reactive Green 5 |
GP6330 | Rebamipide hydrate |
GY7743 | Rebaudioside A |
GA2054 | Rebeccamycin solid |
GM1906 | Reboxetine mesylate |
GW3119 | Red Arabinan |
GW6562 | Red C2-dichlorotriazine |
GW6473 | Red Starch |
GA7036 | Reductiomycin |
GP6787 | Regorafenib |
GW2614 | Regorafenib |
GK8738 | Reinecke salt |
GT9632 | Remazol Brilliant Blue R (C.I. 61200) |
GP1071 | Remdesivir |
GC7445 | Remdesivir-d5 |
GW6687 | Remisporine B |
GP2014 | Repaglinide |
GC0888 | Repaglinide acyl-β-D-glucuronide |
GP5198 | Resazurin sodium salt |
GK0296 | Resiquimod |
GA9580 | Resistomycin |
GK4611 | Resorcinol |
GC1738 | Resorufin 7-O-methyl ether |
GL6291 | Resorufin ethyl ether |
GC3390 | Resorufin β-D-cellotrioside |
GC7466 | Resorufin β-D-lactoside |
GC9633 | Resorufin β-D-xylobioside |
GW9246 | Resorufin-isobutyrate |
GY6194 | Resveratrol 4''-Glucoside |
GP2549 | Resveratrol, natural |
GP5884 | Resveratrol, synthetic |
GA4340 | Retapamulin |
GA5775 | Reticulol |
GP5601 | Retigabine |
GP0386 | Retigabine dihydrochloride |
GP4026 | Retinoic acid |
GP9313 | Retinyl palmitate |
GZ8080 | Reverse Transcriptase, expressed in E. coli |
GL5363 | Reversine |
GW6146 | RF-22c [5-Lipoxygenase Inhibitor] |
GW1302 | RG7422 |
GC8882 | Rhein acyl-b-D-glucuronide |
GX3338 | Rhenium Foil 0.025mm, 99.97% |
GX9025 | Rhenium Foil 0.05mm, 99.97% |
GX2782 | Rhenium Foil 0.125mm, 99.97% |
GX3201 | Rhenium Foil 0.1mm, 99.9+% |
GX5737 | Rhenium Foil 0.25mm, 99.97% |
GX5462 | Rhenium Powder max. 10 micron, 99.99% |
GX8357 | Rhenium Powder max. 10 micron, 99+% |
GX7039 | Rhenium Wire 0.25 mm diameter, 99.99% |
GW4199 | Rhod 2-AM |
GT9154 | Rhodamine 110 chloride |
GT5023 | Rhodamine 6G (C.I. 45160) |
GW3542 | Rhodamine 6G bis(aminoethyl)amine amide bis (trifluoroacetate) |
GW0572 | Rhodamine 6G bis(oxyethylamino)ethane amide bis (trifluoroacetate) |
GW3583 | Rhodamine 6G ethylenediamine amide bis (trifluoroacetate) |
GW3287 | Rhodamine 6G p-diaminoxylene amide bis (trifluoroacetate) |
GT7006 | Rhodamine B (C.I. 45170) |
GT5360 | Rhodamine B base |
GW0490 | Rhodamine B octadecyl ester perchlorate |
GT1789 | Rhodamine B solution, 0.2% in isopropanol |
GX8669 | Rhodium 2-ethylhexanoate solution |
GX4044 | Rhodium acetate, 99.95% (metals basis) |
GX2960 | Rhodium nonanoate |
GX4664 | Rhodium on Activated Carbon 5% Rh/C (Heraeus-Type K-0312) |
GX8515 | Rhodium Wire 0.125 mm diameter, 99.9% |
GX9469 | Rhodium Wire 0.25 mm diameter, 99.9% |
GX1354 | Rhodium Wire 0.5 mm diameter, 99.9% |
GX2999 | Rhodium(III) 2,4-pentanedionate, 99.95% (metals basis) |
GX8671 | Rhodium(III) bromide hydrate |
GX2360 | Rhodium(III) chloride, 99.95% (metals basis) |
GX1988 | Rhodium(III) iodide, 99.95% (metals basis) |
GX1215 | Rhodium(III) nitrate hydrate, 99.95% (metals basis) |
GX1339 | Rhodium(III) nitrate solution |
GX2407 | Rhodium(III) oxide hydrate, 99.95% (metals basis) |
GX8384 | Rhodium(III) sulfate solution |
GT1736 | Rhodizonic acid sodium salt |
GA5462 | Ribavirin |
GC5301 | Ribitol |
GP6544 | Riboflavin-5''-phosphate monosodium salt hydrate |
GP0364 | Riboflavin-5''-phosphate monosodium salt hydrate, USP grade |
GP0758 | Riboflavin, USP grade |
GE6228 | Ribonuclease A |
GE9871 | Ribonuclease A, DNase free |
GZ5072 | Ribonuclease H, expressed in E. coli |
GA7826 | Ribostamycin sulfate salt |
GA1484 | Rifabutin |
GA1853 | Rifampicin |
GW6082 | Rifamycin AF |
GW7973 | Rifamycin AF-API |
GW0296 | Rifamycin AF-DA |
GW6754 | Rifamycin AF-EPTAPI |
GW8320 | Rifamycin AF-K28259 |
GW9425 | Rifamycin AF-K43033 |
GW2343 | Rifamycin AF-K55517 |
GW9490 | Rifamycin AF-K56035 |
GW2592 | Rifamycin AF-K91725 |
GW1836 | Rifamycin AF-O13 |
GW7049 | Rifamycin AF-pNFI |
GW3947 | Rifamycin AG |
GW6382 | Rifamycin AMI-DA |
GW9549 | Rifamycin AMP-DA |
GW6123 | Rifamycin M14 |
GW2191 | Rifamycin O |
GW2550 | Rifamycin PR-14 |
GW4779 | Rifamycin PR-3 |
GW6310 | Rifamycin S, 8-Methyl- |
GA6855 | Rifamycin sodium salt |
GA1653 | Rifapentine |
GA5161 | Rifaximin |
GP3165 | Rilpivirine |
GP5490 | Riluzole |
GX9120 | Rimonabant base |
GP8358 | Rimonabant hydrochloride |
GE2290 | Rink Amide MBHA resin (100 - 200 mesh); loading 0.54 mmol/g |
GP4398 | Risedronate sodium salt |
GP4047 | Risperidone |
GP3714 | Ritonavir |
GP9456 | Rivaroxaban |
GP6624 | Rivastigmine tartrate |
GP0042 | Rizatriptan benzoate |
GK0415 | Ro 31-0432 |
GK6422 | Ro 61-8048 |
GL7789 | RO-3306 |
GW6503 | RO495 |
GL2680 | Robotnikinin |
GP0159 | Rofecoxib |
GP1881 | Rolipram |
GA8206 | Ronidazole |
GP7813 | Ropinirole hydrochloride |
GP7588 | Ropivacaine |
GP9339 | Ropivacaine hydrochloride monohydrate |
GL0492 | Roquefortine C |
GW2731 | Roridin E |
GY0309 | Rosarin |
GP3424 | Roscovitine |
GT2559 | Rose Bengal (C.I. 45440) |
GT3871 | Rose Bengal (C.I. 45440); 90% |
GP6434 | Rosiglitazone |
GP8393 | Rosiglitazone maleate |
GP8768 | Rosmarinic acid |
GP1717 | Rosuvastatin calcium salt |
GE1875 | Rotenone |
GL6758 | Rottlerin |
GA4818 | Roxithromycin |
GW9954 | Ru(bpy)2(mcbpy-O-Su-ester)(PF6)2 |
GP6560 | Rubescensin |
GX7425 | Rubidium acetate, 99.9% |
GX8750 | Rubidium bromide, 98+% |
GX5160 | Rubidium bromide, 99+% |
GX7047 | Rubidium carbonate, 99.9% |
GX0269 | Rubidium carbonate, 99% |
GX1174 | Rubidium chloride, 98+% |
GX5493 | Rubidium chloride, 99.9% |
GX7198 | Rubidium chloride, 99% |
GX3341 | Rubidium fluoride, 99.9% |
GX6890 | Rubidium iodide, 99.9% |
GX9415 | Rubidium Metal in breakseal ampoule, 99.5+% |
GX8203 | Rubidium Metal, ampouled, 98.5+% |
GX3418 | Rubidium Metal, ampouled, 99.5+% |
GX4681 | Rubidium molybdate, 99.5% |
GX1346 | Rubidium nitrate, 99.8% |
GX3398 | Rubidium nitrate, 99.99% |
GX1977 | Rubidium sulfate, 99.9% |
GX5881 | Rubidium tungstate, 99.9% |
GL3432 | Rubiginone A2 |
GL3716 | Rubiginone D2 |
GL0712 | Rubratoxin A |
GL3024 | Rubrofusarin |
GY4727 | Rubusoside |
GA5877 | Rugulosin |
GX5847 | Ruthenium acetate, 99.95% (metals basis) |
GX2743 | Ruthenium black |
GX6813 | Ruthenium nitrosyl chloride hydrate, 99.95% (metals basis) |
GX8174 | Ruthenium nitrosylnitrate solution |
GX3664 | Ruthenium oxalate |
GX2247 | Ruthenium Powder max. 60 micron, 99.9% |
GX6247 | Ruthenium Red |
GK8583 | Ruthenium Red, 85% |
GX5246 | Ruthenium Sponge, 99.95% |
GX7049 | Ruthenium(III) 2,4-pentanedionate |
GX1927 | Ruthenium(III) chloride hydrate, 99.95+% (metals basis) |
GX9865 | Ruthenium(III) chloride solution |
GX6148 | Ruthenium(III) chloride, anhydrous, 99.95% (metals basis) |
GX3574 | Ruthenium(IV) oxide, 99.9% |
GX3068 | Ruthenium(IV) oxide, 99.9+% |
GX6302 | Ruthenium(IV) oxide, hydrate |
GC4239 | Rutin hydrate |
GW5081 | Rutin trihydrate |
GC1207 | Rutinose |
GW4048 | Ruxolitinib . phosphate salt |
GW2265 | Ruxolitinib (free base) |
GW0575 | RWJ-67657 |
GK9991 | S-(-)-Nicotine |
GW4235 | S-(5'')-Adenosyl-3-thiopropylamine |
GW5830 | S-3-Hydroxyisobutyric acid sodium salt |
GW7274 | S-99 |
GN7982 | S-Adenosyl-L-methionine disulfate tosylate |
GW4050 | S-BAIBA |
GM1431 | S-Benzyl-L-cysteine |
GW1881 | S-Gboxin iodide |
GL7950 | S-Nitrosoglutathione |
GK1940 | S(+)-Niguldipine hydrochloride |
GK8256 | S(+)-Propylene glycol |
GL4789 | S14161 |
GW2276 | S49076 hydrochloride |
GW5897 | S6K-18 |
GX2610 | Saccharin |
GK7761 | Saccharin sodium salt |
GC5203 | Safinamide metabolite NW-1689 acyl-β-D-glucuronide |
GT4125 | Safranine O (C.I. 50240) |
GE3658 | Safranine O solution |
GL4333 | SAG |
GL3544 | SAG Analog (highly active) |
GL4668 | SAG Analog (LowTox) |
GL1175 | SAG dihydrochloride |
GP7722 | Salbutamol |
GP1722 | Salbutamol hemisulphate salt |
GK4505 | Salicylaldehyde |
GK5951 | Salicylaldehyde azine |
GK2541 | Salicylaldoxime |
GC2468 | Salicylic acid acyl-β-D-glucuronide |
GC2631 | Salicylic acid phenolic D-glucuronide |
GK2915 | Salicylic acid, 99% |
GK1093 | Salicylic acid, BP, Ph. Eur grade |
GC0027 | Salidroside |
GA5900 | Salinomycin |
GA1100 | Salinomycin sodium salt |
GW2220 | Salinosporamide A |
GP0706 | Salmeterol xinafoate |
GL4615 | Salsalate |
GX9664 | Samarium acetate hydrate, 99.9% |
GX1618 | Samarium acetate hydrate, 99.999% |
GX0464 | Samarium boride, 99.9% |
GX2799 | Samarium carbonate hydrate, 99.9% |
GX6156 | Samarium carbonate hydrate, 99.999% |
GX7267 | Samarium Chips, 99.9% |
GX7091 | Samarium chloride anhydrous, 99.9% |
GX3470 | Samarium chloride hydrate, 99.9% |
GX1744 | Samarium chloride hydrate, 99.99% |
GX5717 | Samarium chloride hydrate, 99.999% |
GX7951 | Samarium fluoride, 99.9% |
GX7004 | Samarium fluoride, 99.999% |
GX1790 | Samarium Foil 0.127mm, 99.9% |
GX1688 | Samarium Foil 0.25mm, 99.9% |
GX8775 | Samarium hydroxide, 99.999% |
GX4456 | Samarium nitrate hydrate, 99.9% |
GX1901 | Samarium oxalate hydrate, 99.9% |
GX6229 | Samarium oxalate hydrate, 99.999% |
GX7450 | Samarium oxide-Nano Powder, 99.9% |
GX7148 | Samarium oxide, 99.9% |
GX4190 | Samarium oxide, 99.9% |
GX9205 | Samarium oxide, 99.99% |
GX3328 | Samarium Pieces distilled, 99.99% |
GX9543 | Samarium Pieces, 99.9% |
GX0211 | Samarium Powder, 99.9% |
GX4164 | Samarium sulfate anhydrous, 99.9% |
GX3999 | Samarium sulfate hydrate, 99.9% |
GX0514 | Samarium(III) oxide Nanopowder, 99,9 % |
GW2862 | Sancycline |
GX1450 | Sand, washed |
GX2216 | Sand, washed, coarse, 0.6 - 1.2 mm |
GL9271 | Sanguinarine chloride hydrate |
GL2589 | SANT-2 |
GC2179 | Saponin |
GL5222 | Saquayamycin B1 |
GP7183 | Saquinavir mesylate |
GW6888 | SAR-020106 |
GW6041 | SAR-131675 |
GL3294 | Sarcophine |
GM2992 | Sarcosine |
GL5788 | Sauchinone |
GK2422 | SB 202190 |
GK9716 | SB 203580 |
GL9739 | SB 216763 |
GL2098 | SB 415286 |
GL2219 | SB 431542 hydrate |
GW7595 | SB-242235 |
GL6242 | SB-366791 |
GW4213 | SB590885 |
GK8201 | SBFI-AM |
GK2799 | SC-560 |
GX1407 | Scandium acetate hydrate, 99.9% |
GX4514 | Scandium acetate hydrate, 99.99+% |
GX1474 | Scandium carbonate, 99.999% |
GX5232 | Scandium chloride anhydrous, 99.9% |
GX2862 | Scandium chloride hydrate, 99.9% |
GX8802 | Scandium chloride hydrate, 99.999% |
GX3576 | Scandium fluoride, 99.9% |
GX6028 | Scandium fluoride, 99.99% |
GX9576 | Scandium oxide, 99.9% |
GX2472 | Scandium oxide, 99.99% |
GX8482 | Scandium oxide, 99.999% |
GX6171 | Scandium oxide, 99.999% |
GX2769 | Scandium Pieces, 99.9% |
GX0690 | Scandium Pieces, 99.99% |
GX3289 | Scandium Powder -100 mesh, 99.9% |
GX2474 | Scandium sulfate pentahydrate, 99.99% |
GW5917 | SCH900776 |
GT3929 | Schiff''s reagent |
GP9899 | Schisandrin B |
GP0437 | Sclareol |
GL9785 | Sclerotiorin |
GP5098 | Scopolamine |
GP9811 | Scopolamine butylbromide |
GE4184 | Scott′s Tap Water Substitute Concentrate, 10X solution |
GC9987 | Scutellarin |
GW7617 | SD-06 |
GW8497 | SD-169 |
GW3902 | Secalonic acid F |
GC3456 | Secoisolariciresinol diglucoside |
GD2712 | Secondary alcohol ethoxylate (41); 70% solution in water |
GW3677 | Sekikaic acid |
GW6519 | Selamectin |
GX1661 | Selenium Granules 2-4 mm, 99.99% |
GX5814 | Selenium Granules 2-4 mm, 99.999% |
GX9113 | Selenium oxide, 99.8% |
GX6083 | Selenium oxide, 99.9% |
GX8476 | Selenium oxide, 99.999% |
GX2812 | Selenium Powder -160 mesh, 99.99+% |
GX2064 | Selenium Powder -200 mesh, 99.8% |
GX7357 | Selenium Powder -325 mesh, 99.6% |
GX7822 | Selenium sulfide, 94+% |
GX7134 | Selenous acid |
GX1905 | Selenous acid, 99.999% |
GC2229 | Selexipag metabolite MRE-269 acyl-β-D-glucuronide |
GW7307 | Selonsertib |
GW0805 | Selonsertib Hydrochloride |
GW9004 | Selumetinib |
GW8695 | Semaglutide |
GW1848 | Semaglutide . AcOH |
GC5003 | Sennoside A |
GC2469 | Sennoside B |
GL5651 | Sericic acid |
GW5344 | Seriniquinone |
GK3987 | Serinol |
GP4050 | Serotonin hydrochloride |
GL0410 | Serratol |
GP9522 | Sertindole |
GC2168 | Sertraline carbamoyl glucuronide |
GP7667 | Sertraline hydrochloride |
GL9605 | Sesame oil |
GY7083 | Sesamolin |
GL6392 | Setomimycin (Setomimicin) |
GW4211 | SGI-1776 |
GW4900 | SGX-523 |
GL3266 | Shellac |
GP5211 | Shikimic acid |
GL5964 | Shikonin |
GY7466 | Shikonin |
GY5943 | Shikonofuran A |
GL5333 | Shz-1 |
GL1634 | Siamycin I |
GW9434 | Sibiriline |
GP3242 | Sildenafil citrate |
GX7225 | Silic acid, 99+% |
GX9287 | Silica Gel, pore size ~25A, 1 - 3 mm beads |
GX6254 | Silica Gel, pore size ~25A, 2 - 5 mm beads |
GX9977 | Silica gel, pore size 60A, particle size 40-63 micron |
GE5162 | Silica Gel, self-indicating, blue to pink, 2 - 5 mm beads |
GE9411 | Silica Gel, self-indicating, orange to colourless, 4 - 8 mm beads, cobalt free |
GK6673 | Silica, fumed, hydrophobic |
GX4045 | Silicon boride, 98% |
GX8061 | Silicon Nanopowder, 99+ % |
GX0657 | Silicon Pieces max. 10 mm, 99.99% |
GX4991 | Silicon Pieces max. 6 mm, 99.9% |
GX7651 | Silicon Pieces max. 6 mm, 99.99% |
GX0748 | Silicon Pieces, polycrystalline, 99.999% |
GX3061 | Silicon Powder -100, +325 mesh, amorphous, 99.999% |
GX3543 | Silicon Powder max. 160 micron, 98.5+% |
GX3775 | Silicon(II) oxide, 99.9% |
GX1467 | Silicon(II) oxide, 99.9%, 3 - 6 mm pieces |
GX5045 | Silicon(II) oxide, 99.99% |
GX1131 | Silicon(IV) acetate |
GX4183 | Silicon(IV) carbide Nanopowder (beta); 99 % |
GX3494 | Silicon(IV) carbide Nanopowder (beta); 99% |
GX4646 | Silicon(IV) carbide, 98.8% |
GX0849 | Silicon(IV) nitride |
GX7444 | Silicon(IV) nitride Nanopowder (amorphous); 99 % |
GX3828 | Silicon(IV) nitride Nanopowder (amorphous); 99 % |
GX2563 | Silicon(IV) oxide + amino group (6:1) Nanopowder , 99,8 % |
GX3021 | Silicon(IV) oxide Nanopowder non-porous, 99.5 % |
GX5961 | Silicon(IV) oxide Nanopowder, 99%+ |
GX4972 | Silicon(IV) oxide-Nano Powder, 99.5% |
GX3393 | Silicon(IV) oxide-Nano Powder, 99% |
GX6601 | Silicon(IV) oxide, 99.9+%, 1-5 mm |
GX5711 | Silicon(IV) oxide, 99.9+%, 3-12 mm |
GX8518 | Silicon(IV) oxide, 99.99%, -100 mesh |
GX5602 | Silicon(IV) oxide, 99.99%, 1-4 mm |
GX9332 | Silicon(IV) oxide, 99.99%, 3-12 mm |
GX0707 | Silicon(IV) oxide, 99.99%, LT 1 micron |
GX1138 | Silicon(IV) oxide, 99.999% |
GK4111 | Silicone oil, 350 cSt |
GK1916 | Silicone oil, 500 cSt |
GX2031 | Silicone oil, 5000 cSt |
GW0786 | Silthiopham |
GX3719 | Silver 4-toluenesulfonate, 99+% |
GX7156 | Silver acetate, 99.99% |
GX7316 | Silver acetate, 99+% |
GK3619 | Silver acetate, anhydrous, 99.5% |
GX4227 | Silver benzoate |
GX7770 | Silver bromide, 99.999% |
GX3419 | Silver bromide, 99+% |
GX5940 | Silver carbonate, 99.7% |
GX7973 | Silver carbonate, 99.999% |
GX8612 | Silver chloride, 99.999% |
GX2669 | Silver chloride, 99.9999% |
GX7556 | Silver chloride, 99+% |
GX3259 | Silver citrate |
GX9442 | Silver conducting fluid |
GX1580 | Silver cyanide, 99% |
GX7129 | Silver fluoride, 98+% |
GX3692 | Silver Foil 0.0125 mm, 99.9+%? |
GX8808 | Silver Foil 0.025 mm, 99.99% |
GX2671 | Silver Foil 0.05 mm, 99.95% |
GX0249 | Silver Foil 0.05 mm, 99.999% |
GX0428 | Silver Foil 0.075 mm, 99.95+% |
GX7405 | Silver Foil 0.075 mm, 99.999% |
GX6467 | Silver Foil 0.1 mm, 99.99% |
GX8584 | Silver Foil 0.1 mm, 99.995% |
GX6705 | Silver Foil 0.125 mm, 99.9% |
GX8127 | Silver Foil 0.125 mm, 99.99% |
GX5907 | Silver Foil 0.25 mm, 99.9% |
GX3813 | Silver Foil 0.25 mm, 99.995% |
GX6836 | Silver Foil 0.5 mm, 99.9% |
GX1382 | Silver Foil 0.5 mm, 99.995% |
GX6646 | Silver Foil 1.0 mm, 99.9% |
GX7472 | Silver Foil 1.0 mm, 99.995% |
GX8631 | Silver Foil 2.0 mm, 99.9% |
GX2488 | Silver Foil 2.0 mm, 99.995% |
GX9289 | Silver Gauze 1024 mesh,cm2, 0.12 mm wire diameter, 99.9% |
GX4288 | Silver Granules 2-8 mm, 99.9+% |
GX0138 | Silver Granules appr. 2x10x10 mm, 99.999% (metals basis) |
GX5040 | Silver hexafluoroantimonate, 95+% |
GX4691 | Silver iodate |
GX0810 | Silver iodide, 99+% |
GX5020 | Silver methanesulfonate |
GX9825 | Silver Nanopowder, 99,9 % |
GX0585 | Silver Nanopowder, 99.5 % |
GX4085 | Silver Nanopowder, 99.95 % |
GX4779 | Silver Nanopowder, coated with fatty acids, 99+ % |
GX7986 | Silver Needles, 99.999% |
GK7224 | Silver nitrate |
GX5332 | Silver nitrate, 99.9%, BP, Ph. Eur., USP grade |
GX8949 | Silver nitrate, 99.999% |
GX9839 | Silver nitrate, 99.9999% |
GX9383 | Silver nitrite |
GX1516 | Silver on Activated Carbon 0,3% Ag/C (Heraeus-Type K-0600) |
GX6147 | Silver on Activated Carbon 0,3% Ag/C (Heraeus-Type K-0602) |
GX6637 | Silver on Activated Carbon 0,3% Ag/C (Heraeus-Type K-0604) |
GX0072 | Silver on Activated Carbon 0,3% Ag/C (Heraeus-Type K-0606) |
GX3306 | Silver on Activated Carbon 0,3% Ag/C (Heraeus-Type K-0608) |
GX7358 | Silver on Activated Carbon 0,5% Ag/C (Heraeus-Type K-0603) |
GX7518 | Silver on Activated Carbon 0,5% Ag/C (Heraeus-Type K-0605) |
GX3267 | Silver on Activated Carbon 0,5% Ag/C (Heraeus-Type K-0607) |
GX9801 | Silver on Activated Carbon 0,5% Ag/C (Heraeus-Type K-0609) |
GX0759 | Silver on Activated Carbon 0,5% Ag/C (Heraeus-Type K-601) |
GX2133 | Silver Pellets 6 x 6 mm, 99.9% |
GX2497 | Silver perchlorate hydrate, 99% |
GX5434 | Silver phosphate, 99+% |
GX4490 | Silver Powder 0.7-1.2 micron, 99.9% |
GX3560 | Silver Powder, crystalline 0.15-0.35 mm, 99.99% |
GX0038 | Silver Powder, crystalline 0.5-1 mm, 99.99% |
GX5751 | Silver Powder, lamellar max. 20 micron |
GX6877 | Silver Rod 10.0 mm diameter, 99.9% |
GX8788 | Silver Rod 10.0 mm diameter, 99.99% |
GX9544 | Silver Rod 12.5 mm diameter, 99.9% |
GX2957 | Silver Rod 4.0 mm diameter, 99.9% |
GX2098 | Silver Rod 5.0 mm diameter, 99.9% |
GX1179 | Silver Rod 5.0 mm diameter, 99.99% |
GX0397 | Silver Rod 7.0 mm diameter, 99.995% |
GX7814 | Silver Rod 8.0 mm diameter, 99.9% |
GK5303 | Silver stearate |
GK2380 | Silver sulfadiazine |
GK0139 | Silver sulfate |
GX7366 | Silver sulfate, 99.999% |
GX7990 | Silver sulfate, 99+% |
GX6306 | Silver tetrafluoroborate, 95+% |
GX6129 | Silver thiocyanate, 98% |
GX7211 | Silver trifluoroacetate, 97+% |
GX0215 | Silver trifluoromethanesulfonate, 97+% |
GX3012 | Silver Tube 12.0 mm diameter, 1.0 mm wall thickness, 99.9% |
GX4351 | Silver Wire 0.025 mm diameter, 99.95+% |
GX9633 | Silver Wire 0.1 mm diameter, 99.9% |
GX4206 | Silver Wire 0.1 mm diameter, 99.995% |
GX8634 | Silver Wire 0.125 mm diameter, 99.9% |
GX1814 | Silver Wire 0.25 mm diameter, 99.9% |
GX3175 | Silver Wire 0.25 mm diameter, 99.995% |
GX6794 | Silver Wire 0.5 mm diameter , 99.99% |
GX0676 | Silver Wire 0.5 mm diameter, 99.9% |
GX5743 | Silver Wire 0.7 mm diameter, 99.9% |
GX1864 | Silver Wire 0.8 mm diameter, 99.97% |
GX0740 | Silver Wire 1.0 mm diameter, 99.9% |
GX2005 | Silver Wire 1.0 mm diameter, 99.99% |
GX1934 | Silver Wire 1.0 mm diameter, 99.999% |
GX3292 | Silver Wire 2.0 mm diameter, 99.9% |
GX5441 | Silver Wire 2.0 mm diameter, 99.995% |
GX1897 | Silver Wire 2.5 mm diameter, 99.9% |
GX3195 | Silver Wool 0.05 mm wire thickness, 99.9% |
GK1310 | Silver(I) oxide |
GX5928 | Silver(I) oxide, 99.99% |
GX4370 | Silver(I) oxide, 99% |
GX6956 | Silver(I) sulfide, 99+% |
GX1436 | Silver(I)-pinanylmercaptide |
GX5874 | Silver(II) oxide, 99+% |
GP4040 | Silybin |
GW7248 | Silymarin |
GP3135 | Simeprevir |
GW5914 | Simetone |
GA4674 | Simocyclinone D8 |
GP4505 | Simvastatin |
GW6325 | Simvastatin sodium salt |
GL5611 | Sinapic acid |
GP8868 | Sinomenine hydrochloride |
GW3120 | Sipholenol A |
GW2180 | Sipholenone A |
GL5518 | Sirtinol |
GA7855 | Sisomicin sulfate salt |
GA7129 | Sitafloxacin monohydrate |
GP3542 | Sitagliptin phosphate hydrate |
GL2669 | Skyrin |
GL0072 | Skyrin |
GL6565 | SMI-4a |
GW7339 | SNARF-DE |
GK2247 | SNC80 |
GW0258 | SNS-314 |
GK8013 | Soda lime, granular, with indicator |
GX1362 | Sodium 1-nonanesulfonate, 99% |
GX9339 | Sodium 1-tetradecanesulfonate, 99% |
GM7502 | Sodium 4-aminosalicylate dihydrate |
GB8871 | Sodium acetate buffer, 3M solution |
GK0054 | Sodium acetate trihydrate |
GK4909 | Sodium acetate trihydrate, 99.5%, BP, Ph. Eur., USP grade |
GX1317 | Sodium acetate trihydrate, 99%, ACS |
GK4763 | Sodium acetate, anhydrous |
GX3743 | Sodium acetate, anhydrous, 99.99% |
GX8442 | Sodium acetate, anhydrous, 99% |
GX3080 | Sodium acrylate |
GE6920 | Sodium azide |
GE4155 | Sodium azide, 0.005% solution |
GE2789 | Sodium azide, 0.1M solution |
GK4323 | Sodium benzoate, 99.5% |
GX1300 | Sodium benzoate, BP, FCC, Ph. Eur., USP grade |
GX3424 | Sodium bismuthate |
GK7777 | Sodium bisulfite |
GE8273 | Sodium borohydride |
GK0682 | Sodium bromide |
GX4625 | Sodium bromide, 99.5% |
GK4939 | Sodium butyrate |
GL5070 | Sodium cacodylate trihydrate |
GK0913 | Sodium caprylate |
GE8906 | Sodium carbonate-bicarbonate buffer, 0.05M solution |
GK1081 | Sodium carbonate, anhydrous |
GK4950 | Sodium carbonate, anhydrous, 99.5 - 100.5 %, BP, Ph. Eur., NF grade |
GX1219 | Sodium carbonate, anhydrous, 99.9% |
GX7344 | Sodium carbonate, anhydrous, 99.999% |
GE8374 | Sodium chloride |
GE3054 | Sodium chloride solution, 5M in water |
GE1119 | Sodium chloride, Ph. Eur., USP grade |
GE0307 | Sodium chloride, suitable for molecular biology |
GL9225 | Sodium cholesteryl sulfate |
GK0137 | Sodium citrate dihydrate |
GK2264 | Sodium citrate, anhydrous |
GX4302 | Sodium cyanate, 98+% |
GE0246 | Sodium cyanoborohydride |
GK8449 | Sodium decanoate |
GK7935 | Sodium diatrizoate |
GK2071 | Sodium diethyldithiocarbamate trihydrate |
GK4167 | Sodium dihydrogen citrate anhydrous |
GX9327 | Sodium dihydrogen diphosphate, 95% |
GK8728 | Sodium dihydrogen phosphate dihydrate |
GX5813 | Sodium dihydrogen phosphate, 99.999% |
GX9427 | Sodium disulfito aurate(I) solution |
GX8950 | Sodium dithionite, 85% |
GL8384 | Sodium DL-lactate, 60% solution |
GL6866 | Sodium dodecanoate |
GD0485 | Sodium dodecyl sulfate, 10% solution in water |
GD0990 | Sodium dodecyl sulfate, 20% solution in water |
GD2962 | Sodium dodecyl sulfate, 99% |
GX5289 | Sodium dodecyl sulfate, for analysis |
GD0901 | Sodium dodecyl sulfate, Ph. Eur., USP grade |
GK6904 | Sodium fluoride |
GX0783 | Sodium fluoride, 99.9+% |
GX4419 | Sodium fluoride, 99%, BP, Ph. Eur. grade |
GX4812 | Sodium fluorophosphate |
GX5028 | Sodium formate |
GC3360 | Sodium glucoheptonate |
GC9014 | Sodium gluconate |
GX3248 | Sodium gluconate, USP grade |
GL1902 | Sodium glycocholate hydrate |
GK3611 | Sodium glycodeoxycholate |
GX7389 | Sodium hexachloroiridate(III) |
GX2684 | Sodium hexachloroiridate(IV) hydrate |
GX8088 | Sodium hexachloroplatinate(IV) hydrate, 99.95% (metals basis) |
GX6620 | Sodium hexachlororhodate(III) hydrate, 99.95% (metals basis) |
GX1991 | Sodium hexafluoroaluminate |
GX0407 | Sodium hexafluorophosphate(V); 98% |
GX2374 | Sodium hexafluorosilicate |
GX5200 | Sodium hexahydroxyplatinate(IV); 99.95% (metals basis) |
GK9696 | Sodium hexametaphosphate |
GX2342 | Sodium hexanitritocobaltate(III) |
GE8414 | Sodium hydrogen carbonate |
GE9811 | Sodium hydrogen carbonate, Ph. Eur., USP grade |
GK7503 | Sodium hydrogen selenite |
GX6396 | Sodium hydrogen sulfate monohydrate, 99+% |
GX2054 | Sodium hydrogen sulfate, 99.99% |
GK0060 | Sodium hydrogen sulfate, fused |
GE8709 | Sodium hydroxide pellets, EP |
GX0315 | Sodium hydroxide, 0.1M solution |
GX9247 | Sodium hydroxide, 0.5M solution |
GX9101 | Sodium hydroxide, 1.0M solution |
GE2728 | Sodium hydroxide, 10M solution |
GX5276 | Sodium hydroxide, 2.0M solution |
GX2802 | Sodium hydroxide, 40% (w/w) solution |
GE0021 | Sodium hydroxide, micropearls |
GX3961 | Sodium hydroxymethanesulfonate |
GX9417 | Sodium hypochlorite, 14% solution |
GX0223 | Sodium hypophosphite monohydrate |
GP2623 | Sodium iodide, 99% |
GX6257 | Sodium iodide, anhydrous, 99.9+% |
GC1128 | Sodium L-ascorbate |
GC0078 | Sodium L-ascorbate, BP, Ph. Eur., USP grade |
GC8333 | Sodium L-lactate |
GK2515 | Sodium lactobionate |
GX6101 | Sodium malonate dibasic monohydrate |
GW6915 | Sodium mesoxalate monohydrate |
GK1356 | Sodium metabisulfite |
GK2800 | Sodium metaperiodate |
GX6056 | Sodium metasilicate nonahydrate |
GK6589 | Sodium metasilicate, anhydrous |
GK7899 | Sodium metavanadate |
GX9397 | Sodium metavanadate, 98+% |
GK7205 | Sodium methoxide |
GX5429 | Sodium molybdate dihydrate, 98% |
GK4422 | Sodium molybdate dihydrate, 99.5% |
GK1113 | Sodium molybdate dihydrate, EP grade |
GX9871 | Sodium n-decyl sulfate, 99% |
GX7367 | Sodium n-tetradecyl sulfate, 99% |
GX4297 | Sodium n-undecyl sulfate, 99% |
GX6887 | Sodium niobate, 99.9% |
GK2648 | Sodium nitrate |
GX6161 | Sodium nitrate, 99.999% |
GK3284 | Sodium nitrite |
GT2671 | Sodium nitroprusside dihydrate |
GX4924 | Sodium nitroprusside dihydrate, ACS grade |
GX3386 | Sodium octyl sulfate |
GK2035 | Sodium oleate |
GK7381 | Sodium orthovanadate |
GK3236 | Sodium oxalate |
GX9079 | Sodium oxalate, 99.5%, ACS grade |
GX3682 | Sodium oxalate, 99+% |
GK7843 | Sodium perborate tetrahydrate |
GX2568 | Sodium periodate, ACS grade |
GX4825 | Sodium peroxodisulfate, 98% |
GX2120 | Sodium perrhenate |
GK5993 | Sodium persulfate |
GE0010 | Sodium phosphate monobasic monohydrate |
GE9539 | Sodium phosphate monobasic, anhydrous |
GK9846 | Sodium phosphate tribasic dodecahydrate, 98% |
GK2399 | Sodium phosphate, anhydrous |
GK1928 | Sodium phosphate, dibasic heptahydrate |
GX3213 | Sodium polytungstate |
GK6391 | Sodium pyrophosphate decahydrate |
GK0841 | Sodium pyrophosphate, anhydrous |
GE9014 | Sodium pyruvate |
GX0590 | Sodium pyruvate, 99%, GlenCell?, suitable for cell culture |
GK1651 | Sodium salicylate |
GK7770 | Sodium salicylate, Ph. Eur. grade |
GE7317 | Sodium selenite pentahydrate, BP, EP grade |
GE9041 | Sodium selenite, anhydrous |
GK8776 | Sodium silicate solution |
GX4705 | Sodium stannate trihydrate |
GV4487 | Sodium succinate dibasic hexahydrate |
GK6710 | Sodium succinate dibasic hexahydrate, 99% |
GE0613 | Sodium sulfate decahydrate |
GE3563 | Sodium sulfate, anhydrous |
GX6055 | Sodium sulfate, anhydrous, 99.99+% |
GE2515 | Sodium sulfite, anhydrous |
GK1687 | Sodium tartrate dihydrate |
GL4583 | Sodium taurochenodeoxycholate |
GL2114 | Sodium taurocholate hydrate |
GD6662 | Sodium taurodeoxycholate hydrate |
GL2752 | Sodium taurolithocholate |
GK8560 | Sodium tauroursodeoxycholate |
GE4325 | Sodium tert-butoxide |
GW3795 | Sodium tetra(p-tolyl)borate |
GK8434 | Sodium tetraborate decahydrate |
GB8919 | Sodium tetraborate decahydrate, EP grade |
GX6969 | Sodium tetraborate, 0.5% solution |
GX5662 | Sodium tetraborate, 5% solution |
GK3065 | Sodium tetraborate, anhydrous |
GX8308 | Sodium tetrachloroaurate(III) hydrate, 99.95% (metals basis) |
GX2315 | Sodium tetrachloropalladate(II) solution |
GX1318 | Sodium tetrachloropalladate(II); 99.95% (metals basis) |
GX0080 | Sodium tetrachloroplatinate(II) |
GX0432 | Sodium tetrachloroplatinate(II) solution |
GX1967 | Sodium tetraethylborate |
GX1082 | Sodium tetrafluoroborate |
GK6603 | Sodium tetraphenylborate |
GX9787 | Sodium tetraphenylborate, ACS grade |
GK8710 | Sodium tetrathionate dihydrate |
GE7173 | Sodium thiocyanate |
GC0633 | Sodium thioglycolate, 98% |
GE5657 | Sodium thiosulfate pentahydrate |
GX3861 | Sodium thiosulfate pentahydrate, Ph. Eur., USP grade |
GE4439 | Sodium thiosulfate solution |
GE4280 | Sodium thiosulfate, anhydrous |
GX4946 | Sodium thiosulfate, pentahydrate, 99.99% |
GK2286 | Sodium triacetoxyborohydride |
GX3440 | Sodium trifluoroacetate, 97+% |
GX5430 | Sodium trimetaphosphate |
GX2065 | Sodium trimethylsilanolate |
GX0579 | Sodium tripolyphosphate |
GK6152 | Sodium tungstate dihydrate |
GX9903 | Sodium tungstate dihydrate, 99+% |
GK0010 | Sodium valproate |
GP2923 | Sofosbuvir |
GP3887 | Solanesol |
GP5592 | Solasonine |
GC0834 | Solketal |
GT7915 | Solvent yellow 7 (4-Phenylazophenol) |
GY8573 | Sophoraflavanone G |
GP6971 | Sorafenib |
GA6389 | Sorbic acid |
GW5247 | Sorbic chloride |
GP8323 | Sotalol hydrochloride |
GE0442 | Soya lecithin, powder |
GL3290 | Soybean oil |
GX1190 | SP Brij S721 MBAL-PA-(SG) [ET80220] |
GW1707 | SP2509 |
GX5912 | Span 80 |
GA1910 | Sparfloxacin |
GA3375 | Spectinomycin dihydrochloride pentahydrate |
GA0510 | Spectinomycin sulfate |
GE1557 | Spermidine |
GE2774 | Spermidine trihydrochloride |
GE1335 | Spermine |
GL9744 | Spermine tetrahydrochloride |
GK9857 | Spinosad |
GW1989 | Spinosad |
GE2928 | Spiperone hydrochloride |
GA2410 | Spiramycin |
GP9788 | Spiramycin adipate |
GA9612 | Spiramycin, EP grade |
GP5407 | Spironolactone |
GK9181 | Splitomicin |
GX8084 | SPS |
GE0666 | Squalane |
GK9974 | Squalene |
GK1230 | Squalene, from vegetal source |
GW0144 | SR3677 |
GB4332 | SSC buffer, 20X solution |
GB0798 | SSPE buffer, 20X solution |
GY9308 | Stachydrine hydrochloride |
GC8978 | Stachyose hydrate |
GX7816 | Stainless steel 316L Nanopowder, 99,9 % |
GX1949 | Stainless steel foil 0.075 mm |
GX8867 | Stainless steel foil 0.1 mm |
GX4507 | Stainless steel foil 0.125 mm |
GX4077 | Stainless steel foil 0.15 mm |
GX0085 | Stainless steel foil 0.25 mm |
GX3645 | Stainless steel foil 0.5 mm |
GX3658 | Stainless steel foil 1 mm |
GX3148 | Stainless steel powder 150 micron |
GX9054 | Stainless steel rod 20 mm diameter |
GX1541 | Stainless steel tube 8.0 mm diameter, 1.0 mm wall thickness |
GX0853 | Stainless steel wire 0.25 mm diameter |
GX1022 | Stainless steel wire 0.5 mm diameter |
GL8815 | Stains-All |
GE6857 | Starch (Smithies); for electrophoresis |
GC9642 | Starch, powder, from potato |
GC6593 | Starch, soluble, ACS grade |
GA8507 | Staurosporine |
GP1591 | Stavudine |
GK7312 | Stearic acid, pure, 98% |
GK8631 | Stearic acid, technical, 90% |
GL8659 | Sterigmatocystin |
GC8724 | Stevioside, 85% |
GC8309 | Stevioside, 98% |
GW5900 | STF-31 |
GP9119 | Stigmasterol, 95% |
GP5909 | Stigmasterol, 98% |
GP3535 | Stiripentol |
GL1351 | Streptochlorin |
GA7700 | Streptomycin sulfate salt |
GA1956 | Streptozocin |
GA1040 | Strobilurin B |
GX5175 | Strontium acetate hydrate, 99+% |
GX5543 | Strontium aluminate, 99+% |
GX4255 | Strontium bromide, 99.99% |
GX6853 | Strontium carbonate, 96+% |
GX5614 | Strontium carbonate, 99.999% |
GX9308 | Strontium carbonate, 99+% |
GK3876 | Strontium chloride hexahydrate |
GX3549 | Strontium chloride hexahydrate, 99%, ACS grade |
GX6973 | Strontium chloride hydrate, 99.99+% |
GX8262 | Strontium fluoride, 99.9% |
GX7221 | Strontium fluoride, 99.99% |
GX3818 | Strontium fluoride, 99% |
GX1288 | Strontium hydroxide, octahydrate, 99+% |
GX0022 | Strontium molybdate, 99.9% |
GX1574 | Strontium nitrate, 99.99% |
GX6363 | Strontium nitrate, 99.999% |
GK5693 | Strontium nitrate, anhydrous, 98% |
GX8751 | Strontium oxide, 99.5% |
GX0588 | Strontium Pieces max. 20 mm, under argon, coated with oil, Ba max. 1%, 99% |
GX0495 | Strontium Pieces max. 8 mm, under oil, 99.2+% |
GX7135 | Strontium titanate Nanopowder, 99.9% |
GX8434 | Strontium titanate-Nano Powder, 99.8% |
GX4862 | Strontium titanate, 99.9% |
GX1727 | Strontium titanate, 99+% |
GX0472 | Strontium tungstate, 99.9% |
GX8495 | Strontium zirconate, 99+% |
GE5799 | Strophanthidin |
GL8974 | Suc-Leu-Tyr-AMC |
GK9938 | Succinic acid |
GK7702 | Succinic acid disodium salt, anhydrous |
GK7520 | Succinic anhydride |
GK7292 | Succinimide |
GL8882 | Succinylcholine chloride dihydrate |
GA4716 | Succinylsulfathiazole |
GC9213 | Sucralose |
GC1410 | Sucralose, USP grade |
GC4473 | Sucrose |
GC4185 | Sucrose benzoate |
GC6190 | Sucrose octaacetate |
GC1775 | Sucrose octasulfate potassium salt |
GK4916 | Sucrose octasulfate sodium salt |
GC0234 | Sucrose octasulfate-aluminum complex |
GC8364 | Sucrose palmitate |
GC2889 | Sucrose stearate |
GC3219 | Sucrose, BP, EP, USP grade |
GC3201 | Sucrose, GlenBiol?, suitable for molecular biology |
GT7000 | Sudan Black B (C.I. 26150) |
GT5180 | Sudan Blue II (C.I. 61554) |
GT4102 | Sudan I (C.I. 12055) |
GT6523 | Sudan II (C.I. 12140) |
GT4766 | Sudan III (C.I. 26100) |
GT6404 | Sudan IV (C.I. 26105) |
GT0292 | Sudan IV (C.I. 26105); certified |
GT2807 | Sudan Orange G (C.I. 11920) |
GT0394 | Sudan Red 7B |
GT7815 | Sudan Red G (C.I. 12150) |
GP5265 | Sulbactam |
GP3240 | Sulbactam sodium salt |
GA6951 | Sulfacetamide |
GA4107 | Sulfacetamide sodium salt hydrate |
GA3238 | Sulfadiazine |
GA7306 | Sulfadiazine sodium salt |
GA2371 | Sulfadimethoxine |
GP2128 | Sulfadoxine |
GA1541 | Sulfaguanidine |
GA7394 | Sulfameter |
GA4809 | Sulfamethazine |
GA1560 | Sulfamethazine sodium salt |
GA9313 | Sulfamethoxazole |
GW3269 | Sulfamethoxazole hydroxylamine |
GA2831 | Sulfamethoxazole sodium salt |
GK7705 | Sulfamic acid |
GA0781 | Sulfanilamide |
GT3529 | Sulfanilic acid azochromotrop |
GK6835 | Sulfanilic acid, 98%, tech. |
GK1101 | Sulfanilic acid, 99% |
GA4287 | Sulfasalazine |
GP8951 | Sulfathiazole |
GA2698 | Sulfathiazole sodium salt |
GA1382 | Sulfisoxazole |
GW4656 | Sulfluramid |
GW0767 | Sulfo-NHS-LC-Biotin sodium salt |
GK6995 | Sulfobromophthalein disodium salt hydrate |
GP8988 | Sulfobutyl ether beta-cyclodextrin sodium |
GK6395 | Sulfolane |
GT6456 | Sulforhodamine 101 |
GW5912 | Sulforhodamine 101 acid chloride |
GL0048 | Sulforhodamine B sodium salt |
GX3219 | Sulfur Pieces max. 12 mm, 99.999% |
GX6872 | Sulfur Pieces max. 7mm, 99.99% |
GX9658 | Sulfur Powder max. 40 micron, 99+% |
GK4767 | Sulfuric acid |
GC2706 | Sulindac acyl-β-D-glucuronide |
GC1435 | Sulindac sulfide acyl-β-D-glucuronide |
GC3795 | Sulindac sulfone acyl-β-D-glucuronide |
GP7278 | Sulpiride |
GA7670 | Sultamicillin tosylate |
GP2908 | Sumatriptan succinate |
GE1230 | Sunflower lecithin, liquid |
GK2233 | Sunflower seed oil |
GP2160 | Sunitinib malate |
GT7438 | Sunset Yellow FCF |
GP0138 | Suramin sodium salt |
GA4790 | Swainsonine |
GL0219 | Swinholide A |
GK8261 | Syringic acid |
GC0704 | Syringin |
GW6303 | T-2 Toxin |
GL6126 | T0901317 |
GZ9900 | T4 DNA Ligase, expressed in E. coli |
GP1913 | Tacrine |
GP0380 | Tadalafil |
GB0692 | TAE Buffer (Tris-acetate-EDTA) (10X) |
GB8437 | TAE Buffer (Tris-acetate-EDTA) (50X) |
GW1397 | TAE684 |
GC0558 | Tafamidis acyl-β-D-glucuronide |
GW3736 | TAK-285 |
GW3025 | TAK-632 |
GW0519 | TAK-715 |
GW9168 | Takeda-6d |
GW8231 | Talabostat . mesylate |
GK0095 | Talc powder |
GM4942 | TAME Hydrochloride |
GA9513 | Tamoxifen |
GP8512 | Tamoxifen citrate salt |
GP0811 | Tamsulosin hydrochloride |
GP3628 | Tandutinib |
GA2100 | Tangeretin |
GC8015 | Tannic acid |
GP2773 | Tanshinone I |
GP2434 | Tanshinone IIA |
GX0042 | Tantalum boride, 99% |
GX1518 | Tantalum boride, 99+% |
GX9092 | Tantalum Foil 0.025 mm, 99.9+% |
GX6275 | Tantalum Foil 0.05 mm, 99.9% |
GX1606 | Tantalum Foil 0.1 mm, 99.9+% |
GX1920 | Tantalum Foil 0.2 mm, blank, 99.9% |
GX4712 | Tantalum Foil 0.25 mm, 99.9+% |
GX5549 | Tantalum Foil 0.5 mm, 99.9+% |
GX4531 | Tantalum Foil 0.7 mm, 99.9% |
GX7306 | Tantalum Foil 1.0 mm, 99.9+% |
GX3093 | Tantalum Foil 2.0 mm, 99.9% |
GX3404 | Tantalum Nanopowder, 99+ % |
GX7711 | Tantalum nitride, 99.5% |
GX2318 | Tantalum Pellets 5-12 mm diameter, 99.9+% |
GX7742 | Tantalum Pellets 6 x 6 mm, 99.9+% |
GX9648 | Tantalum Powder max. 100 micron, 99.9+% |
GX6010 | Tantalum Rod 10 mm diameter, 99.9+% |
GX9402 | Tantalum Rod 5 mm diameter, 99.9+% |
GX7036 | Tantalum Rod 6 mm diameter, 99.9+% |
GX7894 | Tantalum silicide, 99.5% |
GX2012 | Tantalum Tube 8.0 mm diameter, 0.4 mm wall thickness, 99.9% |
GX1767 | Tantalum Wire 0.1 mm diameter, 99.9+% |
GX1706 | Tantalum Wire 0.25 mm diameter, 99.9+% |
GX8414 | Tantalum Wire 0.5 mm diameter, 99.9+% |
GX1293 | Tantalum Wire 0.8 mm diameter, 99.9+% |
GX0501 | Tantalum Wire 1.0 mm diameter, 99.9+% |
GX5078 | Tantalum Wire 1.5 mm diameter, 99.9+% |
GX6270 | Tantalum Wire 2.0 mm diameter, 99.9+% |
GX5719 | Tantalum Wire 3 mm diameter, 99.9+% |
GX1587 | Tantalum(V) fluoride, 99% |
GX7236 | Tantalum(V) iodide, 99.9% |
GX8872 | Tantalum(V) oxide tablets , 99.95% |
GX9831 | Tantalum(V) oxide, 99.9% |
GX4699 | Tantalum(V) oxide, 99.95% |
GX3730 | Tantalum(V) oxide, 99.99% |
GX8163 | Tantalum(V) oxide, 99% |
GC1337 | Tapentadol O-β-D-glucuronide |
GB2435 | TAPS |
GB0912 | TAPS sodium salt |
GB6970 | TAPSO |
GB1759 | TAPSO sodium salt |
GZ6623 | Taq Polymerase from Thermus aquaticus, expressed in E. coli |
GC1982 | Tarenflurbil acyl-β-D-glucuronide |
GT5596 | Tartrazine (C.I. 19140) |
GE8383 | Tartrazine solution |
GW3874 | TASP0415914 |
GP1188 | Taurine |
GA2906 | Taurolidine |
GL9057 | Taxifolin |
GA7262 | Tazobactam |
GA5074 | Tazobactam sodium salt |
GK1120 | TBB |
GL9905 | TBBz |
GB5666 | TBE Buffer (Tris-Borate-EDTA) |
GB0761 | TBE Buffer (Tris-Borate-EDTA) (10X) |
GB6999 | TBE Buffer (Tris-Borate-EDTA) (5X) |
GE5057 | TBTU |
GE3566 | TCTU |
GL4346 | TDZD-8 |
GK8936 | Tea tree oil |
GP2443 | Tegaserod maleate |
GA8806 | Teicoplanin |
GP5773 | Telaprevir |
GA5905 | Telatinib |
GC4386 | Telbivudine |
GA2425 | Telithromycin |
GX6241 | Telluric acid |
GX5929 | Tellurium Bar, zone refined, 99.9999% |
GX6413 | Tellurium bromide, 99.9% |
GX2288 | Tellurium chloride, 99.9% |
GX6776 | Tellurium chloride, 99% |
GX6960 | Tellurium oxide, 99.999% |
GX1730 | Tellurium Pieces, low oxygen, 99.999% |
GX1402 | Tellurium Pieces, zone refined, 99.9999% |
GX8691 | Tellurium Powder -200 mesh, 99.8+% |
GX3953 | Tellurium Powder -30 mesh, 99.99% |
GX8953 | Tellurium Powder max. 250 micron, 99.999% |
GP9498 | Telmisartan |
GC3131 | Telmisartan acyl-b-D-glucuronide |
GP6174 | Temozolomide |
GK6347 | TEMPO |
GP2668 | Teniposide |
GP5400 | Tenofovir |
GP5075 | Tenoxicam |
GW6294 | TEPP46 [ML-265] |
GA7211 | Terbinafine hydrochloride |
GX2475 | Terbium acetate hydrate, 99.9% |
GX1946 | Terbium carbonate hydrate, 99.9% |
GX8364 | Terbium carbonate hydrate, 99.999% |
GX8078 | Terbium Chips, 99.9% |
GX6357 | Terbium chloride anhydrous, 99.9% |
GX3714 | Terbium chloride hydrate, 99.9% |
GX4407 | Terbium chloride hydrate, 99.99% |
GX2628 | Terbium chloride hydrate, 99.999% |
GX1833 | Terbium fluoride, 99.9% |
GX7865 | Terbium fluoride, 99.999% |
GX3388 | Terbium Foil 0.25mm, 99.9% |
GX1428 | Terbium nitrate hydrate, 99.999% |
GX3640 | Terbium oxide, 99.9% |
GX1359 | Terbium oxide, 99.99% |
GX2041 | Terbium oxide, 99.999% |
GX5472 | Terbium oxide, 99.999% |
GX1231 | Terbium Pieces distilled, 99.99% |
GX6615 | Terbium Pieces, 99.9% |
GX9185 | Terbium Powder, 99.9% |
GX9932 | Terbium Wire 1 mm diameter, 99.9% |
GK1414 | Terephthalaldehyde |
GK1161 | Terephthalic acid |
GK4960 | Terephthaloyl chloride |
GP2305 | Terfenadine |
GD5718 | Tergitol 15-S-9 |
GL9892 | Terpendole C |
GL4961 | Terpendole E |
GW3941 | Terpyridine |
GW0390 | Terreic acid |
GA2739 | Terrein |
GL2491 | Territrem B |
GK8834 | tert-Butyl acetate |
GK7414 | tert-Butyl bromoacetate |
GK9215 | tert-Butyldimethylchlorosilane |
GK1425 | tert-Butylhydroquinone |
GK5635 | tert-Butylmethylether |
GB0507 | TES |
GB4016 | TES sodium salt |
GK4143 | Tetra-n-butylammonium tetrafluoroborate |
GX1758 | Tetraammine platinum(II) chloride hydrate |
GX9386 | Tetraammine platinum(II) chloride solution |
GX0154 | Tetraammine platinum(II) hydroxide solution |
GX8736 | Tetraamminepalladium(II) chloride solution |
GX2028 | Tetraamminepalladium(II) chloride, 99.95% (metals basis) |
GX8052 | Tetraamminepalladium(II) nitrate solution (up to 6% Pd) |
GK6994 | Tetrabutylammonium bromide |
GK2828 | Tetrabutylammonium bromide, 99%, HPLC grade |
GX7906 | Tetrabutylammonium chloride |
GK4271 | Tetrabutylammonium dihydrogen phosphate |
GX3285 | Tetrabutylammonium dihydrogen phosphate, 99% |
GK1300 | Tetrabutylammonium fluoride trihydrate |
GK3008 | Tetrabutylammonium hexafluorophosphate |
GK0881 | Tetrabutylammonium hydrogen sulfate |
GK6528 | Tetrabutylammonium hydroxide 40% solution in water |
GK9010 | Tetrabutylammonium iodide |
GK1156 | Tetrabutylammonium perchlorate |
GL2126 | Tetracaine |
GK4286 | Tetracaine hydrochloride |
GK7505 | Tetrachloro-p-benzoquinone |
GS7939 | Tetrachloroethylene, GlenDry?, anhydrous |
GS6265 | Tetrachloroethylene, GlenPure?, analytical grade |
GW8498 | Tetraconazole |
GA9779 | Tetracycline base |
GA4323 | Tetracycline hydrochloride |
GP3828 | Tetracycline hydrochloride, USP grade |
GL5733 | Tetradecane |
GK9362 | Tetradecyltrimethylammonium chloride |
GK7125 | Tetraethoxysilane |
GE1456 | Tetraethylammonium bromide |
GL7065 | Tetraethylammonium chloride |
GK2619 | Tetraethylene glycol |
GK5408 | Tetraheptylammonium bromide |
GL8351 | Tetrahydrobostrycin |
GK1522 | Tetrahydrofuran |
GK0126 | Tetrahydrofuran, 99.9%, for analysis, unstabilised |
GK8887 | Tetrahydrofuran, anhydrous, 99.9%, unstabilised |
GS6029 | Tetrahydrofuran, GlenDry?, anhydrous |
GS8667 | Tetrahydrofuran, GlenDry?, anhydrous over molecular sieve |
GS2203 | Tetrahydrofuran, GlenDry?, anhydrous stabilised with BHT |
GS8138 | Tetrahydrofuran, GlenPure?, analytical grade |
GS4339 | Tetrahydrofuran, GlenPure?, analytical grade stabilised with BHT |
GS2560 | Tetrahydrofuran, GlenUltra?, analytical grade, for LC |
GP8987 | Tetrahydropalmatine |
GP2626 | Tetrahydrozoline hydrochloride |
GK4550 | Tetrakis(decyl)ammonium bromide |
GX5705 | Tetrakis(hydroxymethyl)phosphonium chloride, 80% solution in water |
GX3048 | Tetrakis(triphenylphosphine)nickel(0) |
GK7755 | Tetramethylammonium bromide |
GK4855 | Tetramethylammonium chloride |
GK3760 | Tetramethylammonium hydrogen sulfate |
GK9701 | Tetramethylammonium hydroxide pentahydrate |
GK9635 | Tetramethylammonium hydroxide, 25% solution |
GT4898 | Tetramethylrhodamine isothiocyanate, mixed isomers |
GT6005 | Tetramethylrhodamine-5-isothiocyanate |
GW5949 | Tetramethylrhodamine-5-maleimide |
GW9016 | Tetramethylrhodamine-6-maleimide |
GY8641 | Tetramethylscutellarein |
GP2274 | Tetrandrine |
GK5496 | Tetranitroblue tetrazolium chloride |
GX0411 | Tetrasodium iminodisuccinate |
GT7170 | Tetrazolium Blue Chloride |
GT6818 | Tetrazolium Violet |
GW4440 | TFMU |
GW7223 | TG-46 |
GW3532 | TG-89 |
GL3452 | TG003 |
GW4786 | TG007 |
GW5257 | TG100115 |
GW9139 | TG101209 |
GW6453 | TG101348 |
GW0793 | TGX-221 |
GL7828 | Thailandolide B |
GX4913 | Thallium Granules 1-5 mm, under water, 99.9% |
GX4995 | Thallium Rod 12.7 x 150 mm, under water, 99.999% |
GX3799 | Thallium Rod 8 x 250 mm, under water, 99.999% |
GX8325 | Thallium(I) bromide |
GX5759 | Thallium(I) bromide, 99.999% |
GX8983 | Thallium(I) carbonate, 99.9% |
GX4588 | Thallium(I) carbonate, 99.99% |
GX9612 | Thallium(I) iodide, 99.99% |
GL5516 | Thapsigargin |
GL5484 | Thaxtomin A |
GA1201 | Thaxtomin C |
GW8778 | Theacrine |
GP6302 | Theophylline |
GX0813 | Thermocouple Wire Tungsten/Rhenium W/Re 97/3-W/Re 75/25 |
GX6501 | Thermocouple Wire Tungsten/Rhenium W/Re 97/3-W/Re 75/25 |
GX3855 | Thermocouple Wire Tungsten/Rhenium W/Re 97/3-W/Re 75/25 |
GX6688 | Thermocouple Wire Type S Platinum/Platinum-Rhodium 90/10 |
GW5364 | Thermorubin |
GL9930 | THI |
GA5810 | Thiabendazole |
GW3835 | Thiamethoxam-d3 |
GP0613 | Thiamine hydrochloride, Ph. Eur. grade |
GP8217 | Thiamine hydrochloride, USP grade |
GV4958 | Thiamine nitrate |
GV8106 | Thiamine pyrophosphate |
GA2455 | Thiamphenicol |
GT7767 | Thiazole Orange |
GT3471 | Thiazole Yellow G (C.I. 19540) |
GC4568 | Thiazolyl blue tetrazolium bromide |
GY0412 | Thidiazuron |
GW8386 | Thifluzamide |
GA6948 | Thimerosal |
GA8923 | Thimerosal, BP, EP, USP grade |
GK1732 | Thioacetamide |
GL9350 | Thiocolchicine |
GK2368 | Thiocolchicoside |
GW6823 | Thioglycine |
GK6903 | Thioglycolic acid |
GA0837 | Thiolutin |
GT7720 | Thionin acetate salt |
GK2382 | Thiophene-2-acetic acid |
GK9180 | Thiophene-2-carboxaldehyde |
GK2721 | Thiosemicarbazide |
GA3924 | Thiostrepton |
GE8159 | Thiourea |
GK5170 | Thioxanthen-9-one |
GL2255 | Thonzonium bromide |
GX0006 | Thulium acetate hydrate, 99.9% |
GX7207 | Thulium Chips, 99.9% |
GX6540 | Thulium chloride anhydrous, 99.9% |
GX6481 | Thulium chloride hydrate, 99.9% |
GX8622 | Thulium fluoride, 99.9% |
GX2524 | Thulium fluoride, 99.999% |
GX2441 | Thulium fluoride, 99.9999% |
GX7320 | Thulium hydroxide hydrate, 99.999% |
GX6098 | Thulium nitrate hydrate, 99.9% |
GX8413 | Thulium oxide, 99.9% |
GX1460 | Thulium oxide, 99.99% |
GX9780 | Thulium oxide, 99.999% |
GX6402 | Thulium oxide, 99.9999% |
GX5218 | Thulium Pieces distilled, 99.99% |
GX1096 | Thulium Pieces, 99.9% |
GX0105 | Thulium sulfate hydrate, 99.9% |
GX0279 | Thulium sulfate hydrate, 99.999% |
GX1273 | Thulium sulfide, 99.9% |
GX5248 | Thulium(III) iodide, 99.9% |
GE6597 | Thymidine |
GE0125 | Thymidine 5''-monophosphate disodium salt hydrate |
GE5340 | Thymine |
GT9699 | Thymol |
GT9755 | Thymol Blue |
GT4225 | Thymol blue sodium salt |
GT6465 | Thymol iodide |
GT1470 | Thymolphthalein |
GT9118 | Thymolphthalein, 95%, ACS grade |
GT5953 | Thymoquinone |
GW3846 | Tiadinil |
GA3707 | Tiamulin fumarate |
GP8667 | Tianeptine sodium salt hydrate |
GP9951 | Tiaprofenic acid |
GA1874 | Ticarcillin disodium salt |
GK6202 | Tigecycline hydrate |
GP6895 | Tilmicosin |
GP7307 | Timolol maleate salt |
GX5578 | Tin Bar, 99.999% |
GX2377 | Tin Foil 0.125 mm, 99.99+% |
GX5573 | Tin Foil 0.25 mm, 99.99% |
GX6032 | Tin Foil 0.5 mm, 99.8% |
GX3833 | Tin Foil 0.5 mm, 99.99% |
GX2676 | Tin Foil 1.0 mm, 99.99% |
GX0036 | Tin Granules 2-4 mm, 99.99% |
GX7775 | Tin Granules 2-4 mm, 99.999% |
GX3171 | Tin Granules 3 mm, 99.9999% |
GX7490 | Tin nanopowder, 99.9% [APS LT 100nm] |
GX5876 | Tin Pellets 6 x 6 mm, 99.95% |
GX2142 | Tin Powder -100 mesh, 99.995% |
GX1969 | Tin Powder max. 100 micron, 99+% |
GX7812 | Tin Rod 11 mm diameter, 99.999% |
GX6451 | Tin Rod 6 mm diameter, 99.999% |
GX3375 | Tin Rod 8 mm diameter, 99.999% |
GX4056 | Tin Wire 1.0 mm diameter, 99.9+% |
GX7531 | Tin Wire 1.0 mm diameter, 99.999% |
GX1685 | Tin Wire 2.0 mm diameter, 99.9+% |
GX3444 | Tin Wire 2.0 mm diameter, 99.999% |
GX5603 | Tin(II) 2-ethylhexanoate |
GX2073 | Tin(II) bromide, 99% |
GX9341 | Tin(II) chloride dihydrate |
GX2712 | Tin(II) chloride, anhydrous, 97.0% |
GX3976 | Tin(II) chloride, dihydrate, 98+%, ACS |
GX8135 | Tin(II) ethoxide, 99% |
GX5593 | Tin(II) oxide, 99.9% |
GX2583 | Tin(II) selenide, 99.999% |
GX2830 | Tin(II) sulfate, 96% |
GX9560 | Tin(II) telluride, 99.999% |
GX1651 | Tin(IV) chloride, anhydrous, 99.99% |
GX4247 | Tin(IV) chloride, pentahydrate, 98% |
GX8443 | Tin(IV) oxide Nanopowder, 99.5% |
GX4773 | Tin(IV) oxide Nanopowder, 99.9 % |
GX7439 | Tin(IV) oxide, 99.0% |
GX8913 | Tin(IV) oxide, 99.999% |
GX8128 | Tin(IV) t-butoxide, 99.9% |
GA9668 | Tinidazole |
GA0099 | Tioconazole |
GP5627 | Tiotropium bromide monohydrate |
GP2595 | Tirofiban |
GK6289 | Tiron monohydrate |
GX2370 | Titanium (diisopropoxide) bis (2,4-pentanedionate); 75% in isopropanol |
GX2412 | Titanium Aluminium Vanadium Ti-6Al-4V Powder sperical 75-125 micron |
GX0348 | Titanium Aluminium Vanadium Ti-6Al-4V Powder spherical 45-75 micron, Grade 5 |
GX7735 | Titanium boride |
GX0703 | Titanium dioxide |
GX1193 | Titanium dioxide, 99%, Ph. Eur., BP, USP grade |
GX4446 | Titanium Foil 0.05 mm, 99.6% |
GX2622 | Titanium Foil 0.1 mm, 99.6% |
GX9127 | Titanium Foil 0.125 mm, 99.6% |
GX3290 | Titanium Foil 0.25 mm, 99.6% |
GX1848 | Titanium Foil 0.5 mm, 99.6% |
GX2025 | Titanium Granules ≤ 4 mm, 99.8+% |
GX7622 | Titanium Granules max. 6 mm, 99.8% |
GX3635 | Titanium Nanopowder, 99,9 % |
GX6013 | Titanium nitride, 99% |
GX7199 | Titanium oxide Nanopowder, anatase, 99,5% |
GX3990 | Titanium oxide Nanopowder, rutile, 99,5 % |
GX4909 | Titanium oxide Nanopowder, rutile, 99% [APS 200nm, spherical] |
GX9270 | Titanium oxide Nanopowder, rutile, coated with SiO2, 99 % |
GX2634 | Titanium Pellets 6 x 6 mm, 99.8% |
GX6677 | Titanium Pellets 6 x 6 mm, 99.99% |
GX0119 | Titanium Pieces 2-5mm, 99.995% |
GX4353 | Titanium Powder max. 30 micron, under water, 95+% |
GX5904 | Titanium Powder spherical 125-250 micron, 99.8% |
GX3946 | Titanium Powder spherical 125-250 micron, Grade 1 |
GX7105 | Titanium Powder spherical 45-75 micron, 99.8% |
GX9053 | Titanium Powder spherical 75-125 micron, 99.8% |
GX7318 | Titanium Rod 10.0 mm diameter, 99.7% |
GX4949 | Titanium Rod 15.0 mm diameter, 99.7% |
GX7226 | Titanium Rod 2 mm diameter, 99.6% |
GX9536 | Titanium Rod 3 mm diameter, 99.7% |
GX8130 | Titanium Rod 3 mm diameter, 99.995% |
GX7798 | Titanium Rod 30.0 mm diameter, 99.7% |
GX4343 | Titanium Rod 5 mm diameter, 99.6% |
GX9869 | Titanium Rod 6.35 mm diameter, 99.99+% |
GX9462 | Titanium Rod 8 mm diameter, 99.6% |
GX8460 | Titanium Sheet 1.0mm, 99.6% |
GX4809 | Titanium silicide, 99% |
GX2325 | Titanium Slugs ~5 x 10-12 mm, 99.6% |
GX9535 | Titanium Wire 0.125 mm diameter, 99.6% |
GX4071 | Titanium Wire 0.25 mm diameter, 99.6% |
GX8854 | Titanium Wire 0.5 mm diameter, 99.8% |
GX5183 | Titanium Wire 0.8 mm diameter, 99.8% |
GX1280 | Titanium Wire 1.0 mm diameter, 99.8% |
GX7043 | Titanium(II) oxide, 99.5% |
GX9461 | Titanium(II) oxide, 99.9% |
GX6140 | Titanium(III,IV) oxide, 99.5+% |
GX0376 | Titanium(III) nitride Nanopowder, 97 % |
GX9511 | Titanium(III) oxide |
GX5251 | Titanium(III) oxide, 99.8% |
GX0735 | Titanium(IV) carbide Nanopowder, 99 % |
GX6027 | Titanium(IV) carbide Nanopowder, 99% [APS ~40nm, SSA NLT 50m2/g] |
GX6194 | Titanium(IV) carbide, 99% |
GX0530 | Titanium(IV) chloride-2-tetrahydrofuran |
GX6644 | Titanium(IV) ethoxide |
GX5233 | Titanium(IV) isopropoxide |
GX0421 | Titanium(IV) isopropoxide, 99.99% |
GX2925 | Titanium(IV) n-butoxide, 99% |
GX9404 | Titanium(IV) n-propoxide |
GX3163 | Titanium(IV) oxide Powder 220 nm, 95% |
GX6311 | Titanium(IV) oxide-Nano Powder (anatase); 99.9% |
GX6844 | Titanium(IV) oxide, 99.5% |
GX0305 | Titanium(IV) oxide, 99.9% |
GX9179 | Titanium(IV) oxide, 99.998% |
GX7581 | Titanium(IV) oxide, 99.999% |
GX3109 | Titanium(IV) t-butoxide, 99.99% |
GP9162 | Tivozanib |
GN3044 | TNP-ATP triethylammonium salt, 10mM in water |
GA9878 | Tobramycin |
GA2734 | Tobramycin sulphate |
GL2205 | Tocainide hydrochloride |
GL6289 | TOFA |
GW7684 | Tofacitinib |
GX6522 | Tofacitinib citrate |
GP6227 | Tolazamide |
GC7310 | Tolcapone 3-O-β-D-glucuronide |
GX9655 | Tolfenpyrad |
GC1469 | Tolmetin acyl-β-D-glucuronide |
GA6091 | Tolnaftate |
GP4157 | Tolperisone hydrochloride |
GP3410 | Tolterodine tartrate |
GA3944 | Toltrazuril |
GK6186 | Toluene |
GK9090 | Toluene, anhydrous, 99.9% |
GS5970 | Toluene, GlenDry?, anhydrous |
GS7641 | Toluene, GlenDry?, anhydrous over molecular sieve |
GS4701 | Toluene, GlenPure?, analytical grade |
GS8845 | Toluene, GlenUltra?, analytical grade, for GC |
GT7960 | Toluidine Blue (C.I. 50240) |
GT2793 | Toluidine Blue (C.I. 50240); 1% aqueous solution |
GP0580 | Tonabersat |
GC1245 | Topiramate |
GP8771 | Topotecan hydrochloride |
GP8497 | Toremifene citrate |
GA5035 | Torezolid |
GA2012 | Tosufloxacin tosylate hydrate |
GW0305 | Tozasertib |
GL8927 | TPh A |
GC2746 | Tragacanth |
GW3071 | Tralomethrin |
GP2302 | Trametinib |
GP8888 | Trandolapril |
GK5699 | Tranexamic acid |
GP8731 | Tranilast |
GT3354 | trans-1,2-Diaminocyclohexane-N,N,N'',N''-tetraacetic acid monohydrate |
GT2391 | trans-1,2-Diaminocyclohexane-N,N,N'',N''-tetraacetic acid monohydrate, ACS grade |
GW0162 | trans-1,3-Diphenyl-2-propen-1-ol |
GW1492 | trans-11-Methyl-2-dodecenoic acid |
GW0507 | trans-2-Decenoic acid |
GK7230 | trans-2-Hexenal |
GK3750 | trans-2,3-Dimethylacrylic acid |
GK2300 | trans-4-Hydroxy-3-methoxycinnamic acid |
GM7180 | trans-4-Hydroxy-L-proline |
GM0902 | trans-4-Hydroxy-L-proline, GlenCell?, suitable for cell culture |
GX9122 | trans-4,5-Dihydroxy-1,2-dithiane |
GL7895 | trans-Anethole |
GK4115 | trans-Cinnamic acid |
GX1443 | trans-Dichlorodiamine platinum(II); 99.95% (metals basis) |
GK1850 | trans-Indole-3-acrylic acid |
GC7269 | trans-Resveratrol 3-O-β-D-glucuronide |
GC5367 | trans-Resveratrol 3,5-diacetate |
GC2654 | trans-Resveratrol 4''-O-β-D-glucuronide |
GY6386 | trans-Zeatin |
GL5267 | trans-Zeatin-riboside |
GK8553 | trans,trans-2,4-Hexadien-1-ol |
GP1446 | Trapidil |
GP8388 | Trazodone hydrochloride |
GC8339 | Tri-O-acetyl-D-glucal |
GK2569 | tri-Potassium citrate monohydrate |
GX3054 | tri-Potassium citrate monohydrate, Ph. Eur. grade |
GE6940 | Triacetin |
GL6713 | Triacetyl resveratrol |
GP2518 | Triamcinolone |
GP6845 | Triamcinolone acetonide |
GW4190 | Triazamate |
GW3625 | Triaziflam |
GW0942 | Tribenuron methylester |
GX4926 | Tributyl phosphate, 99% |
GK2312 | Tributylamine |
GX5903 | Tributylhexadecylphosphonium bromide |
GE5936 | Tricaine methanesulfonate |
GL0754 | Tricaprylylmethylammonium chloride |
GK7416 | Trichloroacetic acid |
GP8006 | Trichostatin A |
GT6676 | Trichrome Stain (Aniline Blue) solution |
GT4469 | Trichrome Stain (Light Green) solution |
GB8987 | Tricine |
GB5131 | Tricine, 99% |
GP3360 | Triclabendazole |
GA5716 | Triclosan |
GX7553 | Tricyclohexylphosphine |
GE0563 | Triethanolamine |
GB3570 | Triethanolamine buffer solution, with EDTA and sodium azide |
GX1854 | Triethyl citrate |
GK5301 | Triethyl orthoformate |
GK7255 | Triethylamine |
GK0316 | Triethylamine hydrochloride |
GS8310 | Triethylamine, GlenDry?, anhydrous |
GS4732 | Triethylamine, GlenDry?, anhydrous over molecular sieve |
GB3614 | Triethylammonium acetate buffer, 1M solution in water |
GK6592 | Triethylene glycol monooctyl ether |
GX6817 | Triethylsilane |
GX5753 | Triethyltin bromide |
GX5707 | Trifloxystrobin |
GL5164 | Trifluoperazine dihydrochloride |
GK6959 | Trifluoroacetic acid |
GK2000 | Trifluoroacetic acid, Ultrapure for synthesis |
GL9311 | Trifluoromethanesulfonamide |
GC7093 | Trifluoromethanesulfonic acid |
GK4778 | Trifluoromethanesulfonic anhydride |
GE1913 | Trifluridine |
GK5203 | Trigonelline hydrochloride |
GP8355 | Trilostane |
GA3656 | Trimethoprim |
GA5588 | Trimethoprim lactate salt |
GW9332 | Trimethoprim sulfate |
GK1848 | Trimethyl orthoacetate |
GK5763 | Trimethylamine-N-oxide dihydrate |
GX1287 | Trimethyltin chloride |
GE8419 | Trioctylmethylammonium chloride |
GX0729 | Trioctylphosphine oxide |
GX0766 | Triphenylantimony, 98% |
GX2207 | Triphenyllead acetate |
GK1326 | Triphenylphosphine |
GX7580 | Triphenylphosphine gold (I) chloride, 99.95% (metals basis) |
GK3762 | Triphenylphosphine hydrobromide |
GK8650 | Triphenylphosphine oxide |
GX6810 | Triphenyltin chloride |
GL7060 | Tripolin A |
GL9093 | Tripolin B |
GP2934 | Triptolide |
GP7166 | TRIS |
GX7765 | Tris (triphenylphosphine)ruthenium(II) chloride, 99.95% (metals basis) |
GB8936 | TRIS acetate |
GB8580 | Tris Acetate-EDTA buffer solution |
GB9261 | Tris Acetate-EDTA buffer, 10X solution |
GB4755 | Tris Acetate-EDTA buffer, 50X solution |
GB3555 | TRIS Buffered Saline (TBS); 10X solution |
GB4431 | TRIS hydrochloride |
GB1923 | TRIS Ultrapure, 99.9%, Ph. Eur. grade |
GE1860 | Tris-(2-carboxyethyl)phosphine hydrochloride |
GX7489 | Tris-EDTA buffer solution (10X, suitable for molecular biology, pH 8.0) |
GX8166 | Tris-EDTA buffer solution (1X, pH 8.0) |
GB5857 | Tris-EDTA buffer, 100X solution |
GE4461 | TRIS-Glycine Buffer 10X |
GE6710 | TRIS-Glycine Buffer 10X, GlenBiol?, suitable for molecular biology |
GE2706 | TRIS-Glycine-SDS Buffer 10X |
GE9118 | TRIS-Glycine-SDS Buffer 10X, GlenBiol?, suitable for molecular biology |
GB0181 | TRIS-Tricine-SDS running buffer, 10X solution |
GP9311 | Tris(hydroxymethyl)aminomethane |
GX2604 | Tris(triphenylphosphine)rhodium(I) chloride, 99.95% (metals basis) |
GX1218 | Tris[(1-benzyl-1H-1,2,3-triazol-4-yl)methyl]amine |
GW0051 | Tris[3,5-bis(trifluoromethyl)phenyl]phosphine |
GX8017 | Tris[tris(3,5-bis(trifluoromethyl)phenyl)phosphine]palladium(0) (Superstable Pd(0) catalyst) |
GP8940 | Troglitazone |
GT7534 | Tropaeolin O (C.I. 14270) |
GT4399 | Tropaeolin OO |
GP3255 | Tropicamide |
GA4312 | Tropodithietic acid |
GE7945 | Tropolone |
GL4062 | Trypacidin |
GT3970 | Trypan Blue (C.I. 23850) |
GT0822 | Trypan Blue (C.I. 23850); 0.4% solution |
GE3976 | Trypsin |
GE5012 | Trypsin, bovine origin |
GP9154 | Tryptamine |
GE6771 | Tryptone (Casein hydrolysate, enzymatic digest) |
GW9504 | Tubastatin A |
GA3247 | Tulathromycin A |
GX2208 | Tungsten boride, 99.5% |
GX6015 | Tungsten boride, 99.5% |
GX2331 | Tungsten boride, 99+% |
GX5611 | Tungsten carbide |
GX3926 | Tungsten Foil 0.025 mm, 99.95% |
GX0695 | Tungsten Foil 0.05 mm, 99.9+% |
GX7233 | Tungsten Foil 0.1 mm, 99.96% |
GX3609 | Tungsten Foil 0.15 mm, 99.96% |
GX6917 | Tungsten Foil 0.2 mm, 99.96% |
GX9553 | Tungsten Foil 0.5 mm, 99.96% |
GX0404 | Tungsten Foil 0.7 mm, 99.96% |
GX0201 | Tungsten Foil 1.0 mm, 99.96% |
GX1242 | Tungsten Foil 2.0 mm, 99.96% |
GX2321 | Tungsten Granules 0.5-2 mm, 99.7% |
GX8256 | Tungsten Nanopowder, 99,9 % |
GX8914 | Tungsten nanopowder, 99.0% |
GX8345 | Tungsten Pellets 6.35 x 6.35 mm, 99.97% |
GX8906 | Tungsten Powder 2.8 micron, 99.95% |
GX3247 | Tungsten Powder 5 micron (Mo 1 ppm); 99.999% |
GX4644 | Tungsten Powder max. 10 micron (Mo 5 ppm); 99.99+% |
GX8566 | Tungsten Rod 1 mm, 99.95+% |
GX0975 | Tungsten Rod 1.2 mm, 99.95+% |
GX3271 | Tungsten Rod 10 mm diameter, 99.95+% |
GX9070 | Tungsten Rod 12 mm diameter, 99.95+% |
GX8106 | Tungsten Rod 15 mm diameter, 99.95+% |
GX5842 | Tungsten Rod 2 mm, 99.95+% |
GX1135 | Tungsten Rod 2.5 mm, 99.95+% |
GX5958 | Tungsten Rod 20 mm diameter, 99.95+% |
GX1465 | Tungsten Rod 3.0 mm diameter, 99.95+% |
GX0030 | Tungsten Rod 4.0 mm diameter, 99.95+% |
GX3169 | Tungsten Rod 5.0 mm diameter, 99.95+% |
GX3278 | Tungsten Rod 8.0 mm diameter, 99.95+% |
GX9862 | Tungsten silicide, 99% |
GX4566 | Tungsten sulfide, 99.8% |
GX9233 | Tungsten Wire 0.01 mm diameter, 99.9+% |
GX4882 | Tungsten Wire 0.1 mm diameter, 99.95+% |
GX6303 | Tungsten Wire 0.15 mm diameter, 99.9% |
GX3564 | Tungsten Wire 0.2 mm diameter, 99.95+% |
GX2906 | Tungsten Wire 0.25 mm diameter, 99.95+% |
GX2248 | Tungsten Wire 0.3 mm diameter, 99.95+% |
GX6591 | Tungsten Wire 0.4 mm diameter, 99.95+% |
GX4458 | Tungsten Wire 0.5 mm diameter, 99.95+% |
GX2815 | Tungsten Wire 0.7 mm diameter, 99.95+% |
GX0753 | Tungsten Wire 1.0 mm diameter, 99.95+% |
GX5029 | Tungsten Wire 1.4 mm diameter, 99.95+% |
GX0156 | Tungsten Wire 2.0 mm diameter, 99.95+% |
GX8863 | Tungsten(IV) carbide, 99,95 % |
GX7776 | Tungsten(IV) disulfide Nanopowder, 99 % |
GX9957 | Tungsten(IV) oxide, 99.5% |
GX7903 | Tungsten(VI) oxide-Nano Powder, 99+% |
GX6170 | Tungsten(VI) oxide, 99.9% |
GX1091 | Tungsten(VI) oxide, 99.9% |
GX9024 | Tungsten(VI) oxide, 99.99% |
GX6962 | Tungsten(VI) oxide, 99.995% |
GX0912 | Tungsten(VI) oxide, 99+% |
GX7349 | Tungstic acid, 99+% |
GD9856 | Tween 20 |
GE1584 | Tween 20, BP, Ph. Eur., USP/NF grade |
GD3405 | Tween 40 |
GL6809 | Tween 60 |
GL3891 | Tween 60, BP, Ph. Eur., USP/NF grade |
GD5948 | Tween 80 |
GD6218 | Tween 80, 10% solution in water |
GA0812 | Tylosin |
GA6954 | Tylosin phosphate |
GA2429 | Tylosin tartrate |
GL3025 | Tyloxapol, USP grade |
GE1766 | Tyramine |
GE5178 | Tyramine hydrochloride |
GZ6771 | Tyrosinase, from mushroom |
GW6423 | UBS109 |
GC8551 | UDP-a-D-galactose disodium salt |
GL9453 | UK-1 |
GL1279 | UK-5099 |
GW2505 | Ulipristal acetate |
GE8775 | Umbelliferone |
GL5507 | Umbellulone |
GW1024 | Umifenovir hydrochloride |
GK3588 | Undecane |
GC9189 | Undecyl b-D-glucopyranoside |
GL3897 | Undecylprodigiosin |
GK0306 | Uracil |
GZ6540 | Uracil DNA Glycosylase Modified, from E. coli |
GE5342 | Uracil-beta-D-arabinofuranoside |
GE9705 | Uracil, 99%, Ultrapure |
GP1109 | Urapidil hydrochloride |
GE3329 | Urea |
GE2507 | Urea, 8M solution |
GE1210 | Urea, suitable for molecular biology |
GE8815 | Urethane |
GK0117 | Uric acid sodium salt |
GP7250 | Uridine |
GC9934 | Uridine 5''-diphosphate disodium salt |
GL9970 | Uridine 5''-monophosphate |
GE7138 | Uridine 5''-monophosphate disodium salt |
GE8880 | Uridine 5''-triphosphate trisodium salt hydrate |
GW3144 | URMC-099 |
GP1000 | Ursodeoxycholic acid |
GE7225 | Ursolic acid |
GA5888 | Usnic acid |
GP4343 | Vadimezan |
GP1612 | Valaciclovir hydrochloride |
GP8320 | Valdecoxib |
GK2938 | Valeric acid |
GK6340 | Valerophenone |
GA4672 | Validamycin A |
GA5799 | Valinomycin |
GC0999 | Valproic acid b-D-glucuronide |
GP7911 | Valrubicin |
GP3294 | Valsartan |
GP8514 | Valsartan, USP grade |
GX3187 | Vanadium boride |
GX1692 | Vanadium boride, 99% |
GX7849 | Vanadium carbide |
GX7155 | Vanadium Foil 0.05 mm, 99.7% |
GX3817 | Vanadium Foil 0.1mm, 99.9% |
GX7019 | Vanadium Foil 0.2mm, 99.9% |
GX3211 | Vanadium Foil 0.3 mm, 99.9% |
GX7305 | Vanadium Foil 0.5 mm, 99.9% |
GX0644 | Vanadium Foil 1.0 mm, 99.9% |
GX8141 | Vanadium nitride, 99.5% |
GX9091 | Vanadium Pellets 6 x 6.35 mm, 99.9% |
GX5702 | Vanadium Powder -200 mesh, 99.5+% |
GX4789 | Vanadium Rod 10 mm diameter, 99.9% |
GX2688 | Vanadium Rod 12 mm diameter, 99.9% |
GX9210 | Vanadium Rod 5 mm diameter, 99.9% |
GX6444 | Vanadium Rod 6 mm diameter, 99.9% |
GX6500 | Vanadium silicide |
GX8226 | Vanadium Turnings, 99.7% |
GX8439 | Vanadium Wire 1.0 mm diameter, 99.8% annealed |
GX1566 | Vanadium Wire 2.0 mm diameter, 99.9% |
GX7607 | Vanadium(III) oxide, 99.9% |
GX7946 | Vanadium(III) oxide, 99.99+% |
GX5007 | Vanadium(IV) oxide sulfate hydrate |
GX8438 | Vanadium(IV) oxide sulfate hydrate, 99.99+% |
GX4523 | Vanadium(IV) oxide, 98+% |
GX1438 | Vanadium(IV) oxide, 99.5% |
GX7477 | Vanadium(V) oxide isopropoxide, 99.9% |
GX4031 | Vanadium(V) oxide trichloride, 99% |
GX1959 | Vanadium(V) oxide, 98+% |
GX7781 | Vanadium(V) oxide, 99.9% |
GX7627 | Vanadium(V) oxide, 99.99% |
GA6284 | Vancomycin hydrochloride |
GP1439 | Vandetanib |
GK9155 | Vanillic acid |
GP6341 | Vanillin |
GC3471 | Varenicline carbamoyl b-D-glucuronide |
GP9070 | Vecuronium bromide |
GA9355 | Venturicidin A |
GP4575 | Verapamil hydrochloride |
GL4143 | Veratridine |
GC8855 | Verbascoside |
GL5203 | Verruculogen |
GT0164 | Victoria Pure Blue BO (C.I. 42595) |
GP8547 | Vigabatrin |
GP4588 | Vildagliptin |
GC5074 | Vildagliptin O-β-D-glucuronide |
GA7194 | Vinblastine sulfate |
GP3407 | Vincamine |
GA1776 | Vincristine sulfate |
GP8222 | Vindoline |
GP5205 | Vinorelbine ditartrate |
GP3347 | Vinpocetine |
GA3764 | Virginiamycin M |
GA7111 | Virginiamycin S1 |
GW3857 | Viridicatumtoxin |
GL6994 | Viridiol |
GA7777 | Virustomycin A |
GV2742 | Vitamin A acetate |
GE2859 | Vitamin B12 |
GV3321 | Vitamin B12, pyrogen free |
GV6132 | Vitamin D2 |
GV6134 | Vitamin D2, USP grade |
GK3575 | Vitamin E, liquid |
GV4612 | Vitamin K1 |
GV6200 | Vitamin K2 |
GV3614 | Vitamin K3 |
GC5761 | Vitexin |
GA6306 | Voriconazole |
GP5178 | Vorinostat |
GW0993 | VR23 [Proteasome Inhibitor] |
GW0199 | VTX-27 |
GW1373 | VX-702 |
GW2962 | VX-745 |
GL9804 | W-5 hydrochloride |
GW9714 | W493 B |
GP6872 | Warfarin sodium salt |
GK0904 | Water, BP, Ph. Eur. grade, sterile |
GK8002 | Water, distilled |
GK8512 | Water, distilled, GlenBiol?, suitable for molecular biology |
GK3940 | Water, GlenCell?, suitable for cell culture |
GS3420 | Water, GlenPure?, analytical grade |
GS9307 | Water, GlenUltra?, analytical grade, for LC |
GL6617 | Wedelolactone |
GT2669 | Weigert’s iron haematoxylin solution A |
GT5732 | Weigert’s iron haematoxylin solution B |
GL2455 | White Line Inducing Principle |
GY6190 | Withaferin A |
GP7400 | Wogonin |
GE4316 | Wortmannin |
GT7819 | Wright's stain |
GW5858 | WSP1 |
GL2940 | WY-14643 |
GW8255 | WZB117 |
GP1801 | Xamoterol hemifumarate |
GC4475 | Xanthan gum |
GK1029 | Xanthine |
GK7942 | Xanthine sodium salt |
GY0767 | Xanthohumol |
GL7316 | Xanthomegnin |
GK2391 | Xanthophyll |
GL7340 | Xanthorrhizol |
GN2077 | Xanthosine 5''-monophosphate disodium salt |
GP5578 | Xanthotoxin |
GW2238 | XD14 |
GW6307 | XL019 |
GW8661 | XL388 |
GW5078 | XL765 |
GC5281 | XTT sodium salt |
GC4689 | Xylan |
GL1298 | Xylazine hydrochloride |
GT4153 | Xylene Cyanol FF (C.I. 42135) |
GS2860 | Xylene mixed isomers, GlenDry?, anhydrous |
GS3017 | Xylene mixed isomers, GlenDry?, anhydrous over molecular sieve |
GS4352 | Xylene mixed isomers, GlenPure?, analytical grade |
GK8919 | Xylene, mixture of isomers |
GT7988 | Xylenol Blue |
GT8065 | Xylenol Orange tetrasodium salt |
GT1513 | Xylidine Ponceau 2R (C.l. 16150) |
GT4376 | Xylidyl blue I sodium salt |
GC3694 | Xylitol |
GK8578 | Y-27632 dihydrochloride |
GK7558 | YC-1 |
GE4420 | Yeast extract, powder |
GW7605 | YM201636 hydrochloride |
GP3367 | Yohimbine hydrochloride |
GX6016 | Ytterbium acetate hydrate, 99.9% |
GX0496 | Ytterbium acetate hydrate, 99.999% |
GX9318 | Ytterbium carbonate hydrate, 99.999% |
GX0566 | Ytterbium Chips, 99.9% |
GX0939 | Ytterbium chloride hydrate, 99.9% |
GX4544 | Ytterbium chloride hydrate, 99.99% |
GX5550 | Ytterbium chloride hydrate, 99.999% |
GX0983 | Ytterbium chloride, anhydrous, 99.9% |
GX0640 | Ytterbium D-3-trifluoroacetylcamphorate, 99% |
GX0009 | Ytterbium fluoride, 99.99% |
GX3495 | Ytterbium fluoride, anhydrous, 99.9% |
GX0255 | Ytterbium fluoride, anhydrous, 99.99% |
GX0552 | Ytterbium Foil 0.25mm, 99.9% |
GX0032 | Ytterbium Foil 0.5mm, 99.9% |
GX2918 | Ytterbium hydroxide hydrate |
GX6920 | Ytterbium nitrate hydrate, 99.9% |
GX9000 | Ytterbium nitrate hydrate, 99.99% |
GX6984 | Ytterbium nitrate hydrate, 99.999% |
GX0481 | Ytterbium oxide, 99.9% |
GX9006 | Ytterbium oxide, 99.99% |
GX1114 | Ytterbium oxide, 99.999% |
GX5403 | Ytterbium oxide, 99.9999% |
GX5815 | Ytterbium oxide, 99.9999% |
GX2266 | Ytterbium Pieces distilled, 99.99% |
GX9797 | Ytterbium Pieces, 99.9% |
GX5748 | Ytterbium Powder, 99.9% |
GX9935 | Ytterbium sulfate hydrate, 99.9% |
GX1576 | Ytterbium sulfate hydrate, 99.999% |
GX6211 | Ytterbium Wire 1 mm diameter, 99.9% |
GK2615 | Ytterbium(lll) chloride hexahydrate |
GX6589 | Yttrium acetate hydrate, 99.9% |
GX4609 | Yttrium acetate hydrate, 99.999% |
GX1971 | Yttrium aluminium oxide, 99.9% |
GX5260 | Yttrium aluminium oxide, 99.99% |
GX4857 | Yttrium carbonate hydrate, 99.9% |
GX9109 | Yttrium carbonate hydrate, 99.99% |
GX2433 | Yttrium carbonate hydrate, 99.998% |
GX3456 | Yttrium Chips, 99.9% |
GX8247 | Yttrium chloride hexahydrate, 99.9% |
GX0202 | Yttrium chloride hexahydrate, 99.99% |
GX5098 | Yttrium chloride hexahydrate, 99.999% |
GX6849 | Yttrium chloride, anhydrous, 99.9% |
GX7829 | Yttrium fluoride, anhydrous, 99.9% |
GX1508 | Yttrium fluoride, anhydrous, 99.99% |
GX9715 | Yttrium fluoride, anhydrous, 99.99% |
GX3907 | Yttrium fluoride, anhydrous, 99.999% |
GX2774 | Yttrium Foil 0.25mm, 99.9% |
GX0563 | Yttrium Foil 0.5mm, 99.9% |
GX5764 | Yttrium Foil 1.0mm, 99.9% |
GX4069 | Yttrium hydroxide hydrate, 99.99% |
GX1144 | Yttrium iodide, anhydrous, 99.9% |
GX3740 | Yttrium nitrate hydrate, 99.9% |
GX4485 | Yttrium nitrate hydrate, 99.99% |
GX7552 | Yttrium nitrate hydrate, 99.999% |
GX6018 | Yttrium oxalate hydrate, 99.9% |
GX7755 | Yttrium oxalate hydrate, 99.99% |
GX6058 | Yttrium oxalate hydrate, 99.999% |
GX3179 | Yttrium oxide-Nano Powder, 99.9% |
GX7540 | Yttrium oxide-Nano Powder, 99.99+% |
GX7139 | Yttrium oxide, 99.9% |
GX3134 | Yttrium oxide, 99.9% |
GX7314 | Yttrium oxide, 99.99% |
GX5044 | Yttrium oxide, 99.999% |
GX8334 | Yttrium oxide, 99.9999% |
GX9982 | Yttrium oxide, 99.9999% |
GX0115 | Yttrium pieces, 99.9% |
GX3320 | Yttrium Powder -200 mesh, 99.9% |
GX6165 | Yttrium Rod 12.5 mm diameter, 99.9% |
GX2029 | Yttrium Rod 6.35 mm diameter, 99.9% |
GX7301 | Yttrium sulfate hydrate, 99.9% |
GX6907 | Yttrium sulfate hydrate, 99.999% |
GX0023 | Yttrium Wire 1 mm diameter, 99.9% |
GX6160 | Yttrium-Barium-Copper-Oxide YBCO123 |
GX6459 | Yttrium-thd, 99.9% |
GX8397 | Yttrium(III) oxide Nanopowder, 99,95 % |
GM1130 | Z-beta-Ala-OH |
GM4955 | Z-D-Arg-OH |
GM2905 | Z-D-Glu-OBzl |
GL8968 | Z-Leu-Arg-Gly-Gly-AMC |
GL6936 | Z-Leu-Leu-Glu-AMC |
GK3641 | Z-Leu-Leu-Leu-al |
GL3117 | Z-Leu-Leu-Leu-AMC |
GL0498 | Z-Leu-Leu-Leu-B(OH)2 |
GK6034 | Z-Leu-Leu-Norvalinal |
GL3344 | Z-Leu-Leu-Phe-CHO |
GM1281 | Z-Orn-OH |
GW1865 | Z-Phe-Arg-AFC |
GM8963 | Z-Pyr-OH |
GM0046 | Z-Tyr(tBu)-OH dicyclohexylammonium salt |
GL1523 | Z-VAD-FMK, cell permeable |
GW5750 | Z-Val-Leu-Arg-AMC |
GL3755 | Z-VRPR-FMK |
GP6218 | Zafirlukast |
GC5399 | Zanamivir hydrate |
GK8444 | Zearalenone |
GK4898 | Zeaxanthin |
GX2761 | Zein |
GL7669 | Zelkovamycin |
GX3094 | Zeocin, powder |
GL7258 | Zerumbone |
GC2870 | Zidovudine O-β-D-glucuronide |
GT0168 | Ziehl-Neelsen carbol-fuchsin solution |
GP5873 | Zileuton |
GX0226 | Zinc acetate dihydrate |
GX6789 | Zinc acetate dihydrate, 99%, Ph. Eur. grade |
GX1609 | Zinc acetate hydrate, 99.999% |
GX7384 | Zinc arsenide, 99.999% |
GX8264 | Zinc arsenide, 99.999% |
GX0089 | Zinc bromide, anhydrous, 98+% |
GX2118 | Zinc bromide, anhydrous, 99.999% |
GK2449 | Zinc carbonate basic |
GX3170 | Zinc chloride-2-Tetrahydrofuran |
GK8554 | Zinc chloride, anhydrous |
GX7890 | Zinc chloride, anhydrous, 98+%, ACS |
GK8880 | Zinc chloride, anhydrous, USP grade |
GE1507 | Zinc citrate dihydrate |
GE2021 | Zinc citrate trihydrate |
GX1602 | Zinc cyclohexanebutyrate, AAS |
GX6838 | Zinc fluoride, anhydrous, 99.999% |
GX1212 | Zinc fluoride, anhydrous, 99% |
GX4786 | Zinc Foil 0.1mm, 99.99+% |
GX5686 | Zinc Foil 0.25 mm, 99.994% |
GX0916 | Zinc Foil 0.5mm, 99.99% |
GX7331 | Zinc Foil 1.0mm, 99.99% |
GK3576 | Zinc formaldehyde sulfoxylate |
GE5157 | Zinc Formalin Fixative |
GE0055 | Zinc Formalin Fixative, 10X solution |
GX1482 | Zinc Granules 1-5 mm, 99.999% |
GX6924 | Zinc hexafluorosilicate hydrate, 98% |
GX1001 | Zinc Ingot, 99.99% |
GX2955 | Zinc iodide, 98% |
GX7251 | Zinc iodide, 99.999%% |
GX0843 | Zinc nitrate hexahydrate |
GX9610 | Zinc oxide, 99.5%, Ph. Eur., USP grade |
GX2362 | Zinc oxide, 99.9% |
GX4992 | Zinc oxide, 99.999% |
GK2332 | Zinc oxide, 99% |
GX9146 | Zinc oxide, Nanopowder, 99.5% |
GX7801 | Zinc oxide, Nanopowder, 99.9% |
GX2313 | Zinc Pellets 6 x 6 mm, 99.95% |
GX4774 | Zinc phosphate dihydrate |
GX0790 | Zinc Pieces max. 20 mm, 99.995+% |
GX4205 | Zinc powder, max. 65 micron, 98% |
GX1328 | Zinc Rod 10 mm, 99.9999% |
GX5998 | Zinc Rod 6 mm, 99.99% |
GX1595 | Zinc Rod 8 mm, 99.999% |
GX6361 | Zinc Rod 8 mm, 99.9999% |
GX7885 | Zinc selenide, 99.999% |
GX6548 | Zinc stearate |
GK7296 | Zinc sulfate heptahydrate |
GX8355 | Zinc sulfate heptahydrate, 99.5+%, ACS |
GX5114 | Zinc sulfate heptahydrate, 99.999% |
GK8729 | Zinc sulfate heptahydrate, EP grade |
GX1311 | Zinc sulfate monohydrate |
GX6888 | Zinc sulfate monohydrate, USP grade |
GX3458 | Zinc sulfide, 99.9% |
GX1917 | Zinc sulfide, 99.99% |
GX6915 | Zinc telluride, 99.999% |
GX8502 | Zinc titanate, 99.9% |
GX2338 | Zinc tungstate, 99.9% |
GK1973 | Zinc undecylenate |
GX7975 | Zinc Wire 0.25 mm diameter, 99.9+% |
GX8111 | Zinc Wire 1.0 mm diameter, 99.999% |
GX7617 | Zinc Wire 2.0 mm diameter, 99.99% |
GX5581 | Zinc-thd, 99.9% |
GX0963 | Zinc(II) 2,4-pentanedionate |
GK0303 | Zincon sodium salt |
GW9151 | Zinpyr-1 |
GK8490 | Zinquin |
GW0052 | Zinquin ethyl ester |
GP6084 | Ziprasidone hydrochloride monohydrate |
GX7510 | Zirconium 2,4-pentanedionate, 98+% |
GX0433 | Zirconium boride, 99+% |
GX2462 | Zirconium carbide |
GX6681 | Zirconium chloride, 98% |
GX1232 | Zirconium dichloride oxide hydrate, 98% |
GX0293 | Zirconium dichloride oxide octahydrate, 98+% |
GX4751 | Zirconium dinitrate oxide hydrate, 99% |
GX6719 | Zirconium ethoxide, 99.99% |
GX8945 | Zirconium Foil 0.025 mm, 99.7% |
GX3385 | Zirconium Foil 0.25 mm, 99.8% |
GX1630 | Zirconium Foil 0.5 mm, 99.8% |
GX0507 | Zirconium Foil 1.0 mm, 99.8% |
GX5634 | Zirconium hydride, 99.7% |
GX1128 | Zirconium n-butoxide |
GX6868 | Zirconium nitride, 99% |
GX5312 | Zirconium Rod 2 mm diameter, 97% |
GX3706 | Zirconium Rod 6.3 mm diameter, 99.7% |
GX8627 | Zirconium silicide, 99.5% |
GX4921 | Zirconium Sponge 3-6 mm, 99.8% |
GX1784 | Zirconium t-butoxide, 99.99% |
GX2203 | Zirconium Wire 1.0 mm diameter, 99+% |
GX9348 | Zirconium(IV) carbide Nanopowder, Hf-content ~3%, 97 % |
GX3347 | Zirconium(IV) carbide Nanopowder, Hf-content ~3%, 97 % |
GX9401 | Zirconium(IV) oxide + 3 mol-% Y2O3-Nano Powder, 99.9% |
GX1650 | Zirconium(IV) oxide + 8 mol-% Y2O3-Nano Powder, 99.9% |
GX0728 | Zirconium(IV) oxide 5 micron, 99.9% |
GX0180 | Zirconium(IV) oxide 5 micron, 99% |
GX2049 | Zirconium(IV) oxide, 99.7% |
GX9883 | Zirconium(IV) oxide, 99.9+% |
GX9587 | Zirconium(IV) oxide, 99.995% |
GX1780 | Zirconium(IV) oxychloride octahydrate |
GW8864 | ZnAF-1 |
GW7372 | ZnAF-1 DA |
GW4970 | ZnAF-1 DA Solution |
GW1582 | ZnAF-1 Solution |
GW6478 | ZnAF-1F |
GW0290 | ZnAF-1F DA |
GW2587 | ZnAF-1F DA Solution |
GW8530 | ZnAF-1F Solution |
GW8223 | ZnAF-2 |
GW0414 | ZnAF-2 DA |
GW3437 | ZnAF-2 DA Solution |
GW9491 | ZnAF-2 Solution |
GW5940 | ZnAF-2F |
GW3623 | ZnAF-2F DA |
GW6359 | ZnAF-2F DA Solution |
GW9813 | ZnAF-2F Solution |
GP9021 | Zofenopril calcium salt |
GP8685 | Zoledronic acid monohydrate |
GC7379 | Zomepirac acyl-β-D-glucuronide |
GW7312 | Zoxamide |
GW6410 | ZSTK474 |
GC7489 | α-D-Cellobiosyl fluoride heptaacetate |
GC7628 | α-D-Lactosyl fluoride |
GC8259 | α-D-Xylopyranosyl azide |
GC7443 | β-D-Cellobiosyl azide |
GC3513 | β-D-Cellobiosyl azide heptaacetate |
GC7217 | β-D-Cellobiosyl fluoride heptaacetate |
GC1608 | β-D-Gal-PEG3-azide tetraacetate |
GC7196 | β-D-Gal-PEG4-azide tetraacetate |
GC9062 | β-D-Galactopyranosyl isomaltol |
GC6873 | β-D-GalNAc-PEG4-azide |
GC3658 | β-D-Glucopyranosyl glycolaldehyde |
GC6092 | β-D-Glucopyranosyl-(1→2)-D-erythrofuranose |
GC2653 | β-D-Glucosamine Pentaacetate |
GC5202 | β-D-Lac-PEG3-azide heptaacetate |
GC3625 | β-D-Lactopyranosylphenyl isothiocyanate |
GC2801 | β-D-Maltosyl azide |
GC3126 | β-D-Xylopyranosyl azide |
GK2475 | β-Estradiol 17-(β-D-glucuronide) sodium salt |
GC4787 | β-L-Fucopyranosyl azide |